prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1csc(C[NH+](C)Cc2ccccc2O)c1C | COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 | COCc1csc(C[NH+](C)Cc2ccccc2O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1C",
"old_substring": "c16ccc7o1"
} |
Can you make molecule COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc2cc(C[NH+](C)Cc3ccccc3O)ccc2o1 | COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 | COCc1cc2cc(C[NH+](C)Cc3ccccc3O)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&ccc2o1",
"old_substring": "c16ccc7o1"
} |
Can you make molecule COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc2cc(C[NH+](C)Cc3ccccc3O)oc12 | COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 | COCc1cccc2cc(C[NH+](C)Cc3ccccc3O)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc2cc&oc12",
"old_substring": "c16ccc7o1"
} |
Can you make molecule COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc2c(C[NH+](C)Cc3ccccc3O)coc2c1 | COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 | COCc1ccc2c(C[NH+](C)Cc3ccccc3O)coc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c&coc2c1",
"old_substring": "c16ccc7o1"
} |
Can you make molecule COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C[NH+](C)Cc2ccccc2O)cc2occc12 | COCc1ccc(C[NH+](C)Cc2ccccc2O)o1 | COCc1cc(C[NH+](C)Cc2ccccc2O)cc2occc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2occc12",
"old_substring": "c16ccc7o1"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)NCCCCC(N)=O | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O | Cc1c(F)cc(N)cc1S(=O)(=O)NCCCCC(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C2C(N)=O"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=S | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=S | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C2C(N)=O"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CNS(=O)(=O)c1cc(N)cc(F)c1C | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O | CC(=O)CNS(=O)(=O)c1cc(N)cc(F)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C2C(N)=O"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)NCC/C(N)=N/O | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O | Cc1c(F)cc(N)cc1S(=O)(=O)NCC/C(N)=N/O | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C2C(N)=O"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)NCC/C(N)=N\O | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(N)=O | Cc1c(F)cc(N)cc1S(=O)(=O)NCC/C(N)=N\O | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C2C(N)=O"
} |
Can you make molecule CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=NS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | CC(C)=NS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&C",
"old_substring": "CC4"
} |
Can you make molecule CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | C=CSNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(I)=NS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | CC(I)=NS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&I",
"old_substring": "CC4"
} |
Can you make molecule CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | C=CCCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(N=CCCl)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | CCNS(=O)(=O)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | O=S(=O)(N=CCCl)[C@@H]1CC[NH+](C[C@@H]2CCCc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCl",
"old_substring": "CC4"
} |
Can you make molecule CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 | CCC(=O)NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C3CCO"
} |
Can you make molecule CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | C=C=CONS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 | C=C=CONS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C3CCO"
} |
Can you make molecule CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 | CCC(CO)=NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "C3CCO"
} |
Can you make molecule CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 | CCCC(=O)NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "C3CCO"
} |
Can you make molecule CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(=O)NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)NCCCO)C(=O)C2 | C=CCC(=O)NS(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&=O",
"old_substring": "C3CCO"
} |
Can you make molecule COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1I | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)ccc1Br | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 | COc1cc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1Cl | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)c1Br | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 | COc1cccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)c1Cl | COc1ccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)cc1 | COc1cccc(-n2ccc(CNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])n2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(Cl)(Cl)Cl)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(Cl)(Cl)Cl)CC1)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)CC(C)(C)C)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)CC(C)(C)C)CC1)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NC1CCC(C(=O)OCCCC(C)(C)C)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OCCCC(C)(C)C)CC1)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NC1CCC(C(=O)OCCCC(F)(F)F)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OCCCC(F)(F)F)CC1)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NC1CCC(C(=O)OCCCCC(F)(F)F)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OC(C)(C)C)CC1)[C@H]1CCCO1 | CC[C@@H](NC(=O)NC1CCC(C(=O)OCCCCC(F)(F)F)CC1)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+](C)C)C(=O)C[C@H]1CCCCN(C(=O)c2ccc3[nH]nnc3c2)C1 | CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 | CN(CC[NH+](C)C)C(=O)C[C@H]1CCCCN(C(=O)c2ccc3[nH]nnc3c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN&C1",
"old_substring": "[C@H]18COCCN14"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+](C)C)C(=O)C[C@H]1CC(CC(=O)c2ccc3[nH]nnc3c2)=NO1 | CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 | CN(CC[NH+](C)C)C(=O)C[C@H]1CC(CC(=O)c2ccc3[nH]nnc3c2)=NO1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(C&)=NO1",
"old_substring": "[C@H]18COCCN14"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+](C)C)C(=O)C[C@H]1C=C(CC(=O)c2ccc3[nH]nnc3c2)ON1 | CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 | CN(CC[NH+](C)C)C(=O)C[C@H]1C=C(CC(=O)c2ccc3[nH]nnc3c2)ON1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C(C&)ON1",
"old_substring": "[C@H]18COCCN14"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+](C)C)C(=O)C[C@H]1CCC(=O)N(C(=O)c2ccc3[nH]nnc3c2)C1 | CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 | CN(CC[NH+](C)C)C(=O)C[C@H]1CCC(=O)N(C(=O)c2ccc3[nH]nnc3c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC(=O)N&C1",
"old_substring": "[C@H]18COCCN14"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+](C)C)C(=O)C[C@H]1CCCCN(C(=O)c2ccc3[nH]nnc3c2)C1=O | CN(CC[NH+](C)C)C(=O)C[C@H]1COCCN1C(=O)c1ccc2[nH]nnc2c1 | CN(CC[NH+](C)C)C(=O)C[C@H]1CCCCN(C(=O)c2ccc3[nH]nnc3c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN&C1=O",
"old_substring": "[C@H]18COCCN14"
} |
Can you make molecule CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CC(C)[C@H](CCc1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "CC[C@@H]46"
} |
Can you make molecule CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CCC[C@@H](CCc1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "CC[C@@H]46"
} |
Can you make molecule CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCC1=CCC[C@@H]1c1ccc(F)cc1)C(=O)Cn1nnc(-c2ccccc2)n1 | CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CN(CCC1=CCC[C@@H]1c1ccc(F)cc1)C(=O)Cn1nnc(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "CC[C@@H]46"
} |
Can you make molecule CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCc1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CCCC[C@@H](CCc1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "CC[C@@H]46"
} |
Can you make molecule CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(CCc1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CC[C@H](c1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | CC[C@](C)(CCc1ccc(F)cc1)N(C)C(=O)Cn1nnc(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CC&",
"old_substring": "CC[C@@H]46"
} |
Can you make molecule O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1cc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)cc1Br)Nc1nccs1 | O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 | O=C(Cn1cc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)cc1Br)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&cc1Br",
"old_substring": "n16cccc17"
} |
Can you make molecule O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn(CC(=O)Nc2nccs2)c(=O)c1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1 | O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 | Cc1ccn(CC(=O)Nc2nccs2)c(=O)c1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc(C)c&c1=O",
"old_substring": "n16cccc17"
} |
Can you make molecule O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)c(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)cn1CC(=O)Nc1nccs1 | O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 | Cc1cc(=O)c(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)cn1CC(=O)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&c(=O)cc1C",
"old_substring": "n16cccc17"
} |
Can you make molecule O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)c(=O)n1CC(=O)Nc1nccs1 | O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 | Cc1ccc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)c(=O)n1CC(=O)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(C)ccc&c1=O",
"old_substring": "n16cccc17"
} |
Can you make molecule O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1cc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)cc(Cl)c1=O)Nc1nccs1 | O=C(Cn1cccc1-c1nc(-c2ccc(OC(F)(F)F)cc2)no1)Nc1nccs1 | O=C(Cn1cc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)cc(Cl)c1=O)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&cc(Cl)c1=O",
"old_substring": "n16cccc17"
} |
Can you make molecule CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(Nc2ccc(CC(=O)N3CCN(CC)CC3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CCN(CC)CC3)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&CC1",
"old_substring": "N14CC[NH+]5CC1"
} |
Can you make molecule CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(Nc2ccc(CC(=O)N3CCO[C@H](CC)C3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CCO[C@H](CC)C3)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCO[C@H]&C1",
"old_substring": "N14CC[NH+]5CC1"
} |
Can you make molecule CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(Nc2ccc(CC(=O)N3C[C@H](CC)CC3=O)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3C[C@H](CC)CC3=O)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H]&CC1=O",
"old_substring": "N14CC[NH+]5CC1"
} |
Can you make molecule CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(Nc2ccc(CC(=O)N3CCO[C@@H](CC)C3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CCO[C@@H](CC)C3)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCO[C@@H]&C1",
"old_substring": "N14CC[NH+]5CC1"
} |
Can you make molecule CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(Nc2ccc(CC(=O)N3CCS[C@@H](CC)C3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CC[NH+](CC)CC3)cc2)n1 | CCc1nsc(Nc2ccc(CC(=O)N3CCS[C@@H](CC)C3)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCS[C@@H]&C1",
"old_substring": "N14CC[NH+]5CC1"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@H]1CC[C@@H](C2SCCS2)C1)c1ccccc1 | CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 | CC(=CC(=O)N[C@H]1CC[C@@H](C2SCCS2)C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "CS6"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@H]1CC[C@@H](C2SCCCS2)C1)c1ccccc1 | CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 | CC(=CC(=O)N[C@H]1CC[C@@H](C2SCCCS2)C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "CS6"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@H]1CC[C@@H](C2(C)SCCS2)C1)c1ccccc1 | CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 | CC(=CC(=O)N[C@H]1CC[C@@H](C2(C)SCCS2)C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&SCCS1",
"old_substring": "CS6"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@H]1CC[C@@H](C2SCSCS2)C1)c1ccccc1 | CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 | CC(=CC(=O)N[C@H]1CC[C@@H](C2SCSCS2)C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "CS6"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@H]1CC[C@@H](C2CSCCSC2)C1)c1ccccc1 | CS[C@@H]1CC[C@H](NC(=O)C=C(C)c2ccccc2)C1 | CC(=CC(=O)N[C@H]1CC[C@@H](C2CSCCSC2)C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "CS6"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CCCCC1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1SCCCS1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1SCSCS1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CCCCCC1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CSCCSC1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CC1 | Cc1ccc([N+](=O)[O-])cc1NCC(=O)N[C@](C)(C#N)C1CSCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C16CC1"
} |
Can you make molecule CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H](NC(=O)CCNSC(=O)CC23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNSC(=O)CC23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H](NC(=O)CCNCC(=C=O)CC23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNCC(=C=O)CC23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H](NC(=O)CCNC(=O)CCCC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNC(=O)CCCC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H](NC(=O)CCNC(=O)CC(C)(C)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNC(=O)CC(C)(C)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H](NC(=O)CCNC[S@+]([O-])CCCC23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | CC1(C)[C@H](NC(=O)CCNC[S@+]([O-])CCCC23CC4CC(CC(C4)C2)C3)[C@H]2CCO[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C58=O"
} |
Can you make molecule c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(CCCCOC2CC[NH+](Cc3cccnc3)CC2)cc1 | c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 | c1ccc(CCCCOC2CC[NH+](Cc3cccnc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C47"
} |
Can you make molecule c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(CCCCCOC2CC[NH+](Cc3cccnc3)CC2)cc1 | c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 | c1ccc(CCCCCOC2CC[NH+](Cc3cccnc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C47"
} |
Can you make molecule c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(C2CC(OC3CC[NH+](Cc4cccnc4)CC3)C2)cc1 | c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 | c1ccc(C2CC(OC3CC[NH+](Cc4cccnc4)CC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C47"
} |
Can you make molecule c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(OOC1CC[NH+](Cc2cccnc2)CC1)Sc1ccccc1 | c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 | S=C(OOC1CC[NH+](Cc2cccnc2)CC1)Sc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C47"
} |
Can you make molecule c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(Nc1ccccc1)SOC1CC[NH+](Cc2cccnc2)CC1 | c1ccc(COC2CC[NH+](Cc3cccnc3)CC2)cc1 | S=C(Nc1ccccc1)SOC1CC[NH+](Cc2cccnc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C47"
} |
Can you make molecule O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | O=C(/C=C/SC1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CCC[C@@H]([NH+]3CCC(CO)CC3)C2)nc1C1CCCC1 | O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | O=Cc1sc(N2CCC[C@@H]([NH+]3CCC(CO)CC3)C2)nc1C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CCC[C@@H]([NH+]3CCC(CO)CC3)C2)sc1C1CCCC1 | O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | O=Cc1nc(N2CCC[C@@H]([NH+]3CCC(CO)CC3)C2)sc1C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/CC1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | O=C(N/N=C/CC1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | OCC1CC[NH+]([C@@H]2CCCN(ON=C3CCN(C4CCCC4)CC3)C2)CC1 | O=C(C1CCCC1)N1CCC[C@@H]([NH+]2CCC(CO)CC2)C1 | OCC1CC[NH+]([C@@H]2CCCN(ON=C3CCN(C4CCCC4)CC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C35"
} |
Can you make molecule COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCCCC3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCCCC3)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCCCCC3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCCCCC3)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCC(C)(C)C3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCC(C)(C)C3)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCC(C)(C)CC3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCC(C)(C)CC3)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CC4(CCCCC4)C3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CCCCC3)c(=O)c2c1C | COC(=O)CNC(=O)c1sc2ncn(CC(=O)N3CC4(CCCCC4)C3)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC2(CCCCC2)C1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1CCS(=O)(=O)[O-] | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1CCS(=O)(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C6(=O)[O-]"
} |
Can you make molecule CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)CO | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)CO | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C6(=O)[O-]"
} |
Can you make molecule CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(O)O | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(O)O | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C6(=O)[O-]"
} |
Can you make molecule CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])c1cc(N)ccc1O[C@H](C)C(=O)NCCC(C)C | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] | CCC(CC)(C(=O)[O-])c1cc(N)ccc1O[C@H](C)C(=O)NCCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C6(=O)[O-]"
} |
Can you make molecule CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1CCCS(=O)(=O)[O-] | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1C(=O)[O-] | CC(C)CCNC(=O)[C@@H](C)Oc1ccc(N)cc1CCCS(=O)(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C6(=O)[O-]"
} |
Can you make molecule CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1ccc(C)c(C)c1O | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1ccc(C)c(C)c1O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&c(O)c1C",
"old_substring": "c17cccc(O)c1"
} |
Can you make molecule CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(C)c1C | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17cccc(O)c1"
} |
Can you make molecule CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(F)c1F | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(F)c1F",
"old_substring": "c17cccc(O)c1"
} |
Can you make molecule CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1ccc(I)cc1 | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17cccc(O)c1"
} |
Can you make molecule CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1ccc(C)cc1C=O | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1cccc(O)c1 | CCN(CC)C(=O)[C@@H]1C[C@@H]([NH3+])CN1C(=O)Cc1ccc(C)cc1C=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&c(C=O)c1",
"old_substring": "c17cccc(O)c1"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)CC(C)(C)N1CCO[C@H](c2ccc(C)o2)C1 | COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 | COc1ccc(F)cc1NC(=O)CC(C)(C)N1CCO[C@H](c2ccc(C)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)CCC(C)(C)N1CCO[C@H](c2ccc(C)o2)C1 | COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 | COc1ccc(F)cc1NC(=O)CCC(C)(C)N1CCO[C@H](c2ccc(C)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)C[C@@H](Br)N1CCO[C@H](c2ccc(C)o2)C1 | COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 | COc1ccc(F)cc1NC(=O)C[C@@H](Br)N1CCO[C@H](c2ccc(C)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1Nc1cc(C)n(N2CCO[C@H](c3ccc(C)o3)C2)c(=O)c1 | COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 | COc1ccc(F)cc1Nc1cc(C)n(N2CCO[C@H](c3ccc(C)o3)C2)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1Nc1c(C)n(N2CCO[C@H](c3ccc(C)o3)C2)ccc1=O | COc1ccc(F)cc1NC(=O)N1CCO[C@H](c2ccc(C)o2)C1 | COc1ccc(F)cc1Nc1c(C)n(N2CCO[C@H](c3ccc(C)o3)C2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3I)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3I)o2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c17ccc(Br)cc1"
} |
Can you make molecule COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3Br)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3Br)o2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c17ccc(Br)cc1"
} |
Can you make molecule COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nnc(SCC(=O)c3cc(Br)ccc3I)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3cc(Br)ccc3I)o2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c17ccc(Br)cc1"
} |
Can you make molecule COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)c(Cl)c3F)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)c(Cl)c3F)o2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(Cl)c1F",
"old_substring": "c17ccc(Br)cc1"
} |
Can you make molecule COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nnc(SCC(=O)c3cc(Br)ccc3Cl)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3ccc(Br)cc3)o2)cc1OC | COc1ccc(-c2nnc(SCC(=O)c3cc(Br)ccc3Cl)o2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c17ccc(Br)cc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.