prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CC[CH]CCC2)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 | COc1ccc(C(=O)N2CC[CH]CCC2)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H]&CC1",
"old_substring": "N16CCC%10CC1"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2C[CH]CCCC2)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 | COc1ccc(C(=O)N2C[CH]CCCC2)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC[C@@H]&C1",
"old_substring": "N16CCC%10CC1"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCC=C(C)C2)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 | COc1ccc(C(=O)N2CCC=C(C)C2)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N16CCC%10CC1"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(=O)c1ccc(OC)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 | CCCCCC(=O)c1ccc(OC)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "N16CCC%10CC1"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2C[CH]CC[C@H]2C)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | COc1ccc(C(=O)N2CCC([C@@]3(C)NC(=O)N(C4Cc5ccccc5C4)C3=O)CC2)cc1 | COc1ccc(C(=O)N2C[CH]CC[C@H]2C)cc1.C[C@@H]1NC(=O)N(C2Cc3ccccc3C2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H]&CC[C@H]1C",
"old_substring": "N16CCC%10CC1"
} |
Can you make molecule CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(NC(=O)c2cc(C)n(C3(C)CCCC3)c2C)s1 | CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 | CCc1cnc(NC(=O)c2cc(C)n(C3(C)CCCC3)c2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C6(C)C"
} |
Can you make molecule CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(NC(=O)c2cc(C)n(C(Cl)(Cl)Cl)c2C)s1 | CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 | CCc1cnc(NC(=O)c2cc(C)n(C(Cl)(Cl)Cl)c2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C6(C)C"
} |
Can you make molecule CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)n1c(C)cc(C(=O)Nc2ncc(CC)s2)c1C | CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 | CCCC(C)(C)n1c(C)cc(C(=O)Nc2ncc(CC)s2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C6(C)C"
} |
Can you make molecule CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(NC(=O)c2cc(C)n(C(C)(CC)CC)c2C)s1 | CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 | CCc1cnc(NC(=O)c2cc(C)n(C(C)(CC)CC)c2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C6(C)C"
} |
Can you make molecule CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(NC(=O)c2cc(C)n(C3(C=O)CCCCCC3)c2C)s1 | CCc1cnc(NC(=O)c2cc(C)n(C(C)C)c2C)s1 | CCc1cnc(NC(=O)c2cc(C)n(C3(C=O)CCCCCC3)c2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C6(C)C"
} |
Can you make molecule COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)cc1I | COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 | COc1ccc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c13ccccc18"
} |
Can you make molecule COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)ccc1Br | COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 | COc1cc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c13ccccc18"
} |
Can you make molecule COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)cc1Cl | COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 | COc1ccc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c13ccccc18"
} |
Can you make molecule COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)c1Br | COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 | COc1cccc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c13ccccc18"
} |
Can you make molecule COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)c1Cl | COc1ccccc1-c1nc(C[NH+](C)Cc2ccc(C#N)cc2)cs1 | COc1cccc(-c2nc(C[NH+](C)Cc3ccc(C#N)cc3)cs2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c13ccccc18"
} |
Can you make molecule COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2noc(-c3ccc4nc(-c5ccc(Cl)cc5)[nH]c4c3)n2)cc1OC | COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3ccc4nc(-c5ccc(Cl)cc5)[nH]c4c3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nc&[nH]c2c1",
"old_substring": "c17cc9n[nH]1"
} |
Can you make molecule COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)c[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)c[nH]3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c[nH]1",
"old_substring": "c17cc9n[nH]1"
} |
Can you make molecule COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2noc(-c3cc4cc(-c5ccc(Cl)cc5)cnc4[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3cc4cc(-c5ccc(Cl)cc5)cnc4[nH]3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&cnc2[nH]1",
"old_substring": "c17cc9n[nH]1"
} |
Can you make molecule COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2noc(-c3cc4nc(-c5ccc(Cl)cc5)ccc4[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3cc4nc(-c5ccc(Cl)cc5)ccc4[nH]3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2nc&ccc2[nH]1",
"old_substring": "c17cc9n[nH]1"
} |
Can you make molecule COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2noc(-c3cc4ncc(-c5ccc(Cl)cc5)cc4[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3cc(-c4ccc(Cl)cc4)n[nH]3)n2)cc1OC | COc1ccc(-c2noc(-c3cc4ncc(-c5ccc(Cl)cc5)cc4[nH]3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ncc&cc2[nH]1",
"old_substring": "c17cc9n[nH]1"
} |
Can you make molecule CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NSC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | CC[C@H](NSC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CCCC(=O)N1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | CC[C@H](NC(=O)CCCC(=O)N1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CC(C)(C)N1C(=O)c2ccccc2N2C(=O)CC[C@@]21C)c1ccc(C)cc1 | CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | CC[C@H](NC(=O)CC(C)(C)N1C(=O)c2ccccc2N2C(=O)CC[C@@]21C)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC[S@+]([O-])CCCN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | CC[C@H](NC[S@+]([O-])CCCN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CCC(C)(C)N1C(=O)c2ccccc2N2C(=O)CC[C@@]21C)c1ccc(C)cc1 | CC[C@H](NC(=O)CN1C(=O)c2ccccc2N2C(=O)CC[C@]12C)c1ccc(C)cc1 | CC[C@H](NC(=O)CCC(C)(C)N1C(=O)c2ccccc2N2C(=O)CC[C@@]21C)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)CC(C)(C)NCc2ccnc(OC(C)(C)C)c2)cn1 | Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 | Cc1ccc(CNC(=O)CC(C)(C)NCc2ccnc(OC(C)(C)C)c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)CCC(C)(C)NCc2ccnc(OC(C)(C)C)c2)cn1 | Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 | Cc1ccc(CNC(=O)CCC(C)(C)NCc2ccnc(OC(C)(C)C)c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNc2c(C)n(C)n(NCc3ccnc(OC(C)(C)C)c3)c2=O)cn1 | Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 | Cc1ccc(CNc2c(C)n(C)n(NCc3ccnc(OC(C)(C)C)c3)c2=O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNc2nn(NCc3ccnc(OC(C)(C)C)c3)c(C)cc2=O)cn1 | Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 | Cc1ccc(CNc2nn(NCc3ccnc(OC(C)(C)C)c3)c(C)cc2=O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)C[C@@H](Br)NCc2ccnc(OC(C)(C)C)c2)cn1 | Cc1ccc(CNC(=O)NCc2ccnc(OC(C)(C)C)c2)cn1 | Cc1ccc(CNC(=O)C[C@@H](Br)NCc2ccnc(OC(C)(C)C)c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(OCOC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | CCN(OCOC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCO&",
"old_substring": "C7CO"
} |
Can you make molecule CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CON(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | C=CON(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C7CO"
} |
Can you make molecule CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)N(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | CCC(=O)N(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C7CO"
} |
Can you make molecule CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C=CON(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | C=C=CON(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C7CO"
} |
Can you make molecule CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | CCN(CCO)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | CCN(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C#N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&",
"old_substring": "C7CO"
} |
Can you make molecule Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nn(C[NH+]3CCCCCCC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(C[NH+]3CCCCCCC3)c(=S)n2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCCCCC1",
"old_substring": "C4[NH+]1CCCCC1"
} |
Can you make molecule Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nn(C[N+]3=CCCC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(C[N+]3=CCCC3)c(=S)n2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[N+]1=CCCC1",
"old_substring": "C4[NH+]1CCCCC1"
} |
Can you make molecule Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nn([NH+]3CCCCCCC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn([NH+]3CCCCCCC3)c(=S)n2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCCC1",
"old_substring": "C4[NH+]1CCCCC1"
} |
Can you make molecule Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nn(C3CC[N+](C)(C)CC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(C3CC[N+](C)(C)CC3)c(=S)n2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C4[NH+]1CCCCC1"
} |
Can you make molecule Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nn(N3CCCO[C@@H](C)C3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(C[NH+]3CCCCC3)c(=S)n2-c2ccccc2)c1 | Cc1cccc(-c2nn(N3CCCO[C@@H](C)C3)c(=S)n2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CN&CCCO1",
"old_substring": "C4[NH+]1CCCCC1"
} |
Can you make molecule C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](C1CCCCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](C1CCCCCC1)[C@@H]1CCc2cccnc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](C1CCCCCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](C1CCCCCCC1)[C@@H]1CCc2cccnc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](SC1=CCCCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](SC1=CCCCCC1)[C@@H]1CCc2cccnc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](C1CCC(Cl)CC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](C1CCC(Cl)CC1)[C@@H]1CCc2cccnc21 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](CCC1=CCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](C1CCCC1)[C@@H]1CCc2cccnc21 | C[NH2+][C@@H](CCC1=CCCC1)[C@@H]1CCc2cccnc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cc(C(=O)[O-])cc(C)c2I)c(C)c1 | Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 | Cc1ccc(-c2cc(C(=O)[O-])cc(C)c2I)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(C)c1I",
"old_substring": "c14cccc(F)c13"
} |
Can you make molecule Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cc(C(=O)[O-])c(F)cc2Cl)c(C)c1 | Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 | Cc1ccc(-c2cc(C(=O)[O-])c(F)cc2Cl)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(F)cc1Cl",
"old_substring": "c14cccc(F)c13"
} |
Can you make molecule Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2ccc(C(=O)[O-])c(Cl)c2Cl)c(C)c1 | Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 | Cc1ccc(-c2ccc(C(=O)[O-])c(Cl)c2Cl)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c(Cl)c1Cl",
"old_substring": "c14cccc(F)c13"
} |
Can you make molecule Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cc(C(=O)[O-])cc(Cl)c2Cl)c(C)c1 | Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 | Cc1ccc(-c2cc(C(=O)[O-])cc(Cl)c2Cl)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(Cl)c1Cl",
"old_substring": "c14cccc(F)c13"
} |
Can you make molecule Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2ccc(I)c(C(=O)[O-])c2F)c(C)c1 | Cc1ccc(-c2cccc(F)c2C(=O)[O-])c(C)c1 | Cc1ccc(-c2ccc(I)c(C(=O)[O-])c2F)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)c&c1F",
"old_substring": "c14cccc(F)c13"
} |
Can you make molecule CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c2ccccc2n2c(S[C@H](C(=O)CN=C=S)c3ccccc3)nnc12 | CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 | Cn1c2ccccc2n2c(S[C@H](C(=O)CN=C=S)c3ccccc3)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN4C"
} |
Can you make molecule CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c2ccccc2n2c(S[C@H](C(=O)CN3CCSCC3)c3ccccc3)nnc12 | CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 | Cn1c2ccccc2n2c(S[C@H](C(=O)CN3CCSCC3)c3ccccc3)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCSCC1",
"old_substring": "CN4C"
} |
Can you make molecule CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 | CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 | CON(C)CCCC(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CN4C"
} |
Can you make molecule CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c2ccccc2n2c(S[C@H](C(=O)CN3CCCCC3)c3ccccc3)nnc12 | CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 | Cn1c2ccccc2n2c(S[C@H](C(=O)CN3CCCCC3)c3ccccc3)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCCCC1",
"old_substring": "CN4C"
} |
Can you make molecule CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c2ccccc2n2c(S[C@H](C(=O)SC3=NCCS3)c3ccccc3)nnc12 | CN(C)C(=O)[C@@H](Sc1nnc2n(C)c3ccccc3n12)c1ccccc1 | Cn1c2ccccc2n2c(S[C@H](C(=O)SC3=NCCS3)c3ccccc3)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NCCS1",
"old_substring": "CN4C"
} |
Can you make molecule Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCOCC3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCOCC3)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCOCC1",
"old_substring": "[C@H]17CCCO1"
} |
Can you make molecule Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CSCCS3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CSCCS3)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSCCS1",
"old_substring": "[C@H]17CCCO1"
} |
Can you make molecule Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CC=CS3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CC=CS3)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]17CCCO1"
} |
Can you make molecule Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@@H]3CCSC3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@@H]3CCSC3)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@H]17CCCO1"
} |
Can you make molecule Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CC34CCOCC4)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CCCO3)c([N+](=O)[O-])c2)cc1 | Cc1ccc(C(=O)NNC(=O)c2ccc(SC[C@H]3CC34CCOCC4)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCOCC2",
"old_substring": "[C@H]17CCCO1"
} |
Can you make molecule CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCn1/c(=N/C(=O)[C@@H](CCCCCS)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCCCCS)NC(N)=O)[nH]c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "SCCC&",
"old_substring": "S5C"
} |
Can you make molecule CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCn1/c(=N/C(=O)[C@@H](CCSC(F)F)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCSC(F)F)NC(N)=O)[nH]c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "S5C"
} |
Can you make molecule CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCn1/c(=N/C(=O)[C@@H](CCCCCCCS)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCCCCCCS)NC(N)=O)[nH]c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "S5C"
} |
Can you make molecule CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCn1/c(=N/C(=O)[C@@H](CCCCCCCCS)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCCCCCCCS)NC(N)=O)[nH]c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "S5C"
} |
Can you make molecule CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCn1/c(=N/C(=O)[C@@H](CCSC(F)(F)F)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCSC)NC(N)=O)[nH]c2ccccc21 | CCCn1/c(=N/C(=O)[C@@H](CCSC(F)(F)F)NC(N)=O)[nH]c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "S5C"
} |
Can you make molecule Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(C(=O)/N=c2\sc3ccccc3n2C)cc1N1CCOCC1 | Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 | Cc1sc(C(=O)/N=c2\sc3ccccc3n2C)cc1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(C)s1",
"old_substring": "c14sccc1S3(=O)=O"
} |
Can you make molecule Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1/c(=N/C(=O)c2sc(N3CCOCC3)cc2Br)sc2ccccc21 | Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 | Cn1/c(=N/C(=O)c2sc(N3CCOCC3)cc2Br)sc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&cc1Br",
"old_substring": "c14sccc1S3(=O)=O"
} |
Can you make molecule Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1/c(=N/C(=O)c2ccc(N3CCOCC3)s2)sc2ccccc21 | Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 | Cn1/c(=N/C(=O)c2ccc(N3CCOCC3)s2)sc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c14sccc1S3(=O)=O"
} |
Can you make molecule Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1/c(=N/C(=O)c2csc(N3CCOCC3)c2)sc2ccccc21 | Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 | Cn1/c(=N/C(=O)c2csc(N3CCOCC3)c2)sc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c14sccc1S3(=O)=O"
} |
Can you make molecule Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1/c(=N/C(=O)c2ccc(/C=N/ON3CCOCC3)cc2)sc2ccccc21 | Cn1/c(=N/C(=O)c2sccc2S(=O)(=O)N2CCOCC2)sc2ccccc21 | Cn1/c(=N/C(=O)c2ccc(/C=N/ON3CCOCC3)cc2)sc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(/C=N/O&)cc1",
"old_substring": "c14sccc1S3(=O)=O"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1C[C@@H](C)N(C(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1 | COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O | COc1ccccc1N1C[C@@H](C)N(C(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@@H](C)N&C1",
"old_substring": "N16C[C@@H]5CC1=O"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCCN(C(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1=O | COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O | COc1ccccc1N1CCCN(C(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N16C[C@@H]5CC1=O"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCC[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1 | COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O | COc1ccccc1N1CCC[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@H]&C1",
"old_substring": "N16C[C@@H]5CC1=O"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCS[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1 | COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O | COc1ccccc1N1CCS[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCS[C@@H]&C1",
"old_substring": "N16C[C@@H]5CC1=O"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C[C@@H](C)C(=O)C(=O)NN1C(=O)NC2(CCCCC2)C1=O | COc1ccccc1N1C[C@@H](C(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1=O | COc1ccccc1C[C@@H](C)C(=O)C(=O)NN1C(=O)NC2(CCCCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "N16C[C@@H]5CC1=O"
} |
Can you make molecule COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(CC(=O)SNc2ccccc2C(=O)NC(C)(C)C)cc(OC)c1 | COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(CC(=O)SNc2ccccc2C(=O)NC(C)(C)C)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C39=O"
} |
Can you make molecule COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc(C(=O)CCCC(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(OC)cc(C(=O)CCCC(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C39=O"
} |
Can you make molecule COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc(C(C)(C)CC(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(OC)cc(C(C)(C)CC(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc(C(C)(C)CCC(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(OC)cc(C(C)(C)CCC(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc([C@H](C)C(=O)SNc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(OC)cc(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)c1 | COc1cc(OC)cc([C@H](C)C(=O)SNc2ccccc2C(=O)NC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C39=O"
} |
Can you make molecule C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccccn1)Nc1nc(-c2ccncc2)nc2ccccc12 | C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 | C[C@H](CC(C)(C)c1ccccn1)Nc1nc(-c2ccncc2)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]35"
} |
Can you make molecule C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNc1nc(-c2ccncc2)nc2ccccc12)CC(=O)c1ccccn1 | C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 | C[C@H](CCNc1nc(-c2ccncc2)nc2ccccc12)CC(=O)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]35"
} |
Can you make molecule C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccccn1)[C@H](C)Nc1nc(-c2ccncc2)nc2ccccc12 | C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 | C[C@H](Cc1ccccn1)[C@H](C)Nc1nc(-c2ccncc2)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]35"
} |
Can you make molecule C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNc1nc(-c2ccncc2)nc2ccccc12)CC(=O)c1ccccn1 | C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 | C[C@@H](CCNc1nc(-c2ccncc2)nc2ccccc12)CC(=O)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]35"
} |
Can you make molecule C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccccn1)Nc1nc(-c2ccncc2)nc2ccccc12 | C[C@H](Nc1nc(-c2ccncc2)nc2ccccc12)c1ccccn1 | CCC[C@@H](CCc1ccccn1)Nc1nc(-c2ccncc2)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]35"
} |
Can you make molecule CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C[NH+]2CCC[C@H](ON(C)[C@@H](C)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H](ON(C)[C@@H](C)c3nccn3C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)N(C)O&",
"old_substring": "[C@@H]89O"
} |
Can you make molecule CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C[NH+]2CCC[C@H]([C@H]3CC[C@@H](c4nccn4C)O3)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H]([C@H]3CC[C@@H](c4nccn4C)O3)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]89O"
} |
Can you make molecule CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C[NH+]2CCC[C@H](CC[C@@H](O)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H](CC[C@@H](O)c3nccn3C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "[C@@H]89O"
} |
Can you make molecule CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C[NH+]2CCC[C@H](CC[C@@H](N)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H](CC[C@@H](N)c3nccn3C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "[C@@H]89O"
} |
Can you make molecule CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C[NH+]2CCC[C@H](CCC[C@@H](O)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H]([C@H](O)c3nccn3C)C2)cc1OC | CCOc1ccc(C[NH+]2CCC[C@H](CCC[C@@H](O)c3nccn3C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "[C@@H]89O"
} |
Can you make molecule O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2Cl)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)cc1Cl",
"old_substring": "c14ccc(O)cc1"
} |
Can you make molecule O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(I)cc2)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(I)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccc(O)cc1"
} |
Can you make molecule O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)c(Cl)c2)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)c(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)c(Cl)c1",
"old_substring": "c14ccc(O)cc1"
} |
Can you make molecule O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(F)cc2F)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(F)cc2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1F",
"old_substring": "c14ccc(O)cc1"
} |
Can you make molecule O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(=O)oc2)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(O)cc2)cc1 | O=C([O-])c1ccc([S@@+]([O-])Cc2ccc(=O)oc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(=O)oc1",
"old_substring": "c14ccc(O)cc1"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)CC(C)(C)NCC(C)(C)Cc1ccccc1 | CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 | CCc1nn(C)cc1CNC(=O)CC(C)(C)NCC(C)(C)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)CCC(C)(C)NCC(C)(C)Cc1ccccc1 | CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 | CCc1nn(C)cc1CNC(=O)CCC(C)(C)NCC(C)(C)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNc1c(C)n(C)n(NCC(C)(C)Cc2ccccc2)c1=O | CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 | CCc1nn(C)cc1CNc1c(C)n(C)n(NCC(C)(C)Cc2ccccc2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C23=O"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNc1nn(NCC(C)(C)Cc2ccccc2)c(C)cc1=O | CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 | CCc1nn(C)cc1CNc1nn(NCC(C)(C)Cc2ccccc2)c(C)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C23=O"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)C[C@@H](Br)NCC(C)(C)Cc1ccccc1 | CCc1nn(C)cc1CNC(=O)NCC(C)(C)Cc1ccccc1 | CCc1nn(C)cc1CNC(=O)C[C@@H](Br)NCC(C)(C)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.