prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nnc3c(=O)n(-c4c(Cl)cccc4Cl)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4c(Cl)cccc4Cl)ccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nnc3c(=O)n(-c4ccc(Cl)cc4I)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4ccc(Cl)cc4I)ccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nnc3c(=O)n(-c4ccc(Cl)cc4Br)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4ccc(Cl)cc4Br)ccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nnc3c(=O)n(-c4ccc(Cl)c(I)c4)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4ccc(Cl)c(I)c4)ccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nnc3c(=O)n(-c4ccc(Cl)c(Cl)c4)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4cccc(Cl)c4)ccc3n2n1 | CSc1nc2nnc3c(=O)n(-c4ccc(Cl)c(Cl)c4)ccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c15cccc(Cl)c1"
} |
Can you make molecule Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3Cl)C(C)C)CC2)c1C | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3Cl)C(C)C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccc(I)cc3)C(C)C)CC2)c1C | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccc(I)cc3)C(C)C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN([C@H](c3nnnn3C=Cc3ccccc3)C(C)C)CC2)c1C | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C | Cc1cccc(N2CCN([C@H](c3nnnn3C=Cc3ccccc3)C(C)C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2nnnc2[C@H](C(C)C)N2CCN(c3cccc(C)c3C)CC2)cc1I | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C | Cc1ccc(Cn2nnnc2[C@H](C(C)C)N2CCN(c3cccc(C)c3C)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3cccc(Br)c3)C(C)C)CC2)c1C | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3ccccc3)C(C)C)CC2)c1C | Cc1cccc(N2CCN([C@H](c3nnnn3Cc3cccc(Br)c3)C(C)C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](Cc2cc(Cl)c(Cl)cc2N)CC1 | CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 | CN1CCC[NH+](Cc2cc(Cl)c(Cl)cc2N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c(Cl)cc1N",
"old_substring": "c14cc(Cl)ccc1N"
} |
Can you make molecule CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](Cc2cc(Cl)cc(Cl)c2N)CC1 | CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 | CN1CCC[NH+](Cc2cc(Cl)cc(Cl)c2N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1N",
"old_substring": "c14cc(Cl)ccc1N"
} |
Can you make molecule CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](Cc2cc(Cl)c(Br)cc2N)CC1 | CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 | CN1CCC[NH+](Cc2cc(Cl)c(Br)cc2N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c(Br)cc1N",
"old_substring": "c14cc(Cl)ccc1N"
} |
Can you make molecule CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](Cc2cc(Cl)c(N)cc2Cl)CC1 | CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 | CN1CCC[NH+](Cc2cc(Cl)c(N)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c(N)cc1Cl",
"old_substring": "c14cc(Cl)ccc1N"
} |
Can you make molecule CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](Cc2cnc(Cl)cc2I)CC1 | CN1CCC[NH+](Cc2cc(Cl)ccc2N)CC1 | CN1CCC[NH+](Cc2cnc(Cl)cc2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)cc1I",
"old_substring": "c14cc(Cl)ccc1N"
} |
Can you make molecule O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C1CC1)N1CCC(C2(Cc3ccncc3)CC[NH2+]C2)CC1 | O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 | O=S(=O)(C1CC1)N1CCC(C2(Cc3ccncc3)CC[NH2+]C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]35"
} |
Can you make molecule O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C1CC1)N1CCC([C@@]2(Cc3ccncc3)CCC[NH2+]C2)CC1 | O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 | O=S(=O)(C1CC1)N1CCC([C@@]2(Cc3ccncc3)CCC[NH2+]C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]35"
} |
Can you make molecule O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C1CC1)N1CCC(c2c[nH+]cn2Cc2ccncc2)CC1 | O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 | O=S(=O)(C1CC1)N1CCC(c2c[nH+]cn2Cc2ccncc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]35"
} |
Can you make molecule O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C1CC1)N1CCC(c2cc(Cc3ccncc3)[nH+][nH]2)CC1 | O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 | O=S(=O)(C1CC1)N1CCC(c2cc(Cc3ccncc3)[nH+][nH]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]35"
} |
Can you make molecule O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1[nH+]cc(C2CCN(S(=O)(=O)C3CC3)CC2)c1Cc1ccncc1 | O=S(=O)(C1CC1)N1CCC([NH2+]Cc2ccncc2)CC1 | Cn1[nH+]cc(C2CCN(S(=O)(=O)C3CC3)CC2)c1Cc1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]35"
} |
Can you make molecule C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(C(=O)NC[C@@H]2CC[NH+](C=Cc3cscn3)C2)cc1 | C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 | N#Cc1ccc(C(=O)NC[C@@H]2CC[NH+](C=Cc3cscn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cscn1",
"old_substring": "C=Cn1cc9cn1"
} |
Can you make molecule C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(C(=O)NC[C@@H]2CC[NH+](C=Cc3nccs3)C2)cc1 | C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 | N#Cc1ccc(C(=O)NC[C@@H]2CC[NH+](C=Cc3nccs3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1nccs1",
"old_substring": "C=Cn1cc9cn1"
} |
Can you make molecule C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(CC[NH+]1CC[C@@H](CNC(=O)c2ccc(C#N)cc2)C1)c1ccccn1 | C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 | C=C(CC[NH+]1CC[C@@H](CNC(=O)c2ccc(C#N)cc2)C1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)c1ccccn1",
"old_substring": "C=Cn1cc9cn1"
} |
Can you make molecule C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=C[NH+]1CC[C@@H](CNC(=O)c2ccc(C#N)cc2)C1)c1ccncc1 | C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 | CC(=C[NH+]1CC[C@@H](CNC(=O)c2ccc(C#N)cc2)C1)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)c1ccncc1",
"old_substring": "C=Cn1cc9cn1"
} |
Can you make molecule C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=C[NH+]1CC[C@@H](CNC(=O)c2ccc(C#N)cc2)C1)c1cccnc1 | C=Cn1cc(C[NH+]2CC[C@@H](CNC(=O)c3ccc(C#N)cc3)C2)cn1 | CC(=C[NH+]1CC[C@@H](CNC(=O)c2ccc(C#N)cc2)C1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)c1cccnc1",
"old_substring": "C=Cn1cc9cn1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)c2)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)c2)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c17csc9n1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)c2C)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)c2C)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1C",
"old_substring": "c17csc9n1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2ccc(-c3ccsc3)s2)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2ccc(-c3ccsc3)s2)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c17csc9n1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2cc(-c3ccsc3)cnc2Cl)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2cc(-c3ccsc3)cnc2Cl)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c17csc9n1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2cc(-c3ccsc3)ncc2Cl)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2csc(-c3ccsc3)n2)C(C)C)cc1 | COc1ccc([C@H]([NH2+]Cc2cc(-c3ccsc3)ncc2Cl)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ncc1Cl",
"old_substring": "c17csc9n1"
} |
Can you make molecule CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCl)=NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | CC(CCl)=NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&CCl",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | CCCC(C)=NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | CC(C)CCNC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CBr)=NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | CCC(CBr)=NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CBr",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)NC(=O)NCCCCBr)N1CC[NH+](CCc2ccccc2)CC1 | CC(C)NC(=O)NC(=O)[C@@H](C)N1CC[NH+](CCc2ccccc2)CC1 | C[C@H](C(=O)NC(=O)NCCCCBr)N1CC[NH+](CCc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC6C"
} |
Can you make molecule CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc2c(C)cc(N3CCO[C@@H](SC(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](SC(F)(F)F)C3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc2c(C)cc(N3CCO[C@@H](CCCC(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](CCCC(F)(F)F)C3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc2c(C)cc(N3CCO[C@@H](CCCCC(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](CCCCC(F)(F)F)C3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc2c(C)cc(N3CCO[C@@H](CC(F)(F)C(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](CC(F)(F)C(F)F)C3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)C(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)F)C3)nc2c1 | CSc1ccc2c(C)cc(N3CCO[C@@H](C(F)(F)C(F)(F)F)C3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccc(-c2nn3c(CC(=O)NCC4CCCCC4)nnc3s2)cc1 | NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 | NC(=O)c1ccc(-c2nn3c(CC(=O)NCC4CCCCC4)nnc3s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn2c&nnc2s1",
"old_substring": "c19nnn7n1"
} |
Can you make molecule NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CC(=O)NCC2CCCCC2)nc1-c1ccc(C(N)=O)cc1 | NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 | Cc1nn(CC(=O)NCC2CCCCC2)nc1-c1ccc(C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&nc1C",
"old_substring": "c19nnn7n1"
} |
Can you make molecule NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccc(-c2nc3cc(CC(=O)NCC4CCCCC4)ncn3n2)cc1 | NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 | NC(=O)c1ccc(-c2nc3cc(CC(=O)NCC4CCCCC4)ncn3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2cc&ncn2n1",
"old_substring": "c19nnn7n1"
} |
Can you make molecule NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccc(-c2ccc3nnc(CC(=O)NCC4CCCCC4)n3n2)cc1 | NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 | NC(=O)c1ccc(-c2ccc3nnc(CC(=O)NCC4CCCCC4)n3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nnc&n2n1",
"old_substring": "c19nnn7n1"
} |
Can you make molecule NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccc(-c2cc(CC(=O)NCC3CCCCC3)nc3ncnn23)cc1 | NC(=O)c1ccc(-c2nnn(CC(=O)NCC3CCCCC3)n2)cc1 | NC(=O)c1ccc(-c2cc(CC(=O)NCC3CCCCC3)nc3ncnn23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc2ncnn12",
"old_substring": "c19nnn7n1"
} |
Can you make molecule CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cc(NSC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NSC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cc(NC(=O)CCCC(=O)n3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC(=O)CCCC(=O)n3cc(Br)cn3)ccc2Oc2ncccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cc(NC(=O)CC(C)(C)n3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC(=O)CC(C)(C)n3cc(Br)cn3)ccc2Oc2ncccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cc(NC[S@+]([O-])CCCn3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC[S@+]([O-])CCCn3cc(Br)cn3)ccc2Oc2ncccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cc(NC(=O)CCC(C)(C)n3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC(=O)Cn3cc(Br)cn3)ccc2Oc2ncccc21 | CN1C(=O)c2cc(NC(=O)CCC(C)(C)n3cc(Br)cn3)ccc2Oc2ncccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2ccccc2c1Cc1cc(C#N)c([C@@H](C(N)=O)c2cccc(F)c2)s1 | COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 | COc1ccc2ccccc2c1Cc1cc(C#N)c([C@@H](C(N)=O)c2cccc(F)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N45C"
} |
Can you make molecule COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2ccccc2c1Cc1ccc([C@@H](C(N)=O)c2cccc(F)c2)c(C#N)c1 | COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 | COc1ccc2ccccc2c1Cc1ccc([C@@H](C(N)=O)c2cccc(F)c2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N45C"
} |
Can you make molecule COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2ccccc2c1CON=C1CCN([C@@H](C(N)=O)c2cccc(F)c2)CC1 | COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 | COc1ccc2ccccc2c1CON=C1CCN([C@@H](C(N)=O)c2cccc(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N45C"
} |
Can you make molecule COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2ccccc2c1Cc1cnc(C#N)c([C@@H](C(N)=O)c2cccc(F)c2)c1 | COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 | COc1ccc2ccccc2c1Cc1cnc(C#N)c([C@@H](C(N)=O)c2cccc(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N45C"
} |
Can you make molecule COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2ccccc2c1CN1CCC=C(C[C@@H](C(N)=O)c2cccc(F)c2)C1 | COc1ccc2ccccc2c1CN(C)[C@@H](C(N)=O)c1cccc(F)c1 | COc1ccc2ccccc2c1CN1CCC=C(C[C@@H](C(N)=O)c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N45C"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@@H]1C[C@@H]([NH+](C)CCCCn2c(=O)oc3cccnc32)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)CCCCn2c(=O)oc3cccnc32)C12CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C8"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@@H]1C[C@@H]([NH+](C)CCCCCn2c(=O)oc3cccnc32)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)CCCCCn2c(=O)oc3cccnc32)C12CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C8"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@@H]1C[C@@H]([NH+](C)C2CC(n3c(=O)oc4cccnc43)C2)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)C2CC(n3c(=O)oc4cccnc43)C2)C12CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C8"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@@H]1C[C@@H]([NH+](C)[C@@H](C)CCn2c(=O)oc3cccnc32)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)[C@@H](C)CCn2c(=O)oc3cccnc32)C12CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6C8"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@@H]1C[C@@H]([NH+](C)C2CCC(n3c(=O)oc4cccnc43)CC2)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)CCn2c(=O)oc3cccnc32)C12CCCC2 | CCO[C@@H]1C[C@@H]([NH+](C)C2CCC(n3c(=O)oc4cccnc43)CC2)C12CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C6C8"
} |
Can you make molecule CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CC(=O)Nc2cc(CC(=O)SN[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(CC(=O)SN[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CC(=O)Nc2cc(C(=O)CCCC(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(C(=O)CCCC(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CC(=O)Nc2cc(C(C)(C)CC(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(C(C)(C)CC(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CC(=O)Nc2cc(C(C)(C)CCC(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(C(C)(C)CCC(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CC(=O)Nc2cc([C@H](C)C(=O)SN[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc(C(=O)N[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | CCN1CC(=O)Nc2cc([C@H](C)C(=O)SN[C@H]3CCO[C@@H]3c3ccccc3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(C2(CCC(C)C)CCN(C(=O)c3ccc(Cl)cn3)C2)c2ccccc12 | Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 | Cc1nnc(C2(CCC(C)C)CCN(C(=O)c3ccc(Cl)cn3)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N345"
} |
Can you make molecule Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(C2(CCC(C)C)CCCN(C(=O)c3ccc(Cl)cn3)C2)c2ccccc12 | Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 | Cc1nnc(C2(CCC(C)C)CCCN(C(=O)c3ccc(Cl)cn3)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N345"
} |
Can you make molecule Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2c(CCC(C)C)oc(C(=O)c3ccc(Cl)cn3)c2C#N)c2ccccc12 | Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 | Cc1nnc(-c2c(CCC(C)C)oc(C(=O)c3ccc(Cl)cn3)c2C#N)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N345"
} |
Can you make molecule Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(C2(CCC(C)C)CCC(=O)N(C(=O)c3ccc(Cl)cn3)C2)c2ccccc12 | Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 | Cc1nnc(C2(CCC(C)C)CCC(=O)N(C(=O)c3ccc(Cl)cn3)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N345"
} |
Can you make molecule Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc([C@]2(CCC(C)C)CCCN(C(=O)c3ccc(Cl)cn3)C2)c2ccccc12 | Cc1nnc(N(CCC(C)C)C(=O)c2ccc(Cl)cn2)c2ccccc12 | Cc1nnc([C@]2(CCC(C)C)CCCN(C(=O)c3ccc(Cl)cn3)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N345"
} |
Can you make molecule Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(SC(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(SC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C2(F)(F)F"
} |
Can you make molecule Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(CCCC(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(CCCC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C2(F)(F)F"
} |
Can you make molecule Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(CCCCC(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(CCCCC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C2(F)(F)F"
} |
Can you make molecule Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)C(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C2(F)(F)F"
} |
Can you make molecule Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(CC(F)(F)C(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1 | Cc1ccoc1/C([O-])=N/S(=O)(=O)c1ccc(CC(F)(F)C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C2(F)(F)F"
} |
Can you make molecule CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nc2ccc(Cl)cc2[nH]1)Nc1ccccc1C1SCCS1 | CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 | O=C(CSc1nc2ccc(Cl)cc2[nH]1)Nc1ccccc1C1SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "CS7"
} |
Can you make molecule CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nc2ccc(Cl)cc2[nH]1)Nc1ccccc1C1SCCCS1 | CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 | O=C(CSc1nc2ccc(Cl)cc2[nH]1)Nc1ccccc1C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "CS7"
} |
Can you make molecule CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(c2ccccc2NC(=O)CSc2nc3ccc(Cl)cc3[nH]2)SCCS1 | CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 | CC1(c2ccccc2NC(=O)CSc2nc3ccc(Cl)cc3[nH]2)SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&SCCS1",
"old_substring": "CS7"
} |
Can you make molecule CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nc2ccc(Cl)cc2[nH]1)Nc1ccccc1C1SCSCS1 | CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 | O=C(CSc1nc2ccc(Cl)cc2[nH]1)Nc1ccccc1C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "CS7"
} |
Can you make molecule CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nc2ccc(Cl)cc2[nH]1)Nc1ccccc1C1CSCCSC1 | CSc1ccccc1NC(=O)CSc1nc2ccc(Cl)cc2[nH]1 | O=C(CSc1nc2ccc(Cl)cc2[nH]1)Nc1ccccc1C1CSCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "CS7"
} |
Can you make molecule Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc2ncn(CCC(CO)=N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | Cc1sc2ncn(CCC(CO)=N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | C/C(Cn1cnc2sc(C)c(C)c2c1=O)=N/ON[C@@H](c1ccccc1)C(C)C | Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | C/C(Cn1cnc2sc(C)c(C)c2c1=O)=N/ON[C@@H](c1ccccc1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN[C@@H](c1ccccc1)C(C)C)n1cnc2sc(C)c(C)c2c1=O | Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | CCC(CC)(C(=O)CN[C@@H](c1ccccc1)C(C)C)n1cnc2sc(C)c(C)c2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc2ncn(SSC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | Cc1sc2ncn(SSC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN[C@@H](c1ccccc1)C(C)C)n1cnc2sc(C)c(C)c2c1=O | Cc1sc2ncn(CC(=O)N[C@@H](c3ccccc3)C(C)C)c(=O)c2c1C | CCC(CC)(C(=O)CCN[C@@H](c1ccccc1)C(C)C)n1cnc2sc(C)c(C)c2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C6C4=O"
} |
Can you make molecule CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NCSCCOC)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)NCSCCOC)N1C(=O)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N35"
} |
Can you make molecule CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)N1CC(CCOC)C1)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)N1CC(CCOC)C1)N1C(=O)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N35"
} |
Can you make molecule CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NC(=N)SCCOC)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)NC(=N)SCCOC)N1C(=O)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N35"
} |
Can you make molecule CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)c1nsc(CCOC)c1N)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)c1nsc(CCOC)c1N)N1C(=O)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N35"
} |
Can you make molecule CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)N(C)C(=S)SCCOC)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)NCCOC)N1C(=O)CCCc2ccccc21 | CC[C@H](C(=O)N(C)C(=S)SCCOC)N1C(=O)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N35"
} |
Can you make molecule CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)S(=O)(=O)C(C)C | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)S(=O)(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "C3CS(C)(=O)=O"
} |
Can you make molecule CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCCCS(C)(=O)=O | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCCCS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "C3CS(C)(=O)=O"
} |
Can you make molecule CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)S(=O)(=O)CC(C)C | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)S(=O)(=O)CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "C3CS(C)(=O)=O"
} |
Can you make molecule CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)C(=O)C(=O)CC(C)C | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)C(=O)C(=O)CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC(=O)C&=O",
"old_substring": "C3CS(C)(=O)=O"
} |
Can you make molecule CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)S(=O)(=O)CCC(C)C | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)CCS(C)(=O)=O | CC[C@@H]([NH3+])[C@H](c1cc(Br)cs1)N(C)S(=O)(=O)CCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCS&(=O)=O",
"old_substring": "C3CS(C)(=O)=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)CC(C)(C)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | CC(C)(C)OC(=O)CC(C)(C)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)CCC(C)(C)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | CC(C)(C)OC(=O)CCC(C)(C)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)C[C@@H](Br)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | CC(C)(C)OC(=O)C[C@@H](Br)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(OOC(C)(C)C)c1ccc(N2CC[C@H]([S@@+]([O-])c3cccc(Cl)c3Cl)C2)cc1 | CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | C=C(OOC(C)(C)C)c1ccc(N2CC[C@H]([S@@+]([O-])c3cccc(Cl)c3Cl)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(O&)c1ccc&cc1",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(OC(C)(C)C)C(=O)CCN1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | CC(C)(C)OC(=O)N1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | CCC(CC)(OC(C)(C)C)C(=O)CCN1CC[C@H]([S@@+]([O-])c2cccc(Cl)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C34=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.