prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCn1c(SCCS(=O)(=O)[O-])nc2ccccc2c1=O | CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O | CCCCCn1c(SCCS(=O)(=O)[O-])nc2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C3C(=O)[O-]"
} |
Can you make molecule CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCn1c(SONC(C)=O)nc2ccccc2c1=O | CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O | CCCCCn1c(SONC(C)=O)nc2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)NO&",
"old_substring": "C3C(=O)[O-]"
} |
Can you make molecule CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCn1c(SCCC(=O)O)nc2ccccc2c1=O | CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O | CCCCCn1c(SCCC(=O)O)nc2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CC(=O)O",
"old_substring": "C3C(=O)[O-]"
} |
Can you make molecule CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCn1c(SC(CC)(CC)C(=O)[O-])nc2ccccc2c1=O | CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O | CCCCCn1c(SC(CC)(CC)C(=O)[O-])nc2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C3C(=O)[O-]"
} |
Can you make molecule CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCn1c(SCCCS(=O)(=O)[O-])nc2ccccc2c1=O | CCCCCn1c(SCC(=O)[O-])nc2ccccc2c1=O | CCCCCn1c(SCCCS(=O)(=O)[O-])nc2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C3C(=O)[O-]"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1.Ic1ccco1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1.Ic1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c1%12ccco1"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1.Cc1ccco1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1.Cc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccoc1C",
"old_substring": "c1%12ccco1"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1.c1cc2ccsc2o1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1.c1cc2ccsc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccoc2s1",
"old_substring": "c1%12ccco1"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1ccco1.Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 | Brc1ccco1.Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c1%12ccco1"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1.Clc1ccco1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nc(-c5ccco5)cs4)cc3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(OCc4nccs4)cc3)sc2c1.Clc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c1%12ccco1"
} |
Can you make molecule COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)cc1I | COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 | COc1ccc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccccc17"
} |
Can you make molecule COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)ccc1Br | COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 | COc1cc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccccc17"
} |
Can you make molecule COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)cc1Cl | COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 | COc1ccc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccccc17"
} |
Can you make molecule COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)c1Br | COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 | COc1cccc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccccc17"
} |
Can you make molecule COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)c1Cl | COc1ccccc1N1CCN(c2ccc(=O)n(CC(=O)NC3CC3)n2)CC1 | COc1cccc(N2CCN(c3ccc(=O)n(CC(=O)NC4CC4)n3)CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccccc17"
} |
Can you make molecule CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)(F)Cl | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)(F)Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&C(F)(F)Cl",
"old_substring": "O3C(F)F"
} |
Can you make molecule CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1C(F)(F)F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "FC&(F)F",
"old_substring": "O3C(F)F"
} |
Can you make molecule CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1SC(F)F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1SC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "O3C(F)F"
} |
Can you make molecule CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1[C@@H](O)CC(F)(F)F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1[C@@H](O)CC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CC(F)(F)F",
"old_substring": "O3C(F)F"
} |
Can you make molecule CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1-c1c(F)cc(C=O)cc1F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1OC(F)F | CC(=CC(=O)N[C@@H](C)c1c(C)noc1C)c1ccccc1-c1c(F)cc(C=O)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1cc(F)c&c(F)c1",
"old_substring": "O3C(F)F"
} |
Can you make molecule COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COCCCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | COCCCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C8"
} |
Can you make molecule COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COCCCCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | COCCCCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C8"
} |
Can you make molecule COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC1CC(n2nc(C)c(NC(=O)N3CC[C@H](Cc4ccccc4)C3)c2C)C1 | COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | COC1CC(n2nc(C)c(NC(=O)N3CC[C@H](Cc4ccccc4)C3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C8"
} |
Can you make molecule COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](C)CCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | CO[C@@H](C)CCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6C8"
} |
Can you make molecule COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC1CCC(n2nc(C)c(NC(=O)N3CC[C@H](Cc4ccccc4)C3)c2C)CC1 | COCCn1nc(C)c(NC(=O)N2CC[C@H](Cc3ccccc3)C2)c1C | COC1CCC(n2nc(C)c(NC(=O)N3CC[C@H](Cc4ccccc4)C3)c2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C6C8"
} |
Can you make molecule Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C[NH+](Cc2nc3ccccc3n2C(C)C)C[C@H](C)O)c1Cl | Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O | Cc1csc(C[NH+](Cc2nc3ccccc3n2C(C)C)C[C@H](C)O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1ccsc17"
} |
Can you make molecule Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+](Cc2nc3ccccc3n2C(C)C)C[C@H](C)O)cc1I | Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O | Cc1ccc(C[NH+](Cc2nc3ccccc3n2C(C)C)C[C@H](C)O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccsc17"
} |
Can you make molecule Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(C[NH+](Cc2nc3ccccc3n2C(C)C)C[C@H](C)O)cc1Br | Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O | Cc1sc(C[NH+](Cc2nc3ccccc3n2C(C)C)C[C@H](C)O)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1sc&cc1Br",
"old_substring": "Cc1ccsc17"
} |
Can you make molecule Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+](Cc2nc3ccccc3n2C(C)C)C[C@H](C)O)cc1Cl | Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O | Cc1ccc(C[NH+](Cc2nc3ccccc3n2C(C)C)C[C@H](C)O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccsc17"
} |
Can you make molecule Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O | Cc1ccsc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O | Cc1cc(I)ccc1C[NH+](Cc1nc2ccccc2n1C(C)C)C[C@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccsc17"
} |
Can you make molecule Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(CCCCNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C57"
} |
Can you make molecule Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCC=NC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(CCC=NC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C57"
} |
Can you make molecule Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCCNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(CCCCCNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C57"
} |
Can you make molecule Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2CC(NC(=O)C[C@H]3Oc4ccc(C)cc4NC3=O)C2)c1 | Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(C2CC(NC(=O)C[C@H]3Oc4ccc(C)cc4NC3=O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C57"
} |
Can you make molecule Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(SC(=S)ONC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(CNC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | Cc1cccc(SC(=S)ONC(=O)C[C@H]2Oc3ccc(C)cc3NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C57"
} |
Can you make molecule C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc([S@+](C)[O-])cc1)c1sc(C(=O)c2cc3cccc(F)c3o2)cc1C#N | C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 | C[C@@H](c1ccc([S@+](C)[O-])cc1)c1sc(C(=O)c2cc3cccc(F)c3o2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N34C"
} |
Can you make molecule C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc([S@+](C)[O-])cc1)c1ccc(C(=O)c2cc3cccc(F)c3o2)cc1C#N | C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 | C[C@@H](c1ccc([S@+](C)[O-])cc1)c1ccc(C(=O)c2cc3cccc(F)c3o2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N34C"
} |
Can you make molecule C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc([S@+](C)[O-])cc1)N1CCC(=NOC(=O)c2cc3cccc(F)c3o2)CC1 | C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 | C[C@@H](c1ccc([S@+](C)[O-])cc1)N1CCC(=NOC(=O)c2cc3cccc(F)c3o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N34C"
} |
Can you make molecule C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc([S@+](C)[O-])cc1)c1cc(C(=O)c2cc3cccc(F)c3o2)cnc1C#N | C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 | C[C@@H](c1ccc([S@+](C)[O-])cc1)c1cc(C(=O)c2cc3cccc(F)c3o2)cnc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N34C"
} |
Can you make molecule C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC1=CCCN(C(=O)c2cc3cccc(F)c3o2)C1)c1ccc([S@+](C)[O-])cc1 | C[C@@H](c1ccc([S@+](C)[O-])cc1)N(C)C(=O)c1cc2cccc(F)c2o1 | C[C@H](CC1=CCCN(C(=O)c2cc3cccc(F)c3o2)C1)c1ccc([S@+](C)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N34C"
} |
Can you make molecule COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)c(C(=O)C(C)C)cc1CSc1nnnn1-c1ccccc1 | COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 | COc1cc(OC)c(C(=O)C(C)C)cc1CSc1nnnn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C5(C)=O"
} |
Can you make molecule COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)c1cc(CSc2nnnn2-c2ccccc2)c(OC)cc1OC | COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 | C=C(C)C(=O)c1cc(CSc2nnnn2-c2ccccc2)c(OC)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C&=O",
"old_substring": "C5(C)=O"
} |
Can you make molecule COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)c(C(=O)CC(C)C)cc1CSc1nnnn1-c1ccccc1 | COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 | COc1cc(OC)c(C(=O)CC(C)C)cc1CSc1nnnn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&=O",
"old_substring": "C5(C)=O"
} |
Can you make molecule COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)c(C(C)C)cc1CSc1nnnn1-c1ccccc1 | COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 | COc1cc(OC)c(C(C)C)cc1CSc1nnnn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "C5(C)=O"
} |
Can you make molecule COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)c(C(=O)CCC(C)C)cc1CSc1nnnn1-c1ccccc1 | COc1cc(OC)c(C(C)=O)cc1CSc1nnnn1-c1ccccc1 | COc1cc(OC)c(C(=O)CCC(C)C)cc1CSc1nnnn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC&=O",
"old_substring": "C5(C)=O"
} |
Can you make molecule Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNC1CC(C)(C)[NH2+]C(C)(C)C1)n1c(C)c(C)sc1=O | Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C | CCC(CC)(C(=O)CNC1CC(C)(C)[NH2+]C(C)(C)C1)n1c(C)c(C)sc1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5CC3=O"
} |
Can you make molecule Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNC1CC(C)(C)[NH2+]C(C)(C)C1)n1c(C)c(C)sc1=O | Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C | CCC(CC)(C(=O)CCNC1CC(C)(C)[NH2+]C(C)(C)C1)n1c(C)c(C)sc1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5CC3=O"
} |
Can you make molecule Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](n1c(C)c(C)sc1=O)[S@+]([O-])CNC1CC(C)(C)[NH2+]C(C)(C)C1 | Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C | CC[C@H](n1c(C)c(C)sc1=O)[S@+]([O-])CNC1CC(C)(C)[NH2+]C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&[S@](=O)C&",
"old_substring": "C5CC3=O"
} |
Can you make molecule Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C(=O)NC1CC(C)(C)[NH2+]C(C)(C)C1)C(=O)n1c(C)c(C)sc1=O | Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C | CCCC[C@@H](C(=O)NC1CC(C)(C)[NH2+]C(C)(C)C1)C(=O)n1c(C)c(C)sc1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H](C&=O)C&=O",
"old_substring": "C5CC3=O"
} |
Can you make molecule Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(=O)n(CCC[S@+]([O-])[C@@H](C)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C | Cc1sc(=O)n(CCC(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C | Cc1sc(=O)n(CCC[S@+]([O-])[C@@H](C)NC2CC(C)(C)[NH2+]C(C)(C)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "C5CC3=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1C(=S)NSC(=O)Cc1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NSC(=O)Cc1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1C(=S)NC(=O)CCCC(=O)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NC(=O)CCCC(=O)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1C(=S)NC(=O)CC(C)(C)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NC(=O)CC(C)(C)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1C(=S)NC(=O)CCC(C)(C)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NC(=O)CCC(C)(C)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1C(=S)NSC(=O)[C@@H](C)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NC(=O)c1ccc(C)cc1 | CC[C@@H]1CCCCN1C(=S)NSC(=O)[C@@H](C)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C23=O"
} |
Can you make molecule CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)C(=O)N[C@@H](CC)CCc1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@@H](CC)CCc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]34C"
} |
Can you make molecule CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)C(=O)N[C@@H](CBr)CCc1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@@H](CBr)CCc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]34C"
} |
Can you make molecule CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)C(=O)N[C@@H](CBr)CCCc1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@@H](CBr)CCCc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]34C"
} |
Can you make molecule CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)C(=O)N[C@H](CCl)CCCc1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@H](CCl)CCCc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]34C"
} |
Can you make molecule CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)C(=O)N[C@H]1CCC[C@H](c2cccc(Br)c2)C1 | CCC[C@H](C)C(=O)N[C@H](C)c1cccc(Br)c1 | CCC[C@H](C)C(=O)N[C@H]1CCC[C@H](c2cccc(Br)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]34C"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2SC(=O)Cc2ccccc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2SC(=O)Cc2ccccc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2C(=O)CCCC(=O)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)CCCC(=O)c2ccccc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2C(=O)CC(C)(C)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)CC(C)(C)c2ccccc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2C(=O)CCC(C)(C)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)CCC(C)(C)c2ccccc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2SC(=O)[C@@H](C)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)c2ccccc2I)c1 | COc1cccc([C@H]2CCCN2SC(=O)[C@@H](C)c2ccccc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1cccc(-n2ccnc2)c1)NC(=O)N1CCCC[C@@H]1C1OCCO1 | C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 | C[C@H](CC(C)(C)c1cccc(-n2ccnc2)c1)NC(=O)N1CCCC[C@@H]1C1OCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]56"
} |
Can you make molecule C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNC(=O)N1CCCC[C@@H]1C1OCCO1)CC(=O)c1cccc(-n2ccnc2)c1 | C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 | C[C@H](CCNC(=O)N1CCCC[C@@H]1C1OCCO1)CC(=O)c1cccc(-n2ccnc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]56"
} |
Can you make molecule C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccc(-n2ccnc2)c1)[C@H](C)NC(=O)N1CCCC[C@@H]1C1OCCO1 | C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 | C[C@H](Cc1cccc(-n2ccnc2)c1)[C@H](C)NC(=O)N1CCCC[C@@H]1C1OCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]56"
} |
Can you make molecule C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)N1CCCC[C@@H]1C1OCCO1)CC(=O)c1cccc(-n2ccnc2)c1 | C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 | C[C@@H](CCNC(=O)N1CCCC[C@@H]1C1OCCO1)CC(=O)c1cccc(-n2ccnc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]56"
} |
Can you make molecule C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1cccc(-n2ccnc2)c1)NC(=O)N1CCCC[C@@H]1C1OCCO1 | C[C@H](NC(=O)N1CCCC[C@@H]1C1OCCO1)c1cccc(-n2ccnc2)c1 | CCC[C@@H](CCc1cccc(-n2ccnc2)c1)NC(=O)N1CCCC[C@@H]1C1OCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]56"
} |
Can you make molecule CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@@H](CCC[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](CCC[NH+]2CCC[C@H](CO)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C35"
} |
Can you make molecule CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@@H](CCCC[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](CCCC[NH+]2CCC[C@H](CO)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@@H](CCCCC[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](CCCCC[NH+]2CCC[C@H](CO)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@@H](C2CC([NH+]3CCC[C@H](CO)C3)C2)C1 | CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](C2CC([NH+]3CCC[C@H](CO)C3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@@H](SC(=S)O[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](C[NH+]2CCC[C@H](CO)C2)C1 | CS(=O)(=O)N1CCC[C@@H](SC(=S)O[NH+]2CCC[C@H](CO)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1([C@H]2CCS(=O)(=O)C2)CCN(C(=O)Cn2nc3n(c2=O)CCCCC3)C1 | CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 | CCC1([C@H]2CCS(=O)(=O)C2)CCN(C(=O)Cn2nc3n(c2=O)CCCCC3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N345"
} |
Can you make molecule CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1([C@H]2CCS(=O)(=O)C2)CCCN(C(=O)Cn2nc3n(c2=O)CCCCC3)C1 | CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 | CCC1([C@H]2CCS(=O)(=O)C2)CCCN(C(=O)Cn2nc3n(c2=O)CCCCC3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N345"
} |
Can you make molecule CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(C(=O)Cn2nc3n(c2=O)CCCCC3)c(C#N)c1[C@H]1CCS(=O)(=O)C1 | CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 | CCc1oc(C(=O)Cn2nc3n(c2=O)CCCCC3)c(C#N)c1[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N345"
} |
Can you make molecule CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1([C@H]2CCS(=O)(=O)C2)CCC(=O)N(C(=O)Cn2nc3n(c2=O)CCCCC3)C1 | CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 | CCC1([C@H]2CCS(=O)(=O)C2)CCC(=O)N(C(=O)Cn2nc3n(c2=O)CCCCC3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N345"
} |
Can you make molecule CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C(=O)Cn2nc3n(c2=O)CCCCC3)c(C#N)c([C@H]2CCS(=O)(=O)C2)n1 | CCN(C(=O)Cn1nc2n(c1=O)CCCCC2)[C@H]1CCS(=O)(=O)C1 | CCc1nc(C(=O)Cn2nc3n(c2=O)CCCCC3)c(C#N)c([C@H]2CCS(=O)(=O)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&nc&nc1&",
"old_substring": "N345"
} |
Can you make molecule COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 | COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 | COCc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@H](CNc2ccccc2C2OCc3ccccc3CO2)C1 | COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 | CS(=O)(=O)N1CCC[C@H](CNc2ccccc2C2OCc3ccccc3CO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@H](CNc2ccccc2C2(O)Cc3ccccc3C2)C1 | COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 | CS(=O)(=O)N1CCC[C@H](CNc2ccccc2C2(O)Cc3ccccc3C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COC(c2ccccc2NC[C@H]2CCCN(S(C)(=O)=O)C2)=CC2=NN2C1 | COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 | C[C@H]1COC(c2ccccc2NC[C@H]2CCCN(S(C)(=O)=O)C2)=CC2=NN2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@H](CNc2ccccc2N2CCOc3ccccc32)C1 | COc1ccccc1NC[C@H]1CCCN(S(C)(=O)=O)C1 | CS(=O)(=O)N1CCC[C@H](CNc2ccccc2N2CCOc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccccc21",
"old_substring": "CO2"
} |
Can you make molecule COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | COCc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | COCSc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | CC(=O)Sc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@@H](c2cc3c(c(C(=O)CS)c2)OCO3)c2cnn(Cc3cccnc3)c2N1 | COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | O=C1C[C@@H](c2cc3c(c(C(=O)CS)c2)OCO3)c2cnn(Cc3cccnc3)c2N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@@H](c2cc3c(c(C(=O)CI)c2)OCO3)c2cnn(Cc3cccnc3)c2N1 | COc1cc([C@@H]2CC(=O)Nc3c2cnn3Cc2cccnc2)cc2c1OCO2 | O=C1C[C@@H](c2cc3c(c(C(=O)CI)c2)OCO3)c2cnn(Cc3cccnc3)c2N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 | O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 | O=C(/C=C/SNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Nc2ccc(F)c(Cl)c2)CCC1=Nc1ccc(Cl)cc1NC(=O)c1ccco1 | O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 | O=C1C(=Nc2ccc(F)c(Cl)c2)CCC1=Nc1ccc(Cl)cc1NC(=O)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cc(Cl)ccc1NN1CCC(=NONc2ccc(F)c(Cl)c2)CC1)c1ccco1 | O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 | O=C(Nc1cc(Cl)ccc1NN1CCC(=NONc2ccc(F)c(Cl)c2)CC1)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCN(Nc2ccc(Cl)cc2NC(=O)c2ccco2)CC1)Nc1ccc(F)c(Cl)c1 | O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 | O=C(NN=C1CCN(Nc2ccc(Cl)cc2NC(=O)c2ccco2)CC1)Nc1ccc(F)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(Nc2ccc(Cl)cc2NC(=O)c2ccco2)CC1)Nc1ccc(F)c(Cl)c1 | O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1ccc(F)c(Cl)c1 | O=C(NN=C1CCC(Nc2ccc(Cl)cc2NC(=O)c2ccco2)CC1)Nc1ccc(F)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C2C4"
} |
Can you make molecule Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1[C@@H](C)NC(=O)CCCC(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)CCCC(=O)Nc1ccc(OCC2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1[C@@H](C)NC(=O)CCC(=O)CNc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)CCC(=O)CNc1ccc(OCC2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1[C@@H](C)NC[S@+]([O-])CCC(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC[S@+]([O-])CCC(=O)Nc1ccc(OCC2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1[C@@H](C)NC(=O)CCCS(=O)(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)CCCS(=O)(=O)Nc1ccc(OCC2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1[C@@H](C)NC(=O)C(C)(F)C(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)C(=O)Nc1ccc(OCC2CCCCC2)cc1 | Cc1nn(C)cc1[C@@H](C)NC(=O)C(C)(F)C(=O)Nc1ccc(OCC2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C3(=O)C4=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.