prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COC(=C(C#N)C#N)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | COC(C)=C(OC)c1cccs1 | COC(=C(C#N)C#N)c1cccs1 | COC(C)=C(OC)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)OC",
"old_substring": "C=2(C#N)C#N"
} |
Can you make molecule COC(=C(C#N)C#N)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=C(C)CBr)c1cccs1 | COC(=C(C#N)C#N)c1cccs1 | COC(=C(C)CBr)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CBr",
"old_substring": "C=2(C#N)C#N"
} |
Can you make molecule COC(=C(C#N)C#N)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=C(C)C)c1cccs1 | COC(=C(C#N)C#N)c1cccs1 | COC(=C(C)C)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "C=2(C#N)C#N"
} |
Can you make molecule COC(=C(C#N)C#N)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=C(C#N)c1nc(C)cs1)c1cccs1 | COC(=C(C#N)C#N)c1cccs1 | COC(=C(C#N)c1nc(C)cs1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C#N)c1nc(C)cs1",
"old_substring": "C=2(C#N)C#N"
} |
Can you make molecule COC(=C(C#N)C#N)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=C(C#N)C(=O)C(C)C)c1cccs1 | COC(=C(C#N)C#N)c1cccs1 | COC(=C(C#N)C(=O)C(C)C)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C(=O)C=&C#N",
"old_substring": "C=2(C#N)C#N"
} |
Can you make molecule O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(NCc2ccnc(OCC(F)F)c2)CCN1NCc1cscn1 | O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 | O=C1C2=CC=CC2=C(NCc2ccnc(OCC(F)F)c2)CCN1NCc1cscn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(NCc2ccnc(OCC(F)F)c2)cc(NCc2cscn2)ccc2oc1-2 | O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 | O=Cc1c(NCc2ccnc(OCC(F)F)c2)cc(NCc2cscn2)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SNCc1cscn1)NCc1ccnc(OCC(F)F)c1 | O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 | O=C(/C=C/SNCc1cscn1)NCc1ccnc(OCC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCc2ccnc(OCC(F)F)c2)nc1NCc1cscn1 | O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 | O=Cc1sc(NCc2ccnc(OCC(F)F)c2)nc1NCc1cscn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCc2ccnc(OCC(F)F)c2)sc1NCc1cscn1 | O=C(NCc1ccnc(OCC(F)F)c1)NCc1cscn1 | O=Cc1nc(NCc2ccnc(OCC(F)F)c2)sc1NCc1cscn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C23"
} |
Can you make molecule C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCN1CCN(C(=O)NCc2ccco2)CC1)CC(=O)N1CCCC1 | C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | C[C@H](CCN1CCN(C(=O)NCc2ccco2)CC1)CC(=O)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]6C3=O"
} |
Can you make molecule C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN1CCN(C(=O)NCc2ccco2)CC1)CC(=O)N1CCCC1 | C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | C[C@@H](CCN1CCN(C(=O)NCc2ccco2)CC1)CC(=O)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]6C3=O"
} |
Can you make molecule C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | C[C@@H](CCN1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@H]6C3=O"
} |
Can you make molecule C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@](CO)(CCCN1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | C[C@](CO)(CCCN1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@]&(CO)CCC&",
"old_substring": "C[C@H]6C3=O"
} |
Can you make molecule C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | C[C@@H](C(=O)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | C[C@H](CC(C)(C)N1CCCC1)N1CCN(C(=O)NCc2ccco2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]6C3=O"
} |
Can you make molecule CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(CCCCBr)cc1)C(=O)NCCCn1cccn1 | CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 | CN(Cc1ccc(CCCCBr)cc1)C(=O)NCCCn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC8C"
} |
Can you make molecule CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 | CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 | C=CCCCCc1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC8C"
} |
Can you make molecule CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(CCCCCBr)cc1)C(=O)NCCCn1cccn1 | CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 | CN(Cc1ccc(CCCCCBr)cc1)C(=O)NCCCn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC8C"
} |
Can you make molecule CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(CCCCCS)cc1)C(=O)NCCCn1cccn1 | CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 | CN(Cc1ccc(CCCCCS)cc1)C(=O)NCCCn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC8C"
} |
Can you make molecule CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(CCCCCCS)cc1)C(=O)NCCCn1cccn1 | CC(C)c1ccc(CN(C)C(=O)NCCCn2cccn2)cc1 | CN(Cc1ccc(CCCCCCS)cc1)C(=O)NCCCn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC8C"
} |
Can you make molecule CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)c3c2CCCC3)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)c3c2CCCC3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c2c1CCCC2",
"old_substring": "c17nn9cc1C"
} |
Can you make molecule CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)c3c2CCCCC3)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)c3c2CCCCC3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c2c1CCCCC2",
"old_substring": "c17nn9cc1C"
} |
Can you make molecule CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1CCCN(C(=O)Nc2ncc(-c3ccccc3Cl)cc2Cl)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2ncc(-c3ccccc3Cl)cc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&cc1Cl",
"old_substring": "c17nn9cc1C"
} |
Can you make molecule CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nc(-c3ccccc3Cl)ccc2Cl)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nc(-c3ccccc3Cl)ccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ccc1Cl",
"old_substring": "c17nn9cc1C"
} |
Can you make molecule CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1CCCN(C(=O)Nc2sc3nc(-c4ccccc4Cl)cn3c2C)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2nn(-c3ccccc3Cl)cc2C)C1 | CNC(=O)[C@@H]1CCCN(C(=O)Nc2sc3nc(-c4ccccc4Cl)cn3c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2nc&cn2c1C",
"old_substring": "c17nn9cc1C"
} |
Can you make molecule COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CC[NH+]([C@@H](CBr)CCNc2ccc(F)cc2)CC1 | COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 | COc1ccccc1N1CC[NH+]([C@@H](CBr)CCNc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]5(C)C3=O"
} |
Can you make molecule COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CC[NH+]([C@@H](CBr)CCCNc2ccc(F)cc2)CC1 | COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 | COc1ccccc1N1CC[NH+]([C@@H](CBr)CCCNc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]5(C)C3=O"
} |
Can you make molecule COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCNc1ccc(F)cc1)[NH+]1CCN(c2ccccc2OC)CC1 | COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 | CC[C@@H](CCNc1ccc(F)cc1)[NH+]1CCN(c2ccccc2OC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]5(C)C3=O"
} |
Can you make molecule COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CC[NH+]([C@@H](CCl)CCNc2ccc(F)cc2)CC1 | COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 | COc1ccccc1N1CC[NH+]([C@@H](CCl)CCNc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCl)CC&",
"old_substring": "[C@H]5(C)C3=O"
} |
Can you make molecule COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CC[NH+]([C@@H](C)CC(C)(C)CNc2ccc(F)cc2)CC1 | COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2)CC1 | COc1ccccc1N1CC[NH+]([C@@H](C)CC(C)(C)CNc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CC(C)(C)C&",
"old_substring": "[C@H]5(C)C3=O"
} |
Can you make molecule CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CCC[C@@H](Oc2ccc(C(=O)CN=C=S)nn2)C1 | CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 | [NH3+][C@H]1CCC[C@@H](Oc2ccc(C(=O)CN=C=S)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CCC[C@@H](Oc2ccc(C(=O)C3N=N3)nn2)C1 | CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 | [NH3+][C@H]1CCC[C@@H](Oc2ccc(C(=O)C3N=N3)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&N=N1",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/OC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 | CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 | C/C=N/OC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C=N/O&",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CCC[C@@H](Oc2ccc(C(=O)CCCN=C=S)nn2)C1 | CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 | [NH3+][C@H]1CCC[C@@H](Oc2ccc(C(=O)CCCN=C=S)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCN=C=S",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CCC[C@@H](Oc2ccc(C(=O)CN3CCSCC3)nn2)C1 | CNC(=O)c1ccc(O[C@@H]2CCC[C@H]([NH3+])C2)nn1 | [NH3+][C@H]1CCC[C@@H](Oc2ccc(C(=O)CN3CCSCC3)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCSCC1",
"old_substring": "CN3"
} |
Can you make molecule COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCSC2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCSC2)cc1OC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)O[C@@H](C)[C@@H]2C=CCC2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2C=CCC2)cc1OC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=CCC1",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCSC2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCSC2)cc1OC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCSC1",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)O[C@@H](C)[C@H]2CCCOCC2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@H]2CCCOCC2)cc1OC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCOCC1",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO[C@H]2C)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO2)cc1OC(F)F | COc1ccc(C(=O)O[C@@H](C)[C@@H]2CCCO[C@H]2C)cc1OC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCO[C@H]1C",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=C2CCCC(=CCC(=O)N3CCCc4ccccc43)C2=O)cc1 | Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 | Cc1ccc(C=C2CCCC(=CCC(=O)N3CCCc4ccccc43)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC=&C1=O",
"old_substring": "C1=6SC(=S)N7C1=O"
} |
Can you make molecule Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=CC2=CN=N[C@H]2CCC(=O)N2CCCc3ccccc32)cc1 | Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 | Cc1ccc(C=CC2=CN=N[C@H]2CCC(=O)N2CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C1=6SC(=S)N7C1=O"
} |
Can you make molecule Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=C2CC(F)(CCC(=O)N3CCCc4ccccc43)C2)cc1 | Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 | Cc1ccc(C=C2CC(F)(CCC(=O)N3CCCc4ccccc43)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C1=6SC(=S)N7C1=O"
} |
Can you make molecule Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=NC(=S)N2CCC(CCC(=O)N3CCCc4ccccc43)CC2)cc1 | Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 | Cc1ccc(C=NC(=S)N2CCC(CCC(=O)N3CCCc4ccccc43)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "C1=6SC(=S)N7C1=O"
} |
Can you make molecule Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=C2CC(C#N)(CCC(=O)N3CCCc4ccccc43)C2)cc1 | Cc1ccc(C=C2SC(=S)N(CCC(=O)N3CCCc4ccccc43)C2=O)cc1 | Cc1ccc(C=C2CC(C#N)(CCC(=O)N3CCCc4ccccc43)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(C#N)C1",
"old_substring": "C1=6SC(=S)N7C1=O"
} |
Can you make molecule CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | C=CSc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | CC(C)c1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC6"
} |
Can you make molecule CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | C=CCCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nnnc1-c1cccc(NS(=O)(=O)c2cccc(CCCCl)c2)c1 | CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | Cn1nnnc1-c1cccc(NS(=O)(=O)c2cccc(CCCCl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nnnc1-c1cccc(NS(=O)(=O)c2cccc(CCCCS)c2)c1 | CCc1cccc(S(=O)(=O)Nc2cccc(-c3nnnn3C)c2)c1 | Cn1nnnc1-c1cccc(NS(=O)(=O)c2cccc(CCCCS)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2C(=O)c1ncc(Cl)cc1Cl | Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C | Cc1ccc2c(c1)CCN2C(=O)c1ncc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Cl)cc1Cl",
"old_substring": "c14ccc(C)nc1C"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)N2CCc3cc(C)ccc32)c(Cl)c1 | Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C | Cc1ccc(C(=O)N2CCc3cc(C)ccc32)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c14ccc(C)nc1C"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2C(=O)c1cnc(Cl)cc1I | Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C | Cc1ccc2c(c1)CCN2C(=O)c1cnc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)cc1I",
"old_substring": "c14ccc(C)nc1C"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2C(=O)c1ccc(C#N)cc1Cl | Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C | Cc1ccc2c(c1)CCN2C(=O)c1ccc(C#N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1Cl",
"old_substring": "c14ccc(C)nc1C"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2C(=O)c1cccc(C)c1C | Cc1ccc2c(c1)CCN2C(=O)c1ccc(C)nc1C | Cc1ccc2c(c1)CCN2C(=O)c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccc(C)nc1C"
} |
Can you make molecule CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CSN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 | CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 | CCCNC(=O)CSN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N17CCN5CC1"
} |
Can you make molecule CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CN1CCN=C1CC(=O)Cc1c(C)nn(-c2ccccc2)c1C | CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 | CCCNC(=O)CN1CCN=C1CC(=O)Cc1c(C)nn(-c2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N17CCN5CC1"
} |
Can you make molecule CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CN1CCCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)C1=O | CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 | CCCNC(=O)CN1CCCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N17CCN5CC1"
} |
Can you make molecule CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CN1CCN=C1SC(=O)Cc1c(C)nn(-c2ccccc2)c1C | CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 | CCCNC(=O)CN1CCN=C1SC(=O)Cc1c(C)nn(-c2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N17CCN5CC1"
} |
Can you make molecule CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)C(C)(C)C1 | CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)CC1 | CCCNC(=O)CN1CCN(C(=O)Cc2c(C)nn(-c3ccccc3)c2C)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N17CCN5CC1"
} |
Can you make molecule Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)c(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 | Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 | Cc1cc(Br)c(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Br)c&s1",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)c1Cl | Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 | Cc1csc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2sc(C(=O)NC3CC[NH+](Cc4nc(-c5ccccc5)cs4)CC3)cc2c1 | Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 | Cc1ccc2sc(C(=O)NC3CC[NH+](Cc4nc(-c5ccccc5)cs4)CC3)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2sc&cc2c1",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)cc1I | Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 | Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)cc1Br | Cc1ccc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)s1 | Cc1sc(C(=O)NC2CC[NH+](Cc3nc(-c4ccccc4)cs3)CC2)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1sc&cc1Br",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(C(=O)OC[C@@H]2CCCSC2)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F | CCOc1ccc(F)c(C(=O)OC[C@@H]2CCCSC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCSC1",
"old_substring": "[C@H]18CCCCO1"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(C(=O)OC[C@H]2CCCC2(C)C)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CCCC2(C)C)c1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]18CCCCO1"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(C(=O)OC[C@H]2CCC=CCCC2)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CCC=CCCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC=CCCC1",
"old_substring": "[C@H]18CCCCO1"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(C(=O)OC[C@H]2CC=CC=C2Cl)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CC=CC=C2Cl)c1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CC=C1Cl",
"old_substring": "[C@H]18CCCCO1"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(C(=O)OC[C@H]2CCOC(C)(C)C2)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CCCCO2)c1F | CCOc1ccc(F)c(C(=O)OC[C@H]2CCOC(C)(C)C2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCOC(C)(C)C1",
"old_substring": "[C@H]18CCCCO1"
} |
Can you make molecule C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NSC(=O)Cc2ncoc2-c2ccccc2)CC1 | C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 | C[NH+]1CCC(NSC(=O)Cc2ncoc2-c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NC(=O)CCCC(=O)c2ncoc2-c2ccccc2)CC1 | C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 | C[NH+]1CCC(NC(=O)CCCC(=O)c2ncoc2-c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NC(=O)CC(C)(C)c2ncoc2-c2ccccc2)CC1 | C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 | C[NH+]1CCC(NC(=O)CC(C)(C)c2ncoc2-c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NC(=O)CCC(C)(C)c2ncoc2-c2ccccc2)CC1 | C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 | C[NH+]1CCC(NC(=O)CCC(C)(C)c2ncoc2-c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNC1CC[NH+](C)CC1)c1ncoc1-c1ccccc1 | C[NH+]1CCC(NC(=O)c2ncoc2-c2ccccc2)CC1 | C[C@H](C(=O)SNC1CC[NH+](C)CC1)c1ncoc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCCN1C[C@H](O)CNC1=C2C=CC=C2C(=O)N(Nc2cccc(F)c2)CC1 | O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 | O=C1CCCN1C[C@H](O)CNC1=C2C=CC=C2C(=O)N(Nc2cccc(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(NC[C@@H](O)CN2CCCC2=O)cc(Nc2cccc(F)c2)ccc2oc1-2 | O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 | O=Cc1c(NC[C@@H](O)CN2CCCC2=O)cc(Nc2cccc(F)c2)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SNc1cccc(F)c1)NC[C@@H](O)CN1CCCC1=O | O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 | O=C(/C=C/SNc1cccc(F)c1)NC[C@@H](O)CN1CCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NC[C@@H](O)CN2CCCC2=O)CCC1=Nc1cccc(F)c1 | O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 | O=C1C(=NC[C@@H](O)CN2CCCC2=O)CCC1=Nc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCCN1C[C@H](O)CNO/N=C/c1ccc(Nc2cccc(F)c2)o1 | O=C(NC[C@@H](O)CN1CCCC1=O)Nc1cccc(F)c1 | O=C1CCCN1C[C@H](O)CNO/N=C/c1ccc(Nc2cccc(F)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C23"
} |
Can you make molecule CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | C=CS[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | C=CCC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N[C@H]2CCC[NH+](CCCCl)C2)cc1O | CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | COc1ccc(C(=O)N[C@H]2CCC[NH+](CCCCl)C2)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N[C@H]2CCC[NH+](CCCCS)C2)cc1O | CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | COc1ccc(C(=O)N[C@H]2CCC[NH+](CCCCS)C2)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N[C@H]2CCC[NH+](CCCBr)C2)cc1O | CC[NH+]1CCC[C@H](NC(=O)c2ccc(OC)c(O)c2)C1 | COc1ccc(C(=O)N[C@H]2CCC[NH+](CCCBr)C2)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC5"
} |
Can you make molecule O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 | O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 | O=C(/C=C/SSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CSN1CCC(=NON2CCN(c3ccc(Cl)cn3)CC2)CC1 | O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 | FC(F)(F)CSN1CCC(=NON2CCN(c3ccc(Cl)cn3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCN(SCC(F)(F)F)CC1)N1CCN(c2ccc(Cl)cn2)CC1 | O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 | O=C(NN=C1CCN(SCC(F)(F)F)CC1)N1CCN(c2ccc(Cl)cn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(SCC(F)(F)F)CC1)N1CCN(c2ccc(Cl)cn2)CC1 | O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 | O=C(NN=C1CCC(SCC(F)(F)F)CC1)N1CCN(c2ccc(Cl)cn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON1CCN(c2ccc(Cl)cn2)CC1)C(=O)SSCC(F)(F)F | O=C(CSCC(F)(F)F)N1CCN(c2ccc(Cl)cn2)CC1 | C/C(=N\ON1CCN(c2ccc(Cl)cn2)CC1)C(=O)SSCC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C4"
} |
Can you make molecule COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)COCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)COCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COCO2",
"old_substring": "c18ccc2c(c1)OCO2"
} |
Can you make molecule COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1cc2c(cc1I)OCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1cc2c(cc1I)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(cc1I)OCO2",
"old_substring": "c18ccc2c(c1)OCO2"
} |
Can you make molecule COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)COC2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COC2",
"old_substring": "c18ccc2c(c1)OCO2"
} |
Can you make molecule COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NC=Cc1ccc2c(c1)OCCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NC=Cc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc2c(c1)OCCO2",
"old_substring": "c18ccc2c(c1)OCO2"
} |
Can you make molecule COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1cc2c(cc1Br)OCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1ccc2c(c1)OCO2 | COc1ccc(Cl)cc1S(=O)(=O)N[C@H](C)C(=O)NCc1cc2c(cc1Br)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(cc1Br)OCO2",
"old_substring": "c18ccc2c(c1)OCO2"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(Cl)(Cl)Cl)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(Cl)(Cl)Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)CC(C)(C)C)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)CC(C)(C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(CCCC(C)(C)C)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(CCCC(C)(C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(CCCC(F)(F)F)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(CCCC(F)(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(CCCCC(F)(F)F)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(C(C)(C)C)n1 | Cn1cc(C(=O)Nc2ccc(-n3ccnn3)cc2)c(CCCCC(F)(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C7(C)(C)C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.