prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2CCCC(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2CCCC(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2CCCCC(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2CCCCC(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2CC(F)(F)C(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2CC(F)(F)C(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)C(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)C(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2CC(F)(F)C(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2C(F)(F)F)CC1 | O=C(Nc1ccccc1)NC1CCN(C(=O)[C@H]2CCCC[C@H]2CC(F)(F)C(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(O)(CCC[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(CCC[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C46"
} |
Can you make molecule CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(O)(CCCC[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(CCCC[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C46"
} |
Can you make molecule CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(O)(CCCCC[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(CCCCC[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C46"
} |
Can you make molecule CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(O)(C2CC([NH2+][C@@H]3CCOC4(CCC4)C3)C2)CC1 | CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(C2CC([NH2+][C@@H]3CCOC4(CCC4)C3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C46"
} |
Can you make molecule CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(O)(SC(=S)O[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(C[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | CC1(C)CCC(O)(SC(=S)O[NH2+][C@@H]2CCOC3(CCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C46"
} |
Can you make molecule [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@H](CCN2C(=O)c3cccc4cccc2c34)CCN1 | [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 | C[C@@H]1C[C@@H](CCN2C(=O)c3cccc4cccc2c34)CCN1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&C[C@H]1C",
"old_substring": "[NH3+][C@H]1CCC[C@H]14"
} |
Can you make molecule [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1NCC[C@@H]1CCN1C(=O)c2cccc3cccc1c23 | [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 | C[C@H]1NCC[C@@H]1CCN1C(=O)c2cccc3cccc1c23 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&[C@H]1C",
"old_substring": "[NH3+][C@H]1CCC[C@H]14"
} |
Can you make molecule [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1NCC[C@@H]1CCN1C(=O)c2cccc3cccc1c23 | [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 | C[C@@H]1NCC[C@@H]1CCN1C(=O)c2cccc3cccc1c23 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&[C@@H]1C",
"old_substring": "[NH3+][C@H]1CCC[C@H]14"
} |
Can you make molecule [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(CCN2C(=O)c3cccc4cccc2c34)C1 | [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 | C[C@H]1CCN(CCN2C(=O)c3cccc4cccc2c34)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C[C@H]1C",
"old_substring": "[NH3+][C@H]1CCC[C@H]14"
} |
Can you make molecule [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(CCN2C(=O)c3cccc4cccc2c34)C1 | [NH3+][C@H]1CCC[C@H]1CCN1C(=O)c2cccc3cccc1c23 | C[C@@H]1CCN(CCN2C(=O)c3cccc4cccc2c34)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[NH3+][C@H]1CCC[C@H]14"
} |
Can you make molecule C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1CCC(Cc2cc(Br)cc(OC)c2O)([C@@H]2CCS(=O)(=O)C2)C1 | C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 | C#CCN1CCC(Cc2cc(Br)cc(OC)c2O)([C@@H]2CCS(=O)(=O)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N345"
} |
Can you make molecule C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1CCCC(Cc2cc(Br)cc(OC)c2O)([C@@H]2CCS(=O)(=O)C2)C1 | C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 | C#CCN1CCCC(Cc2cc(Br)cc(OC)c2O)([C@@H]2CCS(=O)(=O)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N345"
} |
Can you make molecule C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCc1oc(Cc2cc(Br)cc(OC)c2O)c([C@@H]2CCS(=O)(=O)C2)c1C#N | C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 | C#CCc1oc(Cc2cc(Br)cc(OC)c2O)c([C@@H]2CCS(=O)(=O)C2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N345"
} |
Can you make molecule C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1CC(Cc2cc(Br)cc(OC)c2O)([C@@H]2CCS(=O)(=O)C2)CCC1=O | C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 | C#CCN1CC(Cc2cc(Br)cc(OC)c2O)([C@@H]2CCS(=O)(=O)C2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N345"
} |
Can you make molecule C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1CCC[C@@](Cc2cc(Br)cc(OC)c2O)([C@@H]2CCS(=O)(=O)C2)C1 | C#CCN(Cc1cc(Br)cc(OC)c1O)[C@@H]1CCS(=O)(=O)C1 | C#CCN1CCC[C@@](Cc2cc(Br)cc(OC)c2O)([C@@H]2CCS(=O)(=O)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N345"
} |
Can you make molecule Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc3nc(CN4CCN(C)CC4)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4CCN(C)CC4)cc([O-])n3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN(C)CC1",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc3nc(CN4CC(C)C4)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4CC(C)C4)cc([O-])n3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC(C)C1",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc3nc(CN4C[C@@H](C)CC4=O)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4C[C@@H](C)CC4=O)cc([O-])n3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@@H](C)CC1=O",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc3nc(CN4CC[C@H](C)C4)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4CC[C@H](C)C4)cc([O-])n3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H](C)C1",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc3nc(CN4C[C@H](C#N)CC4=O)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4CC[NH+](C)CC4)cc([O-])n3n2)cc1 | Cc1ccc(-c2nc3nc(CN4C[C@H](C#N)CC4=O)cc([O-])n3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H](C#N)CC1=O",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](O)(CNCCC(CO)=C1CCCC1)c1cccs1 | C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 | C[C@@](O)(CNCCC(CO)=C1CCCC1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](O)(CNSC(=O)CC1CCCC1)c1cccs1 | C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 | C[C@@](O)(CNSC(=O)CC1CCCC1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](O)(CN=CC(=O)C=C1CCCC1)c1cccs1 | C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 | C[C@@](O)(CN=CC(=O)C=C1CCCC1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C(=O)C=&",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](O)(CNCC(=C=O)CC1CCCC1)c1cccs1 | C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 | C[C@@](O)(CNCC(=C=O)CC1CCCC1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](O)(CNC(=O)CCCC(=O)C1CCCC1)c1cccs1 | C[C@@](O)(CNC(=O)C1CCCC1)c1cccs1 | C[C@@](O)(CNC(=O)CCCC(=O)C1CCCC1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H](CCCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)N1CCOCC1 | O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 | O[C@H](CCCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "O[C@@H](C4)C5"
} |
Can you make molecule O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N1CCOCC1)N(C)OSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 | C[C@@H](N1CCOCC1)N(C)OSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)N(C)O&",
"old_substring": "O[C@@H](C4)C5"
} |
Can you make molecule O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | BrC[C@@H](CCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)N1CCOCC1 | O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 | BrC[C@@H](CCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "O[C@@H](C4)C5"
} |
Can you make molecule O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N1CCOCC1)C(C)(C)CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 | C[C@@H](N1CCOCC1)C(C)(C)CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "O[C@@H](C4)C5"
} |
Can you make molecule O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | ClC[C@H](CCCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)N1CCOCC1 | O[C@H](CSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CN1CCOCC1 | ClC[C@H](CCCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "O[C@@H](C4)C5"
} |
Can you make molecule C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2Cl)C1 | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccc(I)cc2)C1 | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccc(I)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=S)N/N=C2/CCC[C@@H](C)C2)cc1I | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 | Cc1ccc(CNC(=S)N/N=C2/CCC[C@@H](C)C2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC/C(=N/NC(=S)NCc2cccc(Br)c2)C1 | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 | C[C@@H]1CCC/C(=N/NC(=S)NCc2cccc(Br)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CNC(=S)N/N=C2/CCC[C@@H](C)C2)c1C | C[C@@H]1CCC/C(=N/NC(=S)NCc2ccccc2)C1 | Cc1cccc(CNC(=S)N/N=C2/CCC[C@@H](C)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2ccc(Cl)s2)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2ccc(Cl)s2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c17cccs1"
} |
Can you make molecule O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2ccc(Br)s2)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2ccc(Br)s2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c17cccs1"
} |
Can you make molecule O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2sccc2Br)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2sccc2Br)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c17cccs1"
} |
Can you make molecule O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2csc(I)c2)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2csc(I)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c17cccs1"
} |
Can you make molecule O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cc3c(s2)CSC3)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cccs2)n1 | O=C(c1cc2ccc(Cl)cc2[nH]1)N1CCC[C@@H]1Cn1nnc(-c2cc3c(s2)CSC3)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c17cccs1"
} |
Can you make molecule COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | COCc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | COCSc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(C)=O)ccc1OS(=O)(=O)c1ccc(SC(C)=O)cc1 | COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | COc1cc(C(C)=O)ccc1OS(=O)(=O)c1ccc(SC(C)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(C)=O)ccc1OS(=O)(=O)c1ccc(C(=O)CS)cc1 | COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | COc1cc(C(C)=O)ccc1OS(=O)(=O)c1ccc(C(=O)CS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(C)=O)ccc1OS(=O)(=O)c1ccc(C(=O)CI)cc1 | COc1ccc(S(=O)(=O)Oc2ccc(C(C)=O)cc2OC)cc1 | COc1cc(C(C)=O)ccc1OS(=O)(=O)c1ccc(C(=O)CI)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@H]1CCCC[C@@H]1I | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@H]1CCCC[C@@H]1I | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@@H]1I",
"old_substring": "[C@@H]16CCCC[C@@H]1O"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCS[C@H]1C | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCS[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCS[C@H]1C",
"old_substring": "[C@@H]16CCCC[C@@H]1O"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCSC1 | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCSC1",
"old_substring": "[C@@H]16CCCC[C@@H]1O"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CC12CCC2 | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CC12CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC12CCC2",
"old_substring": "[C@@H]16CCCC[C@@H]1O"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@H]1CCCS[C@@H]1C | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@@H]1CCCC[C@@H]1O | CC(C)c1ccccc1NC(=O)C[NH+](C(C)C)[C@H]1CCCS[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1SCCC[C@@H]1&",
"old_substring": "[C@@H]16CCCC[C@@H]1O"
} |
Can you make molecule O=Cc1ccn(-c2ccc(Br)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccn(-c2ccc(Br)cc2I)c1 | O=Cc1ccn(-c2ccc(Br)cc2)c1 | O=Cc1ccn(-c2ccc(Br)cc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=Cc1ccn(-c2ccc(Br)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccn(-c2ccc(Br)cc2Br)c1 | O=Cc1ccn(-c2ccc(Br)cc2)c1 | O=Cc1ccn(-c2ccc(Br)cc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=Cc1ccn(-c2ccc(Br)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccn(-c2cc(Br)ccc2I)c1 | O=Cc1ccn(-c2ccc(Br)cc2)c1 | O=Cc1ccn(-c2cc(Br)ccc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=Cc1ccn(-c2ccc(Br)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccn(-c2ccc(Br)c(Cl)c2F)c1 | O=Cc1ccn(-c2ccc(Br)cc2)c1 | O=Cc1ccn(-c2ccc(Br)c(Cl)c2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(Cl)c1F",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=Cc1ccn(-c2ccc(Br)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccn(-c2cc(Br)ccc2Cl)c1 | O=Cc1ccn(-c2ccc(Br)cc2)c1 | O=Cc1ccn(-c2cc(Br)ccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | O=C(/C=C/SC1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CCC[C@H](Cn3cc[nH+]c3-c3cc4n(n3)CC[NH2+]C4)C2)nc1C1CC1 | O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | O=Cc1sc(N2CCC[C@H](Cn3cc[nH+]c3-c3cc4n(n3)CC[NH2+]C4)C2)nc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CCC[C@H](Cn3cc[nH+]c3-c3cc4n(n3)CC[NH2+]C4)C2)sc1C1CC1 | O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | O=Cc1nc(N2CCC[C@H](Cn3cc[nH+]c3-c3cc4n(n3)CC[NH2+]C4)C2)sc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/CC1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | O=C(N/N=C/CC1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | c1cn(C[C@H]2CCCN(ON=C3CCN(C4CC4)CC3)C2)c(-c2cc3n(n2)CC[NH2+]C3)[nH+]1 | O=C(C1CC1)N1CCC[C@H](Cn2cc[nH+]c2-c2cc3n(n2)CC[NH2+]C3)C1 | c1cn(C[C@H]2CCCN(ON=C3CCN(C4CC4)CC3)C2)c(-c2cc3n(n2)CC[NH2+]C3)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C45"
} |
Can you make molecule O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCCCC2)C1 | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCCCCC2)C1 | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCCC1",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[NH+]1[C@@H]1CCCN(C(=O)CCNc2ccccc2[N+](=O)[O-])C1 | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 | CC1(C)CCC[NH+]1[C@@H]1CCCN(C(=O)CCNc2ccccc2[N+](=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[NH+]1[C@@H]1CCCN(C(=O)CCNc2ccccc2[N+](=O)[O-])C1 | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 | C[C@@H]1CCCC[NH+]1[C@@H]1CCCN(C(=O)CCNc2ccccc2[N+](=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC[C@H]1C",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC[NH+]([C@@H]2CCCN(C(=O)CCNc3ccccc3[N+](=O)[O-])C2)C1 | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCC[C@@H]([NH+]2CCCC2)C1 | CC1(C)CC[NH+]([C@@H]2CCCN(C(=O)CCNc3ccccc3[N+](=O)[O-])C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)-c1onc(C(=O)C(C)(C)C[C@@H](C)Cl)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)C(C)(C)C[C@@H](C)Cl)c1CO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](Cl)CC&(C)C",
"old_substring": "N14C[C@@H](C)C[C@H](C)C1"
} |
Can you make molecule Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)-c1onc(C(=O)N3CCCC(C)(C)CC3)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)N3CCCC(C)(C)CC3)c1CO2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N14C[C@@H](C)C[C@H](C)C1"
} |
Can you make molecule Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)-c1onc(C(=O)C[C@@H](Br)CCC(C)C)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)C[C@@H](Br)CCC(C)C)c1CO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](Br)CCC(C)C",
"old_substring": "N14C[C@@H](C)C[C@H](C)C1"
} |
Can you make molecule Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)-c1onc(C(=O)C[C@@H](C)C(C)(C)C)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)C[C@@H](C)C(C)(C)C)c1CO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C(C)(C)C",
"old_substring": "N14C[C@@H](C)C[C@H](C)C1"
} |
Can you make molecule Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)-c1onc(C(=O)C(C(C)C)C(C)C)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)N3C[C@@H](C)C[C@H](C)C3)c1CO2 | Cc1ccc2c(c1)-c1onc(C(=O)C(C(C)C)C(C)C)c1CO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "N14C[C@@H](C)C[C@H](C)C1"
} |
Can you make molecule O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COSC(=O)Cc1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | O=C(COSC(=O)Cc1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C39=O"
} |
Can you make molecule O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)CCCC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | O=C(COC(=O)CCCC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C39=O"
} |
Can you make molecule O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)OCC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)c1ccc(Cl)nc1 | O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | CC(C)(CC(=O)OCC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)c1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)OCC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)c1ccc(Cl)nc1 | O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | CC(C)(CCC(=O)OCC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)c1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SOCC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)c1ccc(Cl)nc1 | O=C(COC(=O)c1ccc(Cl)nc1)NC(=O)Nc1ccc2c(c1)OCCO2 | C[C@H](C(=O)SOCC(=O)NC(=O)Nc1ccc2c(c1)OCCO2)c1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C39=O"
} |
Can you make molecule CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | CC(C)CC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1C[C@H]1CCCCBr)C1(c2ccc(F)cc2F)CCOCC1 | CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | O=C(N[C@@H]1C[C@H]1CCCCBr)C1(c2ccc(F)cc2F)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | C=CCCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1C[C@H]1CCCCCl)C1(c2ccc(F)cc2F)CCOCC1 | CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | O=C(N[C@@H]1C[C@H]1CCCCCl)C1(c2ccc(F)cc2F)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | CCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | C=CCCCC[C@@H]1C[C@H]1NC(=O)C1(c2ccc(F)cc2F)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | C=CSOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | C=CCCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)([NH3+])C(=O)NC1CCC(C(=O)OCCCCl)CC1 | CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | CC[C@](C)([NH3+])C(=O)NC1CCC(C(=O)OCCCCl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)([NH3+])C(=O)NC1CCC(C(=O)OCCCCS)CC1 | CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | CC[C@](C)([NH3+])C(=O)NC1CCC(C(=O)OCCCCS)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)([NH3+])C(=O)NC1CCC(C(=O)OCCCBr)CC1 | CCOC(=O)C1CCC(NC(=O)[C@@](C)([NH3+])CC)CC1 | CC[C@](C)([NH3+])C(=O)NC1CCC(C(=O)OCCCBr)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccc(OC)cc1I | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccc(OC)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14ccccc15"
} |
Can you make molecule CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)C(=O)NCc1cccnc1Oc1cc(OC)ccc1Br | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC | CC[C@@H](O)C(=O)NCc1cccnc1Oc1cc(OC)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14ccccc15"
} |
Can you make molecule CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccc(OC)cc1Cl | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccc(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14ccccc15"
} |
Can you make molecule CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)C(=O)NCc1cccnc1Oc1cccc(OC)c1Br | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC | CC[C@@H](O)C(=O)NCc1cccnc1Oc1cccc(OC)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14ccccc15"
} |
Can you make molecule CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)C(=O)NCc1cccnc1Oc1cccc(OC)c1Cl | CC[C@@H](O)C(=O)NCc1cccnc1Oc1ccccc1OC | CC[C@@H](O)C(=O)NCc1cccnc1Oc1cccc(OC)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14ccccc15"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCSc1nnc(-c2cccs2)n1-c1ccccc1)CC(=O)N1CC(=O)Nc2ccccc21 | C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 | C[C@@H](CCSc1nnc(-c2cccs2)n1-c1ccccc1)CC(=O)N1CC(=O)Nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCSc1nnc(-c2cccs2)n1-c1ccccc1)CC(=O)N1CC(=O)Nc2ccccc21 | C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 | C[C@H](CCSc1nnc(-c2cccs2)n1-c1ccccc1)CC(=O)N1CC(=O)Nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN1CC(=O)Nc2ccccc21)Sc1nnc(-c2cccs2)n1-c1ccccc1 | C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 | C[C@@H](CCN1CC(=O)Nc2ccccc21)Sc1nnc(-c2cccs2)n1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)N1CC(=O)Nc2ccccc21)Sc1nnc(-c2cccs2)n1-c1ccccc1 | C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 | C[C@H](CC(C)(C)N1CC(=O)Nc2ccccc21)Sc1nnc(-c2cccs2)n1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(Sc2nnc(-c3cccs3)n2-c2ccccc2)O[C@@H](N2CC(=O)Nc3ccccc32)CS1 | C[C@@H](Sc1nnc(-c2cccs2)n1-c1ccccc1)C(=O)N1CC(=O)Nc2ccccc21 | C[C@@]1(Sc2nnc(-c3cccs3)n2-c2ccccc2)O[C@@H](N2CC(=O)Nc3ccccc32)CS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@]1&O[C@@H]&CS1",
"old_substring": "C[C@@H]4C3=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.