prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)Cc1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOSC(=O)Cc1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOC(=O)CCCC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOC(=O)CC(C)(C)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCC(C)(C)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOC(=O)CCC(C)(C)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)[C@@H](C)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOC(=O)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | CCOSC(=O)[C@@H](C)c1ccc(/[NH+]=c2\oc3c(OCC)cccc3cc2C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C/C(C[NH2+][C@H](C)Cn1cccn1)=N/ON1C[C@H](C(N)=O)Oc2ccccc21 | C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | C/C(C[NH2+][C@H](C)Cn1cccn1)=N/ON1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C3=O"
} |
Can you make molecule C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([NH2+][C@H](C)Cn1cccn1)C(=O)CN1C[C@H](C(N)=O)Oc2ccccc21 | C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CCC(CC)([NH2+][C@H](C)Cn1cccn1)C(=O)CN1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C3=O"
} |
Can you make molecule C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cn1cccn1)[NH2+]SSC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | C[C@H](Cn1cccn1)[NH2+]SSC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([NH2+][C@H](C)Cn1cccn1)C(=O)CCN1C[C@H](C(N)=O)Oc2ccccc21 | C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CCC(CC)([NH2+][C@H](C)Cn1cccn1)C(=O)CCN1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C3=O"
} |
Can you make molecule C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)[NH2+][C@H](C)Cn1cccn1)C(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | C[C@H](Cn1cccn1)[NH2+]CC(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CC[C@H](C(=O)[NH2+][C@H](C)Cn1cccn1)C(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule C=CCSc1nc(N)c(C#N)cc1C#N less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCSc1nc(N)c(C#N)cc1C#N | C=CCSc1nc(N)c(C#N)cc1C#N | C=CCCCSc1nc(N)c(C#N)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC2"
} |
Can you make molecule C=CCSc1nc(N)c(C#N)cc1C#N less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCSc1nc(N)c(C#N)cc1C#N | C=CCSc1nc(N)c(C#N)cc1C#N | C=CCCCCSc1nc(N)c(C#N)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC2"
} |
Can you make molecule C=CCSc1nc(N)c(C#N)cc1C#N less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)Sc1nc(N)c(C#N)cc1C#N | C=CCSc1nc(N)c(C#N)cc1C#N | C=CCCCC(=O)Sc1nc(N)c(C#N)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C=CC2"
} |
Can you make molecule C=CCSc1nc(N)c(C#N)cc1C#N less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(CC=C)Sc1nc(N)c(C#N)cc1C#N | C=CCSc1nc(N)c(C#N)cc1C#N | C=CCC(CC=C)Sc1nc(N)c(C#N)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&CC=C",
"old_substring": "C=CC2"
} |
Can you make molecule C=CCSc1nc(N)c(C#N)cc1C#N less soluble in water? The output molecule should be similar to the input molecule. | C=CC1CCN(Sc2nc(N)c(C#N)cc2C#N)CC1 | C=CCSc1nc(N)c(C#N)cc1C#N | C=CC1CCN(Sc2nc(N)c(C#N)cc2C#N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC1CCN&CC1",
"old_substring": "C=CC2"
} |
Can you make molecule COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C=Cc2cc(CCS(=O)(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | COc1cc(C=Cc2cc(CCS(=O)(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C=Cc2cc(C(=O)CO)c3ccccc3n2)ccc1OCC(=O)[O-] | COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | COc1cc(C=Cc2cc(C(=O)CO)c3ccccc3n2)ccc1OCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C=Cc2cc(C(O)O)c3ccccc3n2)ccc1OCC(=O)[O-] | COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | COc1cc(C=Cc2cc(C(O)O)c3ccccc3n2)ccc1OCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])c1cc(C=Cc2ccc(OCC(=O)[O-])c(OC)c2)nc2ccccc12 | COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | CCC(CC)(C(=O)[O-])c1cc(C=Cc2ccc(OCC(=O)[O-])c(OC)c2)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C=Cc2cc(CCCS(=O)(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | COc1cc(C=Cc2cc(C(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | COc1cc(C=Cc2cc(CCCS(=O)(=O)[O-])c3ccccc3n2)ccc1OCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)c1 | O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 | O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c14ccn6n1"
} |
Can you make molecule O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ccccc1)Nc1csc2nc(-c3ncccc3Cl)cn12 | O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 | O=C(CCC(=O)c1ccccc1)Nc1csc2nc(-c3ncccc3Cl)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2nc&cn12",
"old_substring": "c14ccn6n1"
} |
Can you make molecule O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ccccc1)Nc1cc(-c2ncccc2Cl)nc(Cl)n1 | O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 | O=C(CCC(=O)c1ccccc1)Nc1cc(-c2ncccc2Cl)nc(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc(Cl)n1",
"old_substring": "c14ccn6n1"
} |
Can you make molecule O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ccccc1)Nc1cc(Cl)nc(-c2ncccc2Cl)n1 | O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 | O=C(CCC(=O)c1ccccc1)Nc1cc(Cl)nc(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)nc&n1",
"old_substring": "c14ccn6n1"
} |
Can you make molecule O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(-c2ncccc2Cl)c(Br)c1NC(=O)CCC(=O)c1ccccc1 | O=C(CCC(=O)c1ccccc1)Nc1ccn(-c2ncccc2Cl)n1 | Cn1nc(-c2ncccc2Cl)c(Br)c1NC(=O)CCC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Br)c&nn1C",
"old_substring": "c14ccn6n1"
} |
Can you make molecule Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)sc1Cl | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)sc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&sc1Cl",
"old_substring": "Cc1nc8cs1"
} |
Can you make molecule Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccc(CCNC(=O)c3ccc(OCC(F)F)nc3)cc2s1 | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 | Cc1nc2ccc(CCNC(=O)c3ccc(OCC(F)F)nc3)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc2ccc&cc2s1",
"old_substring": "Cc1nc8cs1"
} |
Can you make molecule Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)ccc1I | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&ccc1I",
"old_substring": "Cc1nc8cs1"
} |
Can you make molecule Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCNC(=O)c2ccc(OCC(F)F)nc2)sc1C | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 | Cc1cc(CCNC(=O)c2ccc(OCC(F)F)nc2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "Cc1nc8cs1"
} |
Can you make molecule Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C=CCNC(=O)c2ccc(OCC(F)F)nc2)s1 | Cc1nc(CCNC(=O)c2ccc(OCC(F)F)nc2)cs1 | Cc1nc(C)c(C=CCNC(=O)c2ccc(OCC(F)F)nc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc(C)c(C=&)s1",
"old_substring": "Cc1nc8cs1"
} |
Can you make molecule COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc2cc([C@@H](C)NC(=O)CC(C)(C)N3CCC(CC[NH+](C)C)CC3)oc12 | COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 | COc1cccc2cc([C@@H](C)NC(=O)CC(C)(C)N3CCC(CC[NH+](C)C)CC3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc2cc([C@@H](C)NC(=O)CCC(C)(C)N3CCC(CC[NH+](C)C)CC3)oc12 | COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 | COc1cccc2cc([C@@H](C)NC(=O)CCC(C)(C)N3CCC(CC[NH+](C)C)CC3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc2cc([C@@H](C)NC(=O)C[C@@H](Br)N3CCC(CC[NH+](C)C)CC3)oc12 | COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 | COc1cccc2cc([C@@H](C)NC(=O)C[C@@H](Br)N3CCC(CC[NH+](C)C)CC3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc2cc([C@@H](C)Nc3cc(C)n(N4CCC(CC[NH+](C)C)CC4)c(=O)c3)oc12 | COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 | COc1cccc2cc([C@@H](C)Nc3cc(C)n(N4CCC(CC[NH+](C)C)CC4)c(=O)c3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc2cc([C@@H](C)Nc3c(C)n(N4CCC(CC[NH+](C)C)CC4)ccc3=O)oc12 | COc1cccc2cc([C@@H](C)NC(=O)N3CCC(CC[NH+](C)C)CC3)oc12 | COc1cccc2cc([C@@H](C)Nc3c(C)n(N4CCC(CC[NH+](C)C)CC4)ccc3=O)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)CC(C)(C)NCc1ccc[nH+]c1N1CCOCC1 | C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 | C[C@@H]1Cc2ccccc2N1C(=O)CC(C)(C)NCc1ccc[nH+]c1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)CCC(C)(C)NCc1ccc[nH+]c1N1CCOCC1 | C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 | C[C@@H]1Cc2ccccc2N1C(=O)CCC(C)(C)NCc1ccc[nH+]c1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)C[C@@H](Br)NCc1ccc[nH+]c1N1CCOCC1 | C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 | C[C@@H]1Cc2ccccc2N1C(=O)C[C@@H](Br)NCc1ccc[nH+]c1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2c3ccccc3C[C@H]2C)cc(=O)n1NCc1ccc[nH+]c1N1CCOCC1 | C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 | Cc1cc(N2c3ccccc3C[C@H]2C)cc(=O)n1NCc1ccc[nH+]c1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N2c3ccccc3C[C@H]2C)c(=O)ccn1NCc1ccc[nH+]c1N1CCOCC1 | C[C@@H]1Cc2ccccc2N1C(=O)NCc1ccc[nH+]c1N1CCOCC1 | Cc1c(N2c3ccccc3C[C@H]2C)c(=O)ccn1NCc1ccc[nH+]c1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OCCC(CO)=Nc2ccccc2N2CCc3ccccc32)cc1 | N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 | N#Cc1ccc(OCCC(CO)=Nc2ccccc2N2CCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C4=O"
} |
Can you make molecule N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(COc1ccc(C#N)cc1)=N/ONc1ccccc1N1CCc2ccccc21 | N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 | C/C(COc1ccc(C#N)cc1)=N/ONc1ccccc1N1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(C#N)cc1)C(=O)CNc1ccccc1N1CCc2ccccc21 | N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 | CCC(CC)(Oc1ccc(C#N)cc1)C(=O)CNc1ccccc1N1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C4=O"
} |
Can you make molecule N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OSSC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 | N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 | N#Cc1ccc(OSSC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(C#N)cc1)C(=O)CCNc1ccccc1N1CCc2ccccc21 | N#Cc1ccc(OCC(=O)Nc2ccccc2N2CCc3ccccc32)cc1 | CCC(CC)(Oc1ccc(C#N)cc1)C(=O)CCNc1ccccc1N1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C4=O"
} |
Can you make molecule C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccccc1F)[NH2+]CCCCc1nc2cc(F)ccc2n1C | C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C | C[C@H](CCc1ccccc1F)[NH2+]CCCCc1nc2cc(F)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccccc1F)[NH2+]CCCCCc1nc2cc(F)ccc2n1C | C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C | C[C@H](CCc1ccccc1F)[NH2+]CCCCCc1nc2cc(F)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccccc1F)[NH2+]C1CC(c2nc3cc(F)ccc3n2C)C1 | C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C | C[C@H](CCc1ccccc1F)[NH2+]C1CC(c2nc3cc(F)ccc3n2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccccc1F)[NH2+][C@@H](C)CCc1nc2cc(F)ccc2n1C | C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C | C[C@H](CCc1ccccc1F)[NH2+][C@@H](C)CCc1nc2cc(F)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccccc1F)[NH2+]C1CCC(c2nc3cc(F)ccc3n2C)CC1 | C[C@H](CCc1ccccc1F)[NH2+]CCc1nc2cc(F)ccc2n1C | C[C@H](CCc1ccccc1F)[NH2+]C1CCC(c2nc3cc(F)ccc3n2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@H]1CCC[C@H]1N1CCCC1 | [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 | [NH3+]C[C@H]1CCC[C@H]1N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N12CCOCC1"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@H]1CCC[C@H]1N1CCCCC1 | [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 | [NH3+]C[C@H]1CCC[C@H]1N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N12CCOCC1"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@H]1CCC[C@H]1N1CCSCC1 | [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 | [NH3+]C[C@H]1CCC[C@H]1N1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N12CCOCC1"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@H]1CCC[C@H]1N1CC=CC1 | [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 | [NH3+]C[C@H]1CCC[C@H]1N1CC=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N12CCOCC1"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@H]1CCC[C@H]1SSN1CCOCC1 | [NH3+]C[C@H]1CCC[C@H]1N1CCOCC1 | [NH3+]C[C@H]1CCC[C@H]1SSN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N12CCOCC1"
} |
Can you make molecule CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C1CC1)[C@@H]1C[C@@H]2c3cccc(OC)c3N2C1.CO | CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC | CC[NH+](C1CC1)[C@@H]1C[C@@H]2c3cccc(OC)c3N2C1.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C[C@H]&N&C1",
"old_substring": "[C@@H]57C[NH3+]"
} |
Can you make molecule CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C1CC1)[C@@H]1CC[C@@H]2c3cccc(OC)c3N21.CO | CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC | CC[NH+](C1CC1)[C@@H]1CC[C@@H]2c3cccc(OC)c3N21.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&N1&",
"old_substring": "[C@@H]57C[NH3+]"
} |
Can you make molecule CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C1CC1)[C@@H]1CO[C@]2(O1)c1cccc(OC)c12.CO | CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC | CC[NH+](C1CC1)[C@@H]1CO[C@]2(O1)c1cccc(OC)c12.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CO[C@]&&O1",
"old_substring": "[C@@H]57C[NH3+]"
} |
Can you make molecule CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C1CC1)[C@@H]1CCC[C@]2(C1)c1cccc(OC)c12.CO | CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC | CC[NH+](C1CC1)[C@@H]1CCC[C@]2(C1)c1cccc(OC)c12.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@@H]57C[NH3+]"
} |
Can you make molecule CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C1CC1)[C@@H]1C[C@]2(CCO1)c1cccc(OC)c12.CO | CC[NH+](C1CC1)[C@@H](C[NH3+])c1cccc(OC)c1OC | CC[NH+](C1CC1)[C@@H]1C[C@]2(CCO1)c1cccc(OC)c12.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C[C@]&&CCO1",
"old_substring": "[C@@H]57C[NH3+]"
} |
Can you make molecule CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(n2nnnc2C[NH+](C)C2CCN(c3ccc(F)cc3)CC2)C1 | CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | CC1CC(n2nnnc2C[NH+](C)C2CCN(c3ccc(F)cc3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC6"
} |
Can you make molecule CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | CC(C)CCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC6"
} |
Can you make molecule CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1nnnn1CCCCBr)C1CCN(c2ccc(F)cc2)CC1 | CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | C[NH+](Cc1nnnn1CCCCBr)C1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC6"
} |
Can you make molecule CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | C=CCCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1nnnn1CCCCCl)C1CCN(c2ccc(F)cc2)CC1 | CCCn1nnnc1C[NH+](C)C1CCN(c2ccc(F)cc2)CC1 | C[NH+](Cc1nnnn1CCCCCl)C1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC6"
} |
Can you make molecule COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc(N2CCN[C@H](C)C2)c1[N+](=O)[O-] | COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] | COc1ncnc(N2CCN[C@H](C)C2)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&[C@H](C)C1",
"old_substring": "N14CC[NH2+][C@H](C)C1"
} |
Can you make molecule COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc(N2CCN[C@H](C)C2=O)c1[N+](=O)[O-] | COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] | COc1ncnc(N2CCN[C@H](C)C2=O)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&[C@H](C)C1=O",
"old_substring": "N14CC[NH2+][C@H](C)C1"
} |
Can you make molecule COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc(N2CCN[C@H](C#N)C2)c1[N+](=O)[O-] | COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] | COc1ncnc(N2CCN[C@H](C#N)C2)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&[C@H](C#N)C1",
"old_substring": "N14CC[NH2+][C@H](C)C1"
} |
Can you make molecule COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc([C@@H](C)C(C)C)c1[N+](=O)[O-] | COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] | COc1ncnc([C@@H](C)C(C)C)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "N14CC[NH2+][C@H](C)C1"
} |
Can you make molecule COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc(N2C[C@H](C)NCC2=O)c1[N+](=O)[O-] | COc1ncnc(N2CC[NH2+][C@H](C)C2)c1[N+](=O)[O-] | COc1ncnc(N2C[C@H](C)NCC2=O)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H](C)N&CC1=O",
"old_substring": "N14CC[NH2+][C@H](C)C1"
} |
Can you make molecule CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)C(=O)N(CC2(CCCC(N)=S)CC2)S1(=O)=O | CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O | CC1(C)C(=O)N(CC2(CCCC(N)=S)CC2)S1(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(N)=S",
"old_substring": "C5C(N)=S"
} |
Can you make molecule CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=S)SC1(CN2C(=O)C(C)(C)S2(=O)=O)CC1 | CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O | CN(C)C(=S)SC1(CN2C(=O)C(C)(C)S2(=O)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN(C)C(=S)S&",
"old_substring": "C5C(N)=S"
} |
Can you make molecule CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=NNC(=O)SC1(CN2C(=O)C(C)(C)S2(=O)=O)CC1 | CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O | CC(C)=NNC(=O)SC1(CN2C(=O)C(C)(C)S2(=O)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)=NNC(=O)S&",
"old_substring": "C5C(N)=S"
} |
Can you make molecule CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)C1(CN2C(=O)C(C)(C)S2(=O)=O)CC1 | CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O | CC(C)C(=O)C1(CN2C(=O)C(C)(C)S2(=O)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C5C(N)=S"
} |
Can you make molecule CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)C(=O)N(CC2(CCCN=C=S)CC2)S1(=O)=O | CC1(C)C(=O)N(CC2(CC(N)=S)CC2)S1(=O)=O | CC1(C)C(=O)N(CC2(CCCN=C=S)CC2)S1(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCN=C=S",
"old_substring": "C5C(N)=S"
} |
Can you make molecule Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ccccc2c1NC(=O)[C@H]1CCOc2ccccc21 | Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 | Cc1ccc2ccccc2c1NC(=O)[C@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2ccccc2c1&",
"old_substring": "Cc1cc5c2ncccc2c1"
} |
Can you make molecule Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@H]2CCOc3ccccc32)c2ccccc12 | Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 | Cc1ccc(NC(=O)[C@H]2CCOc3ccccc32)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&c2ccccc12",
"old_substring": "Cc1cc5c2ncccc2c1"
} |
Can you make molecule Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2sc(NC(=O)[C@H]3CCOc4ccccc43)cc2c1 | Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 | Cc1ccc2sc(NC(=O)[C@H]3CCOc4ccccc43)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2sc&cc2c1",
"old_substring": "Cc1cc5c2ncccc2c1"
} |
Can you make molecule Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2cc(I)ccc2n1 | Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 | Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2cc(I)ccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c2cc(I)ccc2n1",
"old_substring": "Cc1cc5c2ncccc2c1"
} |
Can you make molecule Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccnc2c(Cl)c(Cl)ccc12)[C@H]1CCOc2ccccc21 | Cc1cc(NC(=O)[C@H]2CCOc3ccccc32)c2ncccc2c1 | O=C(Nc1ccnc2c(Cl)c(Cl)ccc12)[C@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc2c&ccnc2c1Cl",
"old_substring": "Cc1cc5c2ncccc2c1"
} |
Can you make molecule Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1CN1CCN(SC(=O)C[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(SC(=O)C[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1CN1CCN(CC(=C=O)C[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(CC(=C=O)C[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1CN1CCN(C(=O)CCCC(=O)[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(C(=O)CCCC(=O)[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1CN1CCN(C(=O)CC(C)(C)[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(C(=O)CC(C)(C)[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1CN1CCN(C[S@+]([O-])CCC[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | Cc1nn(C)cc1CN1CCN(C[S@+]([O-])CCC[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[NH+](CCCCNC(=O)CC(C)(C)Nc2ccccn2)C1 | C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 | C[C@@H]1CCC[NH+](CCCCNC(=O)CC(C)(C)Nc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[NH+](CCCCNC(=O)CCC(C)(C)Nc2ccccn2)C1 | C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 | C[C@@H]1CCC[NH+](CCCCNC(=O)CCC(C)(C)Nc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[NH+](CCCCNC(=O)C[C@@H](Br)Nc2ccccn2)C1 | C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 | C[C@@H]1CCC[NH+](CCCCNC(=O)C[C@@H](Br)Nc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NCCCC[NH+]2CCC[C@@H](C)C2)cc(=O)n1Nc1ccccn1 | C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 | Cc1cc(NCCCC[NH+]2CCC[C@@H](C)C2)cc(=O)n1Nc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NCCCC[NH+]2CCC[C@@H](C)C2)c(=O)ccn1Nc1ccccn1 | C[C@@H]1CCC[NH+](CCCCNC(=O)Nc2ccccn2)C1 | Cc1c(NCCCC[NH+]2CCC[C@@H](C)C2)c(=O)ccn1Nc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N[C@@]1(C#N)CC[C@@H](CC[C@@H](N)C[C@@H]2CC[NH+](C)C2)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](CC[C@@H](N)C[C@@H]2CC[NH+](C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N56C"
} |
Can you make molecule CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N[C@@]1(C#N)CC[C@@H](c2oc(C[C@@H]3CC[NH+](C)C3)nc2C#N)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](c2oc(C[C@@H]3CC[NH+](C)C3)nc2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N56C"
} |
Can you make molecule CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N[C@@]1(C#N)CC[C@@H](S/C(N)=N/CC[C@@H]2CC[NH+](C)C2)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](S/C(N)=N/CC[C@@H]2CC[NH+](C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N/C(=N\\C&)S&",
"old_substring": "N56C"
} |
Can you make molecule CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N[C@@]1(C#N)CC[C@@H](c2sc(C[C@@H]3CC[NH+](C)C3)cc2C#N)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](c2sc(C[C@@H]3CC[NH+](C)C3)cc2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N56C"
} |
Can you make molecule CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N[C@@]1(C#N)CC[C@@H](c2ccc(C[C@@H]3CC[NH+](C)C3)cc2C#N)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](N(C)C[C@@H]2CC[NH+](C)C2)C1 | CC(C)N[C@@]1(C#N)CC[C@@H](c2ccc(C[C@@H]3CC[NH+](C)C3)cc2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N56C"
} |
Can you make molecule CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(C(C)C)CCN(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)C1 | CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C | CC(C)C1(C(C)C)CCN(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N456"
} |
Can you make molecule CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(C(C)C)CCCN(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)C1 | CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C | CC(C)C1(C(C)C)CCCN(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N456"
} |
Can you make molecule CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1oc(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)c(C#N)c1C(C)C | CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C | CC(C)c1oc(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)c(C#N)c1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N456"
} |
Can you make molecule CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(C(C)C)CCC(=O)N(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)C1 | CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C | CC(C)C1(C(C)C)CCC(=O)N(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N456"
} |
Can you make molecule CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nc(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)c(C#N)c(C(C)C)n1 | CC(C)N(C(=O)CSc1ncnc2sc3c(c12)CC[C@H](C)C3)C(C)C | CC(C)c1nc(C(=O)CSc2ncnc3sc4c(c23)CC[C@H](C)C4)c(C#N)c(C(C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&nc&nc1&",
"old_substring": "N456"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.