prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H]1COCCN1SC(=O)CSCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1SC(=O)CSCC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C3"
} |
Can you make molecule CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H]1COCCN1C(=O)CCCC(=O)SCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C(=O)CCCC(=O)SCC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C3"
} |
Can you make molecule CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H]1COCCN1C(=O)CC(C)(C)SCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C(=O)CC(C)(C)SCC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)C3"
} |
Can you make molecule CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H]1COCCN1C[S@+]([O-])CCCSCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C[S@+]([O-])CCCSCC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C3"
} |
Can you make molecule CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H]1COCCN1C(=O)CCC(C)(C)SCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C(=O)CSCC(=O)c1ccccc1 | CC(C)C[C@H]1COCCN1C(=O)CCC(C)(C)SCC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)C3"
} |
Can you make molecule CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1Cc2nc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)sc2C1 | CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 | CCCCC(=O)N1Cc2nc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N24"
} |
Can you make molecule CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCc2cc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)ccc21 | CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 | CCCCC(=O)N1CCc2cc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N24"
} |
Can you make molecule CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)c1sc2nsc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)c2c1N | CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 | CCCCC(=O)c1sc2nsc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)c2c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N24"
} |
Can you make molecule CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCSc2ccc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)cc21 | CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 | CCCCC(=O)N1CCSc2ccc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "N24"
} |
Can you make molecule CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCCn2nc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)cc2C1 | CCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 | CCCCC(=O)N1CCCn2nc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc2C1",
"old_substring": "N24"
} |
Can you make molecule CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(CC(=O)SNc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(CC(=O)SNc2ccc3ccccc3c2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(C(=O)CCCC(=O)Nc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(C(=O)CCCC(=O)Nc2ccc3ccccc3c2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(C(C)(C)CC(=O)Nc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(C(C)(C)CC(=O)Nc2ccc3ccccc3c2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(C(C)(C)CCC(=O)Nc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(C(C)(C)CCC(=O)Nc2ccc3ccccc3c2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc([C@H](C)C(=O)SNc2ccc3ccccc3c2)n(C)n1 | CCCc1cc(C(=O)Nc2ccc3ccccc3c2)n(C)n1 | CCCc1cc([C@H](C)C(=O)SNc2ccc3ccccc3c2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)co1 | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)co1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c17nc8no1"
} |
Can you make molecule CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(CNC(=O)N[C@H]2CCCC2(C)C)ncnc1C(C)(C)C | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 | Cc1c(CNC(=O)N[C@H]2CCCC2(C)C)ncnc1C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c17nc8no1"
} |
Can you make molecule CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(CNC(=O)N[C@H]2CCCC2(C)C)nc1C(C)(C)C | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 | Cc1cnc(CNC(=O)N[C@H]2CCCC2(C)C)nc1C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c17nc8no1"
} |
Can you make molecule CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ncnc(CNC(=O)N[C@H]2CCCC2(C)C)c1F | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 | CC(C)(C)c1ncnc(CNC(=O)N[C@H]2CCCC2(C)C)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c17nc8no1"
} |
Can you make molecule CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)ncc1I | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)no1 | CC(C)(C)c1nc(CNC(=O)N[C@H]2CCCC2(C)C)ncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c17nc8no1"
} |
Can you make molecule Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CC(=O)NCSCc1nnc2n1CCCC2 | Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 | Cc1noc(C)c1CC(=O)NCSCc1nnc2n1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CC(=O)NC(=N)SCc1nnc2n1CCCC2 | Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 | Cc1noc(C)c1CC(=O)NC(=N)SCc1nnc2n1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CC(=O)c1nsc(Cc2nnc3n2CCCC3)c1N | Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 | Cc1noc(C)c1CC(=O)c1nsc(Cc2nnc3n2CCCC3)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N34"
} |
Can you make molecule Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CC(=O)N(C)C(=S)SCc1nnc2n1CCCC2 | Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 | Cc1noc(C)c1CC(=O)N(C)C(=S)SCc1nnc2n1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CC(=O)c1ccc(Cc2nnc3n2CCCC3)n1N | Cc1noc(C)c1CC(=O)NCc1nnc2n1CCCC2 | Cc1noc(C)c1CC(=O)c1ccc(Cc2nnc3n2CCCC3)n1N | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N34"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](C)C(C)(C)CNCC1(c2ccc(F)cc2F)CC1 | CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 | CC(=O)N[C@H](C)C(C)(C)CNCC1(c2ccc(F)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](CCl)CCCNCC1(c2ccc(F)cc2F)CC1 | CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 | CC(=O)N[C@H](CCl)CCCNCC1(c2ccc(F)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H]1C=C(CNCC2(c3ccc(F)cc3F)CC2)N=N1 | CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 | CC(=O)N[C@@H]1C=C(CNCC2(c3ccc(F)cc3F)CC2)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@]1(C)CCCN(NCC2(c3ccc(F)cc3F)CC2)C1 | CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 | CC(=O)N[C@]1(C)CCCN(NCC2(c3ccc(F)cc3F)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@]1&(C)CCCN&C1",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CBr)CCNCC1(c2ccc(F)cc2F)CC1 | CC(=O)N[C@H](C)C(=O)NCC1(c2ccc(F)cc2F)CC1 | CC(=O)N[C@@H](CBr)CCNCC1(c2ccc(F)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2Cl)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2Cl)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c18ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(Br)c(OCc2cc(Cl)cc(Cl)c2Br)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2cc(Cl)cc(Cl)c2Br)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c18ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(Br)c(OCc2c(Cl)ccc(Cl)c2Cl)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2c(Cl)ccc(Cl)c2Cl)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c18ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(Br)c(OCc2c(Cl)cc(Cl)cc2Cl)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2c(Cl)cc(Cl)cc2Cl)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)cc1Cl",
"old_substring": "c18ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(Br)c(OCc2c(Cl)cc(Br)cc2Cl)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 | C[NH2+]Cc1cc(Br)c(OCc2c(Cl)cc(Br)cc2Cl)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c18ccc(Cl)c(Cl)c1"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc([C@H]2C=C[C@H](C[NH2+]Cc3ccc(C)s3)C2)cn1 | CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 | CCn1cc([C@H]2C=C[C@H](C[NH2+]Cc3ccc(C)s3)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]18OCC[C@H]17"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc([C@H]2C=C[C@@H](C[NH2+]Cc3ccc(C)s3)C2)cn1 | CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 | CCn1cc([C@H]2C=C[C@@H](C[NH2+]Cc3ccc(C)s3)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]18OCC[C@H]17"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc([C@H]2CCC[C@H](C[NH2+]Cc3ccc(C)s3)C2)cn1 | CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 | CCn1cc([C@H]2CCC[C@H](C[NH2+]Cc3ccc(C)s3)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]18OCC[C@H]17"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc([C@H]2CCCC[C@H](C[NH2+]Cc3ccc(C)s3)C2)cn1 | CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 | CCn1cc([C@H]2CCCC[C@H](C[NH2+]Cc3ccc(C)s3)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@H]18OCC[C@H]17"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc([C@H]2CCC[C@H](C[NH2+]Cc3ccc(C)s3)CC2)cn1 | CCn1cc([C@H]2OCC[C@H]2C[NH2+]Cc2ccc(C)s2)cn1 | CCn1cc([C@H]2CCC[C@H](C[NH2+]Cc3ccc(C)s3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]18OCC[C@H]17"
} |
Can you make molecule CC[C@H]1CCCCN(C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCC[C@H](C2(C)Cc3ccccc3C2)C1=O | CC[C@H]1CCCCN(C)C1=O | CN1CCCC[C@H](C2(C)Cc3ccccc3C2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CC[C@H]1CCCCN(C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCC[C@H](C2=CC3=CC=C3OC(C)(C)C2)C1=O | CC[C@H]1CCCCN(C)C1=O | CN1CCCC[C@H](C2=CC3=CC=C3OC(C)(C)C2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CC[C@H]1CCCCN(C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCC[C@H](N2CC(C)(C)Sc3ccccc32)C1=O | CC[C@H]1CCCCN(C)C1=O | CN1CCCC[C@H](N2CC(C)(C)Sc3ccccc32)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CN&c2ccccc2S1",
"old_substring": "CC2"
} |
Can you make molecule CC[C@H]1CCCCN(C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCC[C@H](C2C3CCC2CC3)C1=O | CC[C@H]1CCCCN(C)C1=O | CN1CCCC[C@H](C2C3CCC2CC3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2CCC1CC2",
"old_substring": "CC2"
} |
Can you make molecule CC[C@H]1CCCCN(C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCC[C@H](C2(C3CC3)CCC2)C1=O | CC[C@H]1CCCCN(C)C1=O | CN1CCCC[C@H](C2(C3CC3)CCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C2CC2)CCC1",
"old_substring": "CC2"
} |
Can you make molecule CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H](C)CCC(C)(C)C)C1 | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H](C)CCC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "[C@@H]18CCC[C@H](C)C1"
} |
Can you make molecule CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H](CC)C[C@H](C)CC)C1 | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H](CC)C[C@H](C)CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "[C@@H]18CCC[C@H](C)C1"
} |
Can you make molecule CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](CC)CS[C@H]1CC[C@]([NH2+]C)(C(=O)OCC)C1 | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 | CCCC[C@H](CC)CS[C@H]1CC[C@]([NH2+]C)(C(=O)OCC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C&)CC",
"old_substring": "[C@@H]18CCC[C@H](C)C1"
} |
Can you make molecule CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC[C@@H](C)C(=O)S[C@H]1CC[C@]([NH2+]C)(C(=O)OCC)C1 | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 | CCCCCC[C@@H](C)C(=O)S[C@H]1CC[C@]([NH2+]C)(C(=O)OCC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC[C@@H](C)C&=O",
"old_substring": "[C@@H]18CCC[C@H](C)C1"
} |
Can you make molecule CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(C)(C)CS[C@H]1CC[C@]([NH2+]C)(C(=O)OCC)C1 | CCOC(=O)[C@@]1([NH2+]C)CC[C@H](S[C@@H]2CCC[C@H](C)C2)C1 | CCCCCC(C)(C)CS[C@H]1CC[C@]([NH2+]C)(C(=O)OCC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC(C)(C)C&",
"old_substring": "[C@@H]18CCC[C@H](C)C1"
} |
Can you make molecule CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | C=CSOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | C=CCCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2nc(C(F)(F)F)c(=O)n([C@H](C)C(=O)OCCCCl)c2cc1C | CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | Cc1cc2nc(C(F)(F)F)c(=O)n([C@H](C)C(=O)OCCCCl)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2nc(C(F)(F)F)c(=O)n([C@H](C)C(=O)OCCCCS)c2cc1C | CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | Cc1cc2nc(C(F)(F)F)c(=O)n([C@H](C)C(=O)OCCCCS)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2nc(C(F)(F)F)c(=O)n([C@H](C)C(=O)OCCCBr)c2cc1C | CCOC(=O)[C@@H](C)n1c(=O)c(C(F)(F)F)nc2cc(C)c(C)cc21 | Cc1cc2nc(C(F)(F)F)c(=O)n([C@H](C)C(=O)OCCCBr)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | C=CSSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC7"
} |
Can you make molecule CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | C=CCCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC7"
} |
Can you make molecule CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1nc2ccccc2s1)C(=O)Nc1ccc(SCCCCl)nc1 | CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | O=C(NCc1nc2ccccc2s1)C(=O)Nc1ccc(SCCCCl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC7"
} |
Can you make molecule CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1nc2ccccc2s1)C(=O)Nc1ccc(SCCCCS)nc1 | CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | O=C(NCc1nc2ccccc2s1)C(=O)Nc1ccc(SCCCCS)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC7"
} |
Can you make molecule CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1nc2ccccc2s1)C(=O)Nc1ccc(SCCCBr)nc1 | CCSc1ccc(NC(=O)C(=O)NCc2nc3ccccc3s2)cn1 | O=C(NCc1nc2ccccc2s1)C(=O)Nc1ccc(SCCCBr)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC7"
} |
Can you make molecule Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnc3C)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnc3C)cc1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccnc1C",
"old_substring": "n16ccnn1"
} |
Can you make molecule Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3cnc(I)n3)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3cnc(I)n3)cc1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "Ic1ncn&n1",
"old_substring": "n16ccnn1"
} |
Can you make molecule Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccc(C)n3)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccc(C)n3)cc1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc(C)n1",
"old_substring": "n16ccnn1"
} |
Can you make molecule Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3cccnc3=O)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3cccnc3=O)cc1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cccnc1=O",
"old_substring": "n16ccnn1"
} |
Can you make molecule Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3cc(I)cn3)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3ccnn3)cc1)CCC2 | Cc1ccc2c(c1)N(C(=O)c1ccc(-n3cc(I)cn3)cc1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cn1",
"old_substring": "n16ccnn1"
} |
Can you make molecule CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC less soluble in water? The output molecule should be similar to the input molecule. | CCCC1=NCCN1C(=O)N[C@H](CCC)CCc1ccccc1 | CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC | CCCC1=NCCN1C(=O)N[C@H](CCC)CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N35C"
} |
Can you make molecule CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CCc1ccccc1)NC(=O)c1cc(C#N)c(CC)s1 | CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC | CCC[C@H](CCc1ccccc1)NC(=O)c1cc(C#N)c(CC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N35C"
} |
Can you make molecule CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CCc1ccccc1)NC(=O)c1ccc(CC)c(C#N)c1 | CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC | CCC[C@H](CCc1ccccc1)NC(=O)c1ccc(CC)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N35C"
} |
Can you make molecule CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CCc1ccccc1)NC(=O)ON=C1CCN(CC)CC1 | CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC | CCC[C@H](CCc1ccccc1)NC(=O)ON=C1CCN(CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N35C"
} |
Can you make molecule CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC less soluble in water? The output molecule should be similar to the input molecule. | CCCC1=CCCN(C(=O)N[C@H](CCC)CCc2ccccc2)C1 | CCC[C@H](CCc1ccccc1)NC(=O)N(C)CC | CCCC1=CCCN(C(=O)N[C@H](CCC)CCc2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N35C"
} |
Can you make molecule C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccc2c(c1)OCO2)NC(=O)N1CC[C@](O)(C(F)(F)F)C1 | C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 | C[C@H](CC(C)(C)c1ccc2c(c1)OCO2)NC(=O)N1CC[C@](O)(C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]57"
} |
Can you make molecule C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNC(=O)N1CC[C@](O)(C(F)(F)F)C1)CC(=O)c1ccc2c(c1)OCO2 | C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 | C[C@H](CCNC(=O)N1CC[C@](O)(C(F)(F)F)C1)CC(=O)c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]57"
} |
Can you make molecule C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccc2c(c1)OCO2)[C@H](C)NC(=O)N1CC[C@](O)(C(F)(F)F)C1 | C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 | C[C@H](Cc1ccc2c(c1)OCO2)[C@H](C)NC(=O)N1CC[C@](O)(C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]57"
} |
Can you make molecule C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)N1CC[C@](O)(C(F)(F)F)C1)CC(=O)c1ccc2c(c1)OCO2 | C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 | C[C@@H](CCNC(=O)N1CC[C@](O)(C(F)(F)F)C1)CC(=O)c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]57"
} |
Can you make molecule C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccc2c(c1)OCO2)NC(=O)N1CC[C@](O)(C(F)(F)F)C1 | C[C@H](NC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1ccc2c(c1)OCO2 | CCC[C@@H](CCc1ccc2c(c1)OCO2)NC(=O)N1CC[C@](O)(C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]57"
} |
Can you make molecule O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O[C@]1(C[NH2+][C@@H]2CCN(CCCC(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(CCCC(F)(F)F)C2)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O[C@]1(C[NH2+][C@@H]2CCN(CCCCC(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(CCCCC(F)(F)F)C2)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O[C@]1(C[NH2+][C@@H]2CCN(SC(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(SC(F)(F)F)C2)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O[C@]1(C[NH2+][C@@H]2CCN(S/C=C/C(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(S/C=C/C(F)(F)F)C2)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C=C/C(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)C(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)F)C2)CCCc2ccccc21 | O[C@]1(C[NH2+][C@@H]2CCN(CC(F)(F)C(F)(F)F)C2)CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(C(=S)NN2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | CC(=O)Nc1ccc(C(=S)NN2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C(=S)N&)cc1",
"old_substring": "c18ccc(S7(=O)=O)cc1"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(/C=N/ON2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | CC(=O)Nc1ccc(/C=N/ON2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(/C=N/O&)cc1",
"old_substring": "c18ccc(S7(=O)=O)cc1"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(Br)c(O)c(N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)c1 | CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | CC(=O)Nc1cc(Br)c(O)c(N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(O)c(Br)c1",
"old_substring": "c18ccc(S7(=O)=O)cc1"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(F)c(N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)c1F | CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | CC(=O)Nc1ccc(F)c(N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c&c1F",
"old_substring": "c18ccc(S7(=O)=O)cc1"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)c(F)cc1F | CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)cc1 | CC(=O)Nc1cc(N2CCc3ccccc3[C@H]2CC(=O)NCc2cccc(C)c2)c(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(F)cc1F",
"old_substring": "c18ccc(S7(=O)=O)cc1"
} |
Can you make molecule CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(NC(=O)C=Cc2ccc(Br)cc2)cc1I | CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 | CCOC(=O)c1ccc(NC(=O)C=Cc2ccc(Br)cc2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccccc15"
} |
Can you make molecule CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc(NC(=O)C=Cc2ccc(Br)cc2)ccc1Br | CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 | CCOC(=O)c1cc(NC(=O)C=Cc2ccc(Br)cc2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccccc15"
} |
Can you make molecule CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(NC(=O)C=Cc2ccc(Br)cc2)cc1Cl | CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 | CCOC(=O)c1ccc(NC(=O)C=Cc2ccc(Br)cc2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccccc15"
} |
Can you make molecule CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(NC(=O)C=Cc2ccc(Br)cc2)c1Br | CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 | CCOC(=O)c1cccc(NC(=O)C=Cc2ccc(Br)cc2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccccc15"
} |
Can you make molecule CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(NC(=O)C=Cc2ccc(Br)cc2)c1Cl | CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(Br)cc1 | CCOC(=O)c1cccc(NC(=O)C=Cc2ccc(Br)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccccc15"
} |
Can you make molecule C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(Cc2noc3ncc(-c4ccc(F)cc4)cc23)CC[C@@H]1[NH3+] | C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] | C[C@@H]1CN(Cc2noc3ncc(-c4ccc(F)cc4)cc23)CC[C@@H]1[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "c1&noc2ncc&cc12",
"old_substring": "c15noc6n1"
} |
Can you make molecule C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(CN2CC[C@H]([NH3+])[C@H](C)C2)ncnc1-c1ccc(F)cc1 | C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] | Cc1c(CN2CC[C@H]([NH3+])[C@H](C)C2)ncnc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c15noc6n1"
} |
Can you make molecule C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(-c2ccc(F)cc2)nc1CN1CC[C@H]([NH3+])[C@H](C)C1 | C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] | Cc1cnc(-c2ccc(F)cc2)nc1CN1CC[C@H]([NH3+])[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c15noc6n1"
} |
Can you make molecule C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(Cc2ncnc(-c3ccc(F)cc3)c2F)CC[C@@H]1[NH3+] | C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] | C[C@@H]1CN(Cc2ncnc(-c3ccc(F)cc3)c2F)CC[C@@H]1[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c15noc6n1"
} |
Can you make molecule C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(Cc2nc(-c3ccc(F)cc3)ncc2I)CC[C@@H]1[NH3+] | C[C@@H]1CN(Cc2noc(-c3ccc(F)cc3)n2)CC[C@@H]1[NH3+] | C[C@@H]1CN(Cc2nc(-c3ccc(F)cc3)ncc2I)CC[C@@H]1[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c15noc6n1"
} |
Can you make molecule COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCSC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | COCSC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | CC(=O)SC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CC(=O)CI)[NH2+][C@H]1CCCN(c2ccccc2F)C1 | COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | CC(C)[C@H](CC(=O)CI)[NH2+][C@H]1CCCN(c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CC1OCCCO1)[NH2+][C@H]1CCCN(c2ccccc2F)C1 | COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | CC(C)[C@H](CC1OCCCO1)[NH2+][C@H]1CCCN(c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CC(=O)CCl)[NH2+][C@H]1CCCN(c2ccccc2F)C1 | COC[C@H]([NH2+][C@H]1CCCN(c2ccccc2F)C1)C(C)C | CC(C)[C@H](CC(=O)CCl)[NH2+][C@H]1CCCN(c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.