prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1)C(C)(C)C | CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | CC(=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC=&C(C)(C)C",
"old_substring": "CC=6C"
} |
Can you make molecule CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | CCCC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "CC=6C"
} |
Can you make molecule CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C=CC1=CCCCC1)NCCC1CCN(c2cc[nH+]cc2)CC1 | CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | O=C(C=CC1=CCCCC1)NCCC1CCN(c2cc[nH+]cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCCCC1",
"old_substring": "CC=6C"
} |
Can you make molecule CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | C=CCCC=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC=6C"
} |
Can you make molecule CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C=C/C(Cl)=C\Cl)NCCC1CCN(c2cc[nH+]cc2)CC1 | CC(C)=CC(=O)NCCC1CCN(c2cc[nH+]cc2)CC1 | O=C(C=C/C(Cl)=C\Cl)NCCC1CCN(c2cc[nH+]cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cl/C=C(/Cl)C&",
"old_substring": "CC=6C"
} |
Can you make molecule C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H]1O[C@](C)(Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@](C)(O)[C@@](C)(O)[C@]1(C)O | C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O | COC[C@H]1O[C@](C)(Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@](C)(O)[C@@](C)(O)[C@]1(C)O | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "C6O"
} |
Can you make molecule C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O less soluble in water? The output molecule should be similar to the input molecule. | COCS[C@H]1O[C@](C)(Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@](C)(O)[C@@](C)(O)[C@]1(C)O | C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O | COCS[C@H]1O[C@](C)(Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@](C)(O)[C@@](C)(O)[C@]1(C)O | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "C6O"
} |
Can you make molecule C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O less soluble in water? The output molecule should be similar to the input molecule. | COCO[C@H]1O[C@](C)(Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@](C)(O)[C@@](C)(O)[C@]1(C)O | C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O | COCO[C@H]1O[C@](C)(Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@](C)(O)[C@@](C)(O)[C@]1(C)O | 102 | {
"fragment_index": 0,
"new_substring": "COCO&",
"old_substring": "C6O"
} |
Can you make molecule C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O less soluble in water? The output molecule should be similar to the input molecule. | C=CO[C@H]1O[C@](C)(Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@](C)(O)[C@@](C)(O)[C@]1(C)O | C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O | C=CO[C@H]1O[C@](C)(Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@](C)(O)[C@@](C)(O)[C@]1(C)O | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C6O"
} |
Can you make molecule C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](C2COC2)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O | C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](CO)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O | C[C@]1(Oc2c[nH]c3ccc(Br)c(Cl)c23)O[C@H](C2COC2)[C@@](C)(O)[C@](C)(O)[C@@]1(C)O | 102 | {
"fragment_index": 0,
"new_substring": "C1&COC1",
"old_substring": "C6O"
} |
Can you make molecule O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1nc(-c2ccccc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | O=C(CCCc1nc(-c2ccccc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c17cccnc1"
} |
Can you make molecule O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1nc(-c2ccc(I)nc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | O=C(CCCc1nc(-c2ccc(I)nc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c17cccnc1"
} |
Can you make molecule O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1nc(-c2cc3cnsc3s2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | O=C(CCCc1nc(-c2cc3cnsc3s2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c17cccnc1"
} |
Can you make molecule O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2noc(CCCC(=O)N3CCC[C@@H](Cc4ccccc4)C3)n2)c(C)n1 | O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | Cc1ccc(-c2noc(CCCC(=O)N3CCC[C@@H](Cc4ccccc4)C3)n2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c17cccnc1"
} |
Can you make molecule O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1nc(-c2ccncc2Cl)no1)N1CCC[C@@H](Cc2ccccc2)C1 | O=C(CCCc1nc(-c2cccnc2)no1)N1CCC[C@@H](Cc2ccccc2)C1 | O=C(CCCc1nc(-c2ccncc2Cl)no1)N1CCC[C@@H](Cc2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c17cccnc1"
} |
Can you make molecule Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(NSC(=O)Cc2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | Cn1nc(NSC(=O)Cc2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(NC(=O)CCCC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | Cn1nc(NC(=O)CCCC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(NC(=O)CC(C)(C)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | Cn1nc(NC(=O)CC(C)(C)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(NC(=O)CCC(C)(C)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | Cn1nc(NC(=O)CCC(C)(C)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNc1nn(C)c2c1[C@@H](c1ccccc1)CC(=O)N2)c1cccc(F)c1 | Cn1nc(NC(=O)c2cccc(F)c2)c2c1NC(=O)C[C@@H]2c1ccccc1 | C[C@H](C(=O)SNc1nn(C)c2c1[C@@H](c1ccccc1)CC(=O)N2)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccncc1Cl)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | O=C(CSc1ccncc1Cl)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c17ccncc1"
} |
Can you make molecule O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccccc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | O=C(CSc1ccccc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c17ccncc1"
} |
Can you make molecule O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1cnccc1Cl)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | O=C(CSc1cnccc1Cl)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c17ccncc1"
} |
Can you make molecule O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1cc(Br)ncc1F)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | O=C(CSc1cc(Br)ncc1F)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c17ccncc1"
} |
Can you make molecule O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(SCC(=O)NCCN2Cc3ccccc3O[C@@H](c3ccccc3)C2)ncc1Br | O=C(CSc1ccncc1)NCCN1Cc2ccccc2O[C@@H](c2ccccc2)C1 | Cc1cc(SCC(=O)NCCN2Cc3ccccc3O[C@@H](c3ccccc3)C2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "c17ccncc1"
} |
Can you make molecule N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OCCCCn2cc(Cl)cn2)cc1 | N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 | N#Cc1ccc(OCCCCn2cc(Cl)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C3C5"
} |
Can you make molecule N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OCCCCCn2cc(Cl)cn2)cc1 | N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 | N#Cc1ccc(OCCCCCn2cc(Cl)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C3C5"
} |
Can you make molecule N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OC2CC(n3cc(Cl)cn3)C2)cc1 | N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 | N#Cc1ccc(OC2CC(n3cc(Cl)cn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C3C5"
} |
Can you make molecule N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCn1cc(Cl)cn1)Oc1ccc(C#N)cc1 | N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 | C[C@@H](CCn1cc(Cl)cn1)Oc1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3C5"
} |
Can you make molecule N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OC2CCC(n3cc(Cl)cn3)CC2)cc1 | N#Cc1ccc(OCCn2cc(Cl)cn2)cc1 | N#Cc1ccc(OC2CCC(n3cc(Cl)cn3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C3C5"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)CC(C)(C)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | C[C@@H]1CCN(C(=O)CC(C)(C)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)CCC(C)(C)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | C[C@@H]1CCN(C(=O)CCC(C)(C)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)C[C@@H](Br)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | C[C@@H]1CCN(C(=O)C[C@@H](Br)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CC[C@@H](C)C[C@H]2C)cc(=O)n1Nc1ccc(O[C@@H]2CCOC2)cc1 | C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | Cc1cc(N2CC[C@@H](C)C[C@H]2C)cc(=O)n1Nc1ccc(O[C@@H]2CCOC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N2CC[C@@H](C)C[C@H]2C)c(=O)ccn1Nc1ccc(O[C@@H]2CCOC2)cc1 | C[C@@H]1CCN(C(=O)Nc2ccc(O[C@@H]3CCOC3)cc2)[C@H](C)C1 | Cc1c(N2CC[C@@H](C)C[C@H]2C)c(=O)ccn1Nc1ccc(O[C@@H]2CCOC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[C@H](C)C1(CC)C[NH+](Cc2ncccc2F)C1 | CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F | CC[C@H](C)[C@H](C)C1(CC)C[NH+](Cc2ncccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CC2)C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)CC.C[NH+](C)Cc1ncccc1F | CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F | CCC(C)CC.C[NH+](C)Cc1ncccc1F | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]&(C)C",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC1([C@@H](C)[C@@H](C)CC)C[NH+](Cc2ncccc2F)C1 | CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F | CCCC1([C@@H](C)[C@@H](C)CC)C[NH+](Cc2ncccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCC2)C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)CC.N#[N+]Cc1ncccc1F | CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F | CCC(C)CC.N#[N+]Cc1ncccc1F | 102 | {
"fragment_index": 0,
"new_substring": "[N+]&#N",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)CC.Fc1cccnc1C[NH+]1CCCC1 | CC[C@H](C)[C@H](C)[NH2+]Cc1ncccc1F | CCC(C)CC.Fc1cccnc1C[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1",
"old_substring": "[NH2+]23"
} |
Can you make molecule C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)c1nc2c(s1)CN(C(=O)c1ccc(OC)c(O)c1)C2 | C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 | C#CC(C)(C)c1nc2c(s1)CN(C(=O)c1ccc(OC)c(O)c1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N24"
} |
Can you make molecule C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)c1onc2c1CN(C(=O)c1ccc(OC)c(O)c1)CC2 | C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 | C#CC(C)(C)c1onc2c1CN(C(=O)c1ccc(OC)c(O)c1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N24"
} |
Can you make molecule C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)c1cc2n(n1)CCCN2C(=O)c1ccc(OC)c(O)c1 | C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 | C#CC(C)(C)c1cc2n(n1)CCCN2C(=O)c1ccc(OC)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N24"
} |
Can you make molecule C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)c1ccc2c(c1)CCN2C(=O)c1ccc(OC)c(O)c1 | C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 | C#CC(C)(C)c1ccc2c(c1)CCN2C(=O)c1ccc(OC)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N24"
} |
Can you make molecule C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)c1cc2n(n1)CCN(C(=O)c1ccc(OC)c(O)c1)C2 | C#CC(C)(C)NC(=O)c1ccc(OC)c(O)c1 | C#CC(C)(C)c1cc2n(n1)CCN(C(=O)c1ccc(OC)c(O)c1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCn2nc&cc2C1",
"old_substring": "N24"
} |
Can you make molecule COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | COCc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | COCSc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | CC(=O)Sc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | O=C(CS)c1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | COc1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | O=C(CI)c1cc([N+](=O)[O-])ccc1OCc1nc(-c2cccs2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)C[C@H]2CN(c3nc4ccccc4o3)C[C@@H]2C)CC1 | CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 | CC1CCN(C(=O)C[C@H]2CN(c3nc4ccccc4o3)C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[NH+]16CCC[C@@H]7C1"
} |
Can you make molecule CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)C[C@H]2C=C[C@@H](c3nc4ccccc4o3)C2)CC1 | CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 | CC1CCN(C(=O)C[C@H]2C=C[C@@H](c3nc4ccccc4o3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[NH+]16CCC[C@@H]7C1"
} |
Can you make molecule CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)C[C@@H]2CC[C@@H](c3nc4ccccc4o3)C2)CC1 | CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 | CC1CCN(C(=O)C[C@@H]2CC[C@@H](c3nc4ccccc4o3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[NH+]16CCC[C@@H]7C1"
} |
Can you make molecule CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)C[C@@H]2CN(c3nc4ccccc4o3)C[C@H]2C)CC1 | CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 | CC1CCN(C(=O)C[C@@H]2CN(c3nc4ccccc4o3)C[C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C[C@H]1C",
"old_substring": "[NH+]16CCC[C@@H]7C1"
} |
Can you make molecule CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)C[C@@]2(N)CC[C@H](c3nc4ccccc4o3)C2)CC1 | CC1CCN(C(=O)C[NH+]2CCC[C@@H](c3nc4ccccc4o3)C2)CC1 | CC1CCN(C(=O)C[C@@]2(N)CC[C@H](c3nc4ccccc4o3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@]1&(N)CC[C@H]&C1",
"old_substring": "[NH+]16CCC[C@@H]7C1"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NSC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NSC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NC(=O)CCCC(=O)c2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)CCCC(=O)c2c[nH]c3ccccc23)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C6"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NC(=O)CC(C)(C)c2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)CC(C)(C)c2c[nH]c3ccccc23)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NC[S@+]([O-])CCCc2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC[S@+]([O-])CCCc2c[nH]c3ccccc23)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NC(=O)CCC(C)(C)c2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)Cc2c[nH]c3ccccc23)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)CCC(C)(C)c2c[nH]c3ccccc23)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(CNC(=O)Nc2ccccc2SC(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2SC(F)(F)F)cc1-c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(CNC(=O)Nc2ccccc2CCCC(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2CCCC(F)(F)F)cc1-c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(CNC(=O)Nc2ccccc2CCCCC(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2CCCCC(F)(F)F)cc1-c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)C(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)C(F)(F)F)cc1-c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(CNC(=O)Nc2ccccc2CC(F)(F)C(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2C(F)(F)F)cc1-c1ccncc1 | Cn1nc(CNC(=O)Nc2ccccc2CC(F)(F)C(F)(F)F)cc1-c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC12CC([NH2+]C[C@H](Cc3cscn3)c3cccc(F)c3)=CC=CC=C1C2 | CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 | CC12CC([NH2+]C[C@H](Cc3cscn3)c3cccc(F)c3)=CC=CC=C1C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC2=C(N=C1[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1)S2 | CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 | CC1(C)CCCC2=C(N=C1[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1)S2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC2=CC2=CC=C([NH2+]C[C@H](Cc2cscn2)c2cccc(F)c2)O1 | CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 | CC1(C)CC2=CC2=CC=C([NH2+]C[C@H](Cc2cscn2)c2cccc(F)c2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC2=CC2=CC=C1[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 | CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 | CN1CCC2=CC2=CC=C1[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc([C@H](C[NH2+]CCCCC23CC2C3)Cc2cscn2)c1 | CC[NH2+]C[C@H](Cc1cscn1)c1cccc(F)c1 | Fc1cccc([C@H](C[NH2+]CCCCC23CC2C3)Cc2cscn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nc2)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1",
"old_substring": "c15ccc6nn1"
} |
Can you make molecule CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)n2C)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)n2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&n1C",
"old_substring": "c15ccc6nn1"
} |
Can you make molecule CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nc2C)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c15ccc6nn1"
} |
Can you make molecule CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)N1CCN(c2ccn(-n3ccnc3C)c2)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 | CCCCS(=O)(=O)N1CCN(c2ccn(-n3ccnc3C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c15ccc6nn1"
} |
Can you make molecule CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)N1CCN(c2ccc3nc(-n4ccnc4C)cn3c2)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc(-n3ccnc3C)nn2)CC1 | CCCCS(=O)(=O)N1CCN(c2ccc3nc(-n4ccnc4C)cn3c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nc&cn2c1",
"old_substring": "c15ccc6nn1"
} |
Can you make molecule O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | O=C(/C=C/Sc1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N(C[C@H]2CCCO2)c2nc3c(F)cccc3s2)nc1-c1cc2ccccc2o1 | O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | O=Cc1sc(N(C[C@H]2CCCO2)c2nc3c(F)cccc3s2)nc1-c1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N(C[C@H]2CCCO2)c2nc3c(F)cccc3s2)sc1-c1cc2ccccc2o1 | O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | O=Cc1nc(N(C[C@H]2CCCO2)c2nc3c(F)cccc3s2)sc1-c1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1)n1nc(-c2cc3ccccc3o2)oc1=S | O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | O=C(N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1)n1nc(-c2cc3ccccc3o2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C36"
} |
Can you make molecule O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc2sc(N(C[C@H]3CCCO3)O/N=C/c3ccc(-c4cc5ccccc5o4)o3)nc12 | O=C(c1cc2ccccc2o1)N(C[C@H]1CCCO1)c1nc2c(F)cccc2s1 | Fc1cccc2sc(N(C[C@H]3CCCO3)O/N=C/c3ccc(-c4cc5ccccc5o4)o3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C36"
} |
Can you make molecule C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC#N)Sc1ccccc1NSC(=O)Cc1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NSC(=O)Cc1ccc(Cl)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC#N)Sc1ccccc1NC(=O)CCCC(=O)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NC(=O)CCCC(=O)c1ccc(Cl)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC#N)Sc1ccccc1NC(=O)CC(C)(C)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NC(=O)CC(C)(C)c1ccc(Cl)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC#N)Sc1ccccc1NC(=O)CCC(C)(C)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NC(=O)CCC(C)(C)c1ccc(Cl)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC#N)Sc1ccccc1NSC(=O)[C@@H](C)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NC(=O)c1ccc(Cl)nc1Cl | C[C@H](CC#N)Sc1ccccc1NSC(=O)[C@@H](C)c1ccc(Cl)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C25=O"
} |
Can you make molecule O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1nc2ccccc2s1)N[C@@H]1CC=CO1 | O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O | O=C(CCCc1nc2ccccc2s1)N[C@@H]1CC=CO1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC=CO1",
"old_substring": "[C@H]14CCOC1=O"
} |
Can you make molecule O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1nc2ccccc2s1)N[C@H]1CSCCO1 | O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O | O=C(CCCc1nc2ccccc2s1)N[C@H]1CSCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSCCO1",
"old_substring": "[C@H]14CCOC1=O"
} |
Can you make molecule O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1nc2ccccc2s1)N[C@H]1CC=CS1 | O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O | O=C(CCCc1nc2ccccc2s1)N[C@H]1CC=CS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]14CCOC1=O"
} |
Can you make molecule O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C1C=CO[C@@H](NC(=O)CCCc2nc3ccccc3s2)C1 | O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O | O=C1C=CO[C@@H](NC(=O)CCCc2nc3ccccc3s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(=O)C=CO1",
"old_substring": "[C@H]14CCOC1=O"
} |
Can you make molecule O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCC[C@H](NC(=O)CCCc2nc3ccccc3s2)C1=O | O=C(CCCc1nc2ccccc2s1)N[C@H]1CCOC1=O | CN1CCCC[C@H](NC(=O)CCCc2nc3ccccc3s2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN(C)C1=O",
"old_substring": "[C@H]14CCOC1=O"
} |
Can you make molecule COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccccc1C)NS(=O)(=O)c1cc(C(=O)OC)n(C)c1 | COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C | CC[C@@H](CCc1ccccc1C)NS(=O)(=O)c1cc(C(=O)OC)n(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]47C"
} |
Can you make molecule COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(S(=O)(=O)N[C@@H](CBr)CCc2ccccc2C)cn1C | COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C | COC(=O)c1cc(S(=O)(=O)N[C@@H](CBr)CCc2ccccc2C)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]47C"
} |
Can you make molecule COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(S(=O)(=O)N[C@@H](CBr)CCCc2ccccc2C)cn1C | COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C | COC(=O)c1cc(S(=O)(=O)N[C@@H](CBr)CCCc2ccccc2C)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]47C"
} |
Can you make molecule COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(S(=O)(=O)N[C@H](CCl)CCCc2ccccc2C)cn1C | COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C | COC(=O)c1cc(S(=O)(=O)N[C@H](CCl)CCCc2ccccc2C)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]47C"
} |
Can you make molecule COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(S(=O)(=O)N[C@H]2CCC[C@H](c3ccccc3C)C2)cn1C | COC(=O)c1cc(S(=O)(=O)N[C@H](C)c2ccccc2C)cn1C | COC(=O)c1cc(S(=O)(=O)N[C@H]2CCC[C@H](c3ccccc3C)C2)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]47C"
} |
Can you make molecule Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@H](CC(=O)c1nc([O-])c2ccc(Cl)cc2n1)n1cc(C)cn1 | Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 | CC(=O)[C@@H](CC(=O)c1nc([O-])c2ccc(Cl)cc2n1)n1cc(C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)[C@H]&CC&=O",
"old_substring": "C4C(=O)[C@H]5C#N"
} |
Can you make molecule Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn(C(=O)C[C@H](C)c2nc([O-])c3ccc(Cl)cc3n2)c1 | Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 | Cc1cnn(C(=O)C[C@H](C)c2nc([O-])c3ccc(Cl)cc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C4C(=O)[C@H]5C#N"
} |
Can you make molecule Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn(CCCC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 | Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 | Cc1cnn(CCCC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(=O)[C@H]&C#N",
"old_substring": "C4C(=O)[C@H]5C#N"
} |
Can you make molecule Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn(C(=O)C[C@@H](C)Cc2nc([O-])c3ccc(Cl)cc3n2)c1 | Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 | Cc1cnn(C(=O)C[C@@H](C)Cc2nc([O-])c3ccc(Cl)cc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H](C)C&",
"old_substring": "C4C(=O)[C@H]5C#N"
} |
Can you make molecule Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn(C(=O)C[C@H](c2nc([O-])c3ccc(Cl)cc3n2)C(C)C)c1 | Cc1cnn(CC(=O)[C@@H](C#N)c2nc([O-])c3ccc(Cl)cc3n2)c1 | Cc1cnn(C(=O)C[C@H](c2nc([O-])c3ccc(Cl)cc3n2)C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&C(C)C",
"old_substring": "C4C(=O)[C@H]5C#N"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.