prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CCCCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C#CCCC&",
"old_substring": "C#CC4"
} |
Can you make molecule C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CCCCCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C#CCCCC&",
"old_substring": "C#CC4"
} |
Can you make molecule C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)Oc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CC(C)(C)Oc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C#CC&(C)C",
"old_substring": "C#CC4"
} |
Can you make molecule C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C#CCC(C)(C)Oc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CCC(C)(C)Oc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C#CCC&(C)C",
"old_substring": "C#CC4"
} |
Can you make molecule C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C#CC(CC)(CC)Oc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CCOc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | C#CC(CC)(CC)Oc1c(Cl)cc(C=C2C(=O)N(c3ccc(F)cc3)C(=O)N=C2[O-])cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C#CC&(CC)CC",
"old_substring": "C#CC4"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | COCc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | COCSc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H](C)NC(=O)CC(C)(C)C)ccc1SC(C)=O | COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | COc1cc([C@H](C)NC(=O)CC(C)(C)C)ccc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H](C)NC(=O)CC(C)(C)C)ccc1C(=O)CS | COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | COc1cc([C@H](C)NC(=O)CC(C)(C)C)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H](C)NC(=O)CC(C)(C)C)ccc1C(=O)CI | COc1ccc([C@H](C)NC(=O)CC(C)(C)C)cc1OC | COc1cc([C@H](C)NC(=O)CC(C)(C)C)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1C(=O)NCCCn1nc(C(F)(F)F)cc1C1CC1 | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 | Cc1cc(Br)ccc1C(=O)NCCCn1nc(C(F)(F)F)cc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C",
"old_substring": "c14ccc(Br)o1"
} |
Can you make molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Br)cccc1C(=O)NCCCn1nc(C(F)(F)F)cc1C1CC1 | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 | Cc1c(Br)cccc1C(=O)NCCCn1nc(C(F)(F)F)cc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c14ccc(Br)o1"
} |
Can you make molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)cc1I | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c14ccc(Br)o1"
} |
Can you make molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1cc2cccc(Br)c2o1 | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1cc2cccc(Br)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cccc(Br)c2o1",
"old_substring": "c14ccc(Br)o1"
} |
Can you make molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1cc2cc(Br)ccc2o1 | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccc(Br)o1 | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1cc2cc(Br)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Br)ccc2o1",
"old_substring": "c14ccc(Br)o1"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2cc(Cc3ccccc3)ccc2s1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2cc(Cc3ccccc3)ccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&ccc2s1",
"old_substring": "c15cc2ccccc2n16"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2cc(Cc3ccccc3)ccc2nc1Cl | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2cc(Cc3ccccc3)ccc2nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&ccc2nc1Cl",
"old_substring": "c15cc2ccccc2n16"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1ccc2cc(Cc3ccccc3)ccc2c1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1ccc2cc(Cc3ccccc3)ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2cc&ccc2c1",
"old_substring": "c15cc2ccccc2n16"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1ccc2ccc(Cc3ccccc3)cc2c1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1ccc2ccc(Cc3ccccc3)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccc&cc2c1",
"old_substring": "c15cc2ccccc2n16"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1ccc2cccc(Cc3ccccc3)c2c1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1cc2ccccc2n1Cc1ccccc1 | O=C(NC[C@@H]1CCC[NH+]2CCCC[C@H]12)c1ccc2cccc(Cc3ccccc3)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2cccc&c2c1",
"old_substring": "c15cc2ccccc2n16"
} |
Can you make molecule CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCCCBr)C1 | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "C5CC"
} |
Can you make molecule CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCc1[nH+]ccn1[C@@H]1CC[C@](C#N)(NCCC)C1 | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 | C=CCCCc1[nH+]ccn1[C@@H]1CC[C@](C#N)(NCCC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C5CC"
} |
Can you make molecule CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCCCCl)C1 | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCCCCl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "C5CC"
} |
Can you make molecule CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1[nH+]ccn1[C@@H]1CC[C@](C#N)(NCCC)C1 | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 | C=CCCCCc1[nH+]ccn1[C@@H]1CC[C@](C#N)(NCCC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C5CC"
} |
Can you make molecule CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2C2CC(C)C2)C1 | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2CCC)C1 | CCCN[C@@]1(C#N)CC[C@@H](n2cc[nH+]c2C2CC(C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "C5CC"
} |
Can you make molecule CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN(SC(=O)Cc1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | CN(SC(=O)Cc1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCCC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | CN(C(=O)CCCC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CC(C)(C)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | CN(C(=O)CC(C)(C)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCC(C)(C)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | CN(C(=O)CCC(C)(C)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN(C)[C@@H]1CCc2ccccc21)c1ccc(CN2CC[NH+](C)CC2)cc1 | CN(C(=O)c1ccc(CN2CC[NH+](C)CC2)cc1)[C@@H]1CCc2ccccc21 | C[C@H](C(=O)SN(C)[C@@H]1CCc2ccccc21)c1ccc(CN2CC[NH+](C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1Cl)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1Cl)S[C@@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1Br)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1Br)S[C@@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)c(Cl)c1)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)c(Cl)c1)S[C@@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(I)cc1F)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(I)cc1F)S[C@@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)CSc1nc2c(c(=O)n1-c1cc3c(F)cccc3s1)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1ccc(F)cc1)S[C@@H](C)C2 | COCCNC(=O)CSc1nc2c(c(=O)n1-c1cc3c(F)cccc3s1)S[C@@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[C@H]1NN=C2C=CC=C[C@H]21)NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1 | O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 | O=C(/C=C/S[C@H]1NN=C2C=CC=C[C@H]21)NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C47"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NC[C@@H]2CCC[NH+](CC3=c4ccccc4=[NH+]C3)C2)nc1[C@H]1NN=C2C=CC=C[C@H]21 | O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 | O=Cc1sc(NC[C@@H]2CCC[NH+](CC3=c4ccccc4=[NH+]C3)C2)nc1[C@H]1NN=C2C=CC=C[C@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C47"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NC[C@@H]2CCC[NH+](CC3=c4ccccc4=[NH+]C3)C2)sc1[C@H]1NN=C2C=CC=C[C@H]21 | O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 | O=Cc1nc(NC[C@@H]2CCC[NH+](CC3=c4ccccc4=[NH+]C3)C2)sc1[C@H]1NN=C2C=CC=C[C@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C47"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)N/N=C/C[C@H]1NN=C2C=CC=C[C@H]21 | O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 | O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)N/N=C/C[C@H]1NN=C2C=CC=C[C@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C47"
} |
Can you make molecule O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 less soluble in water? The output molecule should be similar to the input molecule. | C1=CC2=NN[C@H](N3CCC(=NONC[C@@H]4CCC[NH+](CC5=c6ccccc6=[NH+]C5)C4)CC3)[C@@H]2C=C1 | O=C(NC[C@@H]1CCC[NH+](CC2=c3ccccc3=[NH+]C2)C1)[C@H]1NN=C2C=CC=C[C@H]21 | C1=CC2=NN[C@H](N3CCC(=NONC[C@@H]4CCC[NH+](CC5=c6ccccc6=[NH+]C5)C4)CC3)[C@@H]2C=C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C47"
} |
Can you make molecule COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2ncncc2Cl)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2ncncc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncncc1Cl",
"old_substring": "c16nccn1C"
} |
Can you make molecule COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2c(I)cnn2C)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2c(I)cnn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(I)cnn1C",
"old_substring": "c16nccn1C"
} |
Can you make molecule COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2cccn2C)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2cccn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccn1C",
"old_substring": "c16nccn1C"
} |
Can you make molecule COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2cnn(C)c2Cl)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2cnn(C)c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1ncc&c1Cl",
"old_substring": "c16nccn1C"
} |
Can you make molecule COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2cc(C)c(C)nn2)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2nccn2C)c1 | COc1cccc([C@@H](NC(=O)[C@@H](C)c2ccsc2)c2cc(C)c(C)nn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&nnc1C",
"old_substring": "c16nccn1C"
} |
Can you make molecule CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCCCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)NCCCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C6"
} |
Can you make molecule CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N=CCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)N=CCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C5C6"
} |
Can you make molecule CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCCCCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)NCCCCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C6"
} |
Can you make molecule CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NC1CC(NC(=O)c2cnn(-c3ccc(C)c(Cl)c3)c2C2CC2)C1 | CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)NC1CC(NC(=O)c2cnn(-c3ccc(C)c(Cl)c3)c2C2CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C6"
} |
Can you make molecule CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N=C(C)CCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)NCCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | CC(=O)N=C(C)CCNC(=O)c1cnn(-c2ccc(C)c(Cl)c2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C5C6"
} |
Can you make molecule Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC(=O)SN(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(CC(=O)SN(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C27=O"
} |
Can you make molecule Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CCCC(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(C(=O)CCCC(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C27=O"
} |
Can you make molecule Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(C)(C)CC(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(C(C)(C)CC(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C27=O"
} |
Can you make molecule Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(C)(C)CCC(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(C(C)(C)CCC(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C27=O"
} |
Can you make molecule Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](C)C(=O)SN(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc(C(=O)N(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | Cc1ccc([C@H](C)C(=O)SN(C)C)cc1OCC(=O)NCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C27=O"
} |
Can you make molecule Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1CC(=O)SNCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1CC(=O)SNCc1nc(-c2ccccc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1C(=O)CCCC(=O)NCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1C(=O)CCCC(=O)NCc1nc(-c2ccccc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1C(C)(C)CC(=O)NCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1C(C)(C)CC(=O)NCc1nc(-c2ccccc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1C(C)(C)CCC(=O)NCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1C(C)(C)CCC(=O)NCc1nc(-c2ccccc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1[C@H](C)C(=O)SNCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1C(=O)NCc1nc(-c2ccccc2)n[nH]1 | Cc1ccoc1[C@H](C)C(=O)SNCc1nc(-c2ccccc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1I | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1Br | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)c(I)c1 | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1cc(Cl)ccc1Cl | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)c(Cl)c1 | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)cc1 | COc1ccccc1[C@@H]1C[NH+]=C(N)N1c1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2cc(CC(=O)SNCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(CC(=O)SNCCCCC(N)=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2cc(C(=O)CCCC(=O)NCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(C(=O)CCCC(=O)NCCCCC(N)=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2cc(C(C)(C)CC(=O)NCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(C(C)(C)CC(=O)NCCCCC(N)=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2cc(C(C)(C)CCC(=O)NCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(C(C)(C)CCC(=O)NCCCCC(N)=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2cc([C@H](C)C(=O)SNCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc(C(=O)NCCCCC(N)=O)[nH]c2c1 | Cc1ccc2cc([C@H](C)C(=O)SNCCCCC(N)=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCCC1=C2OCCN2CC(C(=O)N2CCCC2)=CC(c2ccc(F)cc2)=C1 | [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 | [NH3+]CCCC1=C2OCCN2CC(C(=O)N2CCCC2)=CC(c2ccc(F)cc2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N245"
} |
Can you make molecule [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCCC1(c2ccc(F)cc2)CCN(C(=O)N2CCCC2)C1 | [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 | [NH3+]CCCC1(c2ccc(F)cc2)CCN(C(=O)N2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N245"
} |
Can you make molecule [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCCC1(c2ccc(F)cc2)CCCN(C(=O)N2CCCC2)C1 | [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 | [NH3+]CCCC1(c2ccc(F)cc2)CCCN(C(=O)N2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N245"
} |
Can you make molecule [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1c(C(=O)N2CCCC2)oc(CCC[NH3+])c1-c1ccc(F)cc1 | [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 | N#Cc1c(C(=O)N2CCCC2)oc(CCC[NH3+])c1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N245"
} |
Can you make molecule [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCCC1(c2ccc(F)cc2)CCC(=O)N(C(=O)N2CCCC2)C1 | [NH3+]CCCN(C(=O)N1CCCC1)c1ccc(F)cc1 | [NH3+]CCCC1(c2ccc(F)cc2)CCC(=O)N(C(=O)N2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N245"
} |
Can you make molecule CCN(CC)c1ccc(N)c(N)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(c1ccc(N)c(N)[nH+]1)C1(C)Cc2ccccc2C1 | CCN(CC)c1ccc(N)c(N)[nH+]1 | CCN(c1ccc(N)c(N)[nH+]1)C1(C)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCN(CC)c1ccc(N)c(N)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C1=CC2=CC=C2OC(C)(C)C1)c1ccc(N)c(N)[nH+]1 | CCN(CC)c1ccc(N)c(N)[nH+]1 | CCN(C1=CC2=CC=C2OC(C)(C)C1)c1ccc(N)c(N)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCN(CC)c1ccc(N)c(N)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(c1ccc(N)c(N)[nH+]1)N1CC(C)(C)Oc2ccccc21 | CCN(CC)c1ccc(N)c(N)[nH+]1 | CCN(c1ccc(N)c(N)[nH+]1)N1CC(C)(C)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CN&c2ccccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCN(CC)c1ccc(N)c(N)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(c1ccc(N)c(N)[nH+]1)N1CC(C)(C)Sc2ccccc21 | CCN(CC)c1ccc(N)c(N)[nH+]1 | CCN(c1ccc(N)c(N)[nH+]1)N1CC(C)(C)Sc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CN&c2ccccc2S1",
"old_substring": "CC2"
} |
Can you make molecule CCN(CC)c1ccc(N)c(N)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(c1ccc(N)c(N)[nH+]1)C1C2CCC1CC2 | CCN(CC)c1ccc(N)c(N)[nH+]1 | CCN(c1ccc(N)c(N)[nH+]1)C1C2CCC1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2CCC1CC2",
"old_substring": "CC2"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)Nc2cc[nH]c2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2cc[nH]c2)n(-c2ccccc2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc[nH]c1",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)Nc2nc(I)c(I)[nH]2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2nc(I)c(I)[nH]2)n(-c2ccccc2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Ic1nc&[nH]c1I",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)Nc2cn[nH]c(=O)c2Cl)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2cn[nH]c(=O)c2Cl)n(-c2ccccc2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn[nH]c(=O)c1Cl",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)Nc2ccc3[nH]ncc3c2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2ccc3[nH]ncc3c2)n(-c2ccccc2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2[nH]ncc2c1",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)Nc2nc3ccccc3[nH]2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2cn[nH]c2)n(-c2ccccc2C)n1 | Cc1cc(NC(=O)C(=O)Nc2nc3ccccc3[nH]2)n(-c2ccccc2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1ccc2[nH]c&nc2c1",
"old_substring": "c16cn[nH]c1"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+]1CCC(CCC)([C@@H]2CCC(=O)C2)C1 | CCC[NH+](CCC)[C@@H]1CCC(=O)C1 | CCC[NH+]1CCC(CCC)([C@@H]2CCC(=O)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH+]234"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+]1CCC[C@](CCC)([C@@H]2CCC(=O)C2)C1 | CCC[NH+](CCC)[C@@H]1CCC(=O)C1 | CCC[NH+]1CCC[C@](CCC)([C@@H]2CCC(=O)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH+]234"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1[nH+]cn(CCC)c1[C@@H]1CCC(=O)C1 | CCC[NH+](CCC)[C@@H]1CCC(=O)C1 | CCCc1[nH+]cn(CCC)c1[C@@H]1CCC(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH+]234"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc([C@@H]2CCC(=O)C2)n(CCC)[nH+]1 | CCC[NH+](CCC)[C@@H]1CCC(=O)C1 | CCCc1cc([C@@H]2CCC(=O)C2)n(CCC)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH+]234"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1[nH+]n(C)c(CCC)c1[C@@H]1CCC(=O)C1 | CCC[NH+](CCC)[C@@H]1CCC(=O)C1 | CCCc1[nH+]n(C)c(CCC)c1[C@@H]1CCC(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH+]234"
} |
Can you make molecule Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(N2CCC[C@H](NC(=O)N3CCC(c4noc(C)n4)CC3)C2)n1 | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 | Cc1csc(N2CCC[C@H](NC(=O)N3CCC(c4noc(C)n4)CC3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)cs1",
"old_substring": "c17cnn(C)c1"
} |
Can you make molecule Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4csc(C)n4)C3)CC2)no1 | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4csc(C)n4)C3)CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(C)n1",
"old_substring": "c17cnn(C)c1"
} |
Can you make molecule Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(N2CCC[C@H](NC(=O)N3CCC(c4noc(C)n4)CC3)C2)co1 | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 | Cc1nc(N2CCC[C@H](NC(=O)N3CCC(c4noc(C)n4)CC3)C2)co1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&coc(C)n1",
"old_substring": "c17cnn(C)c1"
} |
Can you make molecule Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnc(Cl)nc4Cl)C3)CC2)no1 | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnc(Cl)nc4Cl)C3)CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)nc1Cl",
"old_substring": "c17cnn(C)c1"
} |
Can you make molecule Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(n4nc(C)c(C)c4C)C3)CC2)no1 | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(c4cnn(C)c4)C3)CC2)no1 | Cc1nc(C2CCN(C(=O)N[C@H]3CCCN(n4nc(C)c(C)c4C)C3)CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn&c(C)c1C",
"old_substring": "c17cnn(C)c1"
} |
Can you make molecule COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1SCCS1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CCCCC1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1SCCCS1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1SCSCS1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CCCCCC1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CC1 | COC(=O)[C@H](NCC(F)(F)F)c1cncn1C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CC1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.