prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOSC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)N(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC(=O)CCCC(=O)N(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)N(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC(=O)CC(C)(C)N(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[S@+]([O-])CCCN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC[S@+]([O-])CCCN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCC(C)(C)N(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC(=O)CN(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | CCOC(=O)CCC(C)(C)N(CC1CC1)C(=O)[C@@H]1SCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OC(C)(C)CCBr | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OC(C)(C)CCBr | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "C3C(C)C"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)O[C@@H](C)/C([O-])=N/S(=O)(=O)c1cc([N+](=O)[O-])ccc1C | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C | CCCC(C)(C)O[C@@H](C)/C([O-])=N/S(=O)(=O)c1cc([N+](=O)[O-])ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C3C(C)C"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)(C)CBr | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)(C)CBr | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)CBr",
"old_substring": "C3C(C)C"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OC(C(C)C)C(C)C | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OC(C(C)C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "C3C(C)C"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OC(=O)CCCC(C)C | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OCC(C)C | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)/N=C(\[O-])[C@H](C)OC(=O)CCCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "C3C(C)C"
} |
Can you make molecule CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=Nc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | CC(C)=Nc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&C",
"old_substring": "CC3"
} |
Can you make molecule CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | C=CSNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | C=CSNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | CC(I)=Nc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | CC(I)=Nc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&I",
"old_substring": "CC3"
} |
Can you make molecule CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | C=CCCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2ccc(Cl)c(Cl)c2)c2sc(N=CCCl)nc2N1 | CCNc1nc2c(s1)[C@@H](c1ccc(Cl)c(Cl)c1)CC(=O)N2 | O=C1C[C@H](c2ccc(Cl)c(Cl)c2)c2sc(N=CCCl)nc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCl",
"old_substring": "CC3"
} |
Can you make molecule C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(c2ccc(C[NH3+])cc2I)NC(=O)NC1=O | C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O | C[C@@]1(c2ccc(C[NH3+])cc2I)NC(=O)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14ccc3cc1"
} |
Can you make molecule C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(c2cc(C[NH3+])ccc2Br)NC(=O)NC1=O | C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O | C[C@@]1(c2cc(C[NH3+])ccc2Br)NC(=O)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14ccc3cc1"
} |
Can you make molecule C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(c2ccc(C[NH3+])cc2Cl)NC(=O)NC1=O | C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O | C[C@@]1(c2ccc(C[NH3+])cc2Cl)NC(=O)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14ccc3cc1"
} |
Can you make molecule C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(c2cccc(C[NH3+])c2Br)NC(=O)NC1=O | C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O | C[C@@]1(c2cccc(C[NH3+])c2Br)NC(=O)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14ccc3cc1"
} |
Can you make molecule C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(c2cccc(C[NH3+])c2Cl)NC(=O)NC1=O | C[C@@]1(c2ccc(C[NH3+])cc2)NC(=O)NC1=O | C[C@@]1(c2cccc(C[NH3+])c2Cl)NC(=O)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14ccc3cc1"
} |
Can you make molecule O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCS1 | O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 | O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&CCS1",
"old_substring": "[C@@H]14CN3CCO1"
} |
Can you make molecule O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])C[C@@H]1CCN(c2ccc([N+](=O)[O-])cc2Cl)C1 | O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 | O=C([O-])C[C@@H]1CCN(c2ccc([N+](=O)[O-])cc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCN&C1",
"old_substring": "[C@@H]14CN3CCO1"
} |
Can you make molecule O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])C[C@@H]1CCCN(c2ccc([N+](=O)[O-])cc2Cl)C1=O | O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 | O=C([O-])C[C@@H]1CCCN(c2ccc([N+](=O)[O-])cc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&C1=O",
"old_substring": "[C@@H]14CN3CCO1"
} |
Can you make molecule O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])C[C@@H]1CC[C@H](c2ccc([N+](=O)[O-])cc2Cl)O1 | O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 | O=C([O-])C[C@@H]1CC[C@H](c2ccc([N+](=O)[O-])cc2Cl)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]14CN3CCO1"
} |
Can you make molecule O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])C[C@@H]1CCCN(c2ccc([N+](=O)[O-])cc2Cl)CC1 | O=C([O-])C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2Cl)CCO1 | O=C([O-])C[C@@H]1CCCN(c2ccc([N+](=O)[O-])cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@@H]14CN3CCO1"
} |
Can you make molecule CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | C=CSOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | C=CCCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCCCCl)c1nc2ccccc2nc1Nc1ccc(F)cc1F | CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | O=C(OCCCCl)c1nc2ccccc2nc1Nc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCCCCS)c1nc2ccccc2nc1Nc1ccc(F)cc1F | CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | O=C(OCCCCS)c1nc2ccccc2nc1Nc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCCCBr)c1nc2ccccc2nc1Nc1ccc(F)cc1F | CCOC(=O)c1nc2ccccc2nc1Nc1ccc(F)cc1F | O=C(OCCCBr)c1nc2ccccc2nc1Nc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCCCSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1CCCCSc1ccccc1C(=O)Nn1cnc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCCCCSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1CCCCCSc1ccccc1C(=O)Nn1cnc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1C1CC(Sc2ccccc2C(=O)Nn2cnc3ccccc32)C1 | Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1C1CC(Sc2ccccc2C(=O)Nn2cnc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1SC(=S)OSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1SC(=S)OSc1ccccc1C(=O)Nn1cnc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1NC(=S)SSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1CSc1ccccc1C(=O)Nn1cnc2ccccc21 | Cc1noc(C)c1NC(=S)SSc1ccccc1C(=O)Nn1cnc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C35"
} |
Can you make molecule CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)SN1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 | CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 | CC(C)C(=O)SN1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)N1CCCN(S(=O)(=O)c2cccc(Br)c2)C1=O | CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 | CC(C)C(=O)N1CCCN(S(=O)(=O)c2cccc(Br)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)N1CCN=C1SS(=O)(=O)c1cccc(Br)c1 | CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 | CC(C)C(=O)N1CCN=C1SS(=O)(=O)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)C(C)(C)C1 | CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 | CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)N1CCC(C#N)(S(=O)(=O)c2cccc(Br)c2)CC1 | CC(C)C(=O)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 | CC(C)C(=O)N1CCC(C#N)(S(=O)(=O)c2cccc(Br)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&(C#N)CC1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule OCc1cn2c(n1)OC(Cl)=CC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(F)c1cn2c(n1)OC(Cl)=CC2 | OCc1cn2c(n1)OC(Cl)=CC2 | O=C(F)c1cn2c(n1)OC(Cl)=CC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&F",
"old_substring": "OC3"
} |
Can you make molecule OCc1cn2c(n1)OC(Cl)=CC2 less soluble in water? The output molecule should be similar to the input molecule. | ClCOc1cn2c(n1)OC(Cl)=CC2 | OCc1cn2c(n1)OC(Cl)=CC2 | ClCOc1cn2c(n1)OC(Cl)=CC2 | 102 | {
"fragment_index": 0,
"new_substring": "O&CCl",
"old_substring": "OC3"
} |
Can you make molecule OCc1cn2c(n1)OC(Cl)=CC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cl)c1cn2c(n1)OC(Cl)=CC2 | OCc1cn2c(n1)OC(Cl)=CC2 | O=C(Cl)c1cn2c(n1)OC(Cl)=CC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&Cl",
"old_substring": "OC3"
} |
Can you make molecule OCc1cn2c(n1)OC(Cl)=CC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CF)c1cn2c(n1)OC(Cl)=CC2 | OCc1cn2c(n1)OC(Cl)=CC2 | O=C(CF)c1cn2c(n1)OC(Cl)=CC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CF",
"old_substring": "OC3"
} |
Can you make molecule OCc1cn2c(n1)OC(Cl)=CC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCl)c1cn2c(n1)OC(Cl)=CC2 | OCc1cn2c(n1)OC(Cl)=CC2 | O=C(CCCl)c1cn2c(n1)OC(Cl)=CC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCl",
"old_substring": "OC3"
} |
Can you make molecule C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)CC1 | C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 | C[NH+]1CCC([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=CCC[NH+]([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)C1 | C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 | CC1=CCC[NH+]([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCC[NH+]&C1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+]([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)CC1 | C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 | CC1CC[NH+]([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CC[NH+]&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(C)([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)CC1 | C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 | C[NH+]1CCC(C)([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&(C)CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CC[C@@H]([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)C1 | C[NH2+][C@@]1(C(=O)[O-])CC[C@H](Sc2nccc(=O)[nH]2)C1 | C[NH+]1CC[C@@H]([C@@]2(C(=O)[O-])CC[C@H](Sc3nccc(=O)[nH]3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CC[C@@H]&C1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=NOC2([C@@H](N)c3cnccn3)CCCCCC2)CC1 | C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 | C[NH+]1CCC(=NOC2([C@@H](N)c3cnccn3)CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC(=NO&)CC1",
"old_substring": "C[NH+]3C"
} |
Can you make molecule C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+](C)(C)C1([C@@H](N)c2cnccn2)CCCCCC1 | C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 | C[N+](C)(C)C1([C@@H](N)c2cnccn2)CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "C[NH+]3C"
} |
Can you make molecule C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N[C@@H](c1cnccn1)C1(C[NH+]2CCCSCC2)CCCCCC1 | C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 | N[C@@H](c1cnccn1)C1(C[NH+]2CCCSCC2)CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCSCC1",
"old_substring": "C[NH+]3C"
} |
Can you make molecule C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+]1(C)CCC(C2([C@@H](N)c3cnccn3)CCCCCC2)CC1 | C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 | C[N+]1(C)CCC(C2([C@@H](N)c3cnccn3)CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C[NH+]3C"
} |
Can you make molecule C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N[C@@H](c1cnccn1)C1(C[NH+]2CCCCCCC2)CCCCCC1 | C[NH+](C)C1([C@@H](N)c2cnccn2)CCCCCC1 | N[C@@H](c1cnccn1)C1(C[NH+]2CCCCCCC2)CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCCCCC1",
"old_substring": "C[NH+]3C"
} |
Can you make molecule CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC[C@@H](CNSC(=O)Cc2ccc3nncn3c2)c2ccccc21 | CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 | CC1(C)CC[C@@H](CNSC(=O)Cc2ccc3nncn3c2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC[C@@H](CNC(=O)CCCC(=O)c2ccc3nncn3c2)c2ccccc21 | CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 | CC1(C)CC[C@@H](CNC(=O)CCCC(=O)c2ccc3nncn3c2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)NC[C@@H]1CCC(C)(C)c2ccccc21)c1ccc2nncn2c1 | CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 | CC(C)(CC(=O)NC[C@@H]1CCC(C)(C)c2ccccc21)c1ccc2nncn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)NC[C@@H]1CCC(C)(C)c2ccccc21)c1ccc2nncn2c1 | CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 | CC(C)(CCC(=O)NC[C@@H]1CCC(C)(C)c2ccccc21)c1ccc2nncn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNC[C@@H]1CCC(C)(C)c2ccccc21)c1ccc2nncn2c1 | CC1(C)CC[C@@H](CNC(=O)c2ccc3nncn3c2)c2ccccc21 | C[C@H](C(=O)SNC[C@@H]1CCC(C)(C)c2ccccc21)c1ccc2nncn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[S@+]([O-])CC[NH2+]C1CCC(=Cc2ccc(C#N)cc2)CC1 | C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 | C[S@+]([O-])CC[NH2+]C1CCC(=Cc2ccc(C#N)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "C3C=4"
} |
Can you make molecule C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[S@+]([O-])CC[NH2+]N1CCC=C(C=Cc2ccc(C#N)cc2)C1 | C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 | C[S@+]([O-])CC[NH2+]N1CCC=C(C=Cc2ccc(C#N)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "C3C=4"
} |
Can you make molecule C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[S@+]([O-])CC[NH2+]N1CCCS/C1=N\CC=Cc1ccc(C#N)cc1 | C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 | C[S@+]([O-])CC[NH2+]N1CCCS/C1=N\CC=Cc1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCS/C1=N\\CC&",
"old_substring": "C3C=4"
} |
Can you make molecule C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([NH2+]CC[S@+](C)[O-])C(=O)CC=Cc1ccc(C#N)cc1 | C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 | CCC(CC)([NH2+]CC[S@+](C)[O-])C(=O)CC=Cc1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C3C=4"
} |
Can you make molecule C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[S@+]([O-])CC[NH2+]SC([SH]=Cc1ccc(C#N)cc1)=C(C#N)C#N | C[S@+]([O-])CC[NH2+]CC=Cc1ccc(C#N)cc1 | C[S@+]([O-])CC[NH2+]SC([SH]=Cc1ccc(C#N)cc1)=C(C#N)C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#CC(C#N)=C(S&)S&",
"old_substring": "C3C=4"
} |
Can you make molecule C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Fc1ccccc1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cccc&c1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Cc1ccccc1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Ic1ccccc1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Ic1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Fc1ccc(F)cc1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Fc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1F",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Cc1ccccc1C | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cnn(-c4ccccc4)c3)cc2)CC1 | C[NH+]1CCN(Cc2ccc(C[NH2+]Cc3cn[nH]c3)cc2)CC1.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@H]1CCC[C@@H]1NSC(=O)Cc1c(F)ccc([N+](=O)[O-])c1F | N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F | N#C[C@H]1CCC[C@@H]1NSC(=O)Cc1c(F)ccc([N+](=O)[O-])c1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@H]1CCC[C@@H]1NC(=O)CCCC(=O)c1c(F)ccc([N+](=O)[O-])c1F | N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F | N#C[C@H]1CCC[C@@H]1NC(=O)CCCC(=O)c1c(F)ccc([N+](=O)[O-])c1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)N[C@H]1CCC[C@@H]1C#N)c1c(F)ccc([N+](=O)[O-])c1F | N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F | CC(C)(CC(=O)N[C@H]1CCC[C@@H]1C#N)c1c(F)ccc([N+](=O)[O-])c1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)N[C@H]1CCC[C@@H]1C#N)c1c(F)ccc([N+](=O)[O-])c1F | N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F | CC(C)(CCC(=O)N[C@H]1CCC[C@@H]1C#N)c1c(F)ccc([N+](=O)[O-])c1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN[C@H]1CCC[C@@H]1C#N)c1c(F)ccc([N+](=O)[O-])c1F | N#C[C@H]1CCC[C@@H]1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F | C[C@H](C(=O)SN[C@H]1CCC[C@@H]1C#N)c1c(F)ccc([N+](=O)[O-])c1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)COc1ccc(CCC[C@@H](CCl)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | CC(C)COc1ccc(CCC[C@@H](CCl)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]57C"
} |
Can you make molecule CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)COc1ccc(CCC2=CN=N[C@H]2[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | CC(C)COc1ccc(CCC2=CN=N[C@H]2[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]57C"
} |
Can you make molecule CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)COc1ccc([C@@H]2CC[C@@H]([NH2+]C3C[C@H](C)O[C@@H](C)C3)C2)cc1 | CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | CC(C)COc1ccc([C@@H]2CC[C@@H]([NH2+]C3C[C@H](C)O[C@@H](C)C3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]57C"
} |
Can you make molecule CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)COc1ccc(CC(C)(C)[C@@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | CC(C)COc1ccc(CC(C)(C)[C@@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]57C"
} |
Can you make molecule CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(OCC(C)C)cc1)[NH2+]C1C[C@H](C)O[C@@H](C)C1 | CC(C)COc1ccc([C@H](C)[NH2+]C2C[C@H](C)O[C@@H](C)C2)cc1 | CC[C@@H](CCc1ccc(OCC(C)C)cc1)[NH2+]C1C[C@H](C)O[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]57C"
} |
Can you make molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(N=C(C)O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | CC(=O)Nc1cc(N=C(C)O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)O",
"old_substring": "C5(C)=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(NC(=O)C(C)C)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | CC(=O)Nc1cc(NC(=O)C(C)C)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C5(C)=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(C)=Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | COC(C)=Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)OC",
"old_substring": "C5(C)=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | C=C(C)C(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C&=O",
"old_substring": "C5(C)=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(NC(=O)CC(C)C)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | CC(=O)Nc1cc(NC(=O)CC(C)C)cc(C(=O)Nc2cc(C)cc3cccnc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&=O",
"old_substring": "C5(C)=O"
} |
Can you make molecule Cc1cccnc1C[C@@H](Cl)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@H](Cl)Cc2ncccc2C)c(C)o1 | Cc1cccnc1C[C@@H](Cl)c1ccoc1 | Cc1cc([C@H](Cl)Cc2ncccc2C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)oc1C",
"old_substring": "c13ccoc1"
} |
Can you make molecule Cc1cccnc1C[C@@H](Cl)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccnc1C[C@@H](Cl)c1occc1Br | Cc1cccnc1C[C@@H](Cl)c1ccoc1 | Cc1cccnc1C[C@@H](Cl)c1occc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c13ccoc1"
} |
Can you make molecule Cc1cccnc1C[C@@H](Cl)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccnc1C[C@@H](Cl)c1sccc1C | Cc1cccnc1C[C@@H](Cl)c1ccoc1 | Cc1cccnc1C[C@@H](Cl)c1sccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c13ccoc1"
} |
Can you make molecule Cc1cccnc1C[C@@H](Cl)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccnc1C[C@@H](Cl)c1ccc(I)o1 | Cc1cccnc1C[C@@H](Cl)c1ccoc1 | Cc1cccnc1C[C@@H](Cl)c1ccc(I)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c13ccoc1"
} |
Can you make molecule Cc1cccnc1C[C@@H](Cl)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccnc1C[C@@H](Cl)c1sccc1Br | Cc1cccnc1C[C@@H](Cl)c1ccoc1 | Cc1cccnc1C[C@@H](Cl)c1sccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c13ccoc1"
} |
Can you make molecule CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=S)N1CCCN(c2ccc(C#N)cc2C)CC1 | CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 | CNC(=S)N1CCCN(c2ccc(C#N)cc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1C",
"old_substring": "c13ccc(C#N)cn1"
} |
Can you make molecule CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=S)N1CCCN(c2ccc(C#N)s2)CC1 | CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 | CNC(=S)N1CCCN(c2ccc(C#N)s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)s1",
"old_substring": "c13ccc(C#N)cn1"
} |
Can you make molecule CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=S)N1CCCN(c2ccc(C#N)cc2Cl)CC1 | CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 | CNC(=S)N1CCCN(c2ccc(C#N)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1Cl",
"old_substring": "c13ccc(C#N)cn1"
} |
Can you make molecule CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=S)N1CCCN(c2cc(C)ccc2C#N)CC1 | CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 | CNC(=S)N1CCCN(c2cc(C)ccc2C#N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C#N)c&c1",
"old_substring": "c13ccc(C#N)cn1"
} |
Can you make molecule CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=S)N1CCCN(c2ccc(I)cn2)CC1 | CNC(=S)N1CCCN(c2ccc(C#N)cn2)CC1 | CNC(=S)N1CCCN(c2ccc(I)cn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cn1",
"old_substring": "c13ccc(C#N)cn1"
} |
Can you make molecule C[C@@H](Cl)[C@@H](C)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCBr)CCc1cscc1Br | C[C@@H](Cl)[C@@H](C)c1cscc1Br | C[C@H](CCBr)CCc1cscc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CCBr",
"old_substring": "C[C@@H]2[C@@H](C)Cl"
} |
Can you make molecule C[C@@H](Cl)[C@@H](C)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCBr)CCc1cscc1Br | C[C@@H](Cl)[C@@H](C)c1cscc1Br | C[C@@H](CCBr)CCc1cscc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CCBr",
"old_substring": "C[C@@H]2[C@@H](C)Cl"
} |
Can you make molecule C[C@@H](Cl)[C@@H](C)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cl)CC(C)(C)c1cscc1Br | C[C@@H](Cl)[C@@H](C)c1cscc1Br | C[C@@H](Cl)CC(C)(C)c1cscc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](Cl)CC&(C)C",
"old_substring": "C[C@@H]2[C@@H](C)Cl"
} |
Can you make molecule C[C@@H](Cl)[C@@H](C)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)c1cscc1Br | C[C@@H](Cl)[C@@H](C)c1cscc1Br | CC[C@@H](C)C[C@H](CC)c1cscc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "C[C@@H]2[C@@H](C)Cl"
} |
Can you make molecule C[C@@H](Cl)[C@@H](C)c1cscc1Br less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](CC)Cc1cscc1Br | C[C@@H](Cl)[C@@H](C)c1cscc1Br | CCCC[C@H](CC)Cc1cscc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C&)CC",
"old_substring": "C[C@@H]2[C@@H](C)Cl"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.