prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccccc2Cl)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2ccccc2Cl)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c13ccccc1"
} |
Can you make molecule Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(I)cc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2ccc(I)cc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c13ccccc1"
} |
Can you make molecule Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(C)c(I)c2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2ccc(C)c(I)c2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c13ccccc1"
} |
Can you make molecule Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(Br)c2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2cccc(Br)c2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c13ccccc1"
} |
Can you make molecule Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(C)c2C)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2ccccc2)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | Cc1nc(-c2cccc(C)c2C)c2c(n1)[C@@]1(C)CC[C@@H]2C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c13ccccc1"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1COc1ccc(CC(=O)SN[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(CC(=O)SN[C@@H](C)c2c(C)noc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1COc1ccc(C(=O)CCCC(=O)N[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(C(=O)CCCC(=O)N[C@@H](C)c2c(C)noc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1COc1ccc(C(C)(C)CC(=O)N[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(C(C)(C)CC(=O)N[C@@H](C)c2c(C)noc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1COc1ccc(C(C)(C)CCC(=O)N[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(C(C)(C)CCC(=O)N[C@@H](C)c2c(C)noc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1COc1ccc([C@H](C)C(=O)SN[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc(C(=O)N[C@@H](C)c2c(C)noc2C)cc1 | Cc1noc(C)c1COc1ccc([C@H](C)C(=O)SN[C@@H](C)c2c(C)noc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1(O)Cc2ccccc2C1)Nc1cccc(SC(F)F)c1 | O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 | O=C(/C=C/SC1(O)Cc2ccccc2C1)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2cccc(SC(F)F)c2)nc1C1(O)Cc2ccccc2C1 | O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 | O=Cc1sc(Nc2cccc(SC(F)F)c2)nc1C1(O)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2cccc(SC(F)F)c2)sc1C1(O)Cc2ccccc2C1 | O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 | O=Cc1nc(Nc2cccc(SC(F)F)c2)sc1C1(O)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/CC1(O)Cc2ccccc2C1)Nc1cccc(SC(F)F)c1 | O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 | O=C(N/N=C/CC1(O)Cc2ccccc2C1)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | OC1(N2CCC(=NONc3cccc(SC(F)F)c3)CC2)Cc2ccccc2C1 | O=C(Nc1cccc(SC(F)F)c1)C1(O)Cc2ccccc2C1 | OC1(N2CCC(=NONc3cccc(SC(F)F)c3)CC2)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C35"
} |
Can you make molecule CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(NSC(=O)Cc2cccs2)nn1-c1ccccc1 | CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 | CCc1cc(NSC(=O)Cc2cccs2)nn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(NC(=O)CCCC(=O)c2cccs2)nn1-c1ccccc1 | CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 | CCc1cc(NC(=O)CCCC(=O)c2cccs2)nn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(NC(=O)CC(C)(C)c2cccs2)nn1-c1ccccc1 | CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 | CCc1cc(NC(=O)CC(C)(C)c2cccs2)nn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(NC[S@+]([O-])CCCc2cccs2)nn1-c1ccccc1 | CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 | CCc1cc(NC[S@+]([O-])CCCc2cccs2)nn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(NC(=O)CCC(C)(C)c2cccs2)nn1-c1ccccc1 | CCc1cc(NC(=O)Cc2cccs2)nn1-c1ccccc1 | CCc1cc(NC(=O)CCC(C)(C)c2cccs2)nn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc([N+](=O)[O-])cc2CC(=O)SNCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2CC(=O)SNCc2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)CCCC(=O)NCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)CCCC(=O)NCc2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc([N+](=O)[O-])cc2C(C)(C)CC(=O)NCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2C(C)(C)CC(=O)NCc2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc([N+](=O)[O-])cc2C(C)(C)CCC(=O)NCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2C(C)(C)CCC(=O)NCc2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc([N+](=O)[O-])cc2[C@H](C)C(=O)SNCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc3c(c2)OCCO3)CC1 | CC1CCN(c2ccc([N+](=O)[O-])cc2[C@H](C)C(=O)SNCc2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@]1([NH2+]C2SCCS2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2SCCS2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@]1([NH2+]C2CCCCC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2CCCCC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@]1([NH2+]C2SCCCS2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2SCCCS2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@]1([NH2+]C2SCSCS2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2SCSCS2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@]1([NH2+]C2CCCCCC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2CC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | NC(=O)[C@]1([NH2+]C2CCCCCC2)CC[C@H](Oc2cc(F)cc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](Cc2ccc(C)c(Cl)c2)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2ccc(C)c(Cl)c2)NS(C)(=O)=O)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](Cc2ccc(Br)cc2C)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2ccc(Br)cc2C)NS(C)(=O)=O)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C",
"old_substring": "c18ccccc1C"
} |
Can you make molecule COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](Cc2cccc(Br)c2C)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2cccc(Br)c2C)NS(C)(=O)=O)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c18ccccc1C"
} |
Can you make molecule COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](Cc2ccc(F)cc2Cl)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2ccc(F)cc2Cl)NS(C)(=O)=O)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](Cc2cc(F)ccc2Cl)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2ccccc2C)NS(C)(=O)=O)cc1OC | COc1ccc([C@@H](Cc2cc(F)ccc2Cl)NS(C)(=O)=O)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1nc(CC(=O)SN2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(CC(=O)SN2CCC[C@@H](n3cccn3)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1nc(C(=O)CCCC(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(C(=O)CCCC(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1nc(C(C)(C)CC(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(C(C)(C)CC(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1nc(C(C)(C)CCC(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(C(C)(C)CCC(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1nc([C@H](C)C(=O)SN2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc(C(=O)N2CCC[C@@H](n3cccn3)C2)cs1 | COCc1nc([C@H](C)C(=O)SN2CCC[C@@H](n3cccn3)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(N[C@H]2C[NH+](C(CO)CO)C[C@@H]2C2CC2)CCN1c1ccsc1 | O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 | O=C1C2=CC=CC2=C(N[C@H]2C[NH+](C(CO)CO)C[C@@H]2C2CC2)CCN1c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(N[C@H]2C[NH+](C(CO)CO)C[C@@H]2C2CC2)cc(-c2ccsc2)ccc2oc1-2 | O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 | O=Cc1c(N[C@H]2C[NH+](C(CO)CO)C[C@@H]2C2CC2)cc(-c2ccsc2)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C25"
} |
Can you make molecule O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccsc1)N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1 | O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 | O=C(/C=C/Sc1ccsc1)N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N[C@H]2C[NH+](C(CO)CO)C[C@@H]2C2CC2)nc1-c1ccsc1 | O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 | O=Cc1sc(N[C@H]2C[NH+](C(CO)CO)C[C@@H]2C2CC2)nc1-c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N[C@H]2C[NH+](C(CO)CO)C[C@@H]2C2CC2)sc1-c1ccsc1 | O=C(N[C@H]1C[NH+](C(CO)CO)C[C@@H]1C1CC1)c1ccsc1 | O=Cc1nc(N[C@H]2C[NH+](C(CO)CO)C[C@@H]2C2CC2)sc1-c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C25"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1[NH+]1CCC(C2([C@@H]3CCCCC[C@@H]3CO)CC[NH2+]C2)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC(C2([C@@H]3CCCCC[C@@H]3CO)CC[NH2+]C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]45"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1[NH+]1CCC([C@]2([C@@H]3CCCCC[C@@H]3CO)CCC[NH2+]C2)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC([C@]2([C@@H]3CCCCC[C@@H]3CO)CCC[NH2+]C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]45"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1[NH+]1CCC(n2c[nH+]cc2[C@@H]2CCCCC[C@@H]2CO)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC(n2c[nH+]cc2[C@@H]2CCCCC[C@@H]2CO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1[NH+]1CCC(c2cc([C@@H]3CCCCC[C@@H]3CO)[nH][nH+]2)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC(c2cc([C@@H]3CCCCC[C@@H]3CO)[nH][nH+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1[NH+]1CCC(c2c([C@@H]3CCCCC[C@@H]3CO)c[nH+]n2C)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC([NH2+][C@@H]2CCCCC[C@@H]2CO)CC1 | C[C@@H]1CCCC[C@H]1[NH+]1CCC(c2c([C@@H]3CCCCC[C@@H]3CO)c[nH+]n2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+]1CCC(C[C@@H]2CCN(Cc3cc(Br)ccc3[N+](=O)[O-])C2)CC1 | CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 | CCC[NH+]1CCC(C[C@@H]2CCN(Cc3cc(Br)ccc3[N+](=O)[O-])C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+](C)CC[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 | CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 | CCCC[NH+](C)CC[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+](C&)C&",
"old_substring": "[NH+]34C"
} |
Can you make molecule CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+]1CCC(C[C@@H]2CCN(Cc3cc(Br)ccc3[N+](=O)[O-])C2)CC1 | CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 | CCCC[NH+]1CCC(C[C@@H]2CCN(Cc3cc(Br)ccc3[N+](=O)[O-])C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+]1CC=C(CC[C@@H]2CCN(Cc3cc(Br)ccc3[N+](=O)[O-])C2)CC1 | CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 | CCC[NH+]1CC=C(CC[C@@H]2CCN(Cc3cc(Br)ccc3[N+](=O)[O-])C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+]1Cc2cc(C[C@@H]3CCN(Cc4cc(Br)ccc4[N+](=O)[O-])C3)sc2C1 | CCC[NH+](C)C[C@@H]1CCN(Cc2cc(Br)ccc2[N+](=O)[O-])C1 | CCC[NH+]1Cc2cc(C[C@@H]3CCN(Cc4cc(Br)ccc4[N+](=O)[O-])C3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]34C"
} |
Can you make molecule Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3SCCS3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3SCCS3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CCCCC3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CCCCC3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3SCCCS3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3SCCCS3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3SCSCS3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3SCSCS3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CCCCCC3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CC3)n2)c1C | Cc1cccc([C@H]2CCCC[NH+]2Cc2noc(C3CCCCCC3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)n1ccn(CSCc2nc(-c3cccc(Cl)c3)no2)c1=S | FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 | FC(F)n1ccn(CSCc2nc(-c3cccc(Cl)c3)no2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccn&c1=S",
"old_substring": "n15ccnc16"
} |
Can you make molecule FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CSCc2nc(-c3cccc(Cl)c3)no2)cn(C(F)F)c1=S | FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 | Cn1c(CSCc2nc(-c3cccc(Cl)c3)no2)cn(C(F)F)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&n(C)c1=S",
"old_substring": "n15ccnc16"
} |
Can you make molecule FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(CSCc2nc(-c3cccc(Cl)c3)no2)nc(Cl)cn1C(F)F | FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 | O=c1c(CSCc2nc(-c3cccc(Cl)c3)no2)nc(Cl)cn1C(F)F | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(Cl)nc&c1=O",
"old_substring": "n15ccnc16"
} |
Can you make molecule FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)n1cc(CSCc2nc(-c3cccc(Cl)c3)no2)cc1Br | FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 | FC(F)n1cc(CSCc2nc(-c3cccc(Cl)c3)no2)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&cc1Br",
"old_substring": "n15ccnc16"
} |
Can you make molecule FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1ccc(CSCc2nc(-c3cccc(Cl)c3)no2)cn1C(F)F | FC(F)n1ccnc1CSCc1nc(-c2cccc(Cl)c2)no1 | O=c1ccc(CSCc2nc(-c3cccc(Cl)c3)no2)cn1C(F)F | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&ccc1=O",
"old_substring": "n15ccnc16"
} |
Can you make molecule CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C#N)ccc1CS(=O)(=O)/N=C(\[O-])CC(C)C | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | Cc1cc(C#N)ccc1CS(=O)(=O)/N=C(\[O-])CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1C",
"old_substring": "c12ccc([N+](=O)[O-])cc1"
} |
Can you make molecule CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc2oc(=O)sc2c1 | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc2oc(=O)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2oc(=O)sc2c1",
"old_substring": "c12ccc([N+](=O)[O-])cc1"
} |
Can you make molecule CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc(C(N)=S)cc1Cl | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc(C(N)=S)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C(N)=S)cc1Cl",
"old_substring": "c12ccc([N+](=O)[O-])cc1"
} |
Can you make molecule CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc2ccc(=O)oc2c1 | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc2ccc(=O)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccc(=O)oc2c1",
"old_substring": "c12ccc([N+](=O)[O-])cc1"
} |
Can you make molecule CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc(Br)c(C=O)c1 | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CC(C)C/C([O-])=N/S(=O)(=O)Cc1ccc(Br)c(C=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(C=O)c1",
"old_substring": "c12ccc([N+](=O)[O-])cc1"
} |
Can you make molecule Clc1ccnc(-c2cccc(C3CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccnc(-c2ccc(C3CC3)cc2I)n1 | Clc1ccnc(-c2cccc(C3CC3)c2)n1 | Clc1ccnc(-c2ccc(C3CC3)cc2I)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Clc1ccnc(-c2cccc(C3CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccnc(-c2cc(C3CC3)ccc2Br)n1 | Clc1ccnc(-c2cccc(C3CC3)c2)n1 | Clc1ccnc(-c2cc(C3CC3)ccc2Br)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Clc1ccnc(-c2cccc(C3CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccnc(-c2ccc(C3CC3)cc2Cl)n1 | Clc1ccnc(-c2cccc(C3CC3)c2)n1 | Clc1ccnc(-c2ccc(C3CC3)cc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Clc1ccnc(-c2cccc(C3CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccnc(-c2cccc(C3CC3)c2Br)n1 | Clc1ccnc(-c2cccc(C3CC3)c2)n1 | Clc1ccnc(-c2cccc(C3CC3)c2Br)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Clc1ccnc(-c2cccc(C3CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccnc(-c2cccc(C3CC3)c2Cl)n1 | Clc1ccnc(-c2cccc(C3CC3)c2)n1 | Clc1ccnc(-c2cccc(C3CC3)c2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14cccc5c1"
} |
Can you make molecule CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1Cl | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccc(I)cc1 | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccc(C)c(I)c1 | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccc(C)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1cccc(Br)c1 | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1cccc(C)c1C | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1ccccc1 | CC[C@H](CC(=O)N1CCOC[C@H]1C(N)=O)c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Fc1ccccc1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cccc&c1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Cc1ccccc1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Ic1ccccc1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Ic1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Fc1ccc(F)cc1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Fc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1F",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Cc1ccccc1C | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1 | C[C@@H](C(=O)NCc1ccccc1F)C1CCN(C(=O)c2ccc3ncoc3c2)CC1.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(OCCCCOc2cccc(-n3cncn3)c2)cc1 | CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 | CS(=O)(=O)c1ccc(OCCCCOc2cccc(-n3cncn3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(OCCCCCOc2cccc(-n3cncn3)c2)cc1 | CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 | CS(=O)(=O)c1ccc(OCCCCCOc2cccc(-n3cncn3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(OC2CC(Oc3cccc(-n4cncn4)c3)C2)cc1 | CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 | CS(=O)(=O)c1ccc(OC2CC(Oc3cccc(-n4cncn4)c3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOc1cccc(-n2cncn2)c1)Oc1ccc(S(C)(=O)=O)cc1 | CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 | C[C@@H](CCOc1cccc(-n2cncn2)c1)Oc1ccc(S(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(OC2CCC(Oc3cccc(-n4cncn4)c3)CC2)cc1 | CS(=O)(=O)c1ccc(OCCOc2cccc(-n3cncn3)c2)cc1 | CS(=O)(=O)c1ccc(OC2CCC(Oc3cccc(-n4cncn4)c3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn2c(=O)c(CC(=O)SNc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(CC(=O)SNc3n[n-]c(C(F)(F)F)n3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn2c(=O)c(C(=O)CCCC(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(C(=O)CCCC(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn2c(=O)c(C(C)(C)CC(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(C(C)(C)CC(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn2c(=O)c(C(C)(C)CCC(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(C(C)(C)CCC(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn2c(=O)c([C@H](C)C(=O)SNc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c(C(=O)Nc3n[n-]c(C(F)(F)F)n3)cnc2c1 | Cc1ccn2c(=O)c([C@H](C)C(=O)SNc3n[n-]c(C(F)(F)F)n3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(CCC[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | CCc1nn(C)c(CCC[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C45"
} |
Can you make molecule CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(CCCC[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | CCc1nn(C)c(CCCC[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C45"
} |
Can you make molecule CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(CCCCC[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | CCc1nn(C)c(CCCCC[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C45"
} |
Can you make molecule CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(C2CC([C@]3(C[NH3+])CCCC(C)(C)[C@@H]3O)C2)c1Cl | CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | CCc1nn(C)c(C2CC([C@]3(C[NH3+])CCCC(C)(C)[C@@H]3O)C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C45"
} |
Can you make molecule CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(-c2nc([C@]3(C[NH3+])CCCC(C)(C)[C@@H]3O)c(C)s2)c1Cl | CCc1nn(C)c(C[C@]2(C[NH3+])CCCC(C)(C)[C@@H]2O)c1Cl | CCc1nn(C)c(-c2nc([C@]3(C[NH3+])CCCC(C)(C)[C@@H]3O)c(C)s2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1sc&nc1&",
"old_substring": "C45"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.