prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)CC(C)(C)NC2CC2)C1 | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)CC(C)(C)NC2CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)CCC(C)(C)NC2CC2)C1 | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)CCC(C)(C)NC2CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)C[C@@H](Br)NC2CC2)C1 | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)C[C@@H](Br)NC2CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCC[C@H](C(=O)N3c4ccccc4C[C@H]3C)C2)cc(=O)n1NC1CC1 | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 | Cc1cc(N2CCC[C@H](C(=O)N3c4ccccc4C[C@H]3C)C2)cc(=O)n1NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N2CCC[C@H](C(=O)N3c4ccccc4C[C@H]3C)C2)c(=O)ccn1NC1CC1 | C[C@@H]1Cc2ccccc2N1C(=O)[C@H]1CCCN(C(=O)NC2CC2)C1 | Cc1c(N2CCC[C@H](C(=O)N3c4ccccc4C[C@H]3C)C2)c(=O)ccn1NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COCSCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | COCSCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | CC(=O)SCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | CON(C)CCCCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO5"
} |
Can you make molecule COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | CC(=O)CCCCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO5"
} |
Can you make molecule COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H]2CC=C(COC(=O)c3csc(CC(=O)CCBr)n3)[C@@H]1C2 | COCc1nc(C(=O)OCC2=CC[C@H]3C[C@@H]2C3(C)C)cs1 | CC1(C)[C@H]2CC=C(COC(=O)c3csc(CC(=O)CCBr)n3)[C@@H]1C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO5"
} |
Can you make molecule CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccc(Br)s1)SC(=O)C[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)SC(=O)C[NH+](C)CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccc(Br)s1)C(=O)CCCC(=O)[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C(=O)CCCC(=O)[NH+](C)CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccc(Br)s1)C(=O)CC(C)(C)[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C(=O)CC(C)(C)[NH+](C)CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccc(Br)s1)C[S@+]([O-])CCC[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C[S@+]([O-])CCC[NH+](C)CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccc(Br)s1)C(=O)CCC(C)(C)[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C(=O)C[NH+](C)CC(=O)[O-] | CCN(Cc1ccc(Br)s1)C(=O)CCC(C)(C)[NH+](C)CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)C5"
} |
Can you make molecule O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])[C@H]1CCCN(c2ccc(O)cn2)C1 | O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 | O=C([O-])[C@H]1CCCN(c2ccc(O)cn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)cn1",
"old_substring": "c13ccc([O-])nn1"
} |
Can you make molecule O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])[C@H]1CCCN(c2ccc(O)nc2)C1 | O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 | O=C([O-])[C@H]1CCCN(c2ccc(O)nc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)nc1",
"old_substring": "c13ccc([O-])nn1"
} |
Can you make molecule O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(N2CCC[C@H](C(=O)[O-])C2)nn1 | O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 | Nc1ccc(N2CCC[C@H](C(=O)[O-])C2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(N)nn1",
"old_substring": "c13ccc([O-])nn1"
} |
Can you make molecule O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])[C@H]1CCCN(c2ccc([S-])cc2)C1 | O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 | O=C([O-])[C@H]1CCCN(c2ccc([S-])cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc([S-])cc1",
"old_substring": "c13ccc([O-])nn1"
} |
Can you make molecule O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])[C@H]1CCCN(c2ccc(Cl)nc2[O-])C1 | O=C([O-])[C@H]1CCCN(c2ccc([O-])nn2)C1 | O=C([O-])[C@H]1CCCN(c2ccc(Cl)nc2[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)nc1[O-]",
"old_substring": "c13ccc([O-])nn1"
} |
Can you make molecule COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | COCc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | COCSc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | CC(=O)Sc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | NS(=O)(=O)c1cccc(NC(=O)CCCc2ccc(C(=O)CS)c(F)c2)c1 | COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | NS(=O)(=O)c1cccc(NC(=O)CCCc2ccc(C(=O)CS)c(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | NS(=O)(=O)c1cccc(NC(=O)CCCc2ccc(C(=O)CI)c(F)c2)c1 | COc1ccc(CCCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1F | NS(=O)(=O)c1cccc(NC(=O)CCCc2ccc(C(=O)CI)c(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccccc1[C@@H](c1nnnn1C1CCCCCCC1)[NH+]1CCN(c2ccccc2)CC1 | Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 | Fc1ccccc1[C@@H](c1nnnn1C1CCCCCCC1)[NH+]1CCN(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccccc1[C@@H](c1nnnn1SC1=CCCCCC1)[NH+]1CCN(c2ccccc2)CC1 | Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 | Fc1ccccc1[C@@H](c1nnnn1SC1=CCCCCC1)[NH+]1CCN(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccccc1[C@@H](c1nnnn1C1CCCCCCCCCCC1)[NH+]1CCN(c2ccccc2)CC1 | Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 | Fc1ccccc1[C@@H](c1nnnn1C1CCCCCCCCCCC1)[NH+]1CCN(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccccc1[C@@H](c1nnnn1C1C2=CC=CC=C1CCCC2)[NH+]1CCN(c2ccccc2)CC1 | Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 | Fc1ccccc1[C@@H](c1nnnn1C1C2=CC=CC=C1CCCC2)[NH+]1CCN(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2=CC=CC=C1CCCC2",
"old_substring": "C17CCCCC1"
} |
Can you make molecule Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(n2nnnc2[C@H](c2ccccc2F)[NH+]2CCN(c3ccccc3)CC2)CC1 | Fc1ccccc1[C@@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 | CC1(C)CCC(n2nnnc2[C@H](c2ccccc2F)[NH+]2CCN(c3ccccc3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(C/C(=N\Nc1nc(-c2ccccc2Cl)cs1)c1ccccc1)C(F)(F)F | O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F | O=C(C/C(=N\Nc1nc(-c2ccccc2Cl)cs1)c1ccccc1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(C/C(=N\Nc1nc(-c2ccc(I)cc2)cs1)c1ccccc1)C(F)(F)F | O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F | O=C(C/C(=N\Nc1nc(-c2ccc(I)cc2)cs1)c1ccccc1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2csc(N/N=C(\CC(=O)C(F)(F)F)c3ccccc3)n2)cc1I | O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F | Cc1ccc(-c2csc(N/N=C(\CC(=O)C(F)(F)F)c3ccccc3)n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(C/C(=N\Nc1nc(-c2cccc(Br)c2)cs1)c1ccccc1)C(F)(F)F | O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F | O=C(C/C(=N\Nc1nc(-c2cccc(Br)c2)cs1)c1ccccc1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2csc(N/N=C(\CC(=O)C(F)(F)F)c3ccccc3)n2)c1C | O=C(C/C(=N\Nc1nc(-c2ccccc2)cs1)c1ccccc1)C(F)(F)F | Cc1cccc(-c2csc(N/N=C(\CC(=O)C(F)(F)F)c3ccccc3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c13ccccc1"
} |
Can you make molecule C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)C[NH2+][C@@H](C)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 | CC(C)C(=O)C[NH2+][C@@H](C)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "N2(C)C"
} |
Can you make molecule C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]CC(=O)CC(=N)S)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)CC(=N)S)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N=C(S)C&",
"old_substring": "N2(C)C"
} |
Can you make molecule C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]CC(=O)N(C)C1=CCCC1)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)N(C)C1=CCCC1)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N&(C)C1=CCCC1",
"old_substring": "N2(C)C"
} |
Can you make molecule C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]CC(=O)C(F)(F)C#N)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)C(F)(F)C#N)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N2(C)C"
} |
Can you make molecule C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]CC(=O)c1ccc(N)cc1CN1CC1)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)N(C)C)c1ccc(Cl)s1 | C[C@H]([NH2+]CC(=O)c1ccc(N)cc1CN1CC1)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1ccc2c(c1)CN&CC2",
"old_substring": "N2(C)C"
} |
Can you make molecule CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)COCO3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)COCO3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COCO2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2cc3c(cc2I)OCO3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2cc3c(cc2I)OCO3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(cc1I)OCO2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)COC3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)COC3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COC2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2cc3c(cc2Br)OCO3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2cc3c(cc2Br)OCO3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(cc1Br)OCO2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2cc(F)cc3c2OCOC3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2ccc3c(c2)OCO3)C1=O | CCOC(=O)COc1ccccc1C=C1C(=O)NC(=O)N(c2cc(F)cc3c2OCOC3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cc&c2c(c1)COCO2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)cc(C)c1F | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)cc(C)c1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1F",
"old_substring": "Cc1cc4c(C)o1"
} |
Can you make molecule Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)cc1I | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1cc4c(C)o1"
} |
Can you make molecule Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)cc1Br | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1Br",
"old_substring": "Cc1cc4c(C)o1"
} |
Can you make molecule Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)cc(C)c1Cl | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)cc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1Cl",
"old_substring": "Cc1cc4c(C)o1"
} |
Can you make molecule Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(Cl)cc1F | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(C)o1 | Cc1cc(C(=O)NNC(=O)c2cccc3ccccc23)c(Cl)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Cl)cc1F",
"old_substring": "Cc1cc4c(C)o1"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(NC(=O)CC(C)(C)Nc3ccc(F)cc3)n2)cc1OC | COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC | COc1ccc(-c2csc(NC(=O)CC(C)(C)Nc3ccc(F)cc3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(NC(=O)CCC(C)(C)Nc3ccc(F)cc3)n2)cc1OC | COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC | COc1ccc(-c2csc(NC(=O)CCC(C)(C)Nc3ccc(F)cc3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(NC(=O)C[C@@H](Br)Nc3ccc(F)cc3)n2)cc1OC | COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC | COc1ccc(-c2csc(NC(=O)C[C@@H](Br)Nc3ccc(F)cc3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(Nc3cc(C)n(Nc4ccc(F)cc4)c(=O)c3)n2)cc1OC | COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC | COc1ccc(-c2csc(Nc3cc(C)n(Nc4ccc(F)cc4)c(=O)c3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(Nc3c(C)n(Nc4ccc(F)cc4)ccc3=O)n2)cc1OC | COc1ccc(-c2csc(NC(=O)Nc3ccc(F)cc3)n2)cc1OC | COc1ccc(-c2csc(Nc3c(C)n(Nc4ccc(F)cc4)ccc3=O)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4Cl)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4Cl)n3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccc(I)cc4)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccc(I)cc4)n3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccc(C)c(I)c4)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccc(C)c(I)c4)n3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4cccc(Br)c4)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4cccc(Br)c4)n3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4cccc(C)c4C)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4ccccc4)n3)CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N2CCN([C@H](C)c3nc(N)nc(Nc4cccc(C)c4C)n3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1C1=CC=C(SCc2nnc(C)n2C)N2CCC2=C1 | Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C | Cc1cccc(C)c1-n1nnnc1C1=CC=C(SCc2nnc(C)n2C)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C24"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1-c1ncnc2sc-2c(C)c1SCc1nnc(C)n1C | Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C | Cc1cccc(C)c1-n1nnnc1-c1ncnc2sc-2c(C)c1SCc1nnc(C)n1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C24"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1C1=CC=C2SCCN2C(SCc2nnc(C)n2C)=C1 | Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C | Cc1cccc(C)c1-n1nnnc1C1=CC=C2SCCN2C(SCc2nnc(C)n2C)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C24"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1C1=C2CCN2CC(SCc2nnc(C)n2C)=CC=C1 | Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C | Cc1cccc(C)c1-n1nnnc1C1=C2CCN2CC(SCc2nnc(C)n2C)=CC=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C24"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1-c1ccc(SCc2nnc(C)n2C)c(C)c2sc-2n1 | Cc1cccc(C)c1-n1nnnc1CSCc1nnc(C)n1C | Cc1cccc(C)c1-n1nnnc1-c1ccc(SCc2nnc(C)n2C)c(C)c2sc-2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2nc&ccc12",
"old_substring": "C24"
} |
Can you make molecule COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CC(=O)SN[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(CC(=O)SN[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(=O)CCCC(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(C(=O)CCCC(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(C)(C)CC(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(C(C)(C)CC(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(C)(C)CCC(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(C(C)(C)CCC(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H](C)C(=O)SN[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc(C(=O)N[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | COc1cccc([C@H](C)C(=O)SN[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCl)C(=O)[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@@H](CCl)C(=O)[NH2+][C@H]1CCc2c(Br)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CCl)C&=O",
"old_substring": "C[C@@H]3CCO"
} |
Can you make molecule C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCCl)[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@H](CCCCl)[NH2+][C@H]1CCc2c(Br)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CCCCl",
"old_substring": "C[C@@H]3CCO"
} |
Can you make molecule C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cl)C[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@@H](Cl)C[NH2+][C@H]1CCc2c(Br)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](Cl)C&",
"old_substring": "C[C@@H]3CCO"
} |
Can you make molecule C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](O)CCCC[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@@H](O)CCCC[NH2+][C@H]1CCc2c(Br)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](O)CCCC&",
"old_substring": "C[C@@H]3CCO"
} |
Can you make molecule C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CSC(=O)N1[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@H](CCO)[NH2+][C@H]1CCc2c(Br)cccc21 | C[C@@H]1CSC(=O)N1[NH2+][C@H]1CCc2c(Br)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CSC(=O)N1&",
"old_substring": "C[C@@H]3CCO"
} |
Can you make molecule CCc1ccsc1-c1cnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccsc1-c1cnc(C[NH3+])o1 | CCc1ccsc1-c1cnc(C[NH3+])o1 | C=CSc1ccsc1-c1cnc(C[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccsc1-c1cnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccsc1-c1cnc(C[NH3+])o1 | CCc1ccsc1-c1cnc(C[NH3+])o1 | CC(C)c1ccsc1-c1cnc(C[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccsc1-c1cnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccsc1-c1cnc(C[NH3+])o1 | CCc1ccsc1-c1cnc(C[NH3+])o1 | C=CCCc1ccsc1-c1cnc(C[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccsc1-c1cnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ncc(-c2sccc2CCCCl)o1 | CCc1ccsc1-c1cnc(C[NH3+])o1 | [NH3+]Cc1ncc(-c2sccc2CCCCl)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccsc1-c1cnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ncc(-c2sccc2CCCCS)o1 | CCc1ccsc1-c1cnc(C[NH3+])o1 | [NH3+]Cc1ncc(-c2sccc2CCCCS)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule NC(=O)C1(N2CCCC2)CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1(N2CCCCCC2)CC[NH2+]CC1 | NC(=O)C1(N2CCCC2)CC[NH2+]CC1 | NC(=O)C1(N2CCCCCC2)CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N13CCCC1"
} |
Can you make molecule NC(=O)C1(N2CCCC2)CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1(N2CCCCCCC2)CC[NH2+]CC1 | NC(=O)C1(N2CCCC2)CC[NH2+]CC1 | NC(=O)C1(N2CCCCCCC2)CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N13CCCC1"
} |
Can you make molecule NC(=O)C1(N2CCCC2)CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C2(C(N)=O)CC[NH2+]CC2)CC1 | NC(=O)C1(N2CCCC2)CC[NH2+]CC1 | CC1CCN(C2(C(N)=O)CC[NH2+]CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N13CCCC1"
} |
Can you make molecule NC(=O)C1(N2CCCC2)CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1(N2CCCCCCCC2)CC[NH2+]CC1 | NC(=O)C1(N2CCCC2)CC[NH2+]CC1 | NC(=O)C1(N2CCCCCCCC2)CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N13CCCC1"
} |
Can you make molecule NC(=O)C1(N2CCCC2)CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1(N2CCCCCCC2=O)CC[NH2+]CC1 | NC(=O)C1(N2CCCC2)CC[NH2+]CC1 | NC(=O)C1(N2CCCCCCC2=O)CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N13CCCC1"
} |
Can you make molecule CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]([NH3+])C(=O)[C@H]1C=C[C@@H](C(=O)[O-])C1 | CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C | CC(C)C[C@@H]([NH3+])C(=O)[C@H]1C=C[C@@H](C(=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "N12CC[C@H]3[C@@H]1C"
} |
Can you make molecule CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]([NH3+])C(=O)[C@@H]1CC[C@@H](C(=O)[O-])C1 | CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C | CC(C)C[C@@H]([NH3+])C(=O)[C@@H]1CC[C@@H](C(=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "N12CC[C@H]3[C@@H]1C"
} |
Can you make molecule CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]([NH3+])C(=O)[C@H]1C=C[C@H](C(=O)[O-])C1 | CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C | CC(C)C[C@@H]([NH3+])C(=O)[C@H]1C=C[C@H](C(=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "N12CC[C@H]3[C@@H]1C"
} |
Can you make molecule CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]([NH3+])C(=O)[C@H]1CCCC[C@H](C(=O)[O-])C1 | CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C | CC(C)C[C@@H]([NH3+])C(=O)[C@H]1CCCC[C@H](C(=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "N12CC[C@H]3[C@@H]1C"
} |
Can you make molecule CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]([NH3+])C(=O)[C@H]1CCC[C@H](C(=O)[O-])C1 | CC(C)C[C@@H]([NH3+])C(=O)N1CC[C@H](C(=O)[O-])[C@@H]1C | CC(C)C[C@@H]([NH3+])C(=O)[C@H]1CCC[C@H](C(=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "N12CC[C@H]3[C@@H]1C"
} |
Can you make molecule CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)Cn1c(CCCl)nc2c(C)nn(C)c21 | CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 | CC[C@@H](CCCl)Cn1c(CCCl)nc2c(C)nn(C)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "CC[C@H](C)C3"
} |
Can you make molecule CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCCl)Cn1c(CCCl)nc2c(C)nn(C)c21 | CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 | CC[C@H](CCCl)Cn1c(CCCl)nc2c(C)nn(C)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCCl",
"old_substring": "CC[C@H](C)C3"
} |
Can you make molecule CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)CCCn1c(CCCl)nc2c(C)nn(C)c21 | CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 | CC[C@@H](Cl)CCCn1c(CCCl)nc2c(C)nn(C)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)CCC&",
"old_substring": "CC[C@H](C)C3"
} |
Can you make molecule CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)[C@@H](C)n1c(CCCl)nc2c(C)nn(C)c21 | CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 | CC[C@@H](Cl)[C@@H](C)n1c(CCCl)nc2c(C)nn(C)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)[C@H]&C",
"old_substring": "CC[C@H](C)C3"
} |
Can you make molecule CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)n1c(CCCl)nc2c(C)nn(C)c21 | CC[C@H](C)Cn1c(CCCl)nc2c(C)nn(C)c21 | CC[C@@H](C)C[C@H](CC)n1c(CCCl)nc2c(C)nn(C)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "CC[C@H](C)C3"
} |
Can you make molecule Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(CCC[C@@H](CCl)NC(=O)CCC[NH+]2CCCCC2)n1 | Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 | Cc1csc(CCC[C@@H](CCl)NC(=O)CCC[NH+]2CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]46C"
} |
Can you make molecule Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(CCC2=CN=N[C@H]2NC(=O)CCC[NH+]2CCCCC2)n1 | Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 | Cc1csc(CCC2=CN=N[C@H]2NC(=O)CCC[NH+]2CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]46C"
} |
Can you make molecule Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc([C@@H]2CC[C@@H](NC(=O)CCC[NH+]3CCCCC3)C2)n1 | Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 | Cc1csc([C@@H]2CC[C@@H](NC(=O)CCC[NH+]3CCCCC3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]46C"
} |
Can you make molecule Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(CC(C)(C)[C@@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 | Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 | Cc1csc(CC(C)(C)[C@@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]46C"
} |
Can you make molecule Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1nc(C)cs1)NC(=O)CCC[NH+]1CCCCC1 | Cc1csc([C@H](C)NC(=O)CCC[NH+]2CCCCC2)n1 | CC[C@@H](CCc1nc(C)cs1)NC(=O)CCC[NH+]1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]46C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.