prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | C=CSOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | C=CCCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)c2c(nc3n(CCOCCCCl)c(C(C)(C)C)cn23)n(C)c1=O | CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | Cn1c(=O)c2c(nc3n(CCOCCCCl)c(C(C)(C)C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)c2c(nc3n(CCOCCCCS)c(C(C)(C)C)cn23)n(C)c1=O | CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | Cn1c(=O)c2c(nc3n(CCOCCCCS)c(C(C)(C)C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)c2c(nc3n(CCOCCCBr)c(C(C)(C)C)cn23)n(C)c1=O | CCOCCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 | Cn1c(=O)c2c(nc3n(CCOCCCBr)c(C(C)(C)C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCCCCC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCCCCC3)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N16CCSCC1"
} |
Can you make molecule CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSC(C)(C)C3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSC(C)(C)C3)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC(C)(C)C1",
"old_substring": "N16CCSCC1"
} |
Can you make molecule CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCCCCCC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCCCCCC3)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N16CCSCC1"
} |
Can you make molecule CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCC(C)CC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCC(C)CC3)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N16CCSCC1"
} |
Can you make molecule CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCCCCCCC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCSCC3)cc2C)cc1 | CCc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCCCCCCC3)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N16CCSCC1"
} |
Can you make molecule O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)C1=CC=CN2CCS(=O)(=O)N=C12 | O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 | O=C(Nc1ccccc1)C1=CC=CN2CCS(=O)(=O)N=C12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c14cccnc1"
} |
Can you make molecule O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(I)nc1)C1=CC=CN2CCS(=O)(=O)N=C12 | O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 | O=C(Nc1ccc(I)nc1)C1=CC=CN2CCS(=O)(=O)N=C12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c14cccnc1"
} |
Can you make molecule O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cc2cnsc2s1)C1=CC=CN2CCS(=O)(=O)N=C12 | O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 | O=C(Nc1cc2cnsc2s1)C1=CC=CN2CCS(=O)(=O)N=C12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c14cccnc1"
} |
Can you make molecule O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C2=CC=CN3CCS(=O)(=O)N=C23)c(C)n1 | O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 | Cc1ccc(NC(=O)C2=CC=CN3CCS(=O)(=O)N=C23)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c14cccnc1"
} |
Can you make molecule O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccncc1Cl)C1=CC=CN2CCS(=O)(=O)N=C12 | O=C(Nc1cccnc1)C1=CC=CN2CCS(=O)(=O)N=C12 | O=C(Nc1ccncc1Cl)C1=CC=CN2CCS(=O)(=O)N=C12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c14cccnc1"
} |
Can you make molecule CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC=C(CS(=O)(=O)c2ccc(F)c(F)c2)C1 | CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 | CS(=O)(=O)N1CCC=C(CS(=O)(=O)c2ccc(F)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N13CCCN4CC1"
} |
Can you make molecule CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCSC12CCN(S(=O)(=O)c1ccc(F)c(F)c1)CC2 | CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 | CS(=O)(=O)N1CCSC12CCN(S(=O)(=O)c1ccc(F)c(F)c1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC12CCN&CC2",
"old_substring": "N13CCCN4CC1"
} |
Can you make molecule CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@@H](S(=O)(=O)c2ccc(F)c(F)c2)C1 | CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 | CS(=O)(=O)N1CCC[C@@H](S(=O)(=O)c2ccc(F)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@H]&C1",
"old_substring": "N13CCCN4CC1"
} |
Can you make molecule CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC[C@H](S(=O)(=O)c2ccc(F)c(F)c2)CC1 | CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 | CS(=O)(=O)N1CCC[C@H](S(=O)(=O)c2ccc(F)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H]&CC1",
"old_substring": "N13CCCN4CC1"
} |
Can you make molecule CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 | CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 | CS(=O)(=O)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "N13CCCN4CC1"
} |
Can you make molecule Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(CCCCN(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(CCCCN(C)Cc2cc(Cl)ccc2F)n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(CCCCCN(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(CCCCCN(C)Cc2cc(Cl)ccc2F)n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(C2CC(N(C)Cc3cc(Cl)ccc3F)C2)n1C | Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(C2CC(N(C)Cc3cc(Cl)ccc3F)C2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(SC(=S)ON(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(SC(=S)ON(C)Cc2cc(Cl)ccc2F)n1C | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(NC(=S)SN(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(CN(C)Cc2cc(Cl)ccc2F)n1C | Cc1nnc(NC(=S)SN(C)Cc2cc(Cl)ccc2F)n1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C35"
} |
Can you make molecule CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CCCC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 | CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 | CC(=O)N1CCCC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC[C@@H]&C1",
"old_substring": "N13CC[C@@H]8C1"
} |
Can you make molecule CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CC[C@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C[C@H]1C | CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 | CC(=O)N1CC[C@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&C[C@H]1C",
"old_substring": "N13CC[C@@H]8C1"
} |
Can you make molecule CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CC1=N[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)SC1 | CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 | CC(=O)CC1=N[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)SC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=N[C@@H]&SC1",
"old_substring": "N13CC[C@@H]8C1"
} |
Can you make molecule CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CCC[C@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)CC1 | CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 | CC(=O)N1CCC[C@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H]&CC1",
"old_substring": "N13CC[C@@H]8C1"
} |
Can you make molecule CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CC[C@H](Cl)C(=O)N[C@@H]1CCCC[C@H]1OCCC(C)C | CC(=O)N1CC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2OCCC(C)C)C1 | CC(=O)CC[C@H](Cl)C(=O)N[C@@H]1CCCC[C@H]1OCCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "N13CC[C@@H]8C1"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@@H](NC(=O)CC(C)(C)N(C)Cc2nccn2C(F)F)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)CC(C)(C)N(C)Cc2nccn2C(F)F)C2CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@@H](NC(=O)CCC(C)(C)N(C)Cc2nccn2C(F)F)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)CCC(C)(C)N(C)Cc2nccn2C(F)F)C2CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@@H](NC(=O)C[C@@H](Br)N(C)Cc2nccn2C(F)F)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)C[C@@H](Br)N(C)Cc2nccn2C(F)F)C2CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@@H](Nc2cc(C)n(N(C)Cc3nccn3C(F)F)c(=O)c2)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 | Cc1cnc([C@@H](Nc2cc(C)n(N(C)Cc3nccn3C(F)F)c(=O)c2)C2CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@@H](Nc2c(C)n(N(C)Cc3nccn3C(F)F)ccc2=O)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)N(C)Cc2nccn2C(F)F)C2CC2)s1 | Cc1cnc([C@@H](Nc2c(C)n(N(C)Cc3nccn3C(F)F)ccc2=O)C2CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1CC(=O)SNC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1CC(=O)SNC(=S)Nc1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1C(=O)CCCC(=O)NC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1C(=O)CCCC(=O)NC(=S)Nc1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1C(C)(C)CC(=O)NC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1C(C)(C)CC(=O)NC(=S)Nc1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1C(C)(C)CCC(=O)NC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1C(C)(C)CCC(=O)NC(=S)Nc1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1[C@H](C)C(=O)SNC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1C(=O)NC(=S)Nc1cc(C)cc(C)c1 | COc1ccc(Br)cc1[C@H](C)C(=O)SNC(=S)Nc1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C25=O"
} |
Can you make molecule COC[C@H](C)Cc1nnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1nnc(C[NH3+])o1)CC1OCc2ccccc2CO1 | COC[C@H](C)Cc1nnc(C[NH3+])o1 | C[C@H](Cc1nnc(C[NH3+])o1)CC1OCc2ccccc2CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COC[C@H](C)Cc1nnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1nnc(C[NH3+])o1)CC1(O)Cc2ccccc2C1 | COC[C@H](C)Cc1nnc(C[NH3+])o1 | C[C@H](Cc1nnc(C[NH3+])o1)CC1(O)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COC[C@H](C)Cc1nnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C=C1Oc2ccccc2C1=O)Cc1nnc(C[NH3+])o1 | COC[C@H](C)Cc1nnc(C[NH3+])o1 | C[C@@H](C=C1Oc2ccccc2C1=O)Cc1nnc(C[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&Oc2ccccc2C1=O",
"old_substring": "CO2"
} |
Can you make molecule COC[C@H](C)Cc1nnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C=C1CCOC2(CCC2)C1)Cc1nnc(C[NH3+])o1 | COC[C@H](C)Cc1nnc(C[NH3+])o1 | C[C@@H](C=C1CCOC2(CCC2)C1)Cc1nnc(C[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCOC2(CCC2)C1",
"old_substring": "CO2"
} |
Can you make molecule COC[C@H](C)Cc1nnc(C[NH3+])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C=C(O)c1cc2ccccc2o1)Cc1nnc(C[NH3+])o1 | COC[C@H](C)Cc1nnc(C[NH3+])o1 | C[C@@H](C=C(O)c1cc2ccccc2o1)Cc1nnc(C[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(O)c1cc2ccccc2o1",
"old_substring": "CO2"
} |
Can you make molecule O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)C(=O)N[C@@H]2CCOC3(CCCCC3)C2)nsc1-c1ccc2c(c1)COC2 | O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 | Nc1c(C(=O)C(=O)N[C@@H]2CCOC3(CCCCC3)C2)nsc1-c1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)C(=O)N[C@@H]1CCOC2(CCCCC2)C1)C(=S)Sc1ccc2c(c1)COC2 | O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 | CN(C(=O)C(=O)N[C@@H]1CCOC2(CCCCC2)C1)C(=S)Sc1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1oc(C(=O)C(=O)N[C@@H]2CCOC3(CCCCC3)C2)cc1-c1ccc2c(c1)COC2 | O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 | Nc1oc(C(=O)C(=O)N[C@@H]2CCOC3(CCCCC3)C2)cc1-c1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1CCOC2(CCCCC2)C1)C(=O)N1CCN=C1Sc1ccc2c(c1)COC2 | O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 | O=C(N[C@@H]1CCOC2(CCCCC2)C1)C(=O)N1CCN=C1Sc1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1CCC(c2ccc3c(c2)COC3)CC1)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 | O=C(Nc1ccc2c(c1)COC2)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 | O=C(CN1CCC(c2ccc3c(c2)COC3)CC1)C(=O)N[C@@H]1CCOC2(CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N35"
} |
Can you make molecule Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NSC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCCC(=O)[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)CCCC(=O)[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4"
} |
Can you make molecule Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC(C)(C)[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)CC(C)(C)[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC[S@+]([O-])CCC[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC[S@+]([O-])CCC[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCC(C)(C)[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)C[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)CCC(C)(C)[NH+]2CCSC(C)(C)C2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[C@@H](CS)C[NH+]1CCC(c2ccccc2Cl)CC1 | CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 | CC(C)(C)[C@@H](CS)C[NH+]1CCC(c2ccccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]13CCN4CC1"
} |
Can you make molecule CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[C@@H](CS)C[NH+]1CC(c2ccccc2Cl)C1 | CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 | CC(C)(C)[C@@H](CS)C[NH+]1CC(c2ccccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC&C1",
"old_substring": "[NH+]13CCN4CC1"
} |
Can you make molecule CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[C@@H](CS)C[NH+]1CCCN(Cc2ccccc2Cl)CC1 | CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 | CC(C)(C)[C@@H](CS)C[NH+]1CCCN(Cc2ccccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCN(C&)CC1",
"old_substring": "[NH+]13CCN4CC1"
} |
Can you make molecule CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[C@@H](CS)C[NH+]1CCCN[C@H](c2ccccc2Cl)C1 | CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 | CC(C)(C)[C@@H](CS)C[NH+]1CCCN[C@H](c2ccccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCN[C@H]&C1",
"old_substring": "[NH+]13CCN4CC1"
} |
Can you make molecule CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[C@@H](CS)C[NH+]1CCO[C@H](c2ccccc2Cl)C1 | CC(C)(C)[C@@H](CS)C[NH+]1CCN(c2ccccc2Cl)CC1 | CC(C)(C)[C@@H](CS)C[NH+]1CCO[C@H](c2ccccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCO[C@H]&C1",
"old_substring": "[NH+]13CCN4CC1"
} |
Can you make molecule CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(SC(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(SC(F)(F)F)c2)=NC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(CCCC(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(CCCC(F)(F)F)c2)=NC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(CCCCC(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(CCCCC(F)(F)F)c2)=NC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)C(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)C(F)(F)F)c2)=NC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(CC(F)(F)C(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(C(F)(F)F)c2)=NC(C)(C)C1 | CC1=[N+](c2ccc(C)cc2)C(SCC(=O)Nc2cccc(CC(F)(F)C(F)(F)F)c2)=NC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O | CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O | C=CCC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H]([NH2+]CCNS(C)(=O)=O)[C@H](CCCCl)C1 | CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O | C[C@H]1CC[C@H]([NH2+]CCNS(C)(=O)=O)[C@H](CCCCl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H]([NH2+]CCNS(C)(=O)=O)[C@H](CCCCS)C1 | CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O | C[C@H]1CC[C@H]([NH2+]CCNS(C)(=O)=O)[C@H](CCCCS)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H]([NH2+]CCNS(C)(=O)=O)[C@H](CCCBr)C1 | CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O | C[C@H]1CC[C@H]([NH2+]CCNS(C)(=O)=O)[C@H](CCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC6"
} |
Can you make molecule CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H]([NH2+]CCNS(C)(=O)=O)[C@H](CCCCF)C1 | CC[C@@H]1C[C@@H](C)CC[C@@H]1[NH2+]CCNS(C)(=O)=O | C[C@H]1CC[C@H]([NH2+]CCNS(C)(=O)=O)[C@H](CCCCF)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC6"
} |
Can you make molecule O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCC(C(=O)c2cccs2)CC1 | O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 | O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCC(C(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C(=O)c2cccs2)CCC(C(=O)NCCc2cc(Cl)c3c(c2)OCCO3)CC1 | O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 | CC1(C(=O)c2cccs2)CCC(C(=O)NCCc2cc(Cl)c3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)NCCc2cc(Cl)c3c(c2)OCCO3)CCC(C(=O)c2cccs2)CC1 | O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 | N#CC1(C(=O)NCCc2cc(Cl)c3c(c2)OCCO3)CCC(C(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCCCC(=O)c1cccs1)NCCc1cc(Cl)c2c(c1)OCCO2 | O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 | O=C(CCCCCC(=O)c1cccs1)NCCc1cc(Cl)c2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC1=CCCN(C(=O)NCCc2cc(Cl)c3c(c2)OCCO3)C1)c1cccs1 | O=C(NCCc1cc(Cl)c2c(c1)OCCO2)C1CCN(C(=O)c2cccs2)CC1 | O=C(CC1=CCCN(C(=O)NCCc2cc(Cl)c3c(c2)OCCO3)C1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCN1CCOCC1)C1=Cc2ccccc2OC1 | O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 | O=C(NCCCCN1CCOCC1)C1=Cc2ccccc2OC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=CCCN1CCOCC1)C1=Cc2ccccc2OC1 | O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 | O=C(N=CCCN1CCOCC1)C1=Cc2ccccc2OC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCCN1CCOCC1)C1=Cc2ccccc2OC1 | O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 | O=C(NCCCCCN1CCOCC1)C1=Cc2ccccc2OC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CC(N2CCOCC2)C1)C1=Cc2ccccc2OC1 | O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 | O=C(NC1CC(N2CCOCC2)C1)C1=Cc2ccccc2OC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCN1CCOCC1)=NC(=O)C1=Cc2ccccc2OC1 | O=C(NCCN1CCOCC1)C1=Cc2ccccc2OC1 | CC(CCN1CCOCC1)=NC(=O)C1=Cc2ccccc2OC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4C5"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C[S@+]([O-])CCCC(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1C[S@+]([O-])CCCC(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCCC&=O",
"old_substring": "C7S4(=O)=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H](C)S(=O)(=O)CN1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1[C@@H](C)S(=O)(=O)CN1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&S(=O)(=O)C&",
"old_substring": "C7S4(=O)=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C[S@@+]([O-])CCCC(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1C[S@@+]([O-])CCCC(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@@](=O)CCCC&=O",
"old_substring": "C7S4(=O)=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1cccc(C)c1S(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1-c1cccc(C)c1S(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1S&(=O)=O",
"old_substring": "C7S4(=O)=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(=O)CCCC(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1CS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | Cc1ccccc1C(=O)CCCC(=O)N1CCC[C@@H](C(=O)Nc2ccc(Br)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C7S4(=O)=O"
} |
Can you make molecule Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1I | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc6cc1"
} |
Can you make molecule Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1Cl | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccc6cc1"
} |
Can you make molecule Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1N1C(=O)C2=C3C[C@H](C(C)C)OC[C@@H]3SC2=NC1=S | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 | Cc1cc(I)ccc1N1C(=O)C2=C3C[C@H](C(C)C)OC[C@@H]3SC2=NC1=S | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccc6cc1"
} |
Can you make molecule Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)c1 | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 | Cc1ccc(I)c(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccc6cc1"
} |
Can you make molecule Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)c1 | Cc1ccc(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)cc1 | Cc1ccc(Br)c(N2C(=O)C3=C4C[C@H](C(C)C)OC[C@@H]4SC3=NC2=S)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccc6cc1"
} |
Can you make molecule Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1I.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 | Cc1ccccc1I.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1cccc%10c1"
} |
Can you make molecule Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1Cl.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 | Cc1ccccc1Cl.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1cccc%10c1"
} |
Can you make molecule Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccncc1Br.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 | Cc1ccncc1Br.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "Cc1cccc%10c1"
} |
Can you make molecule Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(F)c1.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 | Cc1cccc(F)c1.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&c(F)c1",
"old_substring": "Cc1cccc%10c1"
} |
Can you make molecule Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(I)c1.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | Cc1cccc(-c2nc3scc(CCNC(=O)C(=O)Nc4ccccc4Cl)n3n2)c1 | Cc1cccc(I)c1.O=C(NCCc1csc2ncnn12)C(=O)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1cccc%10c1"
} |
Can you make molecule Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3I)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3I)n3c2CCC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3Br)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3Br)n3c2CCC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-[n+]2cc(-c3cc(Br)ccc3I)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3cc(Br)ccc3I)n3c2CCC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-[n+]2cc(-c3ccc(Br)c(Cl)c3F)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3ccc(Br)c(Cl)c3F)n3c2CCC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(Cl)c1F",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-[n+]2cc(-c3cc(Br)ccc3Cl)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3ccc(Br)cc3)n3c2CCC3)cc1 | Cc1ccc(-[n+]2cc(-c3cc(Br)ccc3Cl)n3c2CCC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c14ccc(Br)cc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.