prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(CCl)=Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | CC(CCl)=Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC=&CCl",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | CCCC(C)=Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | CC(C)CCNc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CBr)=Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | CCC(CBr)=Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNc1ncnc(NCCCCBr)c1[N+](=O)[O-])c1ccco1 | CC(C)Nc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] | O=C(NNc1ncnc(NCCCCBr)c1[N+](=O)[O-])c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC3C"
} |
Can you make molecule C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(Br)CSN1CCN(c2cc(C)[nH+]c(C)n2)CC1 | C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 | C=C(Br)CSN1CCN(c2cc(C)[nH+]c(C)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(Br)CN1CC(c2cc(C)[nH+]c(C)n2)C1 | C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 | C=C(Br)CN1CC(c2cc(C)[nH+]c(C)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(Br)CN1CCCN(c2cc(C)[nH+]c(C)n2)C1=O | C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 | C=C(Br)CN1CCCN(c2cc(C)[nH+]c(C)n2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(Br)CN1CCN=C1Sc1cc(C)[nH+]c(C)n1 | C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 | C=C(Br)CN1CCN=C1Sc1cc(C)[nH+]c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)C(C)(C)C1 | C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)CC1 | C=C(Br)CN1CCN(c2cc(C)[nH+]c(C)n2)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | COCc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | COCSc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | CC(=O)Sc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | O=C(CS)c1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | COc1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | O=C(CI)c1cccc(CN/C([O-])=C/n2ccc3sccc3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@H](C)N(C)ONC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@H](C)N(C)ONC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)N(C)O&",
"old_substring": "[C@]7(C)(O)C5"
} |
Can you make molecule Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@](C)(C#N)CCNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@](C)(C#N)CCNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@]&(C)(C#N)CC&",
"old_substring": "[C@]7(C)(O)C5"
} |
Can you make molecule Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@](C)(C#N)CCCNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@](C)(C#N)CCCNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@]&(C)(C#N)CCC&",
"old_substring": "[C@]7(C)(O)C5"
} |
Can you make molecule Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@]2(C)CCN(NC(=O)[C@H]3CCCN3C(=O)CC(C)(C)C)C2)c(C)o1 | Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@@]2(C)CCN(NC(=O)[C@H]3CCCN3C(=O)CC(C)(C)C)C2)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@]1&(C)CCN&C1",
"old_substring": "[C@]7(C)(O)C5"
} |
Can you make molecule Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@H](C)/C(O)=N/CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@](C)(O)CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | Cc1cc([C@@H](C)/C(O)=N/CNC(=O)[C@H]2CCCN2C(=O)CC(C)(C)C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)/C(O)=N/C&",
"old_substring": "[C@]7(C)(O)C5"
} |
Can you make molecule O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ncccc1-c1cc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1cc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccccc2[nH]1",
"old_substring": "c18nc2ccccc2[nH]1"
} |
Can you make molecule O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ncccc1-c1cc2sccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1cc2sccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2[nH]1",
"old_substring": "c18nc2ccccc2[nH]1"
} |
Can you make molecule O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ncccc1-c1nc2ccccc2s1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1nc2ccccc2s1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2ccccc2s1",
"old_substring": "c18nc2ccccc2[nH]1"
} |
Can you make molecule O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ncccc1-c1nc2ccccc2nc1Cl)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1nc2ccccc2nc1Cl)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2ccccc2nc1Cl",
"old_substring": "c18nc2ccccc2[nH]1"
} |
Can you make molecule O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ncccc1-c1cc2ccccn2c1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1nc2ccccc2[nH]1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | O=C(CSc1ncccc1-c1cc2ccccn2c1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccccn2c1",
"old_substring": "c18nc2ccccc2[nH]1"
} |
Can you make molecule SCCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]ccn1CCCCS | SCCCCn1cc[nH+]c1 | O=c1[nH]ccn1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc[nH]c1=O",
"old_substring": "n12cc[nH+]c1"
} |
Can you make molecule SCCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | SCCCCc1cn[nH]c1 | SCCCCn1cc[nH+]c1 | SCCCCc1cn[nH]c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn[nH]c1",
"old_substring": "n12cc[nH+]c1"
} |
Can you make molecule SCCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc[nH]c1CCCCS | SCCCCn1cc[nH+]c1 | Cc1nc[nH]c1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc[nH]c1&",
"old_substring": "n12cc[nH+]c1"
} |
Can you make molecule SCCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]cnc1CCCCS | SCCCCn1cc[nH+]c1 | Cc1[nH]cnc1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc[nH]c1C",
"old_substring": "n12cc[nH+]c1"
} |
Can you make molecule SCCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | SCCCCn1ccc2cc[nH+]cc21 | SCCCCn1cc[nH+]c1 | SCCCCn1ccc2cc[nH+]cc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2cc[nH+]cc21",
"old_substring": "n12cc[nH+]c1"
} |
Can you make molecule N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N/C(=N\OSC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 | N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 | N/C(=N\OSC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C3"
} |
Can you make molecule N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N/C(=N\OC(=O)CCCC(=O)Oc1ccccc1Cl)c1ccc(Cl)cc1 | N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 | N/C(=N\OC(=O)CCCC(=O)Oc1ccccc1Cl)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C3"
} |
Can you make molecule N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)O/N=C(\N)c1ccc(Cl)cc1)Oc1ccccc1Cl | N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 | CC(C)(CC(=O)O/N=C(\N)c1ccc(Cl)cc1)Oc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)C3"
} |
Can you make molecule N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N/C(=N\OC[S@+]([O-])CCCOc1ccccc1Cl)c1ccc(Cl)cc1 | N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 | N/C(=N\OC[S@+]([O-])CCCOc1ccccc1Cl)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C3"
} |
Can you make molecule N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)O/N=C(\N)c1ccc(Cl)cc1)Oc1ccccc1Cl | N/C(=N\OC(=O)COc1ccccc1Cl)c1ccc(Cl)cc1 | CC(C)(CCC(=O)O/N=C(\N)c1ccc(Cl)cc1)Oc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)C3"
} |
Can you make molecule CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)[C@@H]1N[C@H](CCS(=O)(=O)[O-])C(C)(C)S1 | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 | CC(C)(C)OC(=O)[C@@H]1N[C@H](CCS(=O)(=O)[O-])C(C)(C)S1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)CO)C(C)(C)S1 | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)CO)C(C)(C)S1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(O)O)C(C)(C)S1 | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(O)O)C(C)(C)S1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(F)(F)C(=O)[O-])C(C)(C)S1 | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(F)(F)C(=O)[O-])C(C)(C)S1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])[C@H]1N[C@@H](C(=O)OC(C)(C)C)SC1(C)C | CC(C)(C)OC(=O)[C@@H]1N[C@H](C(=O)[O-])C(C)(C)S1 | CCC(CC)(C(=O)[O-])[C@H]1N[C@@H](C(=O)OC(C)(C)C)SC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCCCN1C(=O)Cn1cnc2c(nc3n2CCCCC3)c1=O | C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 | C[C@@H]1CCCCCN1C(=O)Cn1cnc2c(nc3n2CCCCC3)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCCCN1&",
"old_substring": "C[C@@H]1CCCN5C1"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCCN1C(=O)Cn1cnc2c(nc3n2CCCCC3)c1=O | C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 | C[C@H]1CCCCCN1C(=O)Cn1cnc2c(nc3n2CCCCC3)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCCCN1&",
"old_substring": "C[C@@H]1CCCN5C1"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCCl)C(=O)Cn1cnc2c(nc3n2CCCCC3)c1=O | C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 | C[C@H](CCCCl)C(=O)Cn1cnc2c(nc3n2CCCCC3)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CCCCl",
"old_substring": "C[C@@H]1CCCN5C1"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1N=C(CCC(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)CS1 | C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 | C[C@H]1N=C(CCC(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)CS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1N=C(CC&)CS1",
"old_substring": "C[C@@H]1CCCN5C1"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)CCCS1 | C[C@@H]1CCCN(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)C1 | C[C@]1(C(=O)Cn2cnc3c(nc4n3CCCCC4)c2=O)CCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@]1&CCCS1",
"old_substring": "C[C@@H]1CCCN5C1"
} |
Can you make molecule C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(CCC2=c3ccccc3=[NH+][C@H]2C)CC1 | C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O | C[C@H]1CCCN(CCC2=c3ccccc3=[NH+][C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H](C)CC1",
"old_substring": "N13C(=O)[C@H]2CCCC[C@@H]2C1=O"
} |
Can you make molecule C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(CCC2=c3ccccc3=[NH+][C@H]2C)CC1 | C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O | C[C@@H]1CCCN(CCC2=c3ccccc3=[NH+][C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@H](C)CC1",
"old_substring": "N13C(=O)[C@H]2CCCC[C@@H]2C1=O"
} |
Can you make molecule C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[NH+]=c2ccccc2=C1CCN1CCC(C2CCOCC2)CC1 | C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O | C[C@@H]1[NH+]=c2ccccc2=C1CCN1CCC(C2CCOCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C2CCOCC2)CC1",
"old_substring": "N13C(=O)[C@H]2CCCC[C@@H]2C1=O"
} |
Can you make molecule C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[NH+]=c2ccccc2=C1CCN1CCOC2(CCCCCC2)C1 | C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O | C[C@@H]1[NH+]=c2ccccc2=C1CCN1CCOC2(CCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC2(CCCCCC2)C1",
"old_substring": "N13C(=O)[C@H]2CCCC[C@@H]2C1=O"
} |
Can you make molecule C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[NH+]=c2ccccc2=C1CCN1CCC[C@H](Cl)C1 | C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O | C[C@@H]1[NH+]=c2ccccc2=C1CCN1CCC[C@H](Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H](Cl)C1",
"old_substring": "N13C(=O)[C@H]2CCCC[C@@H]2C1=O"
} |
Can you make molecule Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NC=C(CCCCN2CCCC2=O)[C@@H]1C(=O)NCc1ccc2[nH]c(C)cc2c1 | Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 | CC1=NC=C(CCCCN2CCCC2=O)[C@@H]1C(=O)NCc1ccc2[nH]c(C)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C(C&)=CN=C1C",
"old_substring": "[C@H]17CCC(=O)N8C1"
} |
Can you make molecule Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2cc(CNC(=O)[C@H]3CC(CCCCN4CCCC4=O)=NO3)ccc2[nH]1 | Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 | Cc1cc2cc(CNC(=O)[C@H]3CC(CCCCN4CCCC4=O)=NO3)ccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(C&)=NO1",
"old_substring": "[C@H]17CCC(=O)N8C1"
} |
Can you make molecule Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2cc(CNC(=O)[C@H]3C=C(CCCCN4CCCC4=O)N=N3)ccc2[nH]1 | Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 | Cc1cc2cc(CNC(=O)[C@H]3C=C(CCCCN4CCCC4=O)N=N3)ccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C(C&)N=N1",
"old_substring": "[C@H]17CCC(=O)N8C1"
} |
Can you make molecule Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2cc(CNC(=O)[C@H]3CCCN(CCCCN4CCCC4=O)C3)ccc2[nH]1 | Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 | Cc1cc2cc(CNC(=O)[C@H]3CCCN(CCCCN4CCCC4=O)C3)ccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCN(C&)C1",
"old_substring": "[C@H]17CCC(=O)N8C1"
} |
Can you make molecule Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2cc(CNC(=O)[C@H]3CN(CCCN4CCCC4=O)C(C)(C)C3)ccc2[nH]1 | Cc1cc2cc(CNC(=O)[C@H]3CCC(=O)N(CCCN4CCCC4=O)C3)ccc2[nH]1 | Cc1cc2cc(CNC(=O)[C@H]3CN(CCCN4CCCC4=O)C(C)(C)C3)ccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C(C)(C)C1",
"old_substring": "[C@H]17CCC(=O)N8C1"
} |
Can you make molecule N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(F)(F)NC(=O)CSc1nc(-c2ccccc2)n[nH]1 | N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 | N#CC(F)(F)NC(=O)CSc1nc(-c2ccccc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N#CC4"
} |
Can you make molecule N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCCCC(=O)NC(=O)CSc1nc(-c2ccccc2)n[nH]1 | N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 | N#CCCCC(=O)NC(=O)CSc1nc(-c2ccccc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CCCCC&=O",
"old_substring": "N#CC4"
} |
Can you make molecule N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(NC(=O)CSc2nc(-c3ccccc3)n[nH]2)CCOCC1 | N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 | N#CC1(NC(=O)CSc2nc(-c3ccccc3)n[nH]2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&CCOCC1",
"old_substring": "N#CC4"
} |
Can you make molecule N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(NC(=O)CSc2nc(-c3ccccc3)n[nH]2)CCCCC1 | N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 | N#CC1(NC(=O)CSc2nc(-c3ccccc3)n[nH]2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&CCCCC1",
"old_substring": "N#CC4"
} |
Can you make molecule N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=NC(=O)CSc1nc(-c2ccccc2)n[nH]1)c1ccccn1 | N#CCNC(=O)CSc1nc(-c2ccccc2)n[nH]1 | N#CC(=NC(=O)CSc1nc(-c2ccccc2)n[nH]1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC=&c1ccccn1",
"old_substring": "N#CC4"
} |
Can you make molecule C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@H]1CC[C@](c2cscc2Br)(c2c(F)cccc2Cl)C1 | C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br | C[NH2+][C@H]1CC[C@](c2cscc2Br)(c2c(F)cccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@H]23C4"
} |
Can you make molecule C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@H]1CC[C@@](c2cscc2Br)(c2c(F)cccc2Cl)C1 | C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br | C[NH2+][C@H]1CC[C@@](c2cscc2Br)(c2c(F)cccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@H]23C4"
} |
Can you make molecule C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](CCCc1cscc1Br)C(C)(C)c1c(F)cccc1Cl | C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br | C[NH2+][C@@H](CCCc1cscc1Br)C(C)(C)c1c(F)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@H]23C4"
} |
Can you make molecule C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H]1CCC[C@](c2cscc2Br)(c2c(F)cccc2Cl)C1 | C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br | C[NH2+][C@@H]1CCC[C@](c2cscc2Br)(c2c(F)cccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@H]23C4"
} |
Can you make molecule C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1C[C@H](c2cscc2Br)C[C@H](c2c(F)cccc2Cl)C1 | C[NH2+][C@H](Cc1c(F)cccc1Cl)c1cscc1Br | C[NH2+]C1C[C@H](c2cscc2Br)C[C@H](c2c(F)cccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "[C@H]23C4"
} |
Can you make molecule O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1Cl | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccc(I)cc1 | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)NCC(=O)N2CC=C(c3ccccc3)CC2)cc1I | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 | Cc1ccc(CNC(=O)NCC(=O)N2CC=C(c3ccccc3)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1cccc(Br)c1 | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CNC(=O)NCC(=O)N2CC=C(c3ccccc3)CC2)c1C | O=C(NCC(=O)N1CC=C(c2ccccc2)CC1)NCc1ccccc1 | Cc1cccc(CNC(=O)NCC(=O)N2CC=C(c3ccccc3)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cccc(C[C@@]3(CC(=O)SNC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(CC(=O)SNC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cccc(C[C@@]3(CC(=C=O)CNC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(CC(=C=O)CNC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cccc(C[C@@]3(C(=O)CCCC(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(C(=O)CCCC(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cccc(C[C@@]3(C(C)(C)CC(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(C(C)(C)CC(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cccc(C[C@@]3(CCC[S@@+]([O-])CNC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(C(=O)NC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | Cc1ccc(-c2cccc(C[C@@]3(CCC[S@@+]([O-])CNC(C)C)CCN(C(=O)C4CC4)C3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C58=O"
} |
Can you make molecule C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=Cn1ccnc1-c1ccccc1CN/C(NCc1cc(C)on1)=[NH+]\C | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 | C=Cn1ccnc1-c1ccccc1CN/C(NCc1cc(C)on1)=[NH+]\C | 102 | {
"fragment_index": 0,
"new_substring": "C=Cn1ccnc1&",
"old_substring": "n16ccnc1"
} |
Can you make molecule C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1cc(I)cn1 | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1cc(I)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cn1",
"old_substring": "n16ccnc1"
} |
Can you make molecule C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccsc1=O | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccsc1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccsc1=O",
"old_substring": "n16ccnc1"
} |
Can you make molecule C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1nc(C)cc1C | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1nc(C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc(C)cc1C",
"old_substring": "n16ccnc1"
} |
Can you make molecule C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1cnc(C)c1C | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1ccnc1 | C/[NH+]=C(/NCc1cc(C)on1)NCc1ccccc1-n1cnc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc(C)c1C",
"old_substring": "n16ccnc1"
} |
Can you make molecule CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCSc1ccc([C@H](C)NC(=O)CC(C)(C)NCc2ncoc2C)cc1 | CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 | CCSc1ccc([C@H](C)NC(=O)CC(C)(C)NCc2ncoc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCSc1ccc([C@H](C)NC(=O)CCC(C)(C)NCc2ncoc2C)cc1 | CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 | CCSc1ccc([C@H](C)NC(=O)CCC(C)(C)NCc2ncoc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCSc1ccc([C@H](C)Nc2c(C)n(C)n(NCc3ncoc3C)c2=O)cc1 | CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 | CCSc1ccc([C@H](C)Nc2c(C)n(C)n(NCc3ncoc3C)c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C34=O"
} |
Can you make molecule CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCSc1ccc([C@H](C)Nc2nn(NCc3ncoc3C)c(C)cc2=O)cc1 | CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 | CCSc1ccc([C@H](C)Nc2nn(NCc3ncoc3C)c(C)cc2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C34=O"
} |
Can you make molecule CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCSc1ccc([C@H](C)NC(=O)C[C@@H](Br)NCc2ncoc2C)cc1 | CCSc1ccc([C@H](C)NC(=O)NCc2ncoc2C)cc1 | CCSc1ccc([C@H](C)NC(=O)C[C@@H](Br)NCc2ncoc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1CC1)Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1 | O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 | O=C(/C=C/SC1CC1)Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C38"
} |
Can you make molecule O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2cccc(NC(=O)N3CCC[C@H]3c3cccc(F)c3)c2)nc1C1CC1 | O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 | O=Cc1sc(Nc2cccc(NC(=O)N3CCC[C@H]3c3cccc(F)c3)c2)nc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C38"
} |
Can you make molecule O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2cccc(NC(=O)N3CCC[C@H]3c3cccc(F)c3)c2)sc1C1CC1 | O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 | O=Cc1nc(Nc2cccc(NC(=O)N3CCC[C@H]3c3cccc(F)c3)c2)sc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C38"
} |
Can you make molecule O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/CC1CC1)Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1 | O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 | O=C(N/N=C/CC1CC1)Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C38"
} |
Can you make molecule O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Nc2cccc(NC(=O)N3CCC[C@H]3c3cccc(F)c3)c2)CCC1=C1CC1 | O=C(Nc1cccc(NC(=O)N2CCC[C@H]2c2cccc(F)c2)c1)C1CC1 | O=C1C(=Nc2cccc(NC(=O)N3CCC[C@H]3c3cccc(F)c3)c2)CCC1=C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C38"
} |
Can you make molecule CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1I | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)c1cc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)ccc1Br | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 | CC(C)NC(=O)c1cc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1Cl | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)c1cccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)c1Br | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 | CC(C)NC(=O)c1cccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)c1cccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)c1Cl | CC(C)NC(=O)c1ccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)cc1 | CC(C)NC(=O)c1cccc(OCC(=O)N2[C@H](C)CCC[C@@H]2C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)COCO2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)COCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COCO2",
"old_substring": "c15ccc2c(c1)OCO2"
} |
Can you make molecule O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1cc2c(cc1I)OCO2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1cc2c(cc1I)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(cc1I)OCO2",
"old_substring": "c15ccc2c(c1)OCO2"
} |
Can you make molecule O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)COC2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(c1)COC2",
"old_substring": "c15ccc2c(c1)OCO2"
} |
Can you make molecule O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1cc2c(cc1Br)OCO2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1cc2c(cc1Br)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(cc1Br)OCO2",
"old_substring": "c15ccc2c(c1)OCO2"
} |
Can you make molecule O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1cc(F)cc2c1OCOC2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 | O=C([O-])CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1cc(F)cc2c1OCOC2 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cc&c2c(c1)COCO2",
"old_substring": "c15ccc2c(c1)OCO2"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.