prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2sc(C[NH2+][C@@H]3CCCc4ccc(F)cc43)nc2n1 | Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 | Cc1cc(C)c2sc(C[NH2+][C@@H]3CCCc4ccc(F)cc43)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(C)c2sc&nc2n1",
"old_substring": "Cc1cc(C)n2c6cnc2n1"
} |
Can you make molecule Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nncc(C[NH2+][C@@H]3CCCc4ccc(F)cc43)c2c1 | Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 | Cc1cc(C)c2nncc(C[NH2+][C@@H]3CCCc4ccc(F)cc43)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(C)c2nncc&c2c1",
"old_substring": "Cc1cc(C)n2c6cnc2n1"
} |
Can you make molecule Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)c(C)nc2c1 | Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 | Cc1ccn2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)c(C)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccn2c&c(C)nc2c1",
"old_substring": "Cc1cc(C)n2c6cnc2n1"
} |
Can you make molecule Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)nc(Cl)nc2s1 | Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 | Cc1cc2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)nc(Cl)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc2c&nc(Cl)nc2s1",
"old_substring": "Cc1cc(C)n2c6cnc2n1"
} |
Can you make molecule Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn(C)c2ccc(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cc12 | Cc1cc(C)n2c(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cnc2n1 | Cc1cn(C)c2ccc(C[NH2+][C@@H]3CCCc4ccc(F)cc43)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cn(C)c2ccc&cc12",
"old_substring": "Cc1cc(C)n2c6cnc2n1"
} |
Can you make molecule CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1nsc(-c2ccc(NCc3cn4c(C)cc(C)nc4n3)c(Cl)c2)c1N | CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | CC(=O)c1nsc(-c2ccc(NCc3cn4c(C)cc(C)nc4n3)c(Cl)c2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N46"
} |
Can you make molecule CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N(C)C(=S)Sc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | CC(=O)N(C)C(=S)Sc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N46"
} |
Can you make molecule CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1cc(-c2ccc(NCc3cn4c(C)cc(C)nc4n3)c(Cl)c2)c(N)o1 | CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | CC(=O)c1cc(-c2ccc(NCc3cn4c(C)cc(C)nc4n3)c(Cl)c2)c(N)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N46"
} |
Can you make molecule CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CCN=C1Sc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | CC(=O)N1CCN=C1Sc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N46"
} |
Can you make molecule CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CN1CCC(c2ccc(NCc3cn4c(C)cc(C)nc4n3)c(Cl)c2)CC1 | CC(=O)Nc1ccc(NCc2cn3c(C)cc(C)nc3n2)c(Cl)c1 | CC(=O)CN1CCC(c2ccc(NCc3cn4c(C)cc(C)nc4n3)c(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N46"
} |
Can you make molecule CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=C(C#N)C(N)=S)c1ccc(F)cc1 | CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 | CC(=C(C#N)C(N)=S)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C#N)C(N)=S",
"old_substring": "C=2(C#N)C(=O)NN"
} |
Can you make molecule CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=C(C#N)C#N)c1ccc(F)cc1 | CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 | CC(=C(C#N)C#N)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C#N)C#N",
"old_substring": "C=2(C#N)C(=O)NN"
} |
Can you make molecule CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(/N=N/C(N)=O)=C(C)c1ccc(F)cc1 | CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 | CC(/N=N/C(N)=O)=C(C)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)/N=N/C(N)=O",
"old_substring": "C=2(C#N)C(=O)NN"
} |
Can you make molecule CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(O)=C(C)c1ccc(F)cc1 | CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 | CC(O)=C(C)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)O",
"old_substring": "C=2(C#N)C(=O)NN"
} |
Can you make molecule CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=S)NN(C)C)c1ccc(F)cc1 | CC(=C(C#N)C(=O)NN)c1ccc(F)cc1 | CC(=NC(=S)NN(C)C)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN(C)NC(=S)N&",
"old_substring": "C=2(C#N)C(=O)NN"
} |
Can you make molecule O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1cccc(CCCCSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(CCCCSc2nc3ccccc3[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C45"
} |
Can you make molecule O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1cccc(CCCCCSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(CCCCCSc2nc3ccccc3[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C45"
} |
Can you make molecule O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1cccc(C2CC(Sc3nc4ccccc4[nH]3)C2)c1 | O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(C2CC(Sc3nc4ccccc4[nH]3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C45"
} |
Can you make molecule O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1cccc(SC(=S)OSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(SC(=S)OSc2nc3ccccc3[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C45"
} |
Can you make molecule O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1cccc(NC(=S)SSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(CSc2nc3ccccc3[nH]2)c1 | O=[N+]([O-])c1cccc(NC(=S)SSc2nc3ccccc3[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C45"
} |
Can you make molecule CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CCCC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC8=O"
} |
Can you make molecule CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CCCCC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC8=O"
} |
Can you make molecule CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCc1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CC(=O)CCCc1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CC8=O"
} |
Can you make molecule CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCc1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CCC(=O)CCCc1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CC8=O"
} |
Can you make molecule CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Cc1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | CCCCC(=O)Cc1ccc(Nc2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC(=O)C&",
"old_substring": "CC8=O"
} |
Can you make molecule c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)([C@@H]1CCOC1)[C@H](CCCc1ccccc1)[NH2+]C1Cc2ccccc2C1 | c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 | CC(C)([C@@H]1CCOC1)[C@H](CCCc1ccccc1)[NH2+]C1Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@H]47C6"
} |
Can you make molecule c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc([C@]2([C@@H]3CCOC3)CCC[C@@H]([NH2+]C3Cc4ccccc4C3)C2)cc1 | c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 | c1ccc([C@]2([C@@H]3CCOC3)CCC[C@@H]([NH2+]C3Cc4ccccc4C3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@H]47C6"
} |
Can you make molecule c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc([C@H]2CC([NH2+]C3Cc4ccccc4C3)C[C@@H]([C@@H]3CCOC3)C2)cc1 | c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 | c1ccc([C@H]2CC([NH2+]C3Cc4ccccc4C3)C[C@@H]([C@@H]3CCOC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "[C@H]47C6"
} |
Can you make molecule c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(-c2cc([NH2+]C3Cc4ccccc4C3)cc3cc([C@@H]4CCOC4)[nH]c23)cc1 | c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 | c1ccc(-c2cc([NH2+]C3Cc4ccccc4C3)cc3cc([C@@H]4CCOC4)[nH]c23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c2[nH]c&cc2c1",
"old_substring": "[C@H]47C6"
} |
Can you make molecule c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(-c2cc3c(cc2[C@@H]2CCOC2)CC([NH2+]C2Cc4ccccc4C2)C3)cc1 | c1ccc([C@@H](C[C@@H]2CCOC2)[NH2+]C2Cc3ccccc3C2)cc1 | c1ccc(-c2cc3c(cc2[C@@H]2CCOC2)CC([NH2+]C2Cc4ccccc4C2)C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&Cc2cc&c&cc2C1",
"old_substring": "[C@H]47C6"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](C)N1C(=O)CC(C)(C)N1CCC[C@H]([NH+](C)C)C1 | C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 | C[C@H]1CCC[C@H](C)N1C(=O)CC(C)(C)N1CCC[C@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](C)N1C(=O)CCC(C)(C)N1CCC[C@H]([NH+](C)C)C1 | C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 | C[C@H]1CCC[C@H](C)N1C(=O)CCC(C)(C)N1CCC[C@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](C)N1C(=O)C[C@@H](Br)N1CCC[C@H]([NH+](C)C)C1 | C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 | C[C@H]1CCC[C@H](C)N1C(=O)C[C@@H](Br)N1CCC[C@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2[C@@H](C)CCC[C@@H]2C)cc(=O)n1N1CCC[C@H]([NH+](C)C)C1 | C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 | Cc1cc(N2[C@@H](C)CCC[C@@H]2C)cc(=O)n1N1CCC[C@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N2[C@@H](C)CCC[C@@H]2C)c(=O)ccn1N1CCC[C@H]([NH+](C)C)C1 | C[C@H]1CCC[C@H](C)N1C(=O)N1CCC[C@H]([NH+](C)C)C1 | Cc1c(N2[C@@H](C)CCC[C@@H]2C)c(=O)ccn1N1CCC[C@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2C[NH2+]CCS2)c1 | COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 | COc1cccc([C@H]2C[NH2+]CCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[NH+]&CCS1",
"old_substring": "[C@H]14C[NH2+]CC[NH+]1C"
} |
Can you make molecule COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H]2C[NH2+]CCS2)c1 | COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 | COc1cccc([C@@H]2C[NH2+]CCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C[NH+]&CCS1",
"old_substring": "[C@H]14C[NH2+]CC[NH+]1C"
} |
Can you make molecule COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCC[NH2+]C2)c1 | COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 | COc1cccc([C@H]2CCC[NH2+]C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[NH+]&C1",
"old_substring": "[C@H]14C[NH2+]CC[NH+]1C"
} |
Can you make molecule COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CC[NH2+]C2)c1 | COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 | COc1cccc([C@H]2CC[NH2+]C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[NH+]&C1",
"old_substring": "[C@H]14C[NH2+]CC[NH+]1C"
} |
Can you make molecule COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2CCCC[NH2+]C2)c1 | COc1cccc([C@H]2C[NH2+]CC[NH+]2C)c1 | COc1cccc([C@H]2CCCC[NH2+]C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[NH+]&C1",
"old_substring": "[C@H]14C[NH2+]CC[NH+]1C"
} |
Can you make molecule CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCO[C@@H]2CN(Cc3ccc(Cl)o3)C[C@@H]21 | CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 | CN1CCO[C@@H]2CN(Cc3ccc(Cl)o3)C[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c15ccc(C#N)o1"
} |
Can you make molecule CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C#N)ccc1CN1C[C@H]2OCCN(C)[C@H]2C1 | CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 | Cc1cc(C#N)ccc1CN1C[C@H]2OCCN(C)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1C",
"old_substring": "c15ccc(C#N)o1"
} |
Can you make molecule CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCO[C@@H]2CN(Cc3ccc(C#N)cc3Cl)C[C@@H]21 | CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 | CN1CCO[C@@H]2CN(Cc3ccc(C#N)cc3Cl)C[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1Cl",
"old_substring": "c15ccc(C#N)o1"
} |
Can you make molecule CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CN2C[C@H]3OCCN(C)[C@H]3C2)s1 | CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 | Cc1ccc(CN2C[C@H]3OCCN(C)[C@H]3C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)s1",
"old_substring": "c15ccc(C#N)o1"
} |
Can you make molecule CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCO[C@@H]2CN(Cc3ccc(I)o3)C[C@@H]21 | CN1CCO[C@@H]2CN(Cc3ccc(C#N)o3)C[C@@H]21 | CN1CCO[C@@H]2CN(Cc3ccc(I)o3)C[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c15ccc(C#N)o1"
} |
Can you make molecule COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | COCc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | COCSc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | CC(=O)Sc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(O[C@@H](C)CNc2ccc(C(=O)CS)cc2)c1 | COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | Cc1cccc(O[C@@H](C)CNc2ccc(C(=O)CS)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(O[C@@H](C)CNc2ccc(C(=O)CI)cc2)c1 | COc1ccc(NC[C@H](C)Oc2cccc(C)c2)cc1 | Cc1cccc(O[C@@H](C)CNc2ccc(C(=O)CI)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | C=CSc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC8"
} |
Can you make molecule CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CCN(Cc3noc(C(C)C)n3)CC2)cc(Cl)c1OC | CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | COc1cc(C[NH+]2CCN(Cc3noc(C(C)C)n3)CC2)cc(Cl)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC8"
} |
Can you make molecule CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | C=CCCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC8"
} |
Can you make molecule CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CCN(Cc3noc(CCCCl)n3)CC2)cc(Cl)c1OC | CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | COc1cc(C[NH+]2CCN(Cc3noc(CCCCl)n3)CC2)cc(Cl)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC8"
} |
Can you make molecule CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CCN(Cc3noc(CCCCS)n3)CC2)cc(Cl)c1OC | CCc1nc(CN2CC[NH+](Cc3cc(Cl)c(OC)c(OC)c3)CC2)no1 | COc1cc(C[NH+]2CCN(Cc3noc(CCCCS)n3)CC2)cc(Cl)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC8"
} |
Can you make molecule COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cc2oc(C(=O)CCC(=O)c3cccs3)nc2C#N)cc1F | COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F | COc1ccc(Cc2oc(C(=O)CCC(=O)c3cccs3)nc2C#N)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N35C"
} |
Can you make molecule COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cc2sc(C(=O)CCC(=O)c3cccs3)cc2C#N)cc1F | COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F | COc1ccc(Cc2sc(C(=O)CCC(=O)c3cccs3)cc2C#N)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N35C"
} |
Can you make molecule COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cc2ccc(C(=O)CCC(=O)c3cccs3)cc2C#N)cc1F | COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F | COc1ccc(Cc2ccc(C(=O)CCC(=O)c3cccs3)cc2C#N)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N35C"
} |
Can you make molecule COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN2CCC(=NOC(=O)CCC(=O)c3cccs3)CC2)cc1F | COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F | COc1ccc(CN2CCC(=NOC(=O)CCC(=O)c3cccs3)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N35C"
} |
Can you make molecule COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cc2cc(C(=O)CCC(=O)c3cccs3)cnc2C#N)cc1F | COc1ccc(CN(C)C(=O)CCC(=O)c2cccs2)cc1F | COc1ccc(Cc2cc(C(=O)CCC(=O)c3cccs3)cnc2C#N)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N35C"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)CCC(=O)N2CCC(c3ccccc3)=N2)nsc1-c1cccc(Oc2ccccc2)c1 | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 | Nc1c(C(=O)CCC(=O)N2CCC(c3ccccc3)=N2)nsc1-c1cccc(Oc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N36"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCC(=O)N1CCC(c2ccccc2)=N1)C(=S)Sc1cccc(Oc2ccccc2)c1 | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 | CN(C(=O)CCC(=O)N1CCC(c2ccccc2)=N1)C(=S)Sc1cccc(Oc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N36"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1oc(C(=O)CCC(=O)N2CCC(c3ccccc3)=N2)cc1-c1cccc(Oc2ccccc2)c1 | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 | Nc1oc(C(=O)CCC(=O)N2CCC(c3ccccc3)=N2)cc1-c1cccc(Oc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N36"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN=C1Sc1cccc(Oc2ccccc2)c1)N1CCC(c2ccccc2)=N1 | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 | O=C(CCC(=O)N1CCN=C1Sc1cccc(Oc2ccccc2)c1)N1CCC(c2ccccc2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N36"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)CN1CCC(c2cccc(Oc3ccccc3)c2)CC1 | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cccc(Oc2ccccc2)c1 | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)CN1CCC(c2cccc(Oc3ccccc3)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N36"
} |
Can you make molecule Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3I)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3I)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(Cc2ccc(NC(=O)c3cc(N4CCOCC4)ccc3Br)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3cc(N4CCOCC4)ccc3Br)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3Cl)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3Cl)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(Cc2ccc(NC(=O)c3cccc(N4CCOCC4)c3Br)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3cccc(N4CCOCC4)c3Br)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(Cc2ccc(NC(=O)c3cccc(N4CCOCC4)c3Cl)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3ccc(N4CCOCC4)cc3)cc2)o1 | Cc1nnc(Cc2ccc(NC(=O)c3cccc(N4CCOCC4)c3Cl)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(CCCCC(N)=O)cc2)c(-c2ccccc2)n1 | Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 | Cn1cc(C(=O)Nc2ccc(CCCCC(N)=O)cc2)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C6C(N)=O"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(CC(N)=S)cc2)c(-c2ccccc2)n1 | Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 | Cn1cc(C(=O)Nc2ccc(CC(N)=S)cc2)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C6C(N)=O"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Cc1ccc(NC(=O)c2cn(C)nc2-c2ccccc2)cc1 | Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 | CC(=O)Cc1ccc(NC(=O)c2cn(C)nc2-c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C6C(N)=O"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(CC/C(N)=N/O)cc2)c(-c2ccccc2)n1 | Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 | Cn1cc(C(=O)Nc2ccc(CC/C(N)=N/O)cc2)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C6C(N)=O"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)Nc2ccc(CC/C(N)=N\O)cc2)c(-c2ccccc2)n1 | Cn1cc(C(=O)Nc2ccc(CC(N)=O)cc2)c(-c2ccccc2)n1 | Cn1cc(C(=O)Nc2ccc(CC/C(N)=N\O)cc2)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C6C(N)=O"
} |
Can you make molecule CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](SCNC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | CCC[C@@H](SCNC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C(=O)OC)C1CN(C(=O)C2C[C@@H](C)O[C@H](C)C2)C1 | CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | CCC[C@H](C(=O)OC)C1CN(C(=O)C2C[C@@H](C)O[C@H](C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N34"
} |
Can you make molecule CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](SC(=N)NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | CCC[C@@H](SC(=N)NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C(=O)OC)c1snc(C(=O)C2C[C@@H](C)O[C@H](C)C2)c1N | CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | CCC[C@H](C(=O)OC)c1snc(C(=O)C2C[C@@H](C)O[C@H](C)C2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N34"
} |
Can you make molecule CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](SC(=S)N(C)C(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | CCC[C@@H](NC(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | CCC[C@@H](SC(=S)N(C)C(=O)C1C[C@@H](C)O[C@H](C)C1)C(=O)OC | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCCN1SC(=O)Cc1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1SC(=O)Cc1sc2nc(C)nc(C)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCCN1C(=O)CCCC(=O)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1C(=O)CCCC(=O)c1sc2nc(C)nc(C)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCCN1C(=O)CC(C)(C)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1C(=O)CC(C)(C)c1sc2nc(C)nc(C)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCCN1C(=O)CCC(C)(C)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1C(=O)CCC(C)(C)c1sc2nc(C)nc(C)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCCN1SC(=O)[C@@H](C)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1C(=O)c1sc2nc(C)nc(C)c2c1C | CNC(=O)[C@H]1CCCCN1SC(=O)[C@@H](C)c1sc2nc(C)nc(C)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CC(=O)N2CC[CH]CCC2)c1.c1ccc(Cc2cccnc2)cc1 | COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 | COc1cccc(CC(=O)N2CC[CH]CCC2)c1.c1ccc(Cc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H]&CC1",
"old_substring": "N15CCC[C@@H]%10C1"
} |
Can you make molecule COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CC(=O)N2C[CH]CCCC2)c1.c1ccc(Cc2cccnc2)cc1 | COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 | COc1cccc(CC(=O)N2C[CH]CCCC2)c1.c1ccc(Cc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC[C@@H]&C1",
"old_substring": "N15CCC[C@@H]%10C1"
} |
Can you make molecule COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[CH]C#CCC(=O)Cc1cccc(OC)c1.c1ccc(Cc2cccnc2)cc1 | COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 | C[CH]C#CCC(=O)Cc1cccc(OC)c1.c1ccc(Cc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C#C[C@@H]&C",
"old_substring": "N15CCC[C@@H]%10C1"
} |
Can you make molecule COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CC(=O)N2C[CH]CC[C@H]2C)c1.c1ccc(Cc2cccnc2)cc1 | COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 | COc1cccc(CC(=O)N2C[CH]CC[C@H]2C)c1.c1ccc(Cc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H]&CC[C@H]1C",
"old_substring": "N15CCC[C@@H]%10C1"
} |
Can you make molecule COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CC(=O)N2CC[CH]C[C@H]2C)c1.c1ccc(Cc2cccnc2)cc1 | COc1cccc(CC(=O)N2CCC[C@@H](c3ccc(Cc4ccccc4)cn3)C2)c1 | COc1cccc(CC(=O)N2CC[CH]C[C@H]2C)c1.c1ccc(Cc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&C[C@H]1C",
"old_substring": "N15CCC[C@@H]%10C1"
} |
Can you make molecule CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccc(C)c(Cl)c2)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccc(C)c(Cl)c2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccc(Br)cc2C)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccc(Br)cc2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C",
"old_substring": "c18ccccc1C"
} |
Can you make molecule CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2cccc(Br)c2C)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2cccc(Br)c2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c18ccccc1C"
} |
Can you make molecule CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccc(F)cc2Cl)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccc(F)cc2Cl)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2cc(F)ccc2Cl)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2ccccc2C)no1 | CCc1nc(C)sc1CNC(=O)CCc1nc(-c2cc(F)ccc2Cl)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | C=CSc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN(C)S(=O)(=O)c1cc(N)ccc1C(C)C | CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | CNC(=O)CN(C)S(=O)(=O)c1cc(N)ccc1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | C=CCCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN(C)S(=O)(=O)c1cc(N)ccc1CCCCl | CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | CNC(=O)CN(C)S(=O)(=O)c1cc(N)ccc1CCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN(C)S(=O)(=O)c1cc(N)ccc1CCCCS | CCc1ccc(N)cc1S(=O)(=O)N(C)CC(=O)NC | CNC(=O)CN(C)S(=O)(=O)c1cc(N)ccc1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.