prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)Cc1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COSC(=O)Cc1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COC(=O)CCCC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COC(=O)CC(C)(C)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCC(C)(C)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COC(=O)CCC(C)(C)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)[C@@H](C)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COC(=O)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | COSC(=O)[C@@H](C)c1sc(NC(=O)Cc2csc(C(C)C)n2)nc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1csc2c1CCCC2)NC[C@@H](O)c1ccco1 | O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 | O=C(/C=C/Sc1csc2c1CCCC2)NC[C@@H](O)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NC[C@@H](O)c2ccco2)nc1-c1csc2c1CCCC2 | O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 | O=Cc1sc(NC[C@@H](O)c2ccco2)nc1-c1csc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NC[C@@H](O)c2ccco2)sc1-c1csc2c1CCCC2 | O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 | O=Cc1nc(NC[C@@H](O)c2ccco2)sc1-c1csc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H](O)c1ccco1)n1nc(-c2csc3c2CCCC3)oc1=S | O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 | O=C(NC[C@@H](O)c1ccco1)n1nc(-c2csc3c2CCCC3)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H](CNO/N=C/c1ccc(-c2csc3c2CCCC3)o1)c1ccco1 | O=C(NC[C@@H](O)c1ccco1)c1csc2c1CCCC2 | O[C@H](CNO/N=C/c1ccc(-c2csc3c2CCCC3)o1)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NSC(=O)Cc3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NSC(=O)Cc3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NC(=O)CCCC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NC(=O)CCCC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NC(=O)CC(C)(C)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NC(=O)CC(C)(C)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NC(=O)CCC(C)(C)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NC(=O)CCC(C)(C)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NSC(=O)[C@@H](C)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | Cc1ccc2nc(NSC(=O)[C@@H](C)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)C1CCC(C[NH2+][C@H](C)c2sccc2C)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 | CC(=O)C1CCC(C[NH2+][C@H](C)c2sccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(CCCCC(N)=O)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(CCCCC(N)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C/C(N)=N\O)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C/C(N)=N\O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&/C(N)=N\\O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(CC/C(N)=N/O)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(CC/C(N)=N/O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(CC/C(N)=N\O)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(C(N)=O)CC1 | Cc1ccsc1[C@@H](C)[NH2+]CC1CCC(CC/C(N)=N\O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3C=Cc3cccc(C)c3)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3C=Cc3cccc(C)c3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc(C=&)c1",
"old_substring": "c19cccc(C)c1"
} |
Can you make molecule Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3c(Cl)cccc3Cl)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3c(Cl)cccc3Cl)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c19cccc(C)c1"
} |
Can you make molecule Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3C=Cc3cccc(Cl)c3)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3C=Cc3cccc(Cl)c3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(Cl)c1",
"old_substring": "c19cccc(C)c1"
} |
Can you make molecule Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cc(C)c(Cl)c(C)c3)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cc(C)c(Cl)c(C)c3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1Cl",
"old_substring": "c19cccc(C)c1"
} |
Can you make molecule Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3C=Cc3cccc(C)c3C)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3Cc3cccc(C)c3)CC2)cc1 | Cc1ccc(C[NH+]2CCN(c3nc4c(c(=O)[nH]c(=O)n4C)n3C=Cc3cccc(C)c3C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc(C=&)c1C",
"old_substring": "c19cccc(C)c1"
} |
Can you make molecule CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3cc(I)ccc3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3cc(I)ccc3Cl)CC(=O)N21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3cc(Br)ccc3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3cc(Br)ccc3Cl)CC(=O)N21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3sc4sccc4c3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3sc4sccc4c3Cl)CC(=O)N21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3sc4ccccc4c3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3sc4ccccc4c3Cl)CC(=O)N21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3cc(Br)c(F)cc3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3ccccc3Cl)CC(=O)N21 | CC1(C)c2[nH]c3ccccc3c2C[C@H]2C(=O)N(Cc3cc(Br)c(F)cc3Cl)CC(=O)N21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)c1ncncc1I)Nc1ccc(C(F)(F)F)cc1 | O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 | O=C(COC(=O)c1ncncc1I)Nc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncncc1I",
"old_substring": "c16ccnnc1"
} |
Can you make molecule O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)OCC(=O)Nc2ccc(C(F)(F)F)cc2)nnc1C | O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 | Cc1cc(C(=O)OCC(=O)Nc2ccc(C(F)(F)F)cc2)nnc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&nnc1C",
"old_substring": "c16ccnnc1"
} |
Can you make molecule O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)c1ncncc1Cl)Nc1ccc(C(F)(F)F)cc1 | O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 | O=C(COC(=O)c1ncncc1Cl)Nc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncncc1Cl",
"old_substring": "c16ccnnc1"
} |
Can you make molecule O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnccc1C(=O)OCC(=O)Nc1ccc(C(F)(F)F)cc1 | O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 | Cc1cnccc1C(=O)OCC(=O)Nc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1C",
"old_substring": "c16ccnnc1"
} |
Can you make molecule O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)n1ccc(I)n1)Nc1ccc(C(F)(F)F)cc1 | O=C(COC(=O)c1ccnnc1)Nc1ccc(C(F)(F)F)cc1 | O=C(COC(=O)n1ccc(I)n1)Nc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Ic1ccn&n1",
"old_substring": "c16ccnnc1"
} |
Can you make molecule CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNSC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNSC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)CCCC(=O)NC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC(=O)CCCC(=O)NC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)CC(C)(C)NC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC(=O)CC(C)(C)NC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC[S@+]([O-])CCCNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC[S@+]([O-])CCCNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)CCC(C)(C)NC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC(=O)CNC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CNC(=O)CCC(C)(C)NC(=O)[C@H]1CCC[NH+]1Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(NC(=O)CCc2nc(C(Cl)(Cl)Cl)no2)CC1 | CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 | CC1CCC(NC(=O)CCc2nc(C(Cl)(Cl)Cl)no2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(NC(=O)CCc2nc(C(C)(C)CC(C)(C)C)no2)CC1 | CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 | CC1CCC(NC(=O)CCc2nc(C(C)(C)CC(C)(C)C)no2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(NC(=O)CCc2nc(CCCC(C)(C)C)no2)CC1 | CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 | CC1CCC(NC(=O)CCc2nc(CCCC(C)(C)C)no2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(NC(=O)CCc2nc(CCCC(F)(F)F)no2)CC1 | CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 | CC1CCC(NC(=O)CCc2nc(CCCC(F)(F)F)no2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(NC(=O)CCc2nc(CCCCC(F)(F)F)no2)CC1 | CC1CCC(NC(=O)CCc2nc(C(C)(C)C)no2)CC1 | CC1CCC(NC(=O)CCc2nc(CCCCC(F)(F)F)no2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NNC(=O)c1ccsc1NSC(=O)Cc1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NSC(=O)Cc1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NNC(=O)c1ccsc1NC(=O)CCCC(=O)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NC(=O)CCCC(=O)c1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NNC(=O)c1ccsc1NC(=O)CC(C)(C)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NC(=O)CC(C)(C)c1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NNC(=O)c1ccsc1NC(=O)CCC(C)(C)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NC(=O)CCC(C)(C)c1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NNC(=O)c1ccsc1NSC(=O)[C@@H](C)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NC(=O)c1ccc([N+](=O)[O-])cc1 | CC(=O)NNC(=O)c1ccsc1NSC(=O)[C@@H](C)c1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C25=O"
} |
Can you make molecule CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](C(=O)Nc1ncc(Cl)cc1Cl)/C(N)=N/O | CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O | CCC[C@@H](C(=O)Nc1ncc(Cl)cc1Cl)/C(N)=N/O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Cl)cc1Cl",
"old_substring": "c13ccc(C)nc1C"
} |
Can you make molecule CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](C(=O)Nc1ccc(C)cc1Cl)/C(N)=N/O | CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O | CCC[C@@H](C(=O)Nc1ccc(C)cc1Cl)/C(N)=N/O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c13ccc(C)nc1C"
} |
Can you make molecule CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](C(=O)Nc1cnc(Cl)cc1I)/C(N)=N/O | CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O | CCC[C@@H](C(=O)Nc1cnc(Cl)cc1I)/C(N)=N/O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)cc1I",
"old_substring": "c13ccc(C)nc1C"
} |
Can you make molecule CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](C(=O)Nc1ccc(C#N)cc1Cl)/C(N)=N/O | CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O | CCC[C@@H](C(=O)Nc1ccc(C#N)cc1Cl)/C(N)=N/O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1Cl",
"old_substring": "c13ccc(C)nc1C"
} |
Can you make molecule CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](C(=O)Nc1cccc(C)c1C)/C(N)=N/O | CCC[C@@H](C(=O)Nc1ccc(C)nc1C)/C(N)=N/O | CCC[C@@H](C(=O)Nc1cccc(C)c1C)/C(N)=N/O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c13ccc(C)nc1C"
} |
Can you make molecule C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@]1(C#N)Sc1nc(-c2ccccc2)cs1 | C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 | C[C@@H]1CC[C@@]1(C#N)Sc1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CC[C@]1&C#N",
"old_substring": "C[C@@H]3C#N"
} |
Can you make molecule C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(Sc2nc(-c3ccccc3)cs2)C1 | C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 | C[C@@H]1CCCN(Sc2nc(-c3ccccc3)cs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCN&C1",
"old_substring": "C[C@@H]3C#N"
} |
Can you make molecule C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCCCN1Sc1nc(-c2ccccc2)cs1 | C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 | C[C@@H]1CCCCCN1Sc1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCCCN1&",
"old_substring": "C[C@@H]3C#N"
} |
Can you make molecule C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCCl)Sc1nc(-c2ccccc2)cs1 | C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 | C[C@H](CCCCl)Sc1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CCCCl",
"old_substring": "C[C@@H]3C#N"
} |
Can you make molecule C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cl)CSc1nc(-c2ccccc2)cs1 | C[C@H](C#N)Sc1nc(-c2ccccc2)cs1 | C[C@@H](Cl)CSc1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](Cl)C&",
"old_substring": "C[C@@H]3C#N"
} |
Can you make molecule C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=S)Sc1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@H](OC(=S)Sc1ccc(F)cc1)C(=O)NCc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=N)Cc1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@H](OC(=N)Cc1ccc(F)cc1)C(=O)NCc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)CCC(=O)c1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@H](C(=O)CCC(=O)c1ccc(F)cc1)C(=O)NCc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NCc1ccccn1)[C@H](O)CCc1ccc(F)cc1 | C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@@H](C(=O)NCc1ccccn1)[C@H](O)CCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)/C=C/Sc1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@H](Oc1ccc(F)cc1)C(=O)NCc1ccccn1 | C[C@H](C(=O)/C=C/Sc1ccc(F)cc1)C(=O)NCc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1occc1C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | CC[C@@H](CCc1occc1C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]36C"
} |
Can you make molecule Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1CC[C@H](CBr)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | Cc1ccoc1CC[C@H](CBr)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]36C"
} |
Can you make molecule Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1CCC[C@H](CBr)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | Cc1ccoc1CCC[C@H](CBr)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]36C"
} |
Can you make molecule Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1CCC[C@@H](CCl)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | Cc1ccoc1CCC[C@@H](CCl)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]36C"
} |
Can you make molecule Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1[C@H]1CCC[C@H]([NH2+]C2CCN([C@@H](C)c3ccncc3)CC2)C1 | Cc1ccoc1[C@@H](C)[NH2+]C1CCN([C@@H](C)c2ccncc2)CC1 | Cc1ccoc1[C@H]1CCC[C@H]([NH2+]C2CCN([C@@H](C)c3ccncc3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]36C"
} |
Can you make molecule O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccccc1Nc1cccc(SC(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(SC(F)(F)F)c1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccccc1Nc1cccc(CCCC(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(CCCC(F)(F)F)c1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccccc1Nc1cccc(CCCCC(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(CCCCC(F)(F)F)c1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccccc1Nc1cccc(C(F)(F)C(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(C(F)(F)C(F)(F)F)c1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccccc1Nc1cccc(CC(F)(F)C(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCCCC1 | O=C(c1ccccc1Nc1cccc(CC(F)(F)C(F)(F)F)c1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCCc2cccc(Cl)c21 | O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCCc2cccc(Cl)c21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cccc(Cl)c21",
"old_substring": "N3[C@@H]1CCCOc2ccc(F)cc21"
} |
Can you make molecule O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCCc2cc(Br)ccc21 | O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCCc2cc(Br)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc(Br)ccc21",
"old_substring": "N3[C@@H]1CCCOc2ccc(F)cc21"
} |
Can you make molecule O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCCc2cc(Cl)ccc21 | O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCCc2cc(Cl)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc(Cl)ccc21",
"old_substring": "N3[C@@H]1CCCOc2ccc(F)cc21"
} |
Can you make molecule O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCSc2ccc(Cl)cc21 | O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCSc2ccc(Cl)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc(Cl)cc21",
"old_substring": "N3[C@@H]1CCCOc2ccc(F)cc21"
} |
Can you make molecule O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CC=C(c2cccs2)CC1 | O=S(=O)(N[C@@H]1CCCOc2ccc(F)cc21)c1ccc2c(c1)OCCCO2 | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CC=C(c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=C(c2cccs2)CC1",
"old_substring": "N3[C@@H]1CCCOc2ccc(F)cc21"
} |
Can you make molecule CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCOc1ccccc1NC(=O)C(=O)NCc1ccncc1 | CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 | CC(C)CCOc1ccccc1NC(=O)C(=O)NCc1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccncc1)C(=O)Nc1ccccc1OCCCCBr | CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 | O=C(NCc1ccncc1)C(=O)Nc1ccccc1OCCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCOc1ccccc1NC(=O)C(=O)NCc1ccncc1 | CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 | C=CCCCOc1ccccc1NC(=O)C(=O)NCc1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccncc1)C(=O)Nc1ccccc1OCCCCCl | CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 | O=C(NCc1ccncc1)C(=O)Nc1ccccc1OCCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCOc1ccccc1NC(=O)C(=O)NCc1ccncc1 | CC(C)Oc1ccccc1NC(=O)C(=O)NCc1ccncc1 | C=CCCCCOc1ccccc1NC(=O)C(=O)NCc1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cc(C(=O)OCC(=O)c2ccc(Cl)s2)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2ccc(Cl)s2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c17cccs1"
} |
Can you make molecule CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cc(C(=O)OCC(=O)c2ccc(Br)s2)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2ccc(Br)s2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c17cccs1"
} |
Can you make molecule CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cc(C(=O)OCC(=O)c2sccc2Br)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2sccc2Br)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c17cccs1"
} |
Can you make molecule CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cc(C(=O)OCC(=O)c2csc(I)c2)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2csc(I)c2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c17cccs1"
} |
Can you make molecule CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cc(C(=O)OCC(=O)c2cc3c(s2)CSC3)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2cccs2)ccc1C | CCC(=O)Nc1cc(C(=O)OCC(=O)c2cc3c(s2)CSC3)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c17cccs1"
} |
Can you make molecule CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCS[C@H]1CCCC[C@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 | CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 | CCS[C@H]1CCCC[C@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@@H]18CC[C@@H]7C1"
} |
Can you make molecule CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCS[C@H]1CCC[C@H](NC(=O)C(=O)Nc2cc(C)nn2C)CC1 | CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 | CCS[C@H]1CCC[C@H](NC(=O)C(=O)Nc2cc(C)nn2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@@H]18CC[C@@H]7C1"
} |
Can you make molecule CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCSCCC1=CCC[C@@H]1NC(=O)C(=O)Nc1cc(C)nn1C | CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 | CCSCCC1=CCC[C@@H]1NC(=O)C(=O)Nc1cc(C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "[C@@H]18CC[C@@H]7C1"
} |
Can you make molecule CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCS[C@@H](CBr)CCCNC(=O)C(=O)Nc1cc(C)nn1C | CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 | CCS[C@@H](CBr)CCCNC(=O)C(=O)Nc1cc(C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@@H]18CC[C@@H]7C1"
} |
Can you make molecule CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCS[C@H]1CCc2sc(NC(=O)C(=O)Nc3cc(C)nn3C)cc2C1 | CCS[C@@H]1CC[C@@H](NC(=O)C(=O)Nc2cc(C)nn2C)C1 | CCS[C@H]1CCc2sc(NC(=O)C(=O)Nc3cc(C)nn3C)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCc2sc&cc2C1",
"old_substring": "[C@@H]18CC[C@@H]7C1"
} |
Can you make molecule O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN[C@H]1CCSc2c(F)cccc21)NC1CCCCCC1 | O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 | O=C(/C=C/SN[C@H]1CCSc2c(F)cccc21)NC1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NC2CCCCCC2)nc1N[C@H]1CCSc2c(F)cccc21 | O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 | O=Cc1sc(NC2CCCCCC2)nc1N[C@H]1CCSc2c(F)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NC2CCCCCC2)sc1N[C@H]1CCSc2c(F)cccc21 | O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 | O=Cc1nc(NC2CCCCCC2)sc1N[C@H]1CCSc2c(F)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NC2CCCCCC2)CCC1=N[C@H]1CCSc2c(F)cccc21 | O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 | O=C1C(=NC2CCCCCC2)CCC1=N[C@H]1CCSc2c(F)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCCCCC1)n1nc(N[C@H]2CCSc3c(F)cccc32)oc1=S | O=C(NC1CCCCCC1)N[C@H]1CCSc2c(F)cccc21 | O=C(NC1CCCCCC1)n1nc(N[C@H]2CCSc3c(F)cccc32)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C34"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.