prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccc(C(=O)NCc2cc(I)ccc2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2cc(I)ccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccc(C(=O)NCc2cc(Br)ccc2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2cc(Br)ccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccc(C(=O)NCc2sc3sccc3c2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2sc3sccc3c2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccc(C(=O)NCc2sc3ccccc3c2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2sc3ccccc3c2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccc(C(=O)NCc2cc(Br)c(F)cc2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 | CCCCOc1ccc(C(=O)NCc2cc(Br)c(F)cc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)ncc1I | CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 | CCc1nc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)ncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c14nsc3n1"
} |
Can you make molecule CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ncc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)s1 | CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 | CCc1ncc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&s1",
"old_substring": "c14nsc3n1"
} |
Can you make molecule CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ncc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)s1 | CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 | CCc1ncc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1nc&sc1&",
"old_substring": "c14nsc3n1"
} |
Can you make molecule CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1csc2nc(N3C[C@@H](C)C[C@@H]3c3ccccc3F)cn12 | CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 | CCc1csc2nc(N3C[C@@H](C)C[C@@H]3c3ccccc3F)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2nc&cn12",
"old_substring": "c14nsc3n1"
} |
Can you make molecule CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)c2sccn12 | CCc1nsc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)n1 | CCc1nc(N2C[C@@H](C)C[C@@H]2c2ccccc2F)c2sccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&c2sccn12",
"old_substring": "c14nsc3n1"
} |
Can you make molecule CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H]2CC[C@]1(C[S@+]([O-])CCCC(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | CC1(C)[C@H]2CC[C@]1(C[S@+]([O-])CCCC(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCCC&=O",
"old_substring": "C6S4(=O)=O"
} |
Can you make molecule CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H]2CC[C@]1(C[S@@+]([O-])CCCC(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | CC1(C)[C@H]2CC[C@]1(C[S@@+]([O-])CCCC(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@@](=O)CCCC&=O",
"old_substring": "C6S4(=O)=O"
} |
Can you make molecule CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@]23CC[C@@H](CC2=O)C3(C)C)c1S(=O)(=O)NCc1ccccc1N1CCOCC1 | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | Cc1cccc([C@@]23CC[C@@H](CC2=O)C3(C)C)c1S(=O)(=O)NCc1ccccc1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1S&(=O)=O",
"old_substring": "C6S4(=O)=O"
} |
Can you make molecule CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H]2CC[C@]1(C(=O)CCCC(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | CC1(C)[C@H]2CC[C@]1(C(=O)CCCC(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C6S4(=O)=O"
} |
Can you make molecule CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)c1ccc(NCc3ccccc3N3CCOCC3)o1)C(=O)C2 | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)NCc1ccccc1N1CCOCC1)C(=O)C2 | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)c1ccc(NCc3ccccc3N3CCOCC3)o1)C(=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&S(=O)(=O)c1ccc&o1",
"old_substring": "C6S4(=O)=O"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2I)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2C(=O)Nc2cc(N3CCCC3=O)ccc2Br)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2cc(N3CCCC3=O)ccc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2Cl)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2C(=O)Nc2cccc(N3CCCC3=O)c2Br)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2cccc(N3CCCC3=O)c2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCN2C(=O)Nc2cccc(N3CCCC3=O)c2Cl)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 | COc1cccc([C@H]2CCCN2C(=O)Nc2cccc(N3CCCC3=O)c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=C(C)c2cccc(Cl)c2)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=C(C)c2cccc(Cl)c2)S/C1=N/c1nnc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1cccc(Cl)c1",
"old_substring": "C=3c1cccc(C)c1"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=Cc2cccc(Cl)c2Cl)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=Cc2cccc(Cl)c2Cl)S/C1=N/c1nnc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(Cl)c1Cl",
"old_substring": "C=3c1cccc(C)c1"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=Cc2cccc(Br)c2)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=Cc2cccc(Br)c2)S/C1=N/c1nnc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(Br)c1",
"old_substring": "C=3c1cccc(C)c1"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=C(CC)c2cccc(Cl)c2)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=C(CC)c2cccc(Cl)c2)S/C1=N/c1nnc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&c1cccc(Cl)c1",
"old_substring": "C=3c1cccc(C)c1"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=C(C)c2cccc(Cl)c2Cl)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=Cc2cccc(C)c2)S/C1=N/c1nnc(C)s1 | C=CCN1C(=O)C(=C(C)c2cccc(Cl)c2Cl)S/C1=N/c1nnc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1cccc(Cl)c1Cl",
"old_substring": "C=3c1cccc(C)c1"
} |
Can you make molecule O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NC(=O)CCc1nc2ccccc2[nH]1)C(=O)CN[C@@H]1CCS(=O)(=O)C1 | O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 | CCC(CC)(NC(=O)CCc1nc2ccccc2[nH]1)C(=O)CN[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5CC4=O"
} |
Can you make molecule O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NC(=O)CCc1nc2ccccc2[nH]1)C(=O)CCN[C@@H]1CCS(=O)(=O)C1 | O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 | CCC(CC)(NC(=O)CCc1nc2ccccc2[nH]1)C(=O)CCN[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5CC4=O"
} |
Can you make molecule O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCC=NC(=O)CCc1nc2ccccc2[nH]1)=N[C@@H]1CCS(=O)(=O)C1 | O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 | CC(CCC=NC(=O)CCc1nc2ccccc2[nH]1)=N[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCC=&C",
"old_substring": "C5CC4=O"
} |
Can you make molecule O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CCc1nc2ccccc2[nH]1)[S@+]([O-])CN[C@@H]1CCS(=O)(=O)C1 | O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 | CC[C@H](NC(=O)CCc1nc2ccccc2[nH]1)[S@+]([O-])CN[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&[S@](=O)C&",
"old_substring": "C5CC4=O"
} |
Can you make molecule O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)NC(=O)CCc1nc2ccccc2[nH]1)C(=O)N[C@@H]1CCS(=O)(=O)C1 | O=C(CCc1nc2ccccc2[nH]1)NCCC(=O)N[C@@H]1CCS(=O)(=O)C1 | CCCC[C@H](C(=O)NC(=O)CCc1nc2ccccc2[nH]1)C(=O)N[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H](C&=O)C&=O",
"old_substring": "C5CC4=O"
} |
Can you make molecule c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccccc1-c1csc2ncnc(Nc3ccc4c(c3)OCCO4)c12 | c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 | Clc1ccccc1-c1csc2ncnc(Nc3ccc4c(c3)OCCO4)c12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c1ccc8cc1"
} |
Can you make molecule c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Ic1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 | c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 | Ic1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c1ccc8cc1"
} |
Can you make molecule c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1I | c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 | Cc1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c1ccc8cc1"
} |
Can you make molecule c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)c1 | c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 | Brc1cccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c1ccc8cc1"
} |
Can you make molecule c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)c1C | c1ccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)cc1 | Cc1cccc(-c2csc3ncnc(Nc4ccc5c(c4)OCCO5)c23)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c1ccc8cc1"
} |
Can you make molecule Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C2([NH2+]Cc3cnc(-c4cc(C)c(C)s4)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4cc(C)c(C)s4)s3)CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "c19ccsc1"
} |
Can you make molecule Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C2([NH2+]Cc3cnc(-c4cc(C)sc4C)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4cc(C)sc4C)s3)CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)sc1C",
"old_substring": "c19ccsc1"
} |
Can you make molecule Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C2([NH2+]Cc3cnc(-c4sccc4Br)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4sccc4Br)s3)CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c19ccsc1"
} |
Can you make molecule Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C2([NH2+]Cc3cnc(-c4cc5sccc5s4)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4cc5sccc5s4)s3)CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c19ccsc1"
} |
Can you make molecule Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C2([NH2+]Cc3cnc(-c4cc(Cl)sc4Cl)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4ccsc4)s3)CCCC2)n1 | Cc1csc(C2([NH2+]Cc3cnc(-c4cc(Cl)sc4Cl)s3)CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c19ccsc1"
} |
Can you make molecule CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2ccc(OC)cc2I)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2ccc(OC)cc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14cccc5c1"
} |
Can you make molecule CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cc(OC)ccc2Br)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cc(OC)ccc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14cccc5c1"
} |
Can you make molecule CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2ccc(OC)cc2Cl)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2ccc(OC)cc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14cccc5c1"
} |
Can you make molecule CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2Br)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14cccc5c1"
} |
Can you make molecule CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2Cl)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2)C1 | CC[NH2+][C@@]1(C(=O)[O-])CC[C@@H](Oc2cccc(OC)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN(SC(=O)Cc3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(SC(=O)Cc3cc(C4CC4)on3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN(C(=O)CCCC(=O)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(C(=O)CCCC(=O)c3cc(C4CC4)on3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN(C(=O)CC(C)(C)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(C(=O)CC(C)(C)c3cc(C4CC4)on3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN(C(=O)CCC(C)(C)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(C(=O)CCC(C)(C)c3cc(C4CC4)on3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN(SC(=O)[C@@H](C)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(C(=O)c3cc(C4CC4)on3)CC2)c1 | Cc1cccc(N2CCN(SC(=O)[C@@H](C)c3cc(C4CC4)on3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C57=O"
} |
Can you make molecule Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(NCSc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | Cc1nc(NCSc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N67"
} |
Can you make molecule Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(NC(=N)Sc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | Cc1nc(NC(=N)Sc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N67"
} |
Can you make molecule Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(N(C)C(=S)Sc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | Cc1nc(N(C)C(=S)Sc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N67"
} |
Can you make molecule Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CN2CCC(c3ccc(OCC4CCOCC4)cc3)CC2)c2cc[nH]c2n1 | Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | Cc1nc(CN2CCC(c3ccc(OCC4CCOCC4)cc3)CC2)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N67"
} |
Can you make molecule Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(-c3ccc(OCC4CCOCC4)cc3)c2N)c2cc[nH]c2n1 | Cc1nc(Nc2ccc(OCC3CCOCC3)cc2)c2cc[nH]c2n1 | Cc1nc(-c2cccc(-c3ccc(OCC4CCOCC4)cc3)c2N)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N67"
} |
Can you make molecule CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSC1(CNC(=O)CC(C)(C)Nc2cc(-c3ccccc3)on2)CCOCC1 | CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 | CCSC1(CNC(=O)CC(C)(C)Nc2cc(-c3ccccc3)on2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSC1(CNC(=O)CCC(C)(C)Nc2cc(-c3ccccc3)on2)CCOCC1 | CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 | CCSC1(CNC(=O)CCC(C)(C)Nc2cc(-c3ccccc3)on2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSC1(CNC(=O)C[C@@H](Br)Nc2cc(-c3ccccc3)on2)CCOCC1 | CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 | CCSC1(CNC(=O)C[C@@H](Br)Nc2cc(-c3ccccc3)on2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSC1(CNc2cc(C)n(Nc3cc(-c4ccccc4)on3)c(=O)c2)CCOCC1 | CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 | CCSC1(CNc2cc(C)n(Nc3cc(-c4ccccc4)on3)c(=O)c2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSC1(CNc2c(C)n(Nc3cc(-c4ccccc4)on3)ccc2=O)CCOCC1 | CCSC1(CNC(=O)Nc2cc(-c3ccccc3)on2)CCOCC1 | CCSC1(CNc2c(C)n(Nc3cc(-c4ccccc4)on3)ccc2=O)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule C[C@H](Cn1ccnc1)NS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)N[C@H](C)Cn1ccnc1 | C[C@H](Cn1ccnc1)NS(C)(=O)=O | CC(C)S(=O)(=O)N[C@H](C)Cn1ccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule C[C@H](Cn1ccnc1)NS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CS(=O)(=O)N[C@H](C)Cn1ccnc1 | C[C@H](Cn1ccnc1)NS(C)(=O)=O | CC(C)CS(=O)(=O)N[C@H](C)Cn1ccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule C[C@H](Cn1ccnc1)NS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cn1ccnc1)NCCCCS(C)(=O)=O | C[C@H](Cn1ccnc1)NS(C)(=O)=O | C[C@H](Cn1ccnc1)NCCCCS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule C[C@H](Cn1ccnc1)NS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cn1ccnc1)NC(=O)N=S(C)(C)=O | C[C@H](Cn1ccnc1)NS(C)(=O)=O | C[C@H](Cn1ccnc1)NC(=O)N=S(C)(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CS(C)(=O)=NC&=O",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule C[C@H](Cn1ccnc1)NS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)CN[C@H](C)Cn1ccnc1 | C[C@H](Cn1ccnc1)NS(C)(=O)=O | CC(C)S(=O)(=O)CN[C@H](C)Cn1ccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S(=O)(=O)C&",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | C=CSc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | Cc1cccc(C(C)C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | C=CCCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCl)c1NC(=O)C[C@H]1C[NH2+]CCO1 | CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | Cc1cccc(CCCCl)c1NC(=O)C[C@H]1C[NH2+]CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCS)c1NC(=O)C[C@H]1C[NH2+]CCO1 | CCc1cccc(C)c1NC(=O)C[C@H]1C[NH2+]CCO1 | Cc1cccc(CCCCS)c1NC(=O)C[C@H]1C[NH2+]CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[NH+]2CCC[C@H](CC(=C=O)Cc3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](CC(=C=O)Cc3ccc(SC)cc3)C2)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C78=O"
} |
Can you make molecule COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[NH+]2CCC[C@H](C(=O)CCCC(=O)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](C(=O)CCCC(=O)c3ccc(SC)cc3)C2)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C78=O"
} |
Can you make molecule COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[NH+]2CCC[C@H](C(=O)CC(C)(C)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](C(=O)CC(C)(C)c3ccc(SC)cc3)C2)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C78=O"
} |
Can you make molecule COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[NH+]2CCC[C@H](C(=O)CCC(C)(C)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](C(=O)CCC(C)(C)c3ccc(SC)cc3)C2)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C78=O"
} |
Can you make molecule COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[NH+]2CCC[C@H](SC(=O)[C@@H](C)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](C(=O)c3ccc(SC)cc3)C2)c1OC | COc1cccc(C[NH+]2CCC[C@H](SC(=O)[C@@H](C)c3ccc(SC)cc3)C2)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C78=O"
} |
Can you make molecule NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 less soluble in water? The output molecule should be similar to the input molecule. | NNC(=O)[C@@H]1CC[C@H](CCCSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](CCCSc2cccc(F)c2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C35"
} |
Can you make molecule NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 less soluble in water? The output molecule should be similar to the input molecule. | NNC(=O)[C@@H]1CC[C@H](CCCCSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](CCCCSc2cccc(F)c2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 less soluble in water? The output molecule should be similar to the input molecule. | NNC(=O)[C@@H]1CC[C@H](CCCCCSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](CCCCCSc2cccc(F)c2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 less soluble in water? The output molecule should be similar to the input molecule. | NNC(=O)[C@@H]1CC[C@H](C2CC(Sc3cccc(F)c3)C2)O1 | NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](C2CC(Sc3cccc(F)c3)C2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 less soluble in water? The output molecule should be similar to the input molecule. | NNC(=O)[C@@H]1CC[C@H](SC(=S)OSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](CSc2cccc(F)c2)O1 | NNC(=O)[C@@H]1CC[C@H](SC(=S)OSc2cccc(F)c2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule CSc1ncc2c(-c3ccccc3)n[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ncc2c(-c3ccccc3Cl)n[nH]c2n1 | CSc1ncc2c(-c3ccccc3)n[nH]c2n1 | CSc1ncc2c(-c3ccccc3Cl)n[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c15ccccc1"
} |
Can you make molecule CSc1ncc2c(-c3ccccc3)n[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ncc2c(-c3ccc(I)cc3)n[nH]c2n1 | CSc1ncc2c(-c3ccccc3)n[nH]c2n1 | CSc1ncc2c(-c3ccc(I)cc3)n[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c15ccccc1"
} |
Can you make molecule CSc1ncc2c(-c3ccccc3)n[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ncc2c(-c3ccc(C)c(I)c3)n[nH]c2n1 | CSc1ncc2c(-c3ccccc3)n[nH]c2n1 | CSc1ncc2c(-c3ccc(C)c(I)c3)n[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c15ccccc1"
} |
Can you make molecule CSc1ncc2c(-c3ccccc3)n[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ncc2c(-c3cccc(Br)c3)n[nH]c2n1 | CSc1ncc2c(-c3ccccc3)n[nH]c2n1 | CSc1ncc2c(-c3cccc(Br)c3)n[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c15ccccc1"
} |
Can you make molecule CSc1ncc2c(-c3ccccc3)n[nH]c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ncc2c(-c3cccc(C)c3C)n[nH]c2n1 | CSc1ncc2c(-c3ccccc3)n[nH]c2n1 | CSc1ncc2c(-c3cccc(C)c3C)n[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c15ccccc1"
} |
Can you make molecule CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1Oc2ccc(NC(C)(C)CC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(NC(C)(C)CC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1Oc2ccc(NC(C)(C)CCC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(NC(C)(C)CCC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1Oc2ccc(N[C@H](Br)CC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(N[C@H](Br)CC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1Oc2ccc(Nn3c(C)cc(OCc4ccccc4)cc3=O)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(Nn3c(C)cc(OCc4ccccc4)cc3=O)cc2CN([C@H](C)CC)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1Oc2ccc(Nn3ccc(=O)c(OCc4ccccc4)c3C)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(NC(=O)OCc3ccccc3)cc2CN([C@H](C)CC)C1=O | CC[C@@H]1Oc2ccc(Nn3ccc(=O)c(OCc4ccccc4)c3C)cc2CN([C@H](C)CC)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN(c2c(Cl)cccc2Cl)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2c(Cl)cccc2Cl)CC1)Nc1ccc2[nH]ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN(c2ccc(Cl)cc2I)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2ccc(Cl)cc2I)CC1)Nc1ccc2[nH]ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN(c2ccc(Cl)cc2Br)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2ccc(Cl)cc2Br)CC1)Nc1ccc2[nH]ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN(c2ccc(Cl)c(I)c2)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2ccc(Cl)c(I)c2)CC1)Nc1ccc2[nH]ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN(c2ccc(Cl)c(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2cccc(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 | O=C(CCC(=O)N1CCN(c2ccc(Cl)c(Cl)c2)CC1)Nc1ccc2[nH]ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCc2sc(C(=O)CC(C)(C)[C@H](C)O)cc2C1 | C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 | C[C@@H]1CCc2sc(C(=O)CC(C)(C)[C@H](C)O)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](O)C(C)(C)C&",
"old_substring": "N14CC[S@@](=O)C(C)(C)C1"
} |
Can you make molecule C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](O)(CC(=O)c1cc2c(s1)CC[C@@H](C)C2)C(C)C | C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 | CC[C@@](O)(CC(=O)c1cc2c(s1)CC[C@@H](C)C2)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@](O)(C&)C(C)C",
"old_substring": "N14CC[S@@](=O)C(C)(C)C1"
} |
Can you make molecule C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCc2sc(C(=O)N3CCSC(C)(C)C3)cc2C1 | C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 | C[C@@H]1CCc2sc(C(=O)N3CCSC(C)(C)C3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC(C)(C)C1",
"old_substring": "N14CC[S@@](=O)C(C)(C)C1"
} |
Can you make molecule C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCc2sc(C(=O)[C@H](C)C(C)(C)C)cc2C1 | C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 | C[C@@H]1CCc2sc(C(=O)[C@H](C)C(C)(C)C)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C",
"old_substring": "N14CC[S@@](=O)C(C)(C)C1"
} |
Can you make molecule C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@](C)(O)CC(=O)c1cc2c(s1)CC[C@@H](C)C2 | C[C@@H]1CCc2sc(C(=O)N3CC[S@@+]([O-])C(C)(C)C3)cc2C1 | CC(C)[C@@](C)(O)CC(=O)c1cc2c(s1)CC[C@@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@](C)(O)C(C)C",
"old_substring": "N14CC[S@@](=O)C(C)(C)C1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.