prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NSC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCCC(=O)n2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC(=O)CCCC(=O)n2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC(C)(C)n2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC(=O)CC(C)(C)n2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC[S@+]([O-])CCCn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC[S@+]([O-])CCCn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCC(C)(C)n2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC(=O)Cn2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | Cc1ccc(NC(=O)CCC(C)(C)n2c(=O)oc3cc(S(=O)(=O)N4CCCCC4)ccc32)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC[C@@H](C)C(=O)c1ccc(F)cc1)c1cccnc1 | CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 | CC(C)[C@@H](NC[C@@H](C)C(=O)c1ccc(F)cc1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NCC[C@H](C)CC(=O)c1ccc(F)cc1)c1cccnc1 | CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 | CC(C)[C@@H](NCC[C@H](C)CC(=O)c1ccc(F)cc1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC[C@@H](O)C(C)(C)c1ccc(F)cc1)c1cccnc1 | CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 | CC(C)[C@@H](NC[C@@H](O)C(C)(C)c1ccc(F)cc1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)c1ccc(F)cc1)N[C@@H](c1cccnc1)C(C)C | CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 | CC[C@H](CC(=O)c1ccc(F)cc1)N[C@@H](c1cccnc1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&CC&=O",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)C[C@H](C)C(=O)c1ccc(F)cc1)c1cccnc1 | CC(C)[C@@H](NC[C@H](O)c1ccc(F)cc1)c1cccnc1 | CC(C)[C@@H](NC(=O)C[C@H](C)C(=O)c1ccc(F)cc1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1[C@@H](CBr)CC[C@@H]1CCOC2(CCC2)C1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1[C@@H](CBr)CC[C@@H]1CCOC2(CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "C45(C)C"
} |
Can you make molecule C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C1(C#N)CCC([C@@H]2CCOC3(CCC3)C2)CC1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C1(C#N)CCC([C@@H]2CCOC3(CCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "C45(C)C"
} |
Can you make molecule C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1[C@@H](CBr)CCC[C@@H]1CCOC2(CCC2)C1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1[C@@H](CBr)CCC[C@@H]1CCOC2(CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "C45(C)C"
} |
Can you make molecule C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1[C@](C)(C#N)CCC[C@@H]1CCOC2(CCC2)C1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1[C@](C)(C#N)CCC[C@@H]1CCOC2(CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@]&(C)(C#N)CCC&",
"old_substring": "C45(C)C"
} |
Can you make molecule C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1c1c(C)c(C)c([C@@H]2CCOC3(CCC3)C2)c(C)c1C | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1C(C)(C)[C@@H]1CCOC2(CCC2)C1 | C[NH2+][C@@H]1C[C@@H](C)CC[C@@H]1c1c(C)c(C)c([C@@H]2CCOC3(CCC3)C2)c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(C)c(C)c&c1C",
"old_substring": "C45(C)C"
} |
Can you make molecule Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(NSC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NSC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(NC(=O)CCCC(=O)c2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC(=O)CCCC(=O)c2ccc(F)cc2)nc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(NC(=O)CC(C)(C)c2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC(=O)CC(C)(C)c2ccc(F)cc2)nc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(NC[S@+]([O-])CCCc2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC[S@+]([O-])CCCc2ccc(F)cc2)nc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(NC(=O)CCC(C)(C)c2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC(=O)Cc2ccc(F)cc2)nc1-c1ccc(F)cc1 | Cc1sc(NC(=O)CCC(C)(C)c2ccc(F)cc2)nc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1cc(C)sc1C)NC(=O)[C@@H](C)c1ccsc1 | Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | CC[C@@H](CCc1cc(C)sc1C)NC(=O)[C@@H](C)c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]45C"
} |
Can you make molecule Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC[C@H](CBr)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | Cc1cc(CC[C@H](CBr)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]45C"
} |
Can you make molecule Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCC[C@H](CBr)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | Cc1cc(CCC[C@H](CBr)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]45C"
} |
Can you make molecule Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCC[C@@H](CCl)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | Cc1cc(CCC[C@@H](CCl)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]45C"
} |
Can you make molecule Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@H]2CCC[C@H](NC(=O)[C@@H](C)c3ccsc3)C2)c(C)s1 | Cc1cc([C@@H](C)NC(=O)[C@@H](C)c2ccsc2)c(C)s1 | Cc1cc([C@H]2CCC[C@H](NC(=O)[C@@H](C)c3ccsc3)C2)c(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]45C"
} |
Can you make molecule Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CC(C)(C)c2cccs2)C1 | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CC(C)(C)c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCC(C)(C)c2cccs2)C1 | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCC(C)(C)c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)N1CCC[C@@H](c2nnc(Cn3ccnc3)n2C)C1)c1cccs1 | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 | C[C@@H](CC(=O)N1CCC[C@@H](c2nnc(Cn3ccnc3)n2C)C1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)C[C@@H](Br)c2cccs2)C1 | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)C[C@@H](Br)c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN1CCC[C@@H](c2nnc(Cn3ccnc3)n2C)C1)c1cccs1 | Cn1c(Cn2ccnc2)nnc1[C@@H]1CCCN(C(=O)CCc2cccs2)C1 | C[C@H](C(=O)SN1CCC[C@@H](c2nnc(Cn3ccnc3)n2C)C1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](O)[C@H](CC)C1(C(=O)NCc2cccc(OC)c2)Cc2ccccc2C1 | COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 | CC[C@H](O)[C@H](CC)C1(C(=O)NCc2cccc(OC)c2)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](O)[C@@H]&CC",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)C2(C[C@@H](CS)C(C)C)Cc3ccccc3C2)c1 | COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 | COc1cccc(CNC(=O)C2(C[C@@H](CS)C(C)C)Cc3ccccc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](CS)C(C)C",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)C2(C[C@H](CO)C(C)C)Cc3ccccc3C2)c1 | COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 | COc1cccc(CNC(=O)C2(C[C@H](CO)C(C)C)Cc3ccccc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](CO)C(C)C",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)C2(N3CCCC(C)(C)C3)Cc3ccccc3C2)c1 | COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 | COc1cccc(CNC(=O)C2(N3CCCC(C)(C)C3)Cc3ccccc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)C2(N3CCC(C)(C)C3)Cc3ccccc3C2)c1 | COc1cccc(CNC(=O)C2(N3C[C@@H](C)O[C@@H](C)C3)Cc3ccccc3C2)c1 | COc1cccc(CNC(=O)C2(N3CCC(C)(C)C3)Cc3ccccc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)(C)C1",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(C)(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | CC1CCC(C)(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CCC&(C)CC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1coc2ccc3ccccc3c12)C1CCCCC1 | CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | O=C(Cc1coc2ccc3ccccc3c12)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | CC1(C)CCC(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1coc2ccc3ccccc3c12)C1CCC(Cl)CC1 | CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | O=C(Cc1coc2ccc3ccccc3c12)C1CCC(Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC1=CCCCC1)Cc1coc2ccc3ccccc3c12 | CC1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 | O=C(CC1=CCCCC1)Cc1coc2ccc3ccccc3c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCCCC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CCCC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SN1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CC(=O)SN1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CCCCC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCN1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CC(=O)CCCN1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCN1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CC(=O)N1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | CCC(=O)CCCN1CCc2cc(-c3csc(NC(=O)C(C)C)n3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CC4=O"
} |
Can you make molecule COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)N1CCc2c(sc(NSC(=O)Cc3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NSC(=O)Cc3ccccc3Br)c2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C68=O"
} |
Can you make molecule COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)N1CCc2c(sc(NC(=O)CCCC(=O)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NC(=O)CCCC(=O)c3ccccc3Br)c2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C68=O"
} |
Can you make molecule COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)N1CCc2c(sc(NC(=O)CC(C)(C)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NC(=O)CC(C)(C)c3ccccc3Br)c2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C68=O"
} |
Can you make molecule COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)N1CCc2c(sc(NC(=O)CCC(C)(C)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NC(=O)CCC(C)(C)c3ccccc3Br)c2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C68=O"
} |
Can you make molecule COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)N1CCc2c(sc(NSC(=O)[C@@H](C)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NC(=O)c3ccccc3Br)c2C#N)C1 | COC(=O)N1CCc2c(sc(NSC(=O)[C@@H](C)c3ccccc3Br)c2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C68=O"
} |
Can you make molecule CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=NC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | CCCC(C)=NC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "CCC4"
} |
Can you make molecule CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CBr)=NC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | CCC(CBr)=NC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CBr",
"old_substring": "CCC4"
} |
Can you make molecule CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCl)=NC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | CC(CCl)=NC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&CCl",
"old_substring": "CCC4"
} |
Can you make molecule CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | CC(C)CCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC4"
} |
Can you make molecule CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nc(-c2ccccc2)c2ccccc21)NCCCCBr | CCCNC(=O)Cn1nc(-c2ccccc2)c2ccccc21 | O=C(Cn1nc(-c2ccccc2)c2ccccc21)NCCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC4"
} |
Can you make molecule Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3nc(Cl)nc(C(C)C)c3C)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3nc(Cl)nc(C(C)C)c3C)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(Cl)nc&c1C",
"old_substring": "c18cc(C)n9n1"
} |
Can you make molecule Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C(C)C)cc(Cl)n3)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C(C)C)cc(Cl)n3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(Cl)n1",
"old_substring": "c18cc(C)n9n1"
} |
Can you make molecule Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(Cl)cc(C(C)C)n3)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(Cl)cc(C(C)C)n3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc&n1",
"old_substring": "c18cc(C)n9n1"
} |
Can you make molecule Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3nc(C)c(C(C)C)s3)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3nc(C)c(C(C)C)s3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c&s1",
"old_substring": "c18cc(C)n9n1"
} |
Can you make molecule Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cccc4c(C)nc(C(C)C)nc34)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cc(C)n(C(C)C)n3)sc2c1 | Cc1cc(C)c2nc(N(CC[NH+](C)C)C(=O)c3cccc4c(C)nc(C(C)C)nc34)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc2c(C)nc&nc12",
"old_substring": "c18cc(C)n9n1"
} |
Can you make molecule COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@]1(C)O[C@]1(C(=O)OC)C1(C)CCCC1 | COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C | COCC[C@]1(C)O[C@]1(C(=O)OC)C1(C)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C6(C)C"
} |
Can you make molecule COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@]1(C)O[C@]1(C(=O)OC)C(Cl)(Cl)Cl | COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C | COCC[C@]1(C)O[C@]1(C(=O)OC)C(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C6(C)C"
} |
Can you make molecule COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)[C@@]1(C(=O)OC)O[C@@]1(C)CCOC | COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C | CCCC(C)(C)[C@@]1(C(=O)OC)O[C@@]1(C)CCOC | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C6(C)C"
} |
Can you make molecule COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)[C@@]1(C(=O)OC)O[C@@]1(C)CCOC | COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C | CCC(C)(CC)[C@@]1(C(=O)OC)O[C@@]1(C)CCOC | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C6(C)C"
} |
Can you make molecule COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@]1(C)O[C@]1(C(=O)OC)C1(C=O)CCCCCC1 | COCC[C@]1(C)O[C@]1(C(=O)OC)C(C)C | COCC[C@]1(C)O[C@]1(C(=O)OC)C1(C=O)CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C6(C)C"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2I)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2I)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccccc14"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1NC(=O)N(CC(=O)Nc2cc(Oc3ccccc3)ccc2Br)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2cc(Oc3ccccc3)ccc2Br)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccccc14"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2Cl)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccccc14"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1NC(=O)N(CC(=O)Nc2cccc(Oc3ccccc3)c2Br)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2cccc(Oc3ccccc3)c2Br)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccccc14"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1NC(=O)N(CC(=O)Nc2cccc(Oc3ccccc3)c2Cl)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2ccccc2Oc2ccccc2)C1=O | CCC[C@@H]1NC(=O)N(CC(=O)Nc2cccc(Oc3ccccc3)c2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccccc14"
} |
Can you make molecule Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NSC(=O)Cc2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NSC(=O)Cc2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NC(=O)CCCC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NC(=O)CCCC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NC(=O)CC(C)(C)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NC(=O)CC(C)(C)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NC(=O)CCC(C)(C)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NC(=O)CCC(C)(C)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NSC(=O)[C@@H](C)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NC(=O)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | Cc1c(NSC(=O)[C@@H](C)c2cc(F)ccc2O)cccc1C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | C=CSc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | CC(C)c1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | C=CCCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN([C@H](C)C(=O)Nc2ccccc2CCCCl)CCO1 | CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | C[C@@H]1CN([C@H](C)C(=O)Nc2ccccc2CCCCl)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN([C@H](C)C(=O)Nc2ccccc2CCCCS)CCO1 | CCc1ccccc1NC(=O)[C@@H](C)N1CCO[C@H](C)C1 | C[C@@H]1CN([C@H](C)C(=O)Nc2ccccc2CCCCS)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CSC[C@H](C)N(C)SC(=O)Cc1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)SC(=O)Cc1ccc(N(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CSC[C@H](C)N(C)C(=O)CCCC(=O)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)C(=O)CCCC(=O)c1ccc(N(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C26=O"
} |
Can you make molecule CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CSC[C@H](C)N(C)C(=O)CC(C)(C)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)C(=O)CC(C)(C)c1ccc(N(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CSC[C@H](C)N(C)C(=O)CCC(C)(C)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)C(=O)CCC(C)(C)c1ccc(N(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CSC[C@H](C)N(C)SC(=O)[C@@H](C)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)C(=O)c1ccc(N(C)C)cc1F | CSC[C@H](C)N(C)SC(=O)[C@@H](C)c1ccc(N(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C26=O"
} |
Can you make molecule CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1I | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCc1cc(C(=O)CSc2nnc3sc4ccccc4n23)ccc1Br | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 | CC(=O)NCc1cc(C(=O)CSc2nnc3sc4ccccc4n23)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1Cl | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCc1cccc(C(=O)CSc2nnc3sc4ccccc4n23)c1Br | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 | CC(=O)NCc1cccc(C(=O)CSc2nnc3sc4ccccc4n23)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCc1cccc(C(=O)CSc2nnc3sc4ccccc4n23)c1Cl | CC(=O)NCc1ccc(C(=O)CSc2nnc3sc4ccccc4n23)cc1 | CC(=O)NCc1cccc(C(=O)CSc2nnc3sc4ccccc4n23)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C[C@@H](O)[C@H]1CCO[C@]2(CCSC2)C1)c1ccccc1O | C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 | C[C@@H](C[C@@H](O)[C@H]1CCO[C@]2(CCSC2)C1)c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C[C@H]&O",
"old_substring": "C[C@H]5[NH3+]"
} |
Can you make molecule C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[C@H]1CCO[C@]2(CCSC2)C1)[C@H](C)c1ccccc1O | C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 | C[C@H](C[C@H]1CCO[C@]2(CCSC2)C1)[C@H](C)c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]5[NH3+]"
} |
Can you make molecule C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](c2ccccc2O)CCN1[C@H]1CCO[C@]2(CCSC2)C1 | C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 | C[C@@H]1[C@H](c2ccccc2O)CCN1[C@H]1CCO[C@]2(CCSC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1[C@H]&CCN1&",
"old_substring": "C[C@H]5[NH3+]"
} |
Can you make molecule C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](c2ccccc2O)OCCN1[C@H]1CCO[C@]2(CCSC2)C1 | C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 | C[C@H]1[C@H](c2ccccc2O)OCCN1[C@H]1CCO[C@]2(CCSC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1[C@H]&OCCN1&",
"old_substring": "C[C@H]5[NH3+]"
} |
Can you make molecule C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(c2ccccc2O)C[C@H]1[C@H]1CCO[C@]2(CCSC2)C1 | C[C@@H]([NH3+])c1ccccc1O[C@H]1CCO[C@]2(CCSC2)C1 | C[C@H]1CCN(c2ccccc2O)C[C@H]1[C@H]1CCO[C@]2(CCSC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&C[C@H]1&",
"old_substring": "C[C@H]5[NH3+]"
} |
Can you make molecule Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(O)c(C2(C)CCCC2)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | Cc1cc(O)c(C2(C)CCCC2)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C5(C)C"
} |
Can you make molecule Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(O)c(C(Cl)(Cl)Cl)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | Cc1cc(O)c(C(Cl)(Cl)Cl)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)C"
} |
Can you make molecule Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1cc([N-]S(=O)(=O)c2c[nH]c3ncccc23)c(C)cc1O | Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | CCCC(C)(C)c1cc([N-]S(=O)(=O)c2c[nH]c3ncccc23)c(C)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C5(C)C"
} |
Can you make molecule Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)c1cc([N-]S(=O)(=O)c2c[nH]c3ncccc23)c(C)cc1O | Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | CCC(C)(CC)c1cc([N-]S(=O)(=O)c2c[nH]c3ncccc23)c(C)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C5(C)C"
} |
Can you make molecule Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(O)c(C2(C=O)CCCCCC2)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | Cc1cc(O)c(C(C)C)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | Cc1cc(O)c(C2(C=O)CCCCCC2)cc1[N-]S(=O)(=O)c1c[nH]c2ncccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C5(C)C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.