prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(CBr)=NC(=O)c1nnn(Cc2nsnc2C)c1C | Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C | CC(CBr)=NC(=O)c1nnn(Cc2nsnc2C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CBr",
"old_substring": "C3(C)C"
} |
Can you make molecule Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nsnc1Cn1nnc(C(=O)NC2(C)CCCC2)c1C | Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C | Cc1nsnc1Cn1nnc(C(=O)NC2(C)CCCC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C3(C)C"
} |
Can you make molecule Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nsnc1Cn1nnc(C(=O)NC(Cl)(Cl)Cl)c1C | Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C | Cc1nsnc1Cn1nnc(C(=O)NC(Cl)(Cl)Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C3(C)C"
} |
Can you make molecule Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(C)=NC(=O)c1nnn(Cc2nsnc2C)c1C | Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C | CCC(CC)C(C)=NC(=O)c1nnn(Cc2nsnc2C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C(CC)CC",
"old_substring": "C3(C)C"
} |
Can you make molecule Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=O)c1nnn(Cc2nsnc2C)c1C)N1CCCC1 | Cc1nsnc1Cn1nnc(C(=O)NC(C)C)c1C | CC(=NC(=O)c1nnn(Cc2nsnc2C)c1C)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)N1CCCC1",
"old_substring": "C3(C)C"
} |
Can you make molecule CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Cc1nsc(N[C@H](CCl)CCCc2ccccc2)n1 | CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 | CC(=O)Cc1nsc(N[C@H](CCl)CCCc2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]36C"
} |
Can you make molecule CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Cc1nsc(N[C@@H]2N=NC=C2CCc2ccccc2)n1 | CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 | CC(=O)Cc1nsc(N[C@@H]2N=NC=C2CCc2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]36C"
} |
Can you make molecule CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Cc1nsc(N[C@@H]2CC[C@@H](c3ccccc3)C2)n1 | CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 | CC(=O)Cc1nsc(N[C@@H]2CC[C@@H](c3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]36C"
} |
Can you make molecule CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Cc1nsc(N[C@H](C)C(C)(C)Cc2ccccc2)n1 | CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 | CC(=O)Cc1nsc(N[C@H](C)C(C)(C)Cc2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]36C"
} |
Can you make molecule CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccccc1)Nc1nc(CC(C)=O)ns1 | CC(=O)Cc1nsc(N[C@@H](C)c2ccccc2)n1 | CC[C@@H](CCc1ccccc1)Nc1nc(CC(C)=O)ns1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]36C"
} |
Can you make molecule COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | COCc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | COCSc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | CC(=O)Sc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1Oc2ccccc2O[C@@H]1C(=O)NCc1ccc(C(=O)CS)nc1 | COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | C[C@H]1Oc2ccccc2O[C@@H]1C(=O)NCc1ccc(C(=O)CS)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1Oc2ccccc2O[C@@H]1C(=O)NCc1ccc(C(=O)CI)nc1 | COc1ccc(CNC(=O)[C@H]2Oc3ccccc3O[C@@H]2C)cn1 | C[C@H]1Oc2ccccc2O[C@@H]1C(=O)NCc1ccc(C(=O)CI)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C)c(-c2nc3ccc(Cl)cc3s2)c(C)c(C)c1C[NH3+] | [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 | Cc1c(C)c(-c2nc3ccc(Cl)cc3s2)c(C)c(C)c1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(C)c(C)c&c1C",
"old_substring": "C14CCC5CC1"
} |
Can you make molecule [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCc2c(C[NH3+])cc(-c3nc4ccc(Cl)cc4s3)cc21 | [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 | CC1(C)CCc2c(C[NH3+])cc(-c3nc4ccc(Cl)cc4s3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2c1CCC2(C)C",
"old_substring": "C14CCC5CC1"
} |
Can you make molecule [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(-c2nc3ccc(Cl)cc3s2)sc2ccc(C[NH3+])cc12 | [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 | Cc1c(-c2nc3ccc(Cl)cc3s2)sc2ccc(C[NH3+])cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc&c(C)c2c1",
"old_substring": "C14CCC5CC1"
} |
Can you make molecule [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1cc(-c2nc3ccc(Cl)cc3s2)c(Cl)cc1Cl | [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 | [NH3+]Cc1cc(-c2nc3ccc(Cl)cc3s2)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(Cl)cc1Cl",
"old_substring": "C14CCC5CC1"
} |
Can you make molecule [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ccc(-c2nc3ccc(Cl)cc3s2)c(Cl)c1Cl | [NH3+]CC1CCC(c2nc3ccc(Cl)cc3s2)CC1 | [NH3+]Cc1ccc(-c2nc3ccc(Cl)cc3s2)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c(Cl)c1Cl",
"old_substring": "C14CCC5CC1"
} |
Can you make molecule CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1=C2CCN2CC(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)=NC(C2CCCC2)=N1 | CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 | CCC1=C2CCN2CC(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)=NC(C2CCCC2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&nc&nc2C1",
"old_substring": "N257"
} |
Can you make molecule CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1=C2OCCN2CC(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)=CC(C2CCCC2)=C1 | CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 | CCC1=C2OCCN2CC(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)=CC(C2CCCC2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N257"
} |
Can you make molecule CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(C2CCCC2)CCN(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)C1 | CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 | CCC1(C2CCCC2)CCN(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N257"
} |
Can you make molecule CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(C2CCCC2)CCCN(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)C1 | CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 | CCC1(C2CCCC2)CCCN(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N257"
} |
Can you make molecule CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)c(C#N)c1C1CCCC1 | CCN(C(=O)NC1CC[NH+](C[C@@H](O)COC)CC1)C1CCCC1 | CCc1oc(C(=O)NC2CC[NH+](C[C@@H](O)COC)CC2)c(C#N)c1C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N257"
} |
Can you make molecule CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSSc1nc2ccccc2c(=O)n1CCc1ccccc1 | CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 | C=CSSc1nc2ccccc2c(=O)n1CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCSc1nc2ccccc2c(=O)n1CCc1ccccc1 | CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 | C=CCCSc1nc2ccccc2c(=O)n1CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c2ccccc2nc(SCCCCl)n1CCc1ccccc1 | CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 | O=c1c2ccccc2nc(SCCCCl)n1CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c2ccccc2nc(SCCCCS)n1CCc1ccccc1 | CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 | O=c1c2ccccc2nc(SCCCCS)n1CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c2ccccc2nc(SCCCBr)n1CCc1ccccc1 | CCSc1nc2ccccc2c(=O)n1CCc1ccccc1 | O=c1c2ccccc2nc(SCCCBr)n1CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COSC(=O)Cc2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COSC(=O)Cc2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COC(=O)CCCC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)CCCC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COC(=O)CC(C)(C)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)CC(C)(C)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COC(=O)CCC(C)(C)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)CCC(C)(C)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COSC(=O)[C@@H](C)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COSC(=O)[C@@H](C)c2cc(Cl)c3c(c2)OCCCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1I | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)ccc1Br | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 | COc1cc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1Cl | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)c1Br | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 | COc1cccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)c1Cl | COc1ccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)cc1 | COc1cccc([C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)[NH+](C)C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NSC(=O)Cc1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NSC(=O)Cc1ccc(C#N)cn1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CCCC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NC(=O)CCCC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CC(C)(C)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NC(=O)CC(C)(C)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CCC(C)(C)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NC(=O)CCC(C)(C)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NSC(=O)[C@@H](C)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NC(=O)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | CC[C@H](NSC(=O)[C@@H](C)c1ccc(C#N)cn1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C25=O"
} |
Can you make molecule CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | CCOC(=O)CC(C)(C)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCC(C)(C)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | CCOC(=O)CCC(C)(C)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)C[C@@H](Br)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | CCOC(=O)C[C@@H](Br)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(C)n(NC(=O)c2c(NC(=O)Cc3ccc(F)cc3)sc3c2CC[C@H](C)C3)c(=O)c1 | CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | CCOc1cc(C)n(NC(=O)c2c(NC(=O)Cc3ccc(F)cc3)sc3c2CC[C@H](C)C3)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1c(C)n(NC(=O)c2c(NC(=O)Cc3ccc(F)cc3)sc3c2CC[C@H](C)C3)ccc1=O | CCOC(=O)NC(=O)c1c(NC(=O)Cc2ccc(F)cc2)sc2c1CC[C@H](C)C2 | CCOc1c(C)n(NC(=O)c2c(NC(=O)Cc3ccc(F)cc3)sc3c2CC[C@H](C)C3)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1cnn(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)c1=S | CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C | CC(C)n1cnn(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnn&c1=S",
"old_substring": "n16cnnc17"
} |
Can you make molecule CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1cnc(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)c1 | CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C | CC(C)n1cnc(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc&c1",
"old_substring": "n16cnnc17"
} |
Can you make molecule CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1nc(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)nc1Cl | CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C | CC(C)n1nc(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc&nc1Cl",
"old_substring": "n16cnnc17"
} |
Can you make molecule CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1cnc(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)cc1=O | CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C | CC(C)n1cnc(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc&cc1=O",
"old_substring": "n16cnnc17"
} |
Can you make molecule CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1cncc(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)c1=O | CC(C)n1cnnc1SCC(=O)Nc1ccc2c(c1)nc(C1CC1)n2C | CC(C)n1cncc(SCC(=O)Nc2ccc3c(c2)nc(C2CC2)n3C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cncc&c1=O",
"old_substring": "n16cnnc17"
} |
Can you make molecule CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | C=CSc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | CC(C)c1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | C=CCCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CC1([C@@H](O)c2ccc(CCCCl)cc2)CCCC1 | CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | [NH3+]CC1([C@@H](O)c2ccc(CCCCl)cc2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CC1([C@@H](O)c2ccc(CCCCS)cc2)CCCC1 | CCc1ccc([C@H](O)C2(C[NH3+])CCCC2)cc1 | [NH3+]CC1([C@@H](O)c2ccc(CCCCS)cc2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COc1ccccc1I | COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COc1ccccc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c17ccc%10cc18"
} |
Can you make molecule COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COc1cccc(Br)c1 | COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c17ccc%10cc18"
} |
Can you make molecule COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COc1cccc(Cl)c1 | COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Cl)c1",
"old_substring": "c17ccc%10cc18"
} |
Can you make molecule COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COc1ccccc1Cl | COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c17ccc%10cc18"
} |
Can you make molecule COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COO/N=C/c1ccccc1 | COc1ccc(CNC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2C)cc1OC | CNC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1C.CO.COO/N=C/c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1cc&ccc1&",
"old_substring": "c17ccc%10cc18"
} |
Can you make molecule COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | COCc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | COCSc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)ccc1SC(C)=O | COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | COc1cc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)ccc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)ccc1C(=O)CS | COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | COc1cc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)ccc1C(=O)CI | COc1ccc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)cc1OC | COc1cc([C@@H]2C(C#N)=C(N)Oc3cc(C)n(CCN4CCOCC4)c(=O)c32)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOc1cccc(Cl)c1)CC(=O)N1CCC(Cc2ccccc2)CC1 | C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 | C[C@H](CCOc1cccc(Cl)c1)CC(=O)N1CCC(Cc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]4C3=O"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOc1cccc(Cl)c1)CC(=O)N1CCC(Cc2ccccc2)CC1 | C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 | C[C@@H](CCOc1cccc(Cl)c1)CC(=O)N1CCC(Cc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]4C3=O"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN1CCC(Cc2ccccc2)CC1)Oc1cccc(Cl)c1 | C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 | C[C@@H](CCN1CCC(Cc2ccccc2)CC1)Oc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@H]4C3=O"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@](CO)(CCCN1CCC(Cc2ccccc2)CC1)Oc1cccc(Cl)c1 | C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 | C[C@](CO)(CCCN1CCC(Cc2ccccc2)CC1)Oc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@]&(CO)CCC&",
"old_substring": "C[C@H]4C3=O"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)N1CCC(Cc2ccccc2)CC1)Oc1cccc(Cl)c1 | C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCC(Cc2ccccc2)CC1 | C[C@H](CC(C)(C)N1CCC(Cc2ccccc2)CC1)Oc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]4C3=O"
} |
Can you make molecule COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2C(C(=O)c3nsc(-c4ccc(F)cc4)c3N)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)c3nsc(-c4ccc(F)cc4)c3N)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N48"
} |
Can you make molecule COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2C(C(=O)N(C)C(=S)Sc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)N(C)C(=S)Sc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N48"
} |
Can you make molecule COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2C(C(=O)c3cc(-c4ccc(F)cc4)c(N)o3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)c3cc(-c4ccc(F)cc4)c(N)o3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N48"
} |
Can you make molecule COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2C(C(=O)N3CCN=C3Sc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)N3CCN=C3Sc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N48"
} |
Can you make molecule COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2C(C(=O)CN3CCC(c4ccc(F)cc4)CC3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)Nc3ccc(F)cc3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | COc1cc([C@@H]2C(C(=O)CN3CCC(c4ccc(F)cc4)CC3)=C(C)Nc3nc(C)nn32)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N48"
} |
Can you make molecule CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CCCCC1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1SCCCS1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1SCSCS1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C15CC1"
} |
Can you make molecule CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CCCCCC1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CSCCSC1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CC1 | CC[C@@H](C)[C@@H](O)C[NH2+][C@@H](c1cccs1)C1CSCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C15CC1"
} |
Can you make molecule CSc1cc(-c2cccs2)oc(=O)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CSc1cc(-c2ccc(Cl)s2)oc(=O)c1C#N | CSc1cc(-c2cccs2)oc(=O)c1C#N | CSc1cc(-c2ccc(Cl)s2)oc(=O)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c14cccs1"
} |
Can you make molecule CSc1cc(-c2cccs2)oc(=O)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CSc1cc(-c2ccc(Br)s2)oc(=O)c1C#N | CSc1cc(-c2cccs2)oc(=O)c1C#N | CSc1cc(-c2ccc(Br)s2)oc(=O)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c14cccs1"
} |
Can you make molecule CSc1cc(-c2cccs2)oc(=O)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CSc1cc(-c2sccc2Br)oc(=O)c1C#N | CSc1cc(-c2cccs2)oc(=O)c1C#N | CSc1cc(-c2sccc2Br)oc(=O)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c14cccs1"
} |
Can you make molecule CSc1cc(-c2cccs2)oc(=O)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CSc1cc(-c2csc(I)c2)oc(=O)c1C#N | CSc1cc(-c2cccs2)oc(=O)c1C#N | CSc1cc(-c2csc(I)c2)oc(=O)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c14cccs1"
} |
Can you make molecule CSc1cc(-c2cccs2)oc(=O)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CSc1cc(-c2cc3c(s2)CSC3)oc(=O)c1C#N | CSc1cc(-c2cccs2)oc(=O)c1C#N | CSc1cc(-c2cc3c(s2)CSC3)oc(=O)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c14cccs1"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NSC(=O)Cc1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NSC(=O)Cc1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)CCCC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NC(=O)CCCC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C26=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)CC(C)(C)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NC(=O)CC(C)(C)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)CCC(C)(C)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NC(=O)CCC(C)(C)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NSC(=O)[C@@H](C)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NC(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | CC(C)[C@@H](NSC(=O)[C@@H](C)c1ccc(NS(C)(=O)=O)cc1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C26=O"
} |
Can you make molecule [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](CO)c1ccc(N2CCCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CCCC2)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](CO)c1ccc(N2CCCCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CCCCC2)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](CO)c1ccc(N2CCSCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CCSCC2)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](CO)c1ccc(N2CC=CC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CC=CC2)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](CO)c1ccc(SSN2CCOCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(N2CCOCC2)c(Cl)c1Cl | [NH3+][C@H](CO)c1ccc(SSN2CCOCC2)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N13CCOCC1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.