prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)CCCCC#N | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)CCCCC#N | 102 | {
"fragment_index": 0,
"new_substring": "S&(=O)(=O)CCCCC#N",
"old_substring": "S2(=O)(=O)[C@@H](C)C#N"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)C(C)(C)C | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "S&(=O)(=O)C(C)(C)C",
"old_substring": "S2(=O)(=O)[C@@H](C)C#N"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)CCCCl | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)CCCCl | 102 | {
"fragment_index": 0,
"new_substring": "S&(=O)(=O)CCCCl",
"old_substring": "S2(=O)(=O)[C@@H](C)C#N"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](C(=O)[O-])CCN1CS(=O)(=O)C(C)(C)C | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N | C[C@H]1[C@H](C(=O)[O-])CCN1CS(=O)(=O)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&S(=O)(=O)C(C)(C)C",
"old_substring": "S2(=O)(=O)[C@@H](C)C#N"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](C(=O)[O-])CCN1C[C@@H](O)C(C)(C)C | C[C@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)[C@@H](C)C#N | C[C@H]1[C@H](C(=O)[O-])CCN1C[C@@H](O)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)[C@H](O)C&",
"old_substring": "S2(=O)(=O)[C@@H](C)C#N"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | COCc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | COCSc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | CC(=O)Sc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(SCC(=O)Nc2ccccc2C(=O)CS)n(N)c1=O | COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | Cc1nnc(SCC(=O)Nc2ccccc2C(=O)CS)n(N)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(SCC(=O)Nc2ccccc2C(=O)CI)n(N)c1=O | COc1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N | Cc1nnc(SCC(=O)Nc2ccccc2C(=O)CI)n(N)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)OCCc2oc3c(C)cccc3c2C)cc1 | Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 | Cc1ccc(S(=O)(=O)OCCc2oc3c(C)cccc3c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&oc2c(C)cccc12",
"old_substring": "c15coc2ccccc12"
} |
Can you make molecule Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)OCCc2c(C)sc3ccccc23)cc1 | Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 | Cc1ccc(S(=O)(=O)OCCc2c(C)sc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(C)sc2ccccc12",
"old_substring": "c15coc2ccccc12"
} |
Can you make molecule Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)OCCc2csc3ccc(Cl)cc23)cc1 | Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 | Cc1ccc(S(=O)(=O)OCCc2csc3ccc(Cl)cc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2ccc(Cl)cc12",
"old_substring": "c15coc2ccccc12"
} |
Can you make molecule Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)OCCc2oc3ccc(Cl)cc3c2C)cc1 | Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 | Cc1ccc(S(=O)(=O)OCCc2oc3ccc(Cl)cc3c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&oc2ccc(Cl)cc12",
"old_substring": "c15coc2ccccc12"
} |
Can you make molecule Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)OCCc2oc3cc(Br)ccc3c2C)cc1 | Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 | Cc1ccc(S(=O)(=O)OCCc2oc3cc(Br)ccc3c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&oc2cc(Br)ccc12",
"old_substring": "c15coc2ccccc12"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cc2cc(F)ccc2s1 | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cc2cc(F)ccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(F)ccc2s1",
"old_substring": "c15cccc(F)c1"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(Br)c1C | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(Br)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c15cccc(F)c1"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1oc2ccc(F)cc2c1C | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1oc2ccc(F)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(F)cc2c1C",
"old_substring": "c15cccc(F)c1"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cc(F)ccc1Br | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cc(F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c15cccc(F)c1"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1ccc(F)cc1Cl | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1cccc(F)c1 | COc1ccccc1[C@@H](C)NC(=O)[C@@H](C)Oc1ccc(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c15cccc(F)c1"
} |
Can you make molecule CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](OC(=S)Sc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | CC[C@@H](OC(=S)Sc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](OC(=N)Cc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | CC[C@@H](OC(=N)Cc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)[O-])C(=O)CCC(=O)c1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O | CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | CC[C@H](C(=O)[O-])C(=O)CCC(=O)c1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)[O-])[C@H](O)CCc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O | CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | CC[C@H](C(=O)[O-])[C@H](O)CCc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)[O-])C(=O)/C=C/Sc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O | CC[C@@H](Oc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O)C(=O)[O-] | CC[C@H](C(=O)[O-])C(=O)/C=C/Sc1ccccc1C=C1S/C(=N\c2cccc(O)c2)N(CC)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@H]1CC[C@H](C[NH2+][C@H](C)c2ccc3c(c2)OCCCO3)O1 | C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 | CC(=O)[C@H]1CC[C@H](C[NH2+][C@H](C)c2ccc3c(c2)OCCCO3)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C5(N)=O"
} |
Can you make molecule C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]C[C@H]1CC[C@H](CCCCC(N)=O)O1)c1ccc2c(c1)OCCCO2 | C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 | C[C@@H]([NH2+]C[C@H]1CC[C@H](CCCCC(N)=O)O1)c1ccc2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C5(N)=O"
} |
Can you make molecule C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]C[C@H]1CC[C@H](C/C(N)=N\O)O1)c1ccc2c(c1)OCCCO2 | C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 | C[C@@H]([NH2+]C[C@H]1CC[C@H](C/C(N)=N\O)O1)c1ccc2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&/C(N)=N\\O",
"old_substring": "C5(N)=O"
} |
Can you make molecule C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]C[C@H]1CC[C@H](CC/C(N)=N/O)O1)c1ccc2c(c1)OCCCO2 | C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 | C[C@@H]([NH2+]C[C@H]1CC[C@H](CC/C(N)=N/O)O1)c1ccc2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C5(N)=O"
} |
Can you make molecule C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]C[C@H]1CC[C@H](CC/C(N)=N\O)O1)c1ccc2c(c1)OCCCO2 | C[C@@H]([NH2+]C[C@H]1CC[C@H](C(N)=O)O1)c1ccc2c(c1)OCCCO2 | C[C@@H]([NH2+]C[C@H]1CC[C@H](CC/C(N)=N\O)O1)c1ccc2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1SCNc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | Cc1ccccc1SCNc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N56"
} |
Can you make molecule Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1SC(=N)Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | Cc1ccccc1SC(=N)Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N56"
} |
Can you make molecule Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1SC(=S)N(C)c1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | Cc1ccccc1SC(=S)N(C)c1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N56"
} |
Can you make molecule Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C1CCN(Cc2nc(N)nc(COc3ccc(F)c(Cl)c3)n2)CC1 | Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | Cc1ccccc1C1CCN(Cc2nc(N)nc(COc3ccc(F)c(Cl)c3)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N56"
} |
Can you make molecule Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1cccc(-c2nc(N)nc(COc3ccc(F)c(Cl)c3)n2)c1N | Cc1ccccc1Nc1nc(N)nc(COc2ccc(F)c(Cl)c2)n1 | Cc1ccccc1-c1cccc(-c2nc(N)nc(COc3ccc(F)c(Cl)c3)n2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N56"
} |
Can you make molecule CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1I | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(OC(=O)C=Cc2ccc(C(N)=O)cc2)ccc1Br | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 | CC(=O)Nc1cc(OC(=O)C=Cc2ccc(C(N)=O)cc2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1Cl | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)c1Br | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 | CC(=O)Nc1cccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)c1Cl | CC(=O)Nc1ccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)cc1 | CC(=O)Nc1cccc(OC(=O)C=Cc2ccc(C(N)=O)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccncc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc(-c2ccncc2Cl)cn1 | O=C([O-])c1ccc(-c2ccncc2)cn1 | O=C([O-])c1ccc(-c2ccncc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c14ccncc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccncc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc(-c2ccccc2)cn1 | O=C([O-])c1ccc(-c2ccncc2)cn1 | O=C([O-])c1ccc(-c2ccccc2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c14ccncc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccncc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc(-c2cnccc2Cl)cn1 | O=C([O-])c1ccc(-c2ccncc2)cn1 | O=C([O-])c1ccc(-c2cnccc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c14ccncc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccncc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc(-c2cc(Br)ncc2F)cn1 | O=C([O-])c1ccc(-c2ccncc2)cn1 | O=C([O-])c1ccc(-c2cc(Br)ncc2F)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c14ccncc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccncc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2ccc(C(=O)[O-])nc2)ncc1Br | O=C([O-])c1ccc(-c2ccncc2)cn1 | Cc1cc(-c2ccc(C(=O)[O-])nc2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "c14ccncc1"
} |
Can you make molecule O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | Fc1c(F)c(F)c(CC(Cl)(Cl)Cl)c(F)c1F | O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl | Fc1c(F)c(F)c(CC(Cl)(Cl)Cl)c(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C&C(Cl)(Cl)Cl",
"old_substring": "O[C@H]2C(Cl)(Cl)Cl"
} |
Can you make molecule O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCl)c1c(F)c(F)c(F)c(F)c1F | O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl | CC(C)[C@H](CCl)c1c(F)c(F)c(F)c(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCl)C(C)C",
"old_substring": "O[C@H]2C(Cl)(Cl)Cl"
} |
Can you make molecule O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | Fc1c(F)c(F)c(NC(Cl)=C(Cl)Cl)c(F)c1F | O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl | Fc1c(F)c(F)c(NC(Cl)=C(Cl)Cl)c(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "N&C(Cl)=C(Cl)Cl",
"old_substring": "O[C@H]2C(Cl)(Cl)Cl"
} |
Can you make molecule O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | Fc1c(F)c(F)c(CC(Cl)=C(Cl)Cl)c(F)c1F | O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl | Fc1c(F)c(F)c(CC(Cl)=C(Cl)Cl)c(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C&C(Cl)=C(Cl)Cl",
"old_substring": "O[C@H]2C(Cl)(Cl)Cl"
} |
Can you make molecule O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1c(F)c(F)c(F)c(F)c1F)C(C)(C)C | O[C@H](c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl | C[C@@H](c1c(F)c(F)c(F)c(F)c1F)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C",
"old_substring": "O[C@H]2C(Cl)(Cl)Cl"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)CN(C)C(=S)Sc2ccc3ccccc3c2)cc1OC | COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC | COc1ccc(/C=N/NC(=O)CN(C)C(=S)Sc2ccc3ccccc3c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N67"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)Cc2cc(-c3ccc4ccccc4c3)c(N)o2)cc1OC | COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC | COc1ccc(/C=N/NC(=O)Cc2cc(-c3ccc4ccccc4c3)c(N)o2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N67"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)CN2CCN=C2Sc2ccc3ccccc3c2)cc1OC | COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC | COc1ccc(/C=N/NC(=O)CN2CCN=C2Sc2ccc3ccccc3c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N67"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)CCN2CCC(c3ccc4ccccc4c3)CC2)cc1OC | COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC | COc1ccc(/C=N/NC(=O)CCN2CCC(c3ccc4ccccc4c3)CC2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N67"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)Cc2cccc(-c3ccc4ccccc4c3)c2N)cc1OC | COc1ccc(/C=N/NC(=O)CNc2ccc3ccccc3c2)cc1OC | COc1ccc(/C=N/NC(=O)Cc2cccc(-c3ccc4ccccc4c3)c2N)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N67"
} |
Can you make molecule Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C2=C(N=Cc3cc(C)n(-c4ccc(O)cc4)c3C)CCS2)cc1Cl | Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | Cc1ccc(NC(=O)C2=C(N=Cc3cc(C)n(-c4ccc(O)cc4)c3C)CCS2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C4(=O)C=6C#N"
} |
Can you make molecule Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(N=Cc2cc(C)n(-c3ccc(O)cc3)c2C)=C(Cl)Cl)cc1Cl | Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | Cc1ccc(NC(=O)C(N=Cc2cc(C)n(-c3ccc(O)cc3)c2C)=C(Cl)Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C4(=O)C=6C#N"
} |
Can you make molecule Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N=C/C=C/N=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | Cc1ccc(N=C/C=C/N=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C=&/C=C/N&",
"old_substring": "C4(=O)C=6C#N"
} |
Can you make molecule Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)C=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | Cc1ccc(NSC(=O)C=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C=6C#N"
} |
Can you make molecule Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC[S@+]([O-])CCC=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | Cc1ccc(NC[S@+]([O-])CCC=Cc2cc(C)n(-c3ccc(O)cc3)c2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C=6C#N"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(CC(=O)SN[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(CC(=O)SN[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(=O)CCCC(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(C(=O)CCCC(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(C)(C)CC(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(C(C)(C)CC(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(C)(C)CCC(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(C(C)(C)CCC(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c([C@H](C)C(=O)SN[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c(C(=O)N[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | Cc1cccn2c(=O)c([C@H](C)C(=O)SN[C@H]3CCN(C(=O)C(C)C)C3)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1n[nH]c2ccccc12)NCCCS(=O)(=O)c1ccccc1 | O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 | O=C(/C=C/Sc1n[nH]c2ccccc12)NCCCS(=O)(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCCCS(=O)(=O)c2ccccc2)nc1-c1n[nH]c2ccccc12 | O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 | O=Cc1sc(NCCCS(=O)(=O)c2ccccc2)nc1-c1n[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCCCS(=O)(=O)c2ccccc2)sc1-c1n[nH]c2ccccc12 | O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 | O=Cc1nc(NCCCS(=O)(=O)c2ccccc2)sc1-c1n[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCS(=O)(=O)c1ccccc1)n1nc(-c2n[nH]c3ccccc23)oc1=S | O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 | O=C(NCCCS(=O)(=O)c1ccccc1)n1nc(-c2n[nH]c3ccccc23)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(CCCNO/N=C/c1ccc(-c2n[nH]c3ccccc23)o1)c1ccccc1 | O=C(NCCCS(=O)(=O)c1ccccc1)c1n[nH]c2ccccc12 | O=S(=O)(CCCNO/N=C/c1ccc(-c2n[nH]c3ccccc23)o1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule C1=C(CC[NH2+]Cc2ccco2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C(CCC2(Cc3ccco3)CC[NH2+]C2)CCCC1 | C1=C(CC[NH2+]Cc2ccco2)CCCC1 | C1=C(CCC2(Cc3ccco3)CC[NH2+]C2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule C1=C(CC[NH2+]Cc2ccco2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C(CC[C@]2(Cc3ccco3)CCC[NH2+]C2)CCCC1 | C1=C(CC[NH2+]Cc2ccco2)CCCC1 | C1=C(CC[C@]2(Cc3ccco3)CCC[NH2+]C2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule C1=C(CC[NH2+]Cc2ccco2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C(CCn2c[nH+]cc2Cc2ccco2)CCCC1 | C1=C(CC[NH2+]Cc2ccco2)CCCC1 | C1=C(CCn2c[nH+]cc2Cc2ccco2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C1=C(CC[NH2+]Cc2ccco2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C(CCc2cc(Cc3ccco3)[nH][nH+]2)CCCC1 | C1=C(CC[NH2+]Cc2ccco2)CCCC1 | C1=C(CCc2cc(Cc3ccco3)[nH][nH+]2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C1=C(CC[NH2+]Cc2ccco2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1[nH+]cc(Cc2ccco2)c1CCC1=CCCCC1 | C1=C(CC[NH2+]Cc2ccco2)CCCC1 | Cn1[nH+]cc(Cc2ccco2)c1CCC1=CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCC(CO)=NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | CCN(CCC(CO)=NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C6C3=O"
} |
Can you make molecule CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C/C(C)=N\ONCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | CCN(C/C(C)=N\ONCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C6C3=O"
} |
Can you make molecule CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)c1cnc(-c2cccnc2)s1)C(CC)(CC)C(=O)CNCc1ccc(F)cc1 | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | CCN(C(=O)c1cnc(-c2cccnc2)s1)C(CC)(CC)C(=O)CNCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6C3=O"
} |
Can you make molecule CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(SSC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | CCN(SSC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C6C3=O"
} |
Can you make molecule CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)c1cnc(-c2cccnc2)s1)C(CC)(CC)C(=O)CCNCc1ccc(F)cc1 | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1cnc(-c2cccnc2)s1 | CCN(C(=O)c1cnc(-c2cccnc2)s1)C(CC)(CC)C(=O)CCNCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C6C3=O"
} |
Can you make molecule FC(F)(F)c1cccc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CCCc1cccc2c1CCCC2 | FC(F)(F)c1cccc2c1CCCC2 | FC(F)(F)CCCc1cccc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "FC3(F)F"
} |
Can you make molecule FC(F)(F)c1cccc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)Sc1cccc2c1CCCC2 | FC(F)(F)c1cccc2c1CCCC2 | FC(F)(F)Sc1cccc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "FC3(F)F"
} |
Can you make molecule FC(F)(F)c1cccc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CCCCc1cccc2c1CCCC2 | FC(F)(F)c1cccc2c1CCCC2 | FC(F)(F)CCCCc1cccc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "FC3(F)F"
} |
Can you make molecule FC(F)(F)c1cccc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | FC1(F)CCC(c2cccc3c2CCCC3)CC1 | FC(F)(F)c1cccc2c1CCCC2 | FC1(F)CCC(c2cccc3c2CCCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC(F)(F)CC1",
"old_substring": "FC3(F)F"
} |
Can you make molecule FC(F)(F)c1cccc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)/C=C/Sc1cccc2c1CCCC2 | FC(F)(F)c1cccc2c1CCCC2 | FC(F)(F)/C=C/Sc1cccc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C=C/C(F)(F)F",
"old_substring": "FC3(F)F"
} |
Can you make molecule CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=O)CCC(C)(C)NC(=O)c1ccnc(OC(C)(C)C)c1 | CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 | CN(C)C(=O)CCC(C)(C)NC(=O)c1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)CCC6"
} |
Can you make molecule CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=O)C(C)(C)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 | CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 | CN(C)C(=O)C(C)(C)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCC&",
"old_substring": "C2(=O)CCC6"
} |
Can you make molecule CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CC(=O)N(C)C)NC(=O)c1ccnc(OC(C)(C)C)c1 | CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 | CC(C)[C@H](CC(=O)N(C)C)NC(=O)c1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&C(C)C",
"old_substring": "C2(=O)CCC6"
} |
Can you make molecule CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=O)C(C)(C)C(C)(C)NC(=O)c1ccnc(OC(C)(C)C)c1 | CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 | CN(C)C(=O)C(C)(C)C(C)(C)NC(=O)c1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)C&(C)C",
"old_substring": "C2(=O)CCC6"
} |
Can you make molecule CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=O)C(CNC(=O)c1ccnc(OC(C)(C)C)c1)=C(Cl)Cl | CN(C)C(=O)CCCNC(=O)c1ccnc(OC(C)(C)C)c1 | CN(C)C(=O)C(CNC(=O)c1ccnc(OC(C)(C)C)c1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C2(=O)CCC6"
} |
Can you make molecule Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nn(C3CC3)c(=S)n2C)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nn(C3CC3)c(=S)n2C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)n1C",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)s2)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)s2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&s1",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2ncc(C3CC3)n2C)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2ncc(C3CC3)n2C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&n1C",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2cc(C3CC3)nn2C)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2cc(C3CC3)nn2C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nn1C",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc3n2C[C@H](C2CC2)CC3)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc(C3CC3)n2C)c(C)c1 | Cc1ccc(NC(=O)[C@H](C)[NH+](C)Cc2nnc3n2C[C@H](C2CC2)CC3)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2n1C[C@H]&CC2",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1cccc(CC(=O)SOCC(=O)C(C)(C)C)c1 | CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 | CN(C)c1cccc(CC(=O)SOCC(=O)C(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1cccc(C(=O)CCCC(=O)OCC(=O)C(C)(C)C)c1 | CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 | CN(C)c1cccc(C(=O)CCCC(=O)OCC(=O)C(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1cccc(C(C)(C)CC(=O)OCC(=O)C(C)(C)C)c1 | CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 | CN(C)c1cccc(C(C)(C)CC(=O)OCC(=O)C(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1cccc(C(C)(C)CCC(=O)OCC(=O)C(C)(C)C)c1 | CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 | CN(C)c1cccc(C(C)(C)CCC(=O)OCC(=O)C(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SOCC(=O)C(C)(C)C)c1cccc(N(C)C)c1 | CN(C)c1cccc(C(=O)OCC(=O)C(C)(C)C)c1 | C[C@H](C(=O)SOCC(=O)C(C)(C)C)c1cccc(N(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C25=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.