prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1-c1snc(C(=O)COc2ccc3c(c2)CCC3)c1N | Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 | Cc1cc(F)ccc1-c1snc(C(=O)COc2ccc3c(c2)CCC3)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N36"
} |
Can you make molecule Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1SC(=S)N(C)C(=O)COc1ccc2c(c1)CCC2 | Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 | Cc1cc(F)ccc1SC(=S)N(C)C(=O)COc1ccc2c(c1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N36"
} |
Can you make molecule Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1-c1cc(C(=O)COc2ccc3c(c2)CCC3)oc1N | Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 | Cc1cc(F)ccc1-c1cc(C(=O)COc2ccc3c(c2)CCC3)oc1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N36"
} |
Can you make molecule Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1SC1=NCCN1C(=O)COc1ccc2c(c1)CCC2 | Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 | Cc1cc(F)ccc1SC1=NCCN1C(=O)COc1ccc2c(c1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N36"
} |
Can you make molecule Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1C1CCN(CC(=O)COc2ccc3c(c2)CCC3)CC1 | Cc1cc(F)ccc1NC(=O)COc1ccc2c(c1)CCC2 | Cc1cc(F)ccc1C1CCN(CC(=O)COc2ccc3c(c2)CCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N36"
} |
Can you make molecule C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CC(C)(C)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | C[C@H](NC(=O)CC(C)(C)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CCC(C)(C)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | C[C@H](NC(=O)CCC(C)(C)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N[C@@H](C)c2ccc(Cl)s2)c(=O)n(NCCC[S@+](C)[O-])n1C | C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | Cc1c(N[C@@H](C)c2ccc(Cl)s2)c(=O)n(NCCC[S@+](C)[O-])n1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)c(N[C@@H](C)c2ccc(Cl)s2)nn1NCCC[S@+](C)[O-] | C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | Cc1cc(=O)c(N[C@@H](C)c2ccc(Cl)s2)nn1NCCC[S@+](C)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)C[C@@H](Br)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | C[C@H](NC(=O)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | C[C@H](NC(=O)C[C@@H](Br)NCCC[S@+](C)[O-])c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)c(=O)n(Cc2ccncc2Cl)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2ccncc2Cl)c2ncccc21)NCCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c17ccncc1"
} |
Can you make molecule O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)c(=O)n(Cc2ccccc2)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2ccccc2)c2ncccc21)NCCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c17ccncc1"
} |
Can you make molecule O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)c(=O)n(C=Cc2ccncc2)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(C=Cc2ccncc2)c2ncccc21)NCCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccncc1",
"old_substring": "c17ccncc1"
} |
Can you make molecule O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)c(=O)n(Cc2cnccc2Cl)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2cnccc2Cl)c2ncccc21)NCCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c17ccncc1"
} |
Can you make molecule O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)c(=O)n(Cc2cc(Br)ncc2F)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2ccncc2)c2ncccc21)NCCc1ccccc1 | O=C(Cn1c(=O)c(=O)n(Cc2cc(Br)ncc2F)c2ncccc21)NCCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c17ccncc1"
} |
Can you make molecule CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(CC(=O)SNc2ccc(F)c(F)c2F)cc1 | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 | CS(=O)(=O)c1ccc(CC(=O)SNc2ccc(F)c(F)c2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(C(=O)CCCC(=O)Nc2ccc(F)c(F)c2F)cc1 | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 | CS(=O)(=O)c1ccc(C(=O)CCCC(=O)Nc2ccc(F)c(F)c2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1ccc(F)c(F)c1F)c1ccc(S(C)(=O)=O)cc1 | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 | CC(C)(CC(=O)Nc1ccc(F)c(F)c1F)c1ccc(S(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)Nc1ccc(F)c(F)c1F)c1ccc(S(C)(=O)=O)cc1 | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 | CC(C)(CCC(=O)Nc1ccc(F)c(F)c1F)c1ccc(S(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNc1ccc(F)c(F)c1F)c1ccc(S(C)(=O)=O)cc1 | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 | C[C@H](C(=O)SNc1ccc(F)c(F)c1F)c1ccc(S(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCC(C)(C)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC3"
} |
Can you make molecule CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCCCCC(=O)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC3"
} |
Can you make molecule CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCC[C@@H](C)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&C",
"old_substring": "CCCC3"
} |
Can you make molecule CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCCC[C@@H](C)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "CCCC3"
} |
Can you make molecule CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCCCOc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | CCC(C)(CC)Oc1ccccc1C=C1SC(N2CCC(C)CC2)=NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "CCCC3"
} |
Can you make molecule CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](CNC(=O)CC(C)(C)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | CC(C)[C@@H](CNC(=O)CC(C)(C)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](CNC(=O)CCC(C)(C)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | CC(C)[C@@H](CNC(=O)CCC(C)(C)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](CNC(=O)C[C@@H](Br)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | CC(C)[C@@H](CNC(=O)C[C@@H](Br)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC[C@@H](c2cccnc2)C(C)C)cc(=O)n1N1CCc2ccc(Cl)cc2C1 | CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | Cc1cc(NC[C@@H](c2cccnc2)C(C)C)cc(=O)n1N1CCc2ccc(Cl)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NC[C@@H](c2cccnc2)C(C)C)c(=O)ccn1N1CCc2ccc(Cl)cc2C1 | CC(C)[C@@H](CNC(=O)N1CCc2ccc(Cl)cc2C1)c1cccnc1 | Cc1c(NC[C@@H](c2cccnc2)C(C)C)c(=O)ccn1N1CCc2ccc(Cl)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=S)Sc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCOC(=S)Sc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=N)Cc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCOC(=N)Cc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)CCC(=O)c1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCC(=O)CCC(=O)c1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](O)CCc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCC[C@H](O)CCc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)/C=C/Sc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCOc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | CCCC(=O)/C=C/Sc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1I | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)ccc1Br | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 | CC(=O)Nc1cc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1Cl | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)c1Br | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 | CC(=O)Nc1cccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)c1Cl | CC(=O)Nc1ccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)cc1 | CC(=O)Nc1cccc(NC(=O)c2nnn(-c3ccc(C)c(C)c3)c2C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | C=CSOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | C=CCCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](O)CC[NH+]2CCC(OCCCCl)CC2)cc1F | CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | Cc1ccc([C@H](O)CC[NH+]2CCC(OCCCCl)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](O)CC[NH+]2CCC(OCCCCS)CC2)cc1F | CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | Cc1ccc([C@H](O)CC[NH+]2CCC(OCCCCS)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](O)CC[NH+]2CCC(OCCCBr)CC2)cc1F | CCOC1CC[NH+](CC[C@@H](O)c2ccc(C)c(F)c2)CC1 | Cc1ccc([C@H](O)CC[NH+]2CCC(OCCCBr)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1cnccc1-c1nnc2n1C[C@@H](CI)S2 | IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 | Clc1cnccc1-c1nnc2n1C[C@@H](CI)S2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c14ccncc1"
} |
Can you make molecule IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 less soluble in water? The output molecule should be similar to the input molecule. | IC[C@@H]1Cn2c(nnc2-c2ccccc2)S1 | IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 | IC[C@@H]1Cn2c(nnc2-c2ccccc2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c14ccncc1"
} |
Can you make molecule IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccncc1-c1nnc2n1C[C@@H](CI)S2 | IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 | Clc1ccncc1-c1nnc2n1C[C@@H](CI)S2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c14ccncc1"
} |
Can you make molecule IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cnc(Br)cc1-c1nnc2n1C[C@@H](CI)S2 | IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 | Fc1cnc(Br)cc1-c1nnc2n1C[C@@H](CI)S2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c14ccncc1"
} |
Can you make molecule IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nnc3n2C[C@@H](CI)S3)ncc1Br | IC[C@@H]1Cn2c(nnc2-c2ccncc2)S1 | Cc1cc(-c2nnc3n2C[C@@H](CI)S3)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "c14ccncc1"
} |
Can you make molecule CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1I | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)ccc1Br | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 | CCOc1cc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1Cl | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)c1Br | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 | CCOc1cccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)c1Cl | CCOc1ccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1 | CCOc1cccc([C@H]2CCCN2C(=O)c2[nH]c(C)c(C(C)=O)c2C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CC(C)CONc1ncnc2sc3c(c12)CCC3 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(ONc1ncnc2sc3c(c12)CCC3)C(C)C | CC(C)CONc1ncnc2sc3c(c12)CCC3 | CC(C)C(ONc1ncnc2sc3c(c12)CCC3)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)CONc1ncnc2sc3c(c12)CCC3 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)ONc1ncnc2sc3c(c12)CCC3 | CC(C)CONc1ncnc2sc3c(c12)CCC3 | CC(C)CCCC(=O)ONc1ncnc2sc3c(c12)CCC3 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)CONc1ncnc2sc3c(c12)CCC3 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC#N)CONc1ncnc2sc3c(c12)CCC3 | CC(C)CONc1ncnc2sc3c(c12)CCC3 | CC(C)(CCC#N)CONc1ncnc2sc3c(c12)CCC3 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)CCC#N",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)CONc1ncnc2sc3c(c12)CCC3 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CI)ONc1ncnc2sc3c(c12)CCC3 | CC(C)CONc1ncnc2sc3c(c12)CCC3 | CC(C)[C@H](CI)ONc1ncnc2sc3c(c12)CCC3 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CI",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)CONc1ncnc2sc3c(c12)CCC3 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCBr)ONc1ncnc2sc3c(c12)CCC3 | CC(C)CONc1ncnc2sc3c(c12)CCC3 | CC(C)(CCBr)ONc1ncnc2sc3c(c12)CCC3 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](O)C(=O)ON1C(=O)c2ccccc2C1=O | CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] | CC(C)[C@@H](O)C(=O)ON1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H](O)C&=O",
"old_substring": "CC(C)[C@@H]3C(=O)[O-]"
} |
Can you make molecule CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(N)=O | CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] | CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&C(N)=O",
"old_substring": "CC(C)[C@@H]3C(=O)[O-]"
} |
Can you make molecule CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](O)CC(=O)ON1C(=O)c2ccccc2C1=O | CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] | CC(C)[C@@H](O)CC(=O)ON1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H](O)CC&=O",
"old_substring": "CC(C)[C@@H]3C(=O)[O-]"
} |
Can you make molecule CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CO)ON1C(=O)c2ccccc2C1=O | CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] | CC(C)[C@H](CO)ON1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CO",
"old_substring": "CC(C)[C@@H]3C(=O)[O-]"
} |
Can you make molecule CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)C(=O)ON1C(=O)c2ccccc2C1=O | CC(C)[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)[O-] | CC(C)[C@@H](C)C(=O)ON1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H](C)C&=O",
"old_substring": "CC(C)[C@@H]3C(=O)[O-]"
} |
Can you make molecule COC[C@H](O)C[NH+]1CCC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](S)C[NH+]1CCC(C)(C)C1 | COC[C@H](O)C[NH+]1CCC(C)(C)C1 | COC[C@H](S)C[NH+]1CCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](S)C&",
"old_substring": "C2[C@H](O)C3"
} |
Can you make molecule COC[C@H](O)C[NH+]1CCC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@@H](O)C(C)(C)[NH+]1CCC(C)(C)C1 | COC[C@H](O)C[NH+]1CCC(C)(C)C1 | COC[C@@H](O)C(C)(C)[NH+]1CCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C2[C@H](O)C3"
} |
Can you make molecule COC[C@H](O)C[NH+]1CCC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@@H](C)C(=O)[NH+]1CCC(C)(C)C1 | COC[C@H](O)C[NH+]1CCC(C)(C)C1 | COC[C@@H](C)C(=O)[NH+]1CCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C2[C@H](O)C3"
} |
Can you make molecule COC[C@H](O)C[NH+]1CCC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](O)C[C@H](C)[NH+]1CCC(C)(C)C1 | COC[C@H](O)C[NH+]1CCC(C)(C)C1 | COC[C@H](O)C[C@H](C)[NH+]1CCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](O)C[C@@H]&C",
"old_substring": "C2[C@H](O)C3"
} |
Can you make molecule COC[C@H](O)C[NH+]1CCC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@@H](C)CC(=O)[NH+]1CCC(C)(C)C1 | COC[C@H](O)C[NH+]1CCC(C)(C)C1 | COCC[C@@H](C)CC(=O)[NH+]1CCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C2[C@H](O)C3"
} |
Can you make molecule COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)SN(c1ccccc1Cl)N1CCCSCC1 | COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 | COC(=O)SN(c1ccccc1Cl)N1CCCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)SN&&",
"old_substring": "C2(=O)[C@H]34"
} |
Can you make molecule COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@H](CN1CCCSCC1)C(=O)c1ccccc1Cl | COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 | COCC[C@H](CN1CCCSCC1)C(=O)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@H](C&)C&=O",
"old_substring": "C2(=O)[C@H]34"
} |
Can you make molecule COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1C[C@@H](c2ccccc2Cl)C[C@@H](N2CCCSCC2)C1 | COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 | COC1C[C@@H](c2ccccc2Cl)C[C@@H](N2CCCSCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "C2(=O)[C@H]34"
} |
Can you make molecule COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](CCCN1CCCSCC1)C(C)(C)c1ccccc1Cl | COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 | CO[C@@H](CCCN1CCCSCC1)C(C)(C)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "C2(=O)[C@H]34"
} |
Can you make molecule COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COS(=O)(=O)c1c(N2CCCSCC2)csc1-c1ccccc1Cl | COC(=O)[C@@H](c1ccccc1Cl)N1CCCSCC1 | COS(=O)(=O)c1c(N2CCCSCC2)csc1-c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&(=O)(=O)c1c&csc1&",
"old_substring": "C2(=O)[C@H]34"
} |
Can you make molecule O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc(-c2ccccc2O)[nH]n1)Nc1nc2ccc(F)cc2s1 | O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 | O=C(/C=C/Sc1cc(-c2ccccc2O)[nH]n1)Nc1nc2ccc(F)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2nc3ccc(F)cc3s2)nc1-c1cc(-c2ccccc2O)[nH]n1 | O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 | O=Cc1sc(Nc2nc3ccc(F)cc3s2)nc1-c1cc(-c2ccccc2O)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2nc3ccc(F)cc3s2)sc1-c1cc(-c2ccccc2O)[nH]n1 | O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 | O=Cc1nc(Nc2nc3ccc(F)cc3s2)sc1-c1cc(-c2ccccc2O)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1nc2ccc(F)cc2s1)n1nc(-c2cc(-c3ccccc3O)[nH]n2)oc1=S | O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 | O=C(Nc1nc2ccc(F)cc2s1)n1nc(-c2cc(-c3ccccc3O)[nH]n2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1ccccc1-c1cc(-c2ccc(/C=N/ONc3nc4ccc(F)cc4s3)o2)n[nH]1 | O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2O)[nH]n1 | Oc1ccccc1-c1cc(-c2ccc(/C=N/ONc3nc4ccc(F)cc4s3)o2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)(F)Cl)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)(F)Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(F)(F)Cl",
"old_substring": "O3C(F)F"
} |
Can you make molecule C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(C(F)(F)F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "FC&(F)F",
"old_substring": "O3C(F)F"
} |
Can you make molecule C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(SC(F)F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "O3C(F)F"
} |
Can you make molecule C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc([C@@H](O)CC(F)(F)F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc([C@@H](O)CC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CC(F)(F)F",
"old_substring": "O3C(F)F"
} |
Can you make molecule C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(-c2c(F)cc(C=O)cc2F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(OC(F)F)c1 | C/C(=N\Nc1ncnc2sc(C)c(C)c12)c1cccc(-c2c(F)cc(C=O)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1cc(F)c&c(F)c1",
"old_substring": "O3C(F)F"
} |
Can you make molecule CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1CCO[C@@H](CNSC(=O)C=Cc2ccnc(Cl)c2)C1 | CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 | CC(C)CN1CCO[C@@H](CNSC(=O)C=Cc2ccnc(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C=6"
} |
Can you make molecule CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1CCO[C@@H](CNC(=O)C2=C(N=Cc3ccnc(Cl)c3)CCS2)C1 | CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 | CC(C)CN1CCO[C@@H](CNC(=O)C2=C(N=Cc3ccnc(Cl)c3)CCS2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C3(=O)C=6"
} |
Can you make molecule CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1CCO[C@@H](CNC(=O)C(N=Cc2ccnc(Cl)c2)=C(Cl)Cl)C1 | CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 | CC(C)CN1CCO[C@@H](CNC(=O)C(N=Cc2ccnc(Cl)c2)=C(Cl)Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C3(=O)C=6"
} |
Can you make molecule CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1CCO[C@@H](CNC(=O)C(C=Cc2ccnc(Cl)c2)=C(Cl)Cl)C1 | CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 | CC(C)CN1CCO[C@@H](CNC(=O)C(C=Cc2ccnc(Cl)c2)=C(Cl)Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C3(=O)C=6"
} |
Can you make molecule CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1CCO[C@@H](CNC[S@+]([O-])CCC=Cc2ccnc(Cl)c2)C1 | CC(C)CN1CCO[C@@H](CNC(=O)C=Cc2ccnc(Cl)c2)C1 | CC(C)CN1CCO[C@@H](CNC[S@+]([O-])CCC=Cc2ccnc(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C=6"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCCCNC(=O)Cc1c[nH]c2c(C)cccc12 | Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 | Cc1cc(F)ccc1CCCCNC(=O)Cc1c[nH]c2c(C)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C4"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCCCCNC(=O)Cc1c[nH]c2c(C)cccc12 | Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 | Cc1cc(F)ccc1CCCCCNC(=O)Cc1c[nH]c2c(C)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C4"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1C1CC(NC(=O)Cc2c[nH]c3c(C)cccc23)C1 | Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 | Cc1cc(F)ccc1C1CC(NC(=O)Cc2c[nH]c3c(C)cccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C4"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1C1CCN(NC(=O)Cc2c[nH]c3c(C)cccc23)CC1 | Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 | Cc1cc(F)ccc1C1CCN(NC(=O)Cc2c[nH]c3c(C)cccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C5C4"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1[C@@H](C)CCNC(=O)Cc1c[nH]c2c(C)cccc12 | Cc1cc(F)ccc1CCNC(=O)Cc1c[nH]c2c(C)cccc12 | Cc1cc(F)ccc1[C@@H](C)CCNC(=O)Cc1c[nH]c2c(C)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C5C4"
} |
Can you make molecule NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H]1CCCN(SC(=O)Cn2nc(-c3cccs3)oc2=O)C1 | NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 | NC(=O)[C@@H]1CCCN(SC(=O)Cn2nc(-c3cccs3)oc2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H]1CCCN(C(=O)CCCC(=O)n2nc(-c3cccs3)oc2=O)C1 | NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 | NC(=O)[C@@H]1CCCN(C(=O)CCCC(=O)n2nc(-c3cccs3)oc2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C6"
} |
Can you make molecule NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)N1CCC[C@@H](C(N)=O)C1)n1nc(-c2cccs2)oc1=O | NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 | CC(C)(CC(=O)N1CCC[C@@H](C(N)=O)C1)n1nc(-c2cccs2)oc1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H]1CCCN(C[S@+]([O-])CCCn2nc(-c3cccs3)oc2=O)C1 | NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 | NC(=O)[C@@H]1CCCN(C[S@+]([O-])CCCn2nc(-c3cccs3)oc2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)N1CCC[C@@H](C(N)=O)C1)n1nc(-c2cccs2)oc1=O | NC(=O)[C@@H]1CCCN(C(=O)Cn2nc(-c3cccs3)oc2=O)C1 | CC(C)(CCC(=O)N1CCC[C@@H](C(N)=O)C1)n1nc(-c2cccs2)oc1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C6"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.