prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(COC(=O)c1cccc(F)c1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)c1cccc(F)c1)NC1SCCS1 | O=C(COC(=O)c1cccc(F)c1)NC1CC1 | O=C(COC(=O)c1cccc(F)c1)NC1SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(COC(=O)c1cccc(F)c1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)c1cccc(F)c1)N=C1CCC1 | O=C(COC(=O)c1cccc(F)c1)NC1CC1 | O=C(COC(=O)c1cccc(F)c1)N=C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(COC(=O)c1cccc(F)c1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)c1cccc(F)c1)NC1CCCCC1 | O=C(COC(=O)c1cccc(F)c1)NC1CC1 | O=C(COC(=O)c1cccc(F)c1)NC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(COC(=O)c1cccc(F)c1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)c1cccc(F)c1)N=C1CCCC1 | O=C(COC(=O)c1cccc(F)c1)NC1CC1 | O=C(COC(=O)c1cccc(F)c1)N=C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(COC(=O)c1cccc(F)c1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)c1cccc(F)c1)NC1SCCCS1 | O=C(COC(=O)c1cccc(F)c1)NC1CC1 | O=C(COC(=O)c1cccc(F)c1)NC1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2([NH2+]C3CCCCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]C3CCCCCC3)CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CCCC1"
} |
Can you make molecule Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2([NH2+]C3CCCCCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]C3CCCCCCC3)CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C15CCCC1"
} |
Can you make molecule Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2([NH2+]SC3=CCCCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]SC3=CCCCCC3)CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C15CCCC1"
} |
Can you make molecule Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2([NH2+]C3CCC(Cl)CC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]C3CCC(Cl)CC3)CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "C15CCCC1"
} |
Can you make molecule Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2([NH2+]CCC3=CCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]C3CCCC3)CCOCC2)cc1 | Clc1ccc(C2([NH2+]CCC3=CCCC3)CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCCC1",
"old_substring": "C15CCCC1"
} |
Can you make molecule NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H](NSC(=O)Cc1cnc2ccccc2n1)c1ccccc1 | NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 | NC(=O)[C@@H](NSC(=O)Cc1cnc2ccccc2n1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H](NC(=O)CCCC(=O)c1cnc2ccccc2n1)c1ccccc1 | NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 | NC(=O)[C@@H](NC(=O)CCCC(=O)c1cnc2ccccc2n1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)N[C@H](C(N)=O)c1ccccc1)c1cnc2ccccc2n1 | NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 | CC(C)(CC(=O)N[C@H](C(N)=O)c1ccccc1)c1cnc2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)N[C@H](C(N)=O)c1ccccc1)c1cnc2ccccc2n1 | NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 | CC(C)(CCC(=O)N[C@H](C(N)=O)c1ccccc1)c1cnc2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN[C@H](C(N)=O)c1ccccc1)c1cnc2ccccc2n1 | NC(=O)[C@@H](NC(=O)c1cnc2ccccc2n1)c1ccccc1 | C[C@H](C(=O)SN[C@H](C(N)=O)c1ccccc1)c1cnc2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(C(=O)[C@H]2CSC(=O)C2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@H]2CSC(=O)C2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSC(=O)C1",
"old_substring": "[C@@H]14CCS(=O)(=O)C1"
} |
Can you make molecule C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(C(=O)[C@@H]2CC(F)(F)CN2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2CC(F)(F)CN2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC(F)(F)CN1",
"old_substring": "[C@@H]14CCS(=O)(=O)C1"
} |
Can you make molecule C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(C(=O)[C@@H]2CCSC2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2CCSC2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@@H]14CCS(=O)(=O)C1"
} |
Can you make molecule C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(C(=O)[C@@H]2C=C(O)N=N2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2C=C(O)N=N2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(O)N=N1",
"old_substring": "[C@@H]14CCS(=O)(=O)C1"
} |
Can you make molecule C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(C(=O)[C@@H]2CC=CO2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2CCS(=O)(=O)C2)C[C@H](C)O1 | C[C@H]1CN(C(=O)[C@@H]2CC=CO2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC=CO1",
"old_substring": "[C@@H]14CCS(=O)(=O)C1"
} |
Can you make molecule COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2c(C)cn3c4c(=O)n(C(=O)C(C)C)c(=O)n(C)c4nc23)cc1 | COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 | COc1ccc(-n2c(C)cn3c4c(=O)n(C(=O)C(C)C)c(=O)n(C)c4nc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C6C(C)=O"
} |
Can you make molecule COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)n1c(=O)c2c(nc3n(-c4ccc(OC)cc4)c(C)cn23)n(C)c1=O | COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 | C=C(C)C(=O)n1c(=O)c2c(nc3n(-c4ccc(OC)cc4)c(C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C&=O",
"old_substring": "C6C(C)=O"
} |
Can you make molecule COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2c(C)cn3c4c(=O)n(C(=O)CC(C)C)c(=O)n(C)c4nc23)cc1 | COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 | COc1ccc(-n2c(C)cn3c4c(=O)n(C(=O)CC(C)C)c(=O)n(C)c4nc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&=O",
"old_substring": "C6C(C)=O"
} |
Can you make molecule COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2c(C)cn3c4c(=O)n(C(=O)CCC(C)C)c(=O)n(C)c4nc23)cc1 | COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 | COc1ccc(-n2c(C)cn3c4c(=O)n(C(=O)CCC(C)C)c(=O)n(C)c4nc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC&=O",
"old_substring": "C6C(C)=O"
} |
Can you make molecule COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC(=O)n1c(=O)c2c(nc3n(-c4ccc(OC)cc4)c(C)cn23)n(C)c1=O | COc1ccc(-n2c(C)cn3c4c(=O)n(CC(C)=O)c(=O)n(C)c4nc23)cc1 | C=C(C)CC(=O)n1c(=O)c2c(nc3n(-c4ccc(OC)cc4)c(C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC&=O",
"old_substring": "C6C(C)=O"
} |
Can you make molecule CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)SN1CCN(C(=O)c2cccc(F)c2)CC1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)SN1CCN(C(=O)c2cccc(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN=C1CC(=O)c1cccc(F)c1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN=C1CC(=O)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCCN(C(=O)c2cccc(F)c2)C1=O | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCCN(C(=O)c2cccc(F)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN=C1SC(=O)c1cccc(F)c1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN=C1SC(=O)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)C(C)(C)C1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)CC1 | CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCN(C(=O)c2cccc(F)c2)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(Cl)(Cl)Cl)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(Cl)(Cl)Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)CC(C)(C)C)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)CC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OCCCC(C)(C)C)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OCCCC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OCCCC(F)(F)F)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OCCCC(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OCCCCC(F)(F)F)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)N1CCC(CN(C)C(=O)OCCCCC(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | COCc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | COCSc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | CC(=O)Sc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | O=C(CS)c1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | COc1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | O=C(CI)c1cccc(CNC(=O)c2ccc([N+](=O)[O-])cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2I)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2Br)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)c(I)c2)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)c(I)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2cc(Cl)ccc2Cl)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2cc(Cl)ccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)c(Cl)c2)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)cc2)C1 | O=C(Cc1cc(F)ccc1F)N1CCO[C@@H](c2ccc(Cl)c(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CSCCN2C(=O)CC(C)(C)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | Cc1ccc([C@@H]2CSCCN2C(=O)CC(C)(C)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CSCCN2C(=O)CCC(C)(C)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | Cc1ccc([C@@H]2CSCCN2C(=O)CCC(C)(C)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CSCCN2C(=O)C[C@@H](Br)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | Cc1ccc([C@@H]2CSCCN2C(=O)C[C@@H](Br)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CSCCN2c2cc(C)n(N[C@@H]3[C@@H]4CCO[C@@H]4C3(C)C)c(=O)c2)o1 | Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | Cc1ccc([C@@H]2CSCCN2c2cc(C)n(N[C@@H]3[C@@H]4CCO[C@@H]4C3(C)C)c(=O)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CSCCN2c2c(C)n(N[C@@H]3[C@@H]4CCO[C@@H]4C3(C)C)ccc2=O)o1 | Cc1ccc([C@@H]2CSCCN2C(=O)N[C@@H]2[C@@H]3CCO[C@@H]3C2(C)C)o1 | Cc1ccc([C@@H]2CSCCN2c2c(C)n(N[C@@H]3[C@@H]4CCO[C@@H]4C3(C)C)ccc2=O)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)COCO2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)COCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COCO2",
"old_substring": "c17ccc2c(c1)OCCO2"
} |
Can you make molecule O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)COC2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COC2",
"old_substring": "c17ccc2c(c1)OCCO2"
} |
Can you make molecule O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1cc(F)cc2c1OCOC2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1cc(F)cc2c1OCOC2 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cc&c2c(c1)COCO2",
"old_substring": "c17ccc2c(c1)OCCO2"
} |
Can you make molecule O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)CCN2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)CCN2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)CCN2",
"old_substring": "c17ccc2c(c1)OCCO2"
} |
Can you make molecule O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)CCC2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)OCCO2 | O=C(CCc1nnc2ccc(NCc3ccccc3Cl)nn12)Nc1ccc2c(c1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)CCC2",
"old_substring": "c17ccc2c(c1)OCCO2"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC(C)(C)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | Cc1ccc(NC(=O)CC(C)(C)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCC(C)(C)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | Cc1ccc(NC(=O)CCC(C)(C)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C[C@@H](Br)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | Cc1ccc(NC(=O)C[C@@H](Br)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Nc2cc(C)n(NC(=O)[C@H](C)N3C[C@@H](C)O[C@@H](C)C3)c(=O)c2)cc1 | Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | Cc1ccc(Nc2cc(C)n(NC(=O)[C@H](C)N3C[C@@H](C)O[C@@H](C)C3)c(=O)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Nc2c(C)n(NC(=O)[C@H](C)N3C[C@@H](C)O[C@@H](C)C3)ccc2=O)cc1 | Cc1ccc(NC(=O)NC(=O)[C@H](C)N2C[C@@H](C)O[C@@H](C)C2)cc1 | Cc1ccc(Nc2c(C)n(NC(=O)[C@H](C)N3C[C@@H](C)O[C@@H](C)C3)ccc2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)Cc1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOSC(=O)Cc1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOC(=O)CCCC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOC(=O)CC(C)(C)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCC(C)(C)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOC(=O)CCC(C)(C)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)[C@@H](C)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | CCOSC(=O)[C@@H](C)c1c(C)[nH]c(C(=O)C(C#N)=Cc2cccc(F)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CN1CCN(C(=O)Nc2cccnc2)CC1)C(=O)c1ccccc1 | O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 | C[C@H](CN1CCN(C(=O)Nc2cccnc2)CC1)C(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C5[C@@H]7O"
} |
Can you make molecule O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN1CCN(C(=O)Nc2cccnc2)CC1)CC(=O)c1ccccc1 | O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 | C[C@@H](CCN1CCN(C(=O)Nc2cccnc2)CC1)CC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C5[C@@H]7O"
} |
Can you make molecule O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(c1ccccc1)[C@H](O)CN1CCN(C(=O)Nc2cccnc2)CC1 | O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 | CC(C)(c1ccccc1)[C@H](O)CN1CCN(C(=O)Nc2cccnc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C5[C@@H]7O"
} |
Can you make molecule O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)c1ccccc1)N1CCN(C(=O)Nc2cccnc2)CC1 | O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 | CC[C@H](CC(=O)c1ccccc1)N1CCN(C(=O)Nc2cccnc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&CC&=O",
"old_substring": "C5[C@@H]7O"
} |
Can you make molecule O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)N1CCN(C(=O)Nc2cccnc2)CC1)C(=O)c1ccccc1 | O=C(Nc1cccnc1)N1CCN(C[C@H](O)c2ccccc2)CC1 | C[C@@H](CC(=O)N1CCN(C(=O)Nc2cccnc2)CC1)C(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C5[C@@H]7O"
} |
Can you make molecule CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)SN1CCN(c2nc3cccnc3s2)CC1 | CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 | CCCCC(=O)SN1CCN(c2nc3cccnc3s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CC(c2nc3cccnc3s2)C1 | CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 | CCCCC(=O)N1CC(c2nc3cccnc3s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCCN(c2nc3cccnc3s2)C1=O | CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 | CCCCC(=O)N1CCCN(c2nc3cccnc3s2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCN=C1Sc1nc2cccnc2s1 | CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 | CCCCC(=O)N1CCN=C1Sc1nc2cccnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCN(c2nc3cccnc3s2)C(C)(C)C1 | CCCCC(=O)N1CCN(c2nc3cccnc3s2)CC1 | CCCCC(=O)N1CCN(c2nc3cccnc3s2)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N14CCN5CC1"
} |
Can you make molecule Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCCc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1CCCc1noc(CSc2ncnc3nc[nH]c23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C57"
} |
Can you make molecule Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCCCc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1CCCCc1noc(CSc2ncnc3nc[nH]c23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C57"
} |
Can you make molecule Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCCCCc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1CCCCCc1noc(CSc2ncnc3nc[nH]c23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C57"
} |
Can you make molecule Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C1CC(c2noc(CSc3ncnc4nc[nH]c34)n2)C1 | Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1C1CC(c2noc(CSc3ncnc4nc[nH]c34)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C57"
} |
Can you make molecule Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1NC(=S)Sc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1Cc1noc(CSc2ncnc3nc[nH]c23)n1 | Cc1ccccc1NC(=S)Sc1noc(CSc2ncnc3nc[nH]c23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C57"
} |
Can you make molecule CCOC(=O)C(C#N)=C(Cl)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)C1CC12CCCCOC2)=C(Cl)C(F)(F)F | CCOC(=O)C(C#N)=C(Cl)C(F)(F)F | N#CC(C(=O)C1CC12CCCCOC2)=C(Cl)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule CCOC(=O)C(C#N)=C(Cl)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)C1CCC12CCOOCCO2)=C(Cl)C(F)(F)F | CCOC(=O)C(C#N)=C(Cl)C(F)(F)F | N#CC(C(=O)C1CCC12CCOOCCO2)=C(Cl)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC2(CC1)OCCO2",
"old_substring": "CC2"
} |
Can you make molecule CCOC(=O)C(C#N)=C(Cl)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)N1CC12CCCCCO2)=C(Cl)C(F)(F)F | CCOC(=O)C(C#N)=C(Cl)C(F)(F)F | N#CC(C(=O)N1CC12CCCCCO2)=C(Cl)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC12CCCCC2",
"old_substring": "CC2"
} |
Can you make molecule CCOC(=O)C(C#N)=C(Cl)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)N1CCOC12CCCCCO2)=C(Cl)C(F)(F)F | CCOC(=O)C(C#N)=C(Cl)C(F)(F)F | N#CC(C(=O)N1CCOC12CCCCCO2)=C(Cl)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC12CCCCC2",
"old_substring": "CC2"
} |
Can you make molecule CCOC(=O)C(C#N)=C(Cl)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)N1CC12CCCCCOC2)=C(Cl)C(F)(F)F | CCOC(=O)C(C#N)=C(Cl)C(F)(F)F | N#CC(C(=O)N1CC12CCCCCOC2)=C(Cl)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC2(CCCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cc2F)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cc2F)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1F",
"old_substring": "c17ccc(F)cn1"
} |
Can you make molecule COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cc2Cl)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cc2Cl)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c17ccc(F)cn1"
} |
Can you make molecule COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cc2Br)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cc2Br)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c17ccc(F)cn1"
} |
Can you make molecule COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)c3cccnc23)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)c3cccnc23)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c2cccnc12",
"old_substring": "c17ccc(F)cn1"
} |
Can you make molecule COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2cccc(Cl)n2)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2ccc(F)cn2)c(OC)c1 | COc1ccc([C@@H](C)[NH2+][C@@H](C)c2cccc(Cl)n2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Cl)n1",
"old_substring": "c17ccc(F)cn1"
} |
Can you make molecule Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)ccc1Br | Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 | Fc1cc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cc&ccc1Br",
"old_substring": "Fc1ccc4cc1"
} |
Can you make molecule Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)c2ccccc12 | Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 | Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1ccc&c2ccccc12",
"old_substring": "Fc1ccc4cc1"
} |
Can you make molecule Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc(F)c([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)c(Br)c1 | Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 | Fc1cc(F)c([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cc(F)c&c(Br)c1",
"old_substring": "Fc1ccc4cc1"
} |
Can you make molecule Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc2c(cc1[C@H]1Oc3ccc(Cl)cc3C3=C1[C@H](c1cccnc1)N1NC=NC1=N3)CCCC2 | Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 | Fc1cc2c(cc1[C@H]1Oc3ccc(Cl)cc3C3=C1[C@H](c1cccnc1)N1NC=NC1=N3)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cc2c(cc1&)CCCC2",
"old_substring": "Fc1ccc4cc1"
} |
Can you make molecule Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc(F)c([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)c(F)c1Cl | Fc1ccc([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)cc1 | Fc1cc(F)c([C@H]2Oc3ccc(Cl)cc3C3=C2[C@H](c2cccnc2)N2NC=NC2=N3)c(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cc(F)c&c(F)c1Cl",
"old_substring": "Fc1ccc4cc1"
} |
Can you make molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)n(C)cc1-c1nc2c(s1)CN(C(=O)[C@H](C)Oc1ccc(F)c(F)c1)C2 | Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 | Cc1cc(=O)n(C)cc1-c1nc2c(s1)CN(C(=O)[C@H](C)Oc1ccc(F)c(F)c1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N25"
} |
Can you make molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)n(C)cc1-c1ccc2c(c1)CCN2C(=O)[C@H](C)Oc1ccc(F)c(F)c1 | Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 | Cc1cc(=O)n(C)cc1-c1ccc2c(c1)CCN2C(=O)[C@H](C)Oc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N25"
} |
Can you make molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)n(C)cc1-c1snc2sc(C(=O)[C@H](C)Oc3ccc(F)c(F)c3)c(N)c12 | Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 | Cc1cc(=O)n(C)cc1-c1snc2sc(C(=O)[C@H](C)Oc3ccc(F)c(F)c3)c(N)c12 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N25"
} |
Can you make molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)n(C)cc1-c1ccc2c(c1)N(C(=O)[C@H](C)Oc1ccc(F)c(F)c1)CCS2 | Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 | Cc1cc(=O)n(C)cc1-c1ccc2c(c1)N(C(=O)[C@H](C)Oc1ccc(F)c(F)c1)CCS2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "N25"
} |
Can you make molecule Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)n(C)cc1-c1cc2n(n1)CCCN(C(=O)[C@H](C)Oc1ccc(F)c(F)c1)C2 | Cc1cc(=O)n(C)cc1NC(=O)[C@H](C)Oc1ccc(F)c(F)c1 | Cc1cc(=O)n(C)cc1-c1cc2n(n1)CCCN(C(=O)[C@H](C)Oc1ccc(F)c(F)c1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc2C1",
"old_substring": "N25"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.