prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[S@+]([O-])CCNSC(=O)Cc1cccc(F)c1Cl | CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl | CC(C)(C)[S@+]([O-])CCNSC(=O)Cc1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[S@+]([O-])CCNC(=O)CCCC(=O)c1cccc(F)c1Cl | CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl | CC(C)(C)[S@+]([O-])CCNC(=O)CCCC(=O)c1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)NCC[S@@+]([O-])C(C)(C)C)c1cccc(F)c1Cl | CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl | CC(C)(CC(=O)NCC[S@@+]([O-])C(C)(C)C)c1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)NCC[S@@+]([O-])C(C)(C)C)c1cccc(F)c1Cl | CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl | CC(C)(CCC(=O)NCC[S@@+]([O-])C(C)(C)C)c1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNCC[S@@+]([O-])C(C)(C)C)c1cccc(F)c1Cl | CC(C)(C)[S@+]([O-])CCNC(=O)c1cccc(F)c1Cl | C[C@H](C(=O)SNCC[S@@+]([O-])C(C)(C)C)c1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccc(F)cc1OCc1nc(C(C)(C)C)cs1)N=O | C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@H](Cc1ccc(F)cc1OCc1nc(C(C)(C)C)cs1)N=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&)N=O",
"old_substring": "C[C@H]6O"
} |
Can you make molecule C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Br)C(=O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@H](Br)C(=O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](Br)C&=O",
"old_substring": "C[C@H]6O"
} |
Can you make molecule C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C#N)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@@H](C#N)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C#N",
"old_substring": "C[C@H]6O"
} |
Can you make molecule C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](O)CCCCc1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@@H](O)CCCCc1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](O)CCCC&",
"old_substring": "C[C@H]6O"
} |
Can you make molecule C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCOCCN1Cc1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@@H](O)c1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | C[C@H]1CCOCCN1Cc1ccc(F)cc1OCc1nc(C(C)(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCOCCN1C&",
"old_substring": "C[C@H]6O"
} |
Can you make molecule COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NC(=O)Nc1cc[nH]c1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1cc[nH]c1)c1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc[nH]c1",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NC(=O)Nc1nc(I)c(I)[nH]1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1nc(I)c(I)[nH]1)c1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Ic1nc&[nH]c1I",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NC(=O)Nc1cn[nH]c(=O)c1Cl)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1cn[nH]c(=O)c1Cl)c1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn[nH]c(=O)c1Cl",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NC(=O)Nc1ccc2[nH]ncc2c1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1ccc2[nH]ncc2c1)c1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2[nH]ncc2c1",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NC(=O)Nc1nc2ccccc2[nH]1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1cn[nH]c1)c1ccc(F)c(F)c1 | COC[C@H](NC(=O)Nc1nc2ccccc2[nH]1)c1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1ccc2[nH]c&nc2c1",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3SC(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3SC(F)(F)F)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3CCCC(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3CCCC(F)(F)F)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3CCCCC(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3CCCCC(F)(F)F)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)C(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)C(F)(F)F)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3CC(F)(F)C(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3C(F)(F)F)cc2)C1=O | C[C@@H]1CS(=O)(=O)N(c2ccc(S(=O)(=O)Nc3ccccc3CC(F)(F)C(F)(F)F)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)[C@@]2(CC(O)=Nc3c2cnn3Cc2ccccc2Cl)c2cc(CCCCBr)ccc21 | CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C | CN1C(=O)[C@@]2(CC(O)=Nc3c2cnn3Cc2ccccc2Cl)c2cc(CCCCBr)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C | CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C | C=CCCCCc1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)[C@@]2(CC(O)=Nc3c2cnn3Cc2ccccc2Cl)c2cc(CCCCCBr)ccc21 | CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C | CN1C(=O)[C@@]2(CC(O)=Nc3c2cnn3Cc2ccccc2Cl)c2cc(CCCCCBr)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)[C@@]2(CC(O)=Nc3c2cnn3Cc2ccccc2Cl)c2cc(CCCCCS)ccc21 | CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C | CN1C(=O)[C@@]2(CC(O)=Nc3c2cnn3Cc2ccccc2Cl)c2cc(CCCCCS)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)[C@@]2(CC(O)=Nc3c2cnn3Cc2ccccc2Cl)c2cc(CCCCCCS)ccc21 | CC(C)c1ccc2c(c1)[C@]1(CC(O)=Nc3c1cnn3Cc1ccccc1Cl)C(=O)N2C | CN1C(=O)[C@@]2(CC(O)=Nc3c2cnn3Cc2ccccc2Cl)c2cc(CCCCCCS)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)NCC(=O)c1nc(C#N)c([C@@H](C)c2cc(F)ccc2F)o1 | CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F | CC[C@@H](C)C(=O)NCC(=O)c1nc(C#N)c([C@@H](C)c2cc(F)ccc2F)o1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N35C"
} |
Can you make molecule CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)NCC(=O)c1cc(C#N)c([C@@H](C)c2cc(F)ccc2F)s1 | CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F | CC[C@@H](C)C(=O)NCC(=O)c1cc(C#N)c([C@@H](C)c2cc(F)ccc2F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N35C"
} |
Can you make molecule CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)NCC(=O)c1ccc([C@@H](C)c2cc(F)ccc2F)c(C#N)c1 | CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F | CC[C@@H](C)C(=O)NCC(=O)c1ccc([C@@H](C)c2cc(F)ccc2F)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N35C"
} |
Can you make molecule CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)NCC(=O)ON=C1CCN([C@@H](C)c2cc(F)ccc2F)CC1 | CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F | CC[C@@H](C)C(=O)NCC(=O)ON=C1CCN([C@@H](C)c2cc(F)ccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N35C"
} |
Can you make molecule CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)NCC(=O)c1cnc(C#N)c([C@@H](C)c2cc(F)ccc2F)c1 | CC[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](C)c1cc(F)ccc1F | CC[C@@H](C)C(=O)NCC(=O)c1cnc(C#N)c([C@@H](C)c2cc(F)ccc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N35C"
} |
Can you make molecule CO/N=C\C(C#N)=Cc1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CO/N=C\C(C#N)=Cc1ccccc1 | CO/N=C\C(C#N)=Cc1cccnc1 | CO/N=C\C(C#N)=Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1",
"old_substring": "C=2c1cccnc1"
} |
Can you make molecule CO/N=C\C(C#N)=Cc1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CO/N=C\C(C#N)=Cc1ccc(Cl)nc1 | CO/N=C\C(C#N)=Cc1cccnc1 | CO/N=C\C(C#N)=Cc1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(Cl)nc1",
"old_substring": "C=2c1cccnc1"
} |
Can you make molecule CO/N=C\C(C#N)=Cc1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CO/N=C\C(C#N)=Cc1ccccc1I | CO/N=C\C(C#N)=Cc1cccnc1 | CO/N=C\C(C#N)=Cc1ccccc1I | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1I",
"old_substring": "C=2c1cccnc1"
} |
Can you make molecule CO/N=C\C(C#N)=Cc1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CO/N=C\C(C#N)=Cc1ccccc1F | CO/N=C\C(C#N)=Cc1cccnc1 | CO/N=C\C(C#N)=Cc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1F",
"old_substring": "C=2c1cccnc1"
} |
Can you make molecule CO/N=C\C(C#N)=Cc1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CO/N=C\C(C#N)=Cc1ccsc1 | CO/N=C\C(C#N)=Cc1cccnc1 | CO/N=C\C(C#N)=Cc1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccsc1",
"old_substring": "C=2c1cccnc1"
} |
Can you make molecule CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccc(C)c(Cl)c1 | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccc(C)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "c16ccccc1C"
} |
Can you make molecule CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccc(Br)cc1C | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccc(Br)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C",
"old_substring": "c16ccccc1C"
} |
Can you make molecule CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1cccc(Br)c1C | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1cccc(Br)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c16ccccc1C"
} |
Can you make molecule CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccc(F)cc1Cl | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccc(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c16ccccc1C"
} |
Can you make molecule CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1cc(F)ccc1Cl | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1ccccc1C | CO[C@H](c1ccc(Cl)cc1)[C@@H](C)NC(=O)C(=O)Nc1cc(F)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Cl",
"old_substring": "c16ccccc1C"
} |
Can you make molecule CC(C)CNC(=O)[C@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC=NC(=O)[C@](C)(N)C(F)(F)F | CC(C)CNC(=O)[C@](C)(N)C(F)(F)F | CC(C)CC=NC(=O)[C@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC=&",
"old_substring": "CC(C)C2"
} |
Can you make molecule CC(C)CNC(=O)[C@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C=NC(=O)[C@](C)(N)C(F)(F)F | CC(C)CNC(=O)[C@](C)(N)C(F)(F)F | CC(C)(C)C=NC(=O)[C@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C=&",
"old_substring": "CC(C)C2"
} |
Can you make molecule CC(C)CNC(=O)[C@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(CCl)=NC(=O)[C@](C)(N)C(F)(F)F | CC(C)CNC(=O)[C@](C)(N)C(F)(F)F | CC(C)C(CCl)=NC(=O)[C@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C=&CCl",
"old_substring": "CC(C)C2"
} |
Can you make molecule CC(C)CNC(=O)[C@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(CBr)=NC(=O)[C@](C)(N)C(F)(F)F | CC(C)CNC(=O)[C@](C)(N)C(F)(F)F | CC(C)C(CBr)=NC(=O)[C@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C=&CBr",
"old_substring": "CC(C)C2"
} |
Can you make molecule CC(C)CNC(=O)[C@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(NC(=O)[C@](C)(N)C(F)(F)F)C(C)C | CC(C)CNC(=O)[C@](C)(N)C(F)(F)F | CC(C)C(NC(=O)[C@](C)(N)C(F)(F)F)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC(C)C2"
} |
Can you make molecule C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1OCC[C@@H]1[C@@H](C)C(=O)C1=c2ccccc2=[NH+]C1 | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 | C[C@@H]1OCC[C@@H]1[C@@H](C)C(=O)C1=c2ccccc2=[NH+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCO[C@H]1C",
"old_substring": "[NH+]13CCC[C@@H]1[C@@H]1CC=CS1"
} |
Can you make molecule C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[C@@H]1CCN(C)[C@@H](C)C1 | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[C@@H]1CCN(C)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1C[C@H]&CCN1C",
"old_substring": "[NH+]13CCC[C@@H]1[C@@H]1CC=CS1"
} |
Can you make molecule C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@@H](C)CCN1[C@@H](C)C(=O)C1=c2ccccc2=[NH+]C1 | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 | C[C@@H]1[C@@H](C)CCN1[C@@H](C)C(=O)C1=c2ccccc2=[NH+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&[C@@H]1C",
"old_substring": "[NH+]13CCC[C@@H]1[C@@H]1CC=CS1"
} |
Can you make molecule C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[C@@H]1CCCC[C@H]1N | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[C@@H]1CCCC[C@H]1N | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]1CCCC[C@H]1&",
"old_substring": "[NH+]13CCC[C@@H]1[C@@H]1CC=CS1"
} |
Can you make molecule C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)N1CCOCC12CCCC2 | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)[NH+]1CCC[C@@H]1[C@@H]1CC=CS1 | C[C@@H](C(=O)C1=c2ccccc2=[NH+]C1)N1CCOCC12CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOCC12CCCC2",
"old_substring": "[NH+]13CCC[C@@H]1[C@@H]1CC=CS1"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1-c1nc2c(s1)CN(C(=O)NCc1cnn(C)c1)C2 | Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 | Cc1nc(Br)ccc1-c1nc2c(s1)CN(C(=O)NCc1cnn(C)c1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N25"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1-c1ccc2c(c1)CCN2C(=O)NCc1cnn(C)c1 | Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 | Cc1nc(Br)ccc1-c1ccc2c(c1)CCN2C(=O)NCc1cnn(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N25"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1-c1snc2sc(C(=O)NCc3cnn(C)c3)c(N)c12 | Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 | Cc1nc(Br)ccc1-c1snc2sc(C(=O)NCc3cnn(C)c3)c(N)c12 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N25"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1-c1ccc2c(c1)N(C(=O)NCc1cnn(C)c1)CCS2 | Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 | Cc1nc(Br)ccc1-c1ccc2c(c1)N(C(=O)NCc1cnn(C)c1)CCS2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "N25"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1-c1cc2n(n1)CCCN(C(=O)NCc1cnn(C)c1)C2 | Cc1nc(Br)ccc1NC(=O)NCc1cnn(C)c1 | Cc1nc(Br)ccc1-c1cc2n(n1)CCCN(C(=O)NCc1cnn(C)c1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc2C1",
"old_substring": "N25"
} |
Can you make molecule COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cnc(CNC(=O)Nc2ccc(C(C)C)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(C(C)C)cc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "N8(C)C"
} |
Can you make molecule COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cnc(CNC(=O)Nc2ccc(CC(=N)S)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(CC(=N)S)cc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N=C(S)C&",
"old_substring": "N8(C)C"
} |
Can you make molecule COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C3=CCCC3)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C3=CCCC3)cc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N&(C)C1=CCCC1",
"old_substring": "N8(C)C"
} |
Can you make molecule COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cnc(CNC(=O)Nc2ccc(C(F)(F)C#N)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(C(F)(F)C#N)cc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N8(C)C"
} |
Can you make molecule COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cnc(CNC(=O)Nc2ccc(N3CCC(C)CC3)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(N(C)C)cc2)c1C | COc1c(C)cnc(CNC(=O)Nc2ccc(N3CCC(C)CC3)cc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N8(C)C"
} |
Can you make molecule COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2cc(COC(=O)COc3cc(Br)ccc3C#N)ccc2c1 | COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 | COc1ccc2cc(COC(=O)COc3cc(Br)ccc3C#N)ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1C#N",
"old_substring": "c18ccccc1C#N"
} |
Can you make molecule COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2cc(COC(=O)COc3ccc(Br)cc3C#N)ccc2c1 | COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 | COc1ccc2cc(COC(=O)COc3ccc(Br)cc3C#N)ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C#N",
"old_substring": "c18ccccc1C#N"
} |
Can you make molecule COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2cc(COC(=O)COc3ccccc3Cl)ccc2c1 | COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 | COc1ccc2cc(COC(=O)COc3ccccc3Cl)ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1C#N"
} |
Can you make molecule COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2cc(COC(=O)COc3ccc4ccccc4c3C#N)ccc2c1 | COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 | COc1ccc2cc(COC(=O)COc3ccc4ccccc4c3C#N)ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccccc2c1C#N",
"old_substring": "c18ccccc1C#N"
} |
Can you make molecule COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2cc(COC(=O)COc3cc(F)ccc3C)ccc2c1 | COc1ccc2cc(COC(=O)COc3ccccc3C#N)ccc2c1 | COc1ccc2cc(COC(=O)COc3cc(F)ccc3C)ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1C",
"old_substring": "c18ccccc1C#N"
} |
Can you make molecule CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CC[C@H](N)CCCc1c[nH]nc1-c1ccc(C)cc1 | CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 | CCS(=O)(=O)CC[C@H](N)CCCc1c[nH]nc1-c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N23C"
} |
Can you make molecule CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCC/N=C(\N)SCc1c[nH]nc1-c1ccc(C)cc1 | CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 | CCS(=O)(=O)CCC/N=C(\N)SCc1c[nH]nc1-c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N/C(=N\\C&)S&",
"old_substring": "N23C"
} |
Can you make molecule CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCc1cc(C#N)c(Cc2c[nH]nc2-c2ccc(C)cc2)s1 | CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 | CCS(=O)(=O)CCc1cc(C#N)c(Cc2c[nH]nc2-c2ccc(C)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N23C"
} |
Can you make molecule CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCc1ccc(Cc2c[nH]nc2-c2ccc(C)cc2)c(C#N)c1 | CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 | CCS(=O)(=O)CCc1ccc(Cc2c[nH]nc2-c2ccc(C)cc2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N23C"
} |
Can you make molecule CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCON=C1CCN(Cc2c[nH]nc2-c2ccc(C)cc2)CC1 | CCS(=O)(=O)CCN(C)Cc1c[nH]nc1-c1ccc(C)cc1 | CCS(=O)(=O)CCON=C1CCN(Cc2c[nH]nc2-c2ccc(C)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N23C"
} |
Can you make molecule COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cn1cc[nH+]c1N1C[C@@H]2C[C@@H]1c1ccc2cc1 | COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 | CO.Cn1cc[nH+]c1N1C[C@@H]2C[C@@H]1c1ccc2cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&N&C1",
"old_substring": "[C@@]5(C)([NH3+])C4"
} |
Can you make molecule COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cn1cc[nH+]c1N1C[C@@H]2C[C@H]1c1ccc2cc1 | COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 | CO.Cn1cc[nH+]c1N1C[C@@H]2C[C@H]1c1ccc2cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@@H]&N&C1",
"old_substring": "[C@@]5(C)([NH3+])C4"
} |
Can you make molecule COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cn1cc[nH+]c1N1[C@@H]2CS[C@H]1c1ccc2cc1 | COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 | CO.Cn1cc[nH+]c1N1[C@@H]2CS[C@H]1c1ccc2cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CS[C@@H]&N1&",
"old_substring": "[C@@]5(C)([NH3+])C4"
} |
Can you make molecule COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cn1cc[nH+]c1N1[C@@H]2SC[C@H]1c1ccc2cc1 | COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 | CO.Cn1cc[nH+]c1N1[C@@H]2SC[C@H]1c1ccc2cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&SC[C@@H]&N1&",
"old_substring": "[C@@]5(C)([NH3+])C4"
} |
Can you make molecule COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cn1cc[nH+]c1N1C[C@@H]2C[C@@H](C1)c1ccc2cc1 | COc1ccc([C@@](C)([NH3+])Cc2[nH+]ccn2C)cc1 | CO.Cn1cc[nH+]c1N1C[C@@H]2C[C@@H](C1)c1ccc2cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&CN&C1",
"old_substring": "[C@@]5(C)([NH3+])C4"
} |
Can you make molecule C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)NCCCCc2nnc3n2CCCCC3)[C@@H](C)C1 | C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 | C[C@H]1CCN(C(=O)NCCCCc2nnc3n2CCCCC3)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C7"
} |
Can you make molecule C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)N=CCCc2nnc3n2CCCCC3)[C@@H](C)C1 | C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 | C[C@H]1CCN(C(=O)N=CCCc2nnc3n2CCCCC3)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C6C7"
} |
Can you make molecule C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)NCCCCCc2nnc3n2CCCCC3)[C@@H](C)C1 | C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 | C[C@H]1CCN(C(=O)NCCCCCc2nnc3n2CCCCC3)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C7"
} |
Can you make molecule C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)NC2CC(c3nnc4n3CCCCC4)C2)[C@@H](C)C1 | C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 | C[C@H]1CCN(C(=O)NC2CC(c3nnc4n3CCCCC4)C2)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C7"
} |
Can you make molecule C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1nnc2n1CCCCC2)=NC(=O)N1CC[C@H](C)C[C@@H]1C | C[C@H]1CCN(C(=O)NCCc2nnc3n2CCCCC3)[C@@H](C)C1 | CC(CCc1nnc2n1CCCCC2)=NC(=O)N1CC[C@H](C)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C6C7"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+](Cc2ccc(I)cc2F)C1)c1nc[nH]n1 | O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 | O=C(NC[C@@H]1CCC[NH+](Cc2ccc(I)cc2F)C1)c1nc[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+](Cc2cc(I)ccc2F)C1)c1nc[nH]n1 | O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 | O=C(NC[C@@H]1CCC[NH+](Cc2cc(I)ccc2F)C1)c1nc[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2Cl)C1)c1nc[nH]n1 | O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 | O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2Cl)C1)c1nc[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1F"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=C[NH+]1CCC[C@@H](CNC(=O)c2nc[nH]n2)C1)c1ccccc1F | O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 | CC(=C[NH+]1CCC[C@@H](CNC(=O)c2nc[nH]n2)C1)c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1ccccc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+](Cc2cc(F)ccc2Br)C1)c1nc[nH]n1 | O=C(NC[C@@H]1CCC[NH+](Cc2ccccc2F)C1)c1nc[nH]n1 | O=C(NC[C@@H]1CCC[NH+](Cc2cc(F)ccc2Br)C1)c1nc[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c18ccccc1F"
} |
Can you make molecule O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CC[C@@H](SCNC(=O)COc2ccc(Cl)c(Cl)c2)CN1 | O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 | O=C1CC[C@@H](SCNC(=O)COc2ccc(Cl)c(Cl)c2)CN1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N36"
} |
Can you make molecule O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CC[C@@H](C2CN(C(=O)COc3ccc(Cl)c(Cl)c3)C2)CN1 | O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 | O=C1CC[C@@H](C2CN(C(=O)COc3ccc(Cl)c(Cl)c3)C2)CN1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N36"
} |
Can you make molecule O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(NC(=O)COc1ccc(Cl)c(Cl)c1)S[C@@H]1CCC(=O)NC1 | O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 | N=C(NC(=O)COc1ccc(Cl)c(Cl)c1)S[C@@H]1CCC(=O)NC1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N36"
} |
Can you make molecule O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)COc2ccc(Cl)c(Cl)c2)nsc1[C@@H]1CCC(=O)NC1 | O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 | Nc1c(C(=O)COc2ccc(Cl)c(Cl)c2)nsc1[C@@H]1CCC(=O)NC1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N36"
} |
Can you make molecule O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)COc1ccc(Cl)c(Cl)c1)C(=S)S[C@@H]1CCC(=O)NC1 | O=C1CC[C@@H](NC(=O)COc2ccc(Cl)c(Cl)c2)CN1 | CN(C(=O)COc1ccc(Cl)c(Cl)c1)C(=S)S[C@@H]1CCC(=O)NC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N36"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCCCOc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1CCCCOc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C38"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCCCCOc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1CCCCCOc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C38"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1C1CC(Oc2ccc(C[NH2+]C[C@H]3CCCO3)cc2)C1 | Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1C1CC(Oc2ccc(C[NH2+]C[C@H]3CCCO3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C38"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1SC(=S)OOc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1SC(=S)OOc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C38"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1NC(=S)SOc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1COc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | Cc1noc(C)c1NC(=S)SOc1ccc(C[NH2+]C[C@H]2CCCO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C38"
} |
Can you make molecule N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cnn2c1N[C@@H](c1ccccc1Cl)C[C@@H]2C(F)F | N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F | N#Cc1cnn2c1N[C@@H](c1ccccc1Cl)C[C@@H]2C(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c13ccccc1"
} |
Can you make molecule N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cnn2c1N[C@@H](c1ccc(I)cc1)C[C@@H]2C(F)F | N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F | N#Cc1cnn2c1N[C@@H](c1ccc(I)cc1)C[C@@H]2C(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c13ccccc1"
} |
Can you make molecule N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@H](C(F)F)n3ncc(C#N)c3N2)cc1I | N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F | Cc1ccc([C@H]2C[C@H](C(F)F)n3ncc(C#N)c3N2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c13ccccc1"
} |
Can you make molecule N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cnn2c1N[C@@H](c1cccc(Br)c1)C[C@@H]2C(F)F | N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F | N#Cc1cnn2c1N[C@@H](c1cccc(Br)c1)C[C@@H]2C(F)F | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c13ccccc1"
} |
Can you make molecule N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2C[C@H](C(F)F)n3ncc(C#N)c3N2)c1C | N#Cc1cnn2c1N[C@@H](c1ccccc1)C[C@@H]2C(F)F | Cc1cccc([C@H]2C[C@H](C(F)F)n3ncc(C#N)c3N2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c13ccccc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.