prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1CCS(=O)(=O)[O-] | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1CCS(=O)(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)CO | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)CO | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(O)O | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(O)O | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])c1c(C)cccc1NC(=O)C[C@@H]1CCCCO1 | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] | CCC(CC)(C(=O)[O-])c1c(C)cccc1NC(=O)C[C@@H]1CCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1CCCS(=O)(=O)[O-] | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1C(=O)[O-] | Cc1cccc(NC(=O)C[C@@H]2CCCCO2)c1CCCS(=O)(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc([C@H](NCCCCc2nnc3ccccn23)C2CC2)cc1Cl | Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl | Clc1ccc([C@H](NCCCCc2nnc3ccccn23)C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C6"
} |
Can you make molecule Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc([C@H](N=CCCc2nnc3ccccn23)C2CC2)cc1Cl | Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl | Clc1ccc([C@H](N=CCCc2nnc3ccccn23)C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C5C6"
} |
Can you make molecule Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc([C@H](NCCCCCc2nnc3ccccn23)C2CC2)cc1Cl | Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl | Clc1ccc([C@H](NCCCCCc2nnc3ccccn23)C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C6"
} |
Can you make molecule Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc([C@H](NC2CC(c3nnc4ccccn34)C2)C2CC2)cc1Cl | Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl | Clc1ccc([C@H](NC2CC(c3nnc4ccccn34)C2)C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C6"
} |
Can you make molecule Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1nnc2ccccn12)=N[C@@H](c1ccc(Cl)c(Cl)c1)C1CC1 | Clc1ccc([C@H](NCCc2nnc3ccccn23)C2CC2)cc1Cl | CC(CCc1nnc2ccccn12)=N[C@@H](c1ccc(Cl)c(Cl)c1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C5C6"
} |
Can you make molecule Clc1ccc(OCCCCSc2ncccn2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | S=C(OCCCCSc1ncccn1)Sc1ccc(Cl)c(Cl)c1 | Clc1ccc(OCCCCSc2ncccn2)cc1Cl | S=C(OCCCCSc1ncccn1)Sc1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule Clc1ccc(OCCCCSc2ncccn2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1ccc(Cl)c(Cl)c1)OCCCCSc1ncccn1 | Clc1ccc(OCCCCSc2ncccn2)cc1Cl | N=C(Cc1ccc(Cl)c(Cl)c1)OCCCCSc1ncccn1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule Clc1ccc(OCCCCSc2ncccn2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCCSc1ncccn1)CCC(=O)c1ccc(Cl)c(Cl)c1 | Clc1ccc(OCCCCSc2ncccn2)cc1Cl | O=C(CCCCSc1ncccn1)CCC(=O)c1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule Clc1ccc(OCCCCSc2ncccn2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H](CCCCSc1ncccn1)CCc1ccc(Cl)c(Cl)c1 | Clc1ccc(OCCCCSc2ncccn2)cc1Cl | O[C@@H](CCCCSc1ncccn1)CCc1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule Clc1ccc(OCCCCSc2ncccn2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc(Cl)c(Cl)c1)CCCCSc1ncccn1 | Clc1ccc(OCCCCSc2ncccn2)cc1Cl | O=C(/C=C/Sc1ccc(Cl)c(Cl)c1)CCCCSc1ncccn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nnc2cc(CC(=O)SN[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | Cn1nnc2cc(CC(=O)SN[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nnc2cc(C(=O)CCCC(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | Cn1nnc2cc(C(=O)CCCC(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nnc2cc(C(C)(C)CC(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | Cn1nnc2cc(C(C)(C)CC(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nnc2cc(C(C)(C)CCC(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | Cn1nnc2cc(C(C)(C)CCC(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN[C@@H](C#N)c1ccc(Cl)c(Cl)c1)c1ccc2c(c1)nnn2C | Cn1nnc2cc(C(=O)N[C@@H](C#N)c3ccc(Cl)c(Cl)c3)ccc21 | C[C@H](C(=O)SN[C@@H](C#N)c1ccc(Cl)c(Cl)c1)c1ccc2c(c1)nnn2C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(-c2nnc(Sc3nc(C4(C)CCCC4)ns3)o2)c1 | Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 | Cc1cc(C)cc(-c2nnc(Sc3nc(C4(C)CCCC4)ns3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(-c2nnc(Sc3nc(C(Cl)(Cl)Cl)ns3)o2)c1 | Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 | Cc1cc(C)cc(-c2nnc(Sc3nc(C(Cl)(Cl)Cl)ns3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1nsc(Sc2nnc(-c3cc(C)cc(C)c3)o2)n1 | Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 | CCCC(C)(C)c1nsc(Sc2nnc(-c3cc(C)cc(C)c3)o2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)c1nsc(Sc2nnc(-c3cc(C)cc(C)c3)o2)n1 | Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 | CCC(C)(CC)c1nsc(Sc2nnc(-c3cc(C)cc(C)c3)o2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(-c2nnc(Sc3nc(C4(C=O)CCCCCC4)ns3)o2)c1 | Cc1cc(C)cc(-c2nnc(Sc3nc(C(C)C)ns3)o2)c1 | Cc1cc(C)cc(-c2nnc(Sc3nc(C4(C=O)CCCCCC4)ns3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C4(C)C"
} |
Can you make molecule CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=Cc1ccc(F)cc1)C(=O)NCc1cc(I)cc(OCC(F)F)n1 | CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 | CC(=Cc1ccc(F)cc1)C(=O)NCc1cc(I)cc(OCC(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)cc&n1",
"old_substring": "c17cccc4n1"
} |
Can you make molecule CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=Cc1ccc(F)cc1)C(=O)NCc1cc(OCC(F)F)cc(Cl)n1 | CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 | CC(=Cc1ccc(F)cc1)C(=O)NCc1cc(OCC(F)F)cc(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(Cl)n1",
"old_substring": "c17cccc4n1"
} |
Can you make molecule CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=Cc1ccc(F)cc1)C(=O)NCc1cc(Cl)cc(OCC(F)F)n1 | CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 | CC(=Cc1ccc(F)cc1)C(=O)NCc1cc(Cl)cc(OCC(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc&n1",
"old_substring": "c17cccc4n1"
} |
Can you make molecule CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=Cc1ccc(F)cc1)C(=O)NCc1ncc(OCC(F)F)cc1Cl | CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 | CC(=Cc1ccc(F)cc1)C(=O)NCc1ncc(OCC(F)F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&cc1Cl",
"old_substring": "c17cccc4n1"
} |
Can you make molecule CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=Cc1ccc(F)cc1)C(=O)NCc1cc(OCC(F)F)cnc1Cl | CC(=Cc1ccc(F)cc1)C(=O)NCc1cccc(OCC(F)F)n1 | CC(=Cc1ccc(F)cc1)C(=O)NCc1cc(OCC(F)F)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c17cccc4n1"
} |
Can you make molecule CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Nc1cccc(CSCNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CSCNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N47"
} |
Can you make molecule CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Nc1cccc(CSC(=N)NC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CSC(=N)NC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N47"
} |
Can you make molecule CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Nc1cccc(CSC(=S)N(C)C(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CSC(=S)N(C)C(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N47"
} |
Can you make molecule CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Nc1cccc(CSC2=NCCN2C(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CSC2=NCCN2C(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N47"
} |
Can you make molecule CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Nc1cccc(CC2CCN(CC(=O)N[C@@H]3CC[NH+](CC4CC4)C3)CC2)c1 | CC(C)Nc1cccc(CNC(=O)N[C@@H]2CC[NH+](CC3CC3)C2)c1 | CC(C)Nc1cccc(CC2CCN(CC(=O)N[C@@H]3CC[NH+](CC4CC4)C3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N47"
} |
Can you make molecule O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)COc1ccc(F)cc1F)C(=O)c1ccccc1Cl | O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl | C[C@H](CNC(=O)COc1ccc(F)cc1F)C(=O)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C5[C@@H]6O"
} |
Can you make molecule O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)COc1ccc(F)cc1F)CC(=O)c1ccccc1Cl | O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl | C[C@@H](CCNC(=O)COc1ccc(F)cc1F)CC(=O)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C5[C@@H]6O"
} |
Can you make molecule O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(c1ccccc1Cl)[C@H](O)CNC(=O)COc1ccc(F)cc1F | O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl | CC(C)(c1ccccc1Cl)[C@H](O)CNC(=O)COc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C5[C@@H]6O"
} |
Can you make molecule O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)c1ccccc1Cl)NC(=O)COc1ccc(F)cc1F | O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl | CC[C@H](CC(=O)c1ccccc1Cl)NC(=O)COc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&CC&=O",
"old_substring": "C5[C@@H]6O"
} |
Can you make molecule O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)NC(=O)COc1ccc(F)cc1F)C(=O)c1ccccc1Cl | O=C(COc1ccc(F)cc1F)NC[C@H](O)c1ccccc1Cl | C[C@@H](CC(=O)NC(=O)COc1ccc(F)cc1F)C(=O)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C5[C@@H]6O"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(=O)Nc1c2c(nn1-c1ccc(C)cc1)C[S@+]([O-])C2 | Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 | CCC(CC)C(=O)Nc1c2c(nn1-c1ccc(C)cc1)C[S@+]([O-])C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(CC)CC",
"old_substring": "C4(=O)C(C)C"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc3c(c2NC(=O)C(C)(C)Br)C[S@@+]([O-])C3)cc1 | Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 | Cc1ccc(-n2nc3c(c2NC(=O)C(C)(C)Br)C[S@@+]([O-])C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)Br",
"old_substring": "C4(=O)C(C)C"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc3c(c2NC(=O)C(C)(C)CCl)C[S@@+]([O-])C3)cc1 | Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 | Cc1ccc(-n2nc3c(c2NC(=O)C(C)(C)CCl)C[S@@+]([O-])C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCl",
"old_substring": "C4(=O)C(C)C"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc3c(c2NC(=O)C(Cl)(Cl)Cl)C[S@@+]([O-])C3)cc1 | Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 | Cc1ccc(-n2nc3c(c2NC(=O)C(Cl)(Cl)Cl)C[S@@+]([O-])C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(Cl)(Cl)Cl",
"old_substring": "C4(=O)C(C)C"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)C(=O)Nc1c2c(nn1-c1ccc(C)cc1)C[S@+]([O-])C2 | Cc1ccc(-n2nc3c(c2NC(=O)C(C)C)C[S@@+]([O-])C3)cc1 | CCC[C@H](C)C(=O)Nc1c2c(nn1-c1ccc(C)cc1)C[S@+]([O-])C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](C)CCC",
"old_substring": "C4(=O)C(C)C"
} |
Can you make molecule COc1nc(Oc2ccc3ccccc3c2)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | COCc1nc(Oc2ccc3ccccc3c2)ccc1N | COc1nc(Oc2ccc3ccccc3c2)ccc1N | COCc1nc(Oc2ccc3ccccc3c2)ccc1N | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1nc(Oc2ccc3ccccc3c2)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | COCSc1nc(Oc2ccc3ccccc3c2)ccc1N | COc1nc(Oc2ccc3ccccc3c2)ccc1N | COCSc1nc(Oc2ccc3ccccc3c2)ccc1N | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1nc(Oc2ccc3ccccc3c2)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1nc(Oc2ccc3ccccc3c2)ccc1N | COc1nc(Oc2ccc3ccccc3c2)ccc1N | CC(=O)Sc1nc(Oc2ccc3ccccc3c2)ccc1N | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1nc(Oc2ccc3ccccc3c2)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(Oc2ccc3ccccc3c2)nc1C(=O)CS | COc1nc(Oc2ccc3ccccc3c2)ccc1N | Nc1ccc(Oc2ccc3ccccc3c2)nc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1nc(Oc2ccc3ccccc3c2)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(Oc2ccc3ccccc3c2)nc1C(=O)CI | COc1nc(Oc2ccc3ccccc3c2)ccc1N | Nc1ccc(Oc2ccc3ccccc3c2)nc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1)c1ccccc1 | O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | O=C(CCC(=O)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O=C67"
} |
Can you make molecule O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc2nc(Nc3ccccc3)c3nncn3c2c1)c1ccccc1 | O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | O=C(/C=C/Sc1ccc2nc(Nc3ccccc3)c3nncn3c2c1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C67"
} |
Can you make molecule O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(-c2ccccc2)nc1-c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | O=Cc1sc(-c2ccccc2)nc1-c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C67"
} |
Can you make molecule O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(-c2ccccc2)sc1-c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | O=Cc1nc(-c2ccccc2)sc1-c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C67"
} |
Can you make molecule O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 less soluble in water? The output molecule should be similar to the input molecule. | C(=N/Oc1ccccc1)\c1ccc(-c2ccc3nc(Nc4ccccc4)c4nncn4c3c2)o1 | O=C(c1ccccc1)c1ccc2nc(Nc3ccccc3)c3nncn3c2c1 | C(=N/Oc1ccccc1)\c1ccc(-c2ccc3nc(Nc4ccccc4)c4nncn4c3c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C67"
} |
Can you make molecule O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C1CC[C@H](Nc2cc(F)ccc2O)CCN1c1cccc(F)c1 | O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O | O=C1CC[C@H](Nc2cc(F)ccc2O)CCN1c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1CC[C@H]&CCN1&",
"old_substring": "O=C2C[C@H]4O"
} |
Can you make molecule O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cc(F)ccc1O)C1=CC[C@H](c2cccc(F)c2)S1 | O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O | O=C(Nc1cc(F)ccc1O)C1=CC[C@H](c2cccc(F)c2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C2C[C@H]4O"
} |
Can you make molecule O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1cccc(F)c1)Nc1cc(F)ccc1O | O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O | O=C(CCC(=O)c1cccc(F)c1)Nc1cc(F)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O=C2C[C@H]4O"
} |
Can you make molecule O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONc1cc(F)ccc1O)[C@H](C)c1cccc(F)c1 | O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O | C/C(=N\ONc1cc(F)ccc1O)[C@H](C)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)[C@@H]&C",
"old_substring": "O=C2C[C@H]4O"
} |
Can you make molecule O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)c1cccc(F)c1)Nc1cc(F)ccc1O | O=C(C[C@@H](O)c1cccc(F)c1)Nc1cc(F)ccc1O | CC[C@@H](CC(=O)c1cccc(F)c1)Nc1cc(F)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&CC&=O",
"old_substring": "O=C2C[C@H]4O"
} |
Can you make molecule CC(C)c1nc(CSCc2ccnn2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nc(CCCCSCc2ccnn2C)no1 | CC(C)c1nc(CSCc2ccnn2C)no1 | CC(C)c1nc(CCCCSCc2ccnn2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C36"
} |
Can you make molecule CC(C)c1nc(CSCc2ccnn2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nc(CCCCCSCc2ccnn2C)no1 | CC(C)c1nc(CSCc2ccnn2C)no1 | CC(C)c1nc(CCCCCSCc2ccnn2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C36"
} |
Can you make molecule CC(C)c1nc(CSCc2ccnn2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nc(C2CC(SCc3ccnn3C)C2)no1 | CC(C)c1nc(CSCc2ccnn2C)no1 | CC(C)c1nc(C2CC(SCc3ccnn3C)C2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C36"
} |
Can you make molecule CC(C)c1nc(CSCc2ccnn2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nc(SC(=S)OSCc2ccnn2C)no1 | CC(C)c1nc(CSCc2ccnn2C)no1 | CC(C)c1nc(SC(=S)OSCc2ccnn2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C36"
} |
Can you make molecule CC(C)c1nc(CSCc2ccnn2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nc(NC(=S)SSCc2ccnn2C)no1 | CC(C)c1nc(CSCc2ccnn2C)no1 | CC(C)c1nc(NC(=S)SSCc2ccnn2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C36"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCCCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | O=C(C1CCCCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCCCCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | O=C(C1CCCCCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C(=O)N2CCC[C@H]2c2nc3cc(-c4ccccc4)ccc3o2)CCCC1 | O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | CC1(C(=O)N2CCC[C@H]2c2nc3cc(-c4ccccc4)ccc3o2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCCCCCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | O=C(C1CCCCCCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1C2CCC1CC2)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | O=C(C1CCC1)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | O=C(C1C2CCC1CC2)N1CCC[C@H]1c1nc2cc(-c3ccccc3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2CCC1CC2",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC([C@@H]2NC(=O)NC2=O)CC1)NC1CCN(c2ccccc2F)CC1 | O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 | O=C(NN=C1CCC([C@@H]2NC(=O)NC2=O)CC1)NC1CCN(c2ccccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3CC6"
} |
Can you make molecule O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC(=O)[C@H]([C@H]2CC=C(C(=O)NC3CCN(c4ccccc4F)CC3)S2)N1 | O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 | O=C1NC(=O)[C@H]([C@H]2CC=C(C(=O)NC3CCN(c4ccccc4F)CC3)S2)N1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3CC6"
} |
Can you make molecule O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONC1CCN(c2ccccc2F)CC1)[C@H](C)[C@@H]1NC(=O)NC1=O | O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 | C/C(=N\ONC1CCN(c2ccccc2F)CC1)[C@H](C)[C@@H]1NC(=O)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)[C@@H]&C",
"old_substring": "O=C3CC6"
} |
Can you make molecule O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC(=O)[C@H](C(Cl)(Cl)[S@+]([O-])CNC2CCN(c3ccccc3F)CC2)N1 | O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 | O=C1NC(=O)[C@H](C(Cl)(Cl)[S@+]([O-])CNC2CCN(c3ccccc3F)CC2)N1 | 102 | {
"fragment_index": 0,
"new_substring": "O=[S@](C&)C&(Cl)Cl",
"old_substring": "O=C3CC6"
} |
Can you make molecule O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC(=O)[C@H](CCC=NC2CCN(c3ccccc3F)CC2)N1 | O=C(CC[C@@H]1NC(=O)NC1=O)NC1CCN(c2ccccc2F)CC1 | O=C1NC(=O)[C@H](CCC=NC2CCN(c3ccccc3F)CC2)N1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "O=C3CC6"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc3c(c2NSC(=O)Cc2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NSC(=O)Cc2ccc(Br)o2)CSC3)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc3c(c2NC(=O)CCCC(=O)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NC(=O)CCCC(=O)c2ccc(Br)o2)CSC3)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc3c(c2NC(=O)CC(C)(C)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NC(=O)CC(C)(C)c2ccc(Br)o2)CSC3)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc3c(c2NC(=O)CCC(C)(C)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NC(=O)CCC(C)(C)c2ccc(Br)o2)CSC3)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc3c(c2NSC(=O)[C@@H](C)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Br)o2)CSC3)cc1C | Cc1ccc(-n2nc3c(c2NSC(=O)[C@@H](C)c2ccc(Br)o2)CSC3)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(SCc2nn(-c3ccccc3)c(=S)n2C)nnc1-c1ccccc1 | C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 | C=CCn1c(SCc2nn(-c3ccccc3)c(=S)n2C)nnc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)n1C",
"old_substring": "c15nnc([S-])n16"
} |
Can you make molecule C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(SCc2nn(-c3ccccc3)c(=S)o2)nnc1-c1ccccc1 | C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 | C=CCn1c(SCc2nn(-c3ccccc3)c(=S)o2)nnc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)o1",
"old_substring": "c15nnc([S-])n16"
} |
Can you make molecule C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(SCc2nn(-c3ccccc3)c(=S)s2)nnc1-c1ccccc1 | C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 | C=CCn1c(SCc2nn(-c3ccccc3)c(=S)s2)nnc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)s1",
"old_substring": "c15nnc([S-])n16"
} |
Can you make molecule C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(SCc2nnc(C)c(-c3ccccc3)n2)nnc1-c1ccccc1 | C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 | C=CCn1c(SCc2nnc(C)c(-c3ccccc3)n2)nnc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc(C)c&n1",
"old_substring": "c15nnc([S-])n16"
} |
Can you make molecule C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(SCn2nc(C)n(-c3ccccc3)c2=S)nnc1-c1ccccc1 | C=CCn1c(SCc2nnc([S-])n2-c2ccccc2)nnc1-c1ccccc1 | C=CCn1c(SCn2nc(C)n(-c3ccccc3)c2=S)nnc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn&c(=S)n1&",
"old_substring": "c15nnc([S-])n16"
} |
Can you make molecule c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | c1nnn(C23C[C@@H]4C[C@@H](CC(c5cc6cn[nH]c6cn5)(C4)C2)C3)n1 | c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 | c1nnn(C23C[C@@H]4C[C@@H](CC(c5cc6cn[nH]c6cn5)(C4)C2)C3)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cn[nH]c2cn1",
"old_substring": "c19nc2c3cn[nH]c3ncn2n1"
} |
Can you make molecule c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | c1cnc2nc(C34C[C@H]5C[C@@H](C3)CC(n3ncnn3)(C5)C4)[nH]c2c1 | c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 | c1cnc2nc(C34C[C@H]5C[C@@H](C3)CC(n3ncnn3)(C5)C4)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2ncccc2[nH]1",
"old_substring": "c19nc2c3cn[nH]c3ncn2n1"
} |
Can you make molecule c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | c1cnc2[nH]c(C34C[C@H]5C[C@@H](C3)CC(n3ncnn3)(C5)C4)nc2c1 | c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 | c1cnc2[nH]c(C34C[C@H]5C[C@@H](C3)CC(n3ncnn3)(C5)C4)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2cccnc2[nH]1",
"old_substring": "c19nc2c3cn[nH]c3ncn2n1"
} |
Can you make molecule c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | c1nc(C23C[C@H]4C[C@@H](C2)CC(n2ncnn2)(C4)C3)c2cc[nH]c2n1 | c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 | c1nc(C23C[C@H]4C[C@@H](C2)CC(n2ncnn2)(C4)C3)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc2[nH]ccc12",
"old_substring": "c19nc2c3cn[nH]c3ncn2n1"
} |
Can you make molecule c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | c1cnc2nc(C34C[C@H]5C[C@@H](C3)CC(n3ncnn3)(C5)C4)cn2c1 | c1nnn(C23C[C@@H]4C[C@@H](CC(c5nc6c7cn[nH]c7ncn6n5)(C4)C2)C3)n1 | c1cnc2nc(C34C[C@H]5C[C@@H](C3)CC(n3ncnn3)(C5)C4)cn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn2cccnc2n1",
"old_substring": "c19nc2c3cn[nH]c3ncn2n1"
} |
Can you make molecule CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCc2ncnn2C2CC(C)C2)c(C[C@H](C)[NH3+])n1 | CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] | Cc1ccc(OCc2ncnn2C2CC(C)C2)c(C[C@H](C)[NH3+])n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC4"
} |
Can you make molecule CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCc2ncnn2CCC(C)C)c(C[C@H](C)[NH3+])n1 | CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] | Cc1ccc(OCc2ncnn2CCC(C)C)c(C[C@H](C)[NH3+])n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC4"
} |
Can you make molecule CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCc2ncnn2CCCCBr)c(C[C@H](C)[NH3+])n1 | CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] | Cc1ccc(OCc2ncnn2CCCCBr)c(C[C@H](C)[NH3+])n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC4"
} |
Can you make molecule CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] | CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] | C=CCCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC4"
} |
Can you make molecule CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCc2ncnn2CCCCCl)c(C[C@H](C)[NH3+])n1 | CCCn1ncnc1COc1ccc(C)nc1C[C@H](C)[NH3+] | Cc1ccc(OCc2ncnn2CCCCCl)c(C[C@H](C)[NH3+])n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC4"
} |
Can you make molecule CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | C=CSSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | C=CCCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)c2ccc(SCCCCl)nc2)C[C@H]1O | CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | C[C@H]1CCN(C(=O)c2ccc(SCCCCl)nc2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)c2ccc(SCCCCS)nc2)C[C@H]1O | CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | C[C@H]1CCN(C(=O)c2ccc(SCCCCS)nc2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)c2ccc(SCCCBr)nc2)C[C@H]1O | CCSc1ccc(C(=O)N2CC[C@H](C)[C@H](O)C2)cn1 | C[C@H]1CCN(C(=O)c2ccc(SCCCBr)nc2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.