prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1sc(C(=O)NCc2ccnc(OC(C)(C)C)c2)cc1C#N | CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 | CC(C)c1sc(C(=O)NCc2ccnc(OC(C)(C)C)c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N26C"
} |
Can you make molecule CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(C(=O)NCc2ccnc(OC(C)(C)C)c2)cc1C#N | CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 | CC(C)c1ccc(C(=O)NCc2ccnc(OC(C)(C)C)c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N26C"
} |
Can you make molecule CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N1CCC(=NOC(=O)NCc2ccnc(OC(C)(C)C)c2)CC1 | CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 | CC(C)N1CCC(=NOC(=O)NCc2ccnc(OC(C)(C)C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N26C"
} |
Can you make molecule CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc(C(=O)NCc2ccnc(OC(C)(C)C)c2)cnc1C#N | CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 | CC(C)c1cc(C(=O)NCc2ccnc(OC(C)(C)C)c2)cnc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N26C"
} |
Can you make molecule CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1=CCCN(C(=O)NCc2ccnc(OC(C)(C)C)c2)C1 | CC(C)N(C)C(=O)NCc1ccnc(OC(C)(C)C)c1 | CC(C)CC1=CCCN(C(=O)NCc2ccnc(OC(C)(C)C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N26C"
} |
Can you make molecule COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)cc1I | COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 | COc1ccc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c13ccccc17"
} |
Can you make molecule COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)ccc1Br | COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 | COc1cc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c13ccccc17"
} |
Can you make molecule COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)cc1Cl | COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 | COc1ccc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c13ccccc17"
} |
Can you make molecule COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)c1Br | COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 | COc1cccc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c13ccccc17"
} |
Can you make molecule COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)c1Cl | COc1ccccc1[C@H](C)NC(=O)C[NH+](C)C1CCS(=O)(=O)CC1 | COc1cccc([C@H](C)NC(=O)C[NH+](C)C2CCS(=O)(=O)CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c13ccccc17"
} |
Can you make molecule Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCNSC(=O)[C@@H](C)NC(=O)C1CCCC1 | Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 | Cc1ccccc1CCNSC(=O)[C@@H](C)NC(=O)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C2(=O)[C@H]5C"
} |
Can you make molecule Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCNC(=O)[C@H](C)CCNC(=O)C1CCCC1 | Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 | Cc1ccccc1CCNC(=O)[C@H](C)CCNC(=O)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C2(=O)[C@H]5C"
} |
Can you make molecule Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCNC(=O)[C@@H](C)CCNC(=O)C1CCCC1 | Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 | Cc1ccccc1CCNC(=O)[C@@H](C)CCNC(=O)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](C)CC&",
"old_substring": "C2(=O)[C@H]5C"
} |
Can you make molecule Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCNC(=O)C[C@@H](Br)NC(=O)C1CCCC1 | Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 | Cc1ccccc1CCNC(=O)C[C@@H](Br)NC(=O)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C2(=O)[C@H]5C"
} |
Can you make molecule Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCN[C@@H](C)CCNC(=O)C1CCCC1 | Cc1ccccc1CCNC(=O)[C@@H](C)NC(=O)C1CCCC1 | Cc1ccccc1CCN[C@@H](C)CCNC(=O)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C2(=O)[C@H]5C"
} |
Can you make molecule Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCCCC3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCCCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCCCCC3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(SC3=CCCCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(SC3=CCCCCC3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCC(Cl)CC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCC(Cl)CC3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(CCC3=CCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(C3CCCC3)C2=O)C1 | Cn1cnnc1C[NH+]1CC[C@]2(CCCN(CCC3=CCCC3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CNC(=O)CC(C)(C)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | COc1ccc(CNC(=O)CC(C)(C)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CNC(=O)CCC(C)(C)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | COc1ccc(CNC(=O)CCC(C)(C)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CNc2c(C)n(C)n(NC[C@@H](C)[NH+]3CCc4sccc4C3)c2=O)cn1 | COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | COc1ccc(CNc2c(C)n(C)n(NC[C@@H](C)[NH+]3CCc4sccc4C3)c2=O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C45=O"
} |
Can you make molecule COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CNc2nn(NC[C@@H](C)[NH+]3CCc4sccc4C3)c(C)cc2=O)cn1 | COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | COc1ccc(CNc2nn(NC[C@@H](C)[NH+]3CCc4sccc4C3)c(C)cc2=O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C45=O"
} |
Can you make molecule COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CNC(=O)C[C@@H](Br)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | COc1ccc(CNC(=O)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | COc1ccc(CNC(=O)C[C@@H](Br)NC[C@@H](C)[NH+]2CCc3sccc3C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCN(CC(N)=O)C(=O)c1occc1COc1ccccc1 | CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 | CC(C)CCN(CC(N)=O)C(=O)c1occc1COc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CN(CCCCBr)C(=O)c1occc1COc1ccccc1 | CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 | NC(=O)CN(CCCCBr)C(=O)c1occc1COc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN(CC(N)=O)C(=O)c1occc1COc1ccccc1 | CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 | C=CCCCN(CC(N)=O)C(=O)c1occc1COc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CN(CCCCCl)C(=O)c1occc1COc1ccccc1 | CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 | NC(=O)CN(CCCCCl)C(=O)c1occc1COc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN(CC(N)=O)C(=O)c1occc1COc1ccccc1 | CC(C)N(CC(N)=O)C(=O)c1occc1COc1ccccc1 | C=CCCCCN(CC(N)=O)C(=O)c1occc1COc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1I | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)ccc1Br | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 | COc1cc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1Cl | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)c1Br | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 | COc1cccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)c1Cl | COc1ccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)cc1 | COc1cccc(N2CCn3c(SCC(=O)Nc4nc(C)cs4)nnc32)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccc(I)cc3F)[NH+](C)C)ccc21 | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccc(I)cc3F)[NH+](C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3cc(I)ccc3F)[NH+](C)C)ccc21 | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3cc(I)ccc3F)[NH+](C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3Cl)[NH+](C)C)ccc21 | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3Cl)[NH+](C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=O)C(=O)NC[C@@H](c1ccc2c(c1)CCN2C)[NH+](C)C)c1ccccc1F | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 | CC(=NC(=O)C(=O)NC[C@@H](c1ccc2c(c1)CCN2C)[NH+](C)C)c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1ccccc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3cc(F)ccc3Br)[NH+](C)C)ccc21 | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccccc3F)[NH+](C)C)ccc21 | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3cc(F)ccc3Br)[NH+](C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c18ccccc1F"
} |
Can you make molecule C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc(=O)[nH]o1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc(=O)[nH]o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(=O)[nH]o1",
"old_substring": "c14cc([O-])no1"
} |
Can you make molecule C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])cc(=O)o1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])cc(=O)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc([O-])cc(=O)o1",
"old_substring": "c14cc([O-])no1"
} |
Can you make molecule C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1noc([S-])n1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1noc([S-])n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&noc([S-])n1",
"old_substring": "c14cc([O-])no1"
} |
Can you make molecule C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1ccc(O)cn1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1ccc(O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)cn1",
"old_substring": "c14cc([O-])no1"
} |
Can you make molecule C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1ccc(O)nc1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1cc([O-])no1 | C[C@H]1CN(c2ccccc2C#N)C(=O)CN1C(=O)CCc1ccc(O)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)nc1",
"old_substring": "c14cc([O-])no1"
} |
Can you make molecule CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(Cc2cc(C#N)c(Cc3cc(=O)n(C)c(=O)n3C)s2)cc1 | CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 | CC(C)c1ccc(Cc2cc(C#N)c(Cc3cc(=O)n(C)c(=O)n3C)s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N34C"
} |
Can you make molecule CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(Cc2ccc(Cc3cc(=O)n(C)c(=O)n3C)c(C#N)c2)cc1 | CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 | CC(C)c1ccc(Cc2ccc(Cc3cc(=O)n(C)c(=O)n3C)c(C#N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N34C"
} |
Can you make molecule CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(CON=C2CCN(Cc3cc(=O)n(C)c(=O)n3C)CC2)cc1 | CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 | CC(C)c1ccc(CON=C2CCN(Cc3cc(=O)n(C)c(=O)n3C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N34C"
} |
Can you make molecule CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(Cc2cnc(C#N)c(Cc3cc(=O)n(C)c(=O)n3C)c2)cc1 | CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 | CC(C)c1ccc(Cc2cnc(C#N)c(Cc3cc(=O)n(C)c(=O)n3C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N34C"
} |
Can you make molecule CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(CN2CCC=C(CCc3cc(=O)n(C)c(=O)n3C)C2)cc1 | CC(C)c1ccc(CN(C)Cc2cc(=O)n(C)c(=O)n2C)cc1 | CC(C)c1ccc(CN2CCC=C(CCc3cc(=O)n(C)c(=O)n3C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N34C"
} |
Can you make molecule COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)N=CCC(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)N=CCC(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC=&",
"old_substring": "C6C(C)C"
} |
Can you make molecule COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NC(C)(C)CCBr)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NC(C)(C)CCBr)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "C6C(C)C"
} |
Can you make molecule COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)N=CC(C)(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)N=CC(C)(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C=&",
"old_substring": "C6C(C)C"
} |
Can you make molecule COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)N=C(CCl)C(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)N=C(CCl)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C=&CCl",
"old_substring": "C6C(C)C"
} |
Can you make molecule COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)N=C(CBr)C(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)NCC(C)C)cc1 | COc1ccccc1[C@H]1CCCN1C(=O)Nc1ccc(C(=O)N=C(CBr)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C=&CBr",
"old_substring": "C6C(C)C"
} |
Can you make molecule CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(Br)c(=O)n(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)n1C | CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 | CCc1c(Br)c(=O)n(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)n1C | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c&c(Br)c(=O)n1&",
"old_substring": "n18ncc(Br)c17"
} |
Can you make molecule CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(Br)cn(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)c1=O | CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 | CCc1cc(Br)cn(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cn&c1=O",
"old_substring": "n18ncc(Br)c17"
} |
Can you make molecule CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)c(C)c1Br | CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 | CCc1nn(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)c(C)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c(Br)c&nn1&",
"old_substring": "n18ncc(Br)c17"
} |
Can you make molecule CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)c2cc(Br)ccc12 | CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 | CCc1nn(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)c2cc(Br)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c2cc(Br)ccc12",
"old_substring": "n18ncc(Br)c17"
} |
Can you make molecule CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(Br)cc(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)cc1Br | CCn1ncc(Br)c1C(=O)N[C@@H]1C(=O)N2C(C(=O)NCC(C)C)=C(C)CS[C@@H]12 | CCc1c(Br)cc(C(=O)N[C@@H]2C(=O)N3C(C(=O)NCC(C)C)=C(C)CS[C@@H]23)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Br)cc&cc1Br",
"old_substring": "n18ncc(Br)c17"
} |
Can you make molecule O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCCCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | O=C(NC1CCCCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NSC1=CCCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | O=C(NSC1=CCCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=CC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | O=C(N=CC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCCCCCCCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | O=C(NC1CCCCCCCCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(NC(=O)[C@H]2SC(=S)n3c2nc(=O)c2cc4c(cc23)OCO4)CCCCCCC1 | O=C(NC1CCCCC1)[C@H]1SC(=S)n2c1nc(=O)c1cc3c(cc12)OCO3 | N#CC1(NC(=O)[C@H]2SC(=S)n3c2nc(=O)c2cc4c(cc23)OCO4)CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cccc(-c2csc(Nc3ccccc3)n2)c1 | Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 | Brc1cccc(-c2csc(Nc3ccccc3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c15cccnc1"
} |
Can you make molecule Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cccc(-c2csc(Nc3ccc(I)nc3)n2)c1 | Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 | Brc1cccc(-c2csc(Nc3ccc(I)nc3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c15cccnc1"
} |
Can you make molecule Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cccc(-c2csc(Nc3cc4cnsc4s3)n2)c1 | Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 | Brc1cccc(-c2csc(Nc3cc4cnsc4s3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c15cccnc1"
} |
Can you make molecule Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Nc2nc(-c3cccc(Br)c3)cs2)c(C)n1 | Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 | Cc1ccc(Nc2nc(-c3cccc(Br)c3)cs2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c15cccnc1"
} |
Can you make molecule Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1cnccc1Nc1nc(-c2cccc(Br)c2)cs1 | Brc1cccc(-c2csc(Nc3cccnc3)n2)c1 | Clc1cnccc1Nc1nc(-c2cccc(Br)c2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c15cccnc1"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1SC(=O)[C@@H](C)c1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1SC(=O)[C@@H](C)c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C2S(=O)(=O)[C@H]3C"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1CC(C)(C)[C@@H](O)c1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1CC(C)(C)[C@@H](O)c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)[C@H]&O",
"old_substring": "C2S(=O)(=O)[C@H]3C"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1C(=O)C[C@H](C)c1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1C(=O)C[C@H](C)c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C2S(=O)(=O)[C@H]3C"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1C(=O)[C@@H](Br)Cc1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1C(=O)[C@@H](Br)Cc1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](Br)C&",
"old_substring": "C2S(=O)(=O)[C@H]3C"
} |
Can you make molecule Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1-n1nnnc1C(=O)[C@H](C)CCc1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1CS(=O)(=O)[C@@H](C)c1c(F)cccc1F | Cc1cccc(C)c1-n1nnnc1C(=O)[C@H](C)CCc1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C2S(=O)(=O)[C@H]3C"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | C[C@H](CC(C)(C)[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]2C4"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[C@@H]1CCCCC[NH2+]1)[C@H](C)[NH2+]CC(C)(C)C | C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | C[C@H](C[C@@H]1CCCCC[NH2+]1)[C@H](C)[NH2+]CC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]2C4"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C[NH2+]C[C@@H](Cl)CC[C@@H]1CCCCC[NH2+]1 | C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | CC(C)(C)C[NH2+]C[C@@H](Cl)CC[C@@H]1CCCCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "Cl[C@H](C&)CC&",
"old_substring": "C[C@H]2C4"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | CCC[C@@H](CC[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]2C4"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | C[C@@H](C[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | CCCC[C@@H](CC[C@@H]1CCCCC[NH2+]1)[NH2+]CC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "C[C@H]2C4"
} |
Can you make molecule CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCC[C@H]1N(C)SC(=O)Cc1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)SC(=O)Cc1ccc2c(c1)NC(=O)CN2CC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCC[C@H]1N(C)C(=O)CCCC(=O)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)C(=O)CCCC(=O)c1ccc2c(c1)NC(=O)CN2CC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCC[C@H]1N(C)C(=O)CC(C)(C)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)C(=O)CC(C)(C)c1ccc2c(c1)NC(=O)CN2CC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCC[C@H]1N(C)C(=O)CCC(C)(C)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)C(=O)CCC(C)(C)c1ccc2c(c1)NC(=O)CN2CC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCC[C@H]1N(C)SC(=O)[C@@H](C)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)C(=O)c1ccc2c(c1)NC(=O)CN2CC | CC[C@H]1CCCC[C@H]1N(C)SC(=O)[C@@H](C)c1ccc2c(c1)NC(=O)CN2CC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)COCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)COCO3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COCO2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2cc3c(cc2I)OCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2cc3c(cc2I)OCO3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(cc1I)OCO2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)COC3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)COC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COC2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2C=Cc2ccc3c(c2)OCCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2C=Cc2ccc3c(c2)OCCO3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc2c(c1)OCCO2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2cc3c(cc2Br)OCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 | CCOC(=O)c1ccc(N[C@H]2c3ccccc3C(=O)N2Cc2cc3c(cc2Br)OCO3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(cc1Br)OCO2",
"old_substring": "c19ccc2c(c1)OCO2"
} |
Can you make molecule Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1[C@H](C)NCCCCc1nc2c(F)cccc2n1C | Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C | Cc1nn(C)c(C)c1[C@H](C)NCCCCc1nc2c(F)cccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1[C@H](C)N=CCCc1nc2c(F)cccc2n1C | Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C | Cc1nn(C)c(C)c1[C@H](C)N=CCCc1nc2c(F)cccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C4C5"
} |
Can you make molecule Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1[C@H](C)NCCCCCc1nc2c(F)cccc2n1C | Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C | Cc1nn(C)c(C)c1[C@H](C)NCCCCCc1nc2c(F)cccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1[C@H](C)NC1CC(c2nc3c(F)cccc3n2C)C1 | Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C | Cc1nn(C)c(C)c1[C@H](C)NC1CC(c2nc3c(F)cccc3n2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1nc2c(F)cccc2n1C)=N[C@@H](C)c1c(C)nn(C)c1C | Cc1nn(C)c(C)c1[C@H](C)NCCc1nc2c(F)cccc2n1C | CC(CCc1nc2c(F)cccc2n1C)=N[C@@H](C)c1c(C)nn(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(Nc2ccccc2)CCN1N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O | O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O | O=C1C2=CC=CC2=C(Nc2ccccc2)CCN1N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(Nc2ccccc2)cc(N2CCCC[C@@H]2[C@H]2CCC[C@@H]2O)ccc2oc1-2 | O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O | O=Cc1c(Nc2ccccc2)cc(N2CCCC[C@@H]2[C@H]2CCC[C@@H]2O)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C23"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN1CCCC[C@@H]1[C@H]1CCC[C@@H]1O)Nc1ccccc1 | O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O | O=C(/C=C/SN1CCCC[C@@H]1[C@H]1CCC[C@@H]1O)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCC[C@@H]1[C@H]1CCCCN1c1ccc(/C=N/ONc2ccccc2)o1 | O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O | O[C@H]1CCC[C@@H]1[C@H]1CCCCN1c1ccc(/C=N/ONc2ccccc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C23"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(N2CCCC[C@@H]2[C@H]2CCC[C@@H]2O)CC1)Nc1ccccc1 | O=C(Nc1ccccc1)N1CCCC[C@@H]1[C@H]1CCC[C@@H]1O | O=C(NN=C1CCC(N2CCCC[C@@H]2[C@H]2CCC[C@@H]2O)CC1)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C23"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.