prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ccccc2n1CCC(=O)N1CCC(CCO)([C@]2(C)CCS(=O)(=O)C2)C1 | Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 | Cc1cc2ccccc2n1CCC(=O)N1CCC(CCO)([C@]2(C)CCS(=O)(=O)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N345"
} |
Can you make molecule Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ccccc2n1CCC(=O)N1CCCC(CCO)([C@]2(C)CCS(=O)(=O)C2)C1 | Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 | Cc1cc2ccccc2n1CCC(=O)N1CCCC(CCO)([C@]2(C)CCS(=O)(=O)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N345"
} |
Can you make molecule Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ccccc2n1CCC(=O)c1oc(CCO)c([C@]2(C)CCS(=O)(=O)C2)c1C#N | Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 | Cc1cc2ccccc2n1CCC(=O)c1oc(CCO)c([C@]2(C)CCS(=O)(=O)C2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N345"
} |
Can you make molecule Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ccccc2n1CCC(=O)N1CC(CCO)([C@]2(C)CCS(=O)(=O)C2)CCC1=O | Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 | Cc1cc2ccccc2n1CCC(=O)N1CC(CCO)([C@]2(C)CCS(=O)(=O)C2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N345"
} |
Can you make molecule Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ccccc2n1CCC(=O)c1nc(CCO)nc([C@]2(C)CCS(=O)(=O)C2)c1C#N | Cc1cc2ccccc2n1CCC(=O)N(CCO)[C@]1(C)CCS(=O)(=O)C1 | Cc1cc2ccccc2n1CCC(=O)c1nc(CCO)nc([C@]2(C)CCS(=O)(=O)C2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&nc&nc1&",
"old_substring": "N345"
} |
Can you make molecule CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC(=O)[C@@H](C)[PH2]=O)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)[C@@H](C)[PH2]=O)NC(=O)[C@@H]1OCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "O=[PH2][C@@H]2C&",
"old_substring": "O2C"
} |
Can you make molecule CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC(=O)SCOC)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)SCOC)NC(=O)[C@@H]1OCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "O2C"
} |
Can you make molecule CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC(=O)OCCl)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)OCCl)NC(=O)[C@@H]1OCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "O&CCl",
"old_substring": "O2C"
} |
Can you make molecule CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC(=O)C(=O)CCCl)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)C(=O)CCCl)NC(=O)[C@@H]1OCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCl",
"old_substring": "O2C"
} |
Can you make molecule CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC(=O)OC(=S)S)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)OC)NC(=O)[C@@H]1OCC[C@H]1C | CCC[C@@H](CC(=O)OC(=S)S)NC(=O)[C@@H]1OCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S",
"old_substring": "O2C"
} |
Can you make molecule COCCOc1cccc(C[NH+]2CCC2(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSCCOc1cccc(C[NH+]2CCC2(C)C)c1 | COCCOc1cccc(C[NH+]2CCC2(C)C)c1 | COCSCCOc1cccc(C[NH+]2CCC2(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COCCOc1cccc(C[NH+]2CCC2(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCCOc1cccc(C[NH+]2CCC2(C)C)c1 | COCCOc1cccc(C[NH+]2CCC2(C)C)c1 | CC(=O)SCCOc1cccc(C[NH+]2CCC2(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COCCOc1cccc(C[NH+]2CCC2(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC[NH+]1Cc1cccc(OCCC(=O)CI)c1 | COCCOc1cccc(C[NH+]2CCC2(C)C)c1 | CC1(C)CC[NH+]1Cc1cccc(OCCC(=O)CI)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCCOc1cccc(C[NH+]2CCC2(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC[NH+]1Cc1cccc(OCCC2OCCCO2)c1 | COCCOc1cccc(C[NH+]2CCC2(C)C)c1 | CC1(C)CC[NH+]1Cc1cccc(OCCC2OCCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COCCOc1cccc(C[NH+]2CCC2(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC[NH+]1Cc1cccc(OCCC(=O)CCl)c1 | COCCOc1cccc(C[NH+]2CCC2(C)C)c1 | CC1(C)CC[NH+]1Cc1cccc(OCCC(=O)CCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(C[NH+]2CC[C@H](C(C)(C)CCBr)C2)s1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](C(C)(C)CCBr)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "C7C(C)C"
} |
Can you make molecule COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)[C@H]1CC[NH+](Cc2ccc(CC(=O)OC)s2)C1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 | CCCC(C)(C)[C@H]1CC[NH+](Cc2ccc(CC(=O)OC)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C7C(C)C"
} |
Can you make molecule COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)(C)CBr)C2)s1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)(C)CBr)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)CBr",
"old_substring": "C7C(C)C"
} |
Can you make molecule COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(C[NH+]2CC[C@H](C(C(C)C)C(C)C)C2)s1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](C(C(C)C)C(C)C)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "C7C(C)C"
} |
Can you make molecule COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(C[NH+]2CC[C@H](C3CCC(C)(C)CC3)C2)s1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](CC(C)C)C2)s1 | COC(=O)Cc1ccc(C[NH+]2CC[C@H](C3CCC(C)(C)CC3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "C7C(C)C"
} |
Can you make molecule Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2Cl)no1 | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2Cl)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccc(I)cc2)no1 | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccc(I)cc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2noc(CCC(=O)N3CCC[C@@H]3c3c(C)noc3C)n2)cc1I | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 | Cc1ccc(-c2noc(CCC(=O)N3CCC[C@@H]3c3c(C)noc3C)n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2cccc(Br)c2)no1 | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2cccc(Br)c2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2noc(CCC(=O)N3CCC[C@@H]3c3c(C)noc3C)n2)c1C | Cc1noc(C)c1[C@H]1CCCN1C(=O)CCc1nc(-c2ccccc2)no1 | Cc1cccc(-c2noc(CCC(=O)N3CCC[C@@H]3c3c(C)noc3C)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCNSC(=O)Cc2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNSC(=O)Cc2cc(C)n(C3CC3)c2C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCNC(=O)CCCC(=O)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNC(=O)CCCC(=O)c2cc(C)n(C3CC3)c2C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCNC(=O)CC(C)(C)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNC(=O)CC(C)(C)c2cc(C)n(C3CC3)c2C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCNC(=O)CCC(C)(C)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNC(=O)CCC(C)(C)c2cc(C)n(C3CC3)c2C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCNSC(=O)[C@@H](C)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNC(=O)c2cc(C)n(C3CC3)c2C)cc1OC | COc1ccc(CCNSC(=O)[C@@H](C)c2cc(C)n(C3CC3)c2C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(CC(=O)SN[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | Cn1cc(CC(=O)SN[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)CCCC(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | Cn1cc(C(=O)CCCC(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(C)(C)CC(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | Cn1cc(C(C)(C)CC(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(C)(C)CCC(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | Cn1cc(C(C)(C)CCC(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN[C@H]1C[C@H]2CC[C@@H]1O2)c1cn(C)nc1-c1ccccc1 | Cn1cc(C(=O)N[C@H]2C[C@H]3CC[C@@H]2O3)c(-c2ccccc2)n1 | C[C@H](C(=O)SN[C@H]1C[C@H]2CC[C@@H]1O2)c1cn(C)nc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1Cl | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1Br | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)c(Cl)c1 | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(I)cc1F | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(I)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1cc2c(F)cccc2s1 | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1ccc(F)cc1 | C[C@@H](Nc1ccc(CO)cc1)C(=O)NCCc1cc2c(F)cccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c17ccc(F)cc1"
} |
Can you make molecule Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc(C=Cc3ccsc3)[nH]c2c1 | Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 | Cc1cnc2nc(C=Cc3ccsc3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccsc1",
"old_substring": "c15ccsc1"
} |
Can you make molecule Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc(Cc3cc(C)c(C)s3)[nH]c2c1 | Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 | Cc1cnc2nc(Cc3cc(C)c(C)s3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "c15ccsc1"
} |
Can you make molecule Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc(Cc3cc(C)sc3C)[nH]c2c1 | Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 | Cc1cnc2nc(Cc3cc(C)sc3C)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)sc1C",
"old_substring": "c15ccsc1"
} |
Can you make molecule Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc(Cc3sccc3Br)[nH]c2c1 | Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 | Cc1cnc2nc(Cc3sccc3Br)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c15ccsc1"
} |
Can you make molecule Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc(Cc3cc4sccc4s3)[nH]c2c1 | Cc1cnc2nc(Cc3ccsc3)[nH]c2c1 | Cc1cnc2nc(Cc3cc4sccc4s3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c15ccsc1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NNC(=O)n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)cc1Cl | Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C | Cc1ccc(NNC(=O)n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(NNC&=O)cc1Cl",
"old_substring": "Cc1ccc([N+](=O)[O-])cc16"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(-n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)c1 | Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C | Cc1ccc(C)c(-n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)c&c1",
"old_substring": "Cc1ccc([N+](=O)[O-])cc16"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(-n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)c1 | Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C | Cc1ccc(I)c(-n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccc([N+](=O)[O-])cc16"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c(-n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)c1 | Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C | Cc1ccc(Br)c(-n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccc([N+](=O)[O-])cc16"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)c(C)cc1I | Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C2C(=N)N3N=C(c4ccccc4)SC3=NC2=O)c1C | Cc1cc(-n2c(C)cc(C=C3C(=N)N4N=C(c5ccccc5)SC4=NC3=O)c2C)c(C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1ccc([N+](=O)[O-])cc16"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCBr)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | CC(C)(CCBr)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "CC5(C)C"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | CCCC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CC5(C)C"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1)C(C)C | CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | CC(C)C(OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC5(C)C"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | CC(C)CCCC(=O)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC5(C)C"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(OC(=O)NC[C@@H]2CCC[NH+](Cc3ccccc3N3CCOCC3)C2)CC1 | CC(C)(C)OC(=O)NC[C@@H]1CCC[NH+](Cc2ccccc2N2CCOCC2)C1 | CC1(C)CCC(OC(=O)NC[C@@H]2CCC[NH+](Cc3ccccc3N3CCOCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC5(C)C"
} |
Can you make molecule c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C[C@@H]1CCOC1)C(=S)Sc1nnnn1-c1ccccc1 | c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 | CN(C[C@@H]1CCOC1)C(=S)Sc1nnnn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1oc(C[C@@H]2CCOC2)cc1-c1nnnn1-c1ccccc1 | c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 | Nc1oc(C[C@@H]2CCOC2)cc1-c1nnnn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N34"
} |
Can you make molecule c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(-n2nnnc2SC2=NCCN2C[C@@H]2CCOC2)cc1 | c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 | c1ccc(-n2nnnc2SC2=NCCN2C[C@@H]2CCOC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N34"
} |
Can you make molecule c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(-n2nnnc2C2CCN(CC[C@@H]3CCOC3)CC2)cc1 | c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 | c1ccc(-n2nnnc2C2CCN(CC[C@@H]3CCOC3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N34"
} |
Can you make molecule c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C[C@@H]2CCOC2)cccc1-c1nnnn1-c1ccccc1 | c1ccc(-n2nnnc2NC[C@@H]2CCOC2)cc1 | Nc1c(C[C@@H]2CCOC2)cccc1-c1nnnn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N34"
} |
Can you make molecule CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc2c(c1-c1nc(C)cs1)CCN(C(=O)CNC(=O)NCC1CCCC1)C2 | CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 | CCc1sc2c(c1-c1nc(C)cs1)CCN(C(=O)CNC(=O)NCC1CCCC1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c(sc&c2&)C1",
"old_substring": "N258"
} |
Can you make molecule CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(-c2nc(C)cs2)cc2c1OCCN(C(=O)CNC(=O)NCC1CCCC1)C2 | CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 | CCc1cc(-c2nc(C)cs2)cc2c1OCCN(C(=O)CNC(=O)NCC1CCCC1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N258"
} |
Can you make molecule CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(c2nc(C)cs2)CCN(C(=O)CNC(=O)NCC2CCCC2)C1 | CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 | CCC1(c2nc(C)cs2)CCN(C(=O)CNC(=O)NCC2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N258"
} |
Can you make molecule CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(c2nc(C)cs2)CCCN(C(=O)CNC(=O)NCC2CCCC2)C1 | CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 | CCC1(c2nc(C)cs2)CCCN(C(=O)CNC(=O)NCC2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N258"
} |
Can you make molecule CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(C(=O)CNC(=O)NCC2CCCC2)c(C#N)c1-c1nc(C)cs1 | CCN(C(=O)CNC(=O)NCC1CCCC1)c1nc(C)cs1 | CCc1oc(C(=O)CNC(=O)NCC2CCCC2)c(C#N)c1-c1nc(C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N258"
} |
Can you make molecule O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(-c2ccc(C(F)(F)F)c(Cl)c2Cl)cc1 | O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 | O=Cc1ccc(-c2ccc(C(F)(F)F)c(Cl)c2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c(Cl)c1Cl",
"old_substring": "c14cc3cc(Cl)n1"
} |
Can you make molecule O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)c2Cl)cc1 | O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 | O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)c2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(Cl)c1Cl",
"old_substring": "c14cc3cc(Cl)n1"
} |
Can you make molecule O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(F)(F)F)cc(-c2ccc(C=O)cc2)c1I | O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 | Cc1cc(C(F)(F)F)cc(-c2ccc(C=O)cc2)c1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(C)c1I",
"old_substring": "c14cc3cc(Cl)n1"
} |
Can you make molecule O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(-c2ccc3c(Cl)c(C(F)(F)F)sc3c2)cc1 | O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 | O=Cc1ccc(-c2ccc3c(Cl)c(C(F)(F)F)sc3c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(Cl)c&sc2c1",
"old_substring": "c14cc3cc(Cl)n1"
} |
Can you make molecule O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(-c2cc3cc(Cl)cc(C(F)(F)F)c3o2)cc1 | O=Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)n2)cc1 | O=Cc1ccc(-c2cc3cc(Cl)cc(C(F)(F)F)c3o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Cl)cc&c2o1",
"old_substring": "c14cc3cc(Cl)n1"
} |
Can you make molecule C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCN1S(=O)(=O)c1ccc(CC#N)cc1 | C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 | C[C@H]1CCCCN1S(=O)(=O)c1ccc(CC#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCCN1&",
"old_substring": "C[C@H]1COCCN12"
} |
Can you make molecule C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CSCCN1S(=O)(=O)c1ccc(CC#N)cc1 | C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 | C[C@H]1CSCCN1S(=O)(=O)c1ccc(CC#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CSCCN1&",
"old_substring": "C[C@H]1COCCN12"
} |
Can you make molecule C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(S(=O)(=O)c2ccc(CC#N)cc2)C1 | C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 | C[C@H]1CCCN(S(=O)(=O)c2ccc(CC#N)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCN&C1",
"old_substring": "C[C@H]1COCCN12"
} |
Can you make molecule C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN1S(=O)(=O)c1ccc(CC#N)cc1 | C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 | C[C@@H]1CCCN1S(=O)(=O)c1ccc(CC#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCN1&",
"old_substring": "C[C@H]1COCCN12"
} |
Can you make molecule C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(S(=O)(=O)c2ccc(CC#N)cc2)C1 | C[C@H]1COCCN1S(=O)(=O)c1ccc(CC#N)cc1 | C[C@@H]1CCCN(S(=O)(=O)c2ccc(CC#N)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCN&C1",
"old_substring": "C[C@H]1COCCN12"
} |
Can you make molecule C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@](O)(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C1 | C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 | C[C@H]1CC[C@@](O)(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CC[C@]&(O)C1",
"old_substring": "C[C@H]1CN4C[C@@H](C)O1"
} |
Can you make molecule C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@@H](C)CCN1c1oc(-c2ccccc2)nc1S(=O)(=O)c1ccc2c(c1)OCCO2 | C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 | C[C@@H]1[C@@H](C)CCN1c1oc(-c2ccccc2)nc1S(=O)(=O)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&[C@@H]1C",
"old_substring": "C[C@H]1CN4C[C@@H](C)O1"
} |
Can you make molecule C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCO[C@H](c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)O1 | C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 | C[C@H]1CCO[C@H](c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCO[C@H]&O1",
"old_substring": "C[C@H]1CN4C[C@@H](C)O1"
} |
Can you make molecule C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1OC(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)O[C@@H]1C | C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 | C[C@H]1OC(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)O[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1OC&O[C@@H]1C",
"old_substring": "C[C@H]1CN4C[C@@H](C)O1"
} |
Can you make molecule C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H](c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)CCO1 | C[C@@H]1CN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)C[C@H](C)O1 | C[C@@H]1C[C@H](c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccc3c(c2)OCCO3)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1C[C@H]&CCO1",
"old_substring": "C[C@H]1CN4C[C@@H](C)O1"
} |
Can you make molecule C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccc(F)c(F)c1)[NH2+]C[C@@H](C)[S@+](C)[O-] | C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] | C[C@H](CC(C)(C)c1ccc(F)c(F)c1)[NH2+]C[C@@H](C)[S@+](C)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]24"
} |
Can you make molecule C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC[NH2+]C[C@@H](C)[S@+](C)[O-])CC(=O)c1ccc(F)c(F)c1 | C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] | C[C@@H](CC[NH2+]C[C@@H](C)[S@+](C)[O-])CC(=O)c1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]24"
} |
Can you make molecule C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[NH2+]CC[C@H](Cl)c1ccc(F)c(F)c1)[S@+](C)[O-] | C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] | C[C@H](C[NH2+]CC[C@H](Cl)c1ccc(F)c(F)c1)[S@+](C)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]24"
} |
Can you make molecule C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1ccc(F)c(F)c1)[NH2+]C[C@@H](C)[S@+](C)[O-] | C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] | CCC[C@H](CC(=O)c1ccc(F)c(F)c1)[NH2+]C[C@@H](C)[S@+](C)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]24"
} |
Can you make molecule C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccc(F)c(F)c1)[NH2+]C[C@@H](C)[S@+](C)[O-] | C[C@H](C[NH2+][C@H](C)c1ccc(F)c(F)c1)[S@+](C)[O-] | CC(C)[C@H](CCc1ccc(F)c(F)c1)[NH2+]C[C@@H](C)[S@+](C)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]24"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1ccsc1NC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1ccsc1NC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&(=O)(=O)c1ccsc1&",
"old_substring": "S5(=O)(=O)CC4"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1ccc(NC(=O)[C@H]2CC(=O)N(c3cccc(F)c3)C2)o1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1ccc(NC(=O)[C@H]2CC(=O)N(c3cccc(F)c3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&(=O)(=O)c1ccc&o1",
"old_substring": "S5(=O)(=O)CC4"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1cc(NC(=O)[C@H]2CC(=O)N(c3cccc(F)c3)C2)co1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1cc(NC(=O)[C@H]2CC(=O)N(c3cccc(F)c3)C2)co1 | 102 | {
"fragment_index": 0,
"new_substring": "S&(=O)(=O)c1cc&co1",
"old_substring": "S5(=O)(=O)CC4"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1ccccc1NC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)c1ccccc1NC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&(=O)(=O)c1ccccc1&",
"old_substring": "S5(=O)(=O)CC4"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1SC(=O)CNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | C[C@@H]1Cc2ccccc2N1S(=O)(=O)CCNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | C[C@@H]1Cc2ccccc2N1SC(=O)CNC(=O)[C@H]1CC(=O)N(c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "S5(=O)(=O)CC4"
} |
Can you make molecule C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc2ccccc2c1)C1(C2CC2)CCN(C(=O)NC[C@H]2CCCO2)C1 | C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 | C[C@@H](c1ccc2ccccc2c1)C1(C2CC2)CCN(C(=O)NC[C@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N357"
} |
Can you make molecule C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc2ccccc2c1)C1(C2CC2)CCCN(C(=O)NC[C@H]2CCCO2)C1 | C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 | C[C@@H](c1ccc2ccccc2c1)C1(C2CC2)CCCN(C(=O)NC[C@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N357"
} |
Can you make molecule C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc2ccccc2c1)c1oc(C(=O)NC[C@H]2CCCO2)c(C#N)c1C1CC1 | C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 | C[C@@H](c1ccc2ccccc2c1)c1oc(C(=O)NC[C@H]2CCCO2)c(C#N)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N357"
} |
Can you make molecule C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc2ccccc2c1)C1(C2CC2)CCC(=O)N(C(=O)NC[C@H]2CCCO2)C1 | C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 | C[C@@H](c1ccc2ccccc2c1)C1(C2CC2)CCC(=O)N(C(=O)NC[C@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N357"
} |
Can you make molecule C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc2ccccc2c1)[C@@]1(C2CC2)CCCN(C(=O)NC[C@H]2CCCO2)C1 | C[C@@H](c1ccc2ccccc2c1)N(C(=O)NC[C@H]1CCCO1)C1CC1 | C[C@@H](c1ccc2ccccc2c1)[C@@]1(C2CC2)CCCN(C(=O)NC[C@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N357"
} |
Can you make molecule C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NCc1nnc(-c2ccccc2Cl)s1)c1ccc(-c2ccccc2)o1 | C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 | C[C@@H](NCc1nnc(-c2ccccc2Cl)s1)c1ccc(-c2ccccc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NCc1nnc(-c2ccc(I)cc2)s1)c1ccc(-c2ccccc2)o1 | C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 | C[C@@H](NCc1nnc(-c2ccc(I)cc2)s1)c1ccc(-c2ccccc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc(CN[C@H](C)c3ccc(-c4ccccc4)o3)s2)cc1I | C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 | Cc1ccc(-c2nnc(CN[C@H](C)c3ccc(-c4ccccc4)o3)s2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NCc1nnc(-c2cccc(Br)c2)s1)c1ccc(-c2ccccc2)o1 | C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 | C[C@@H](NCc1nnc(-c2cccc(Br)c2)s1)c1ccc(-c2ccccc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nnc(CN[C@H](C)c3ccc(-c4ccccc4)o3)s2)c1C | C[C@@H](NCc1nnc(-c2ccccc2)s1)c1ccc(-c2ccccc2)o1 | Cc1cccc(-c2nnc(CN[C@H](C)c3ccc(-c4ccccc4)o3)s2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.