prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1I | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc(N2CN(CCc3ccccc3)CNC2=S)ccc1Br | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 | CCOC(=O)c1cc(N2CN(CCc3ccccc3)CNC2=S)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1Cl | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(N2CN(CCc3ccccc3)CNC2=S)c1Br | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 | CCOC(=O)c1cccc(N2CN(CCc3ccccc3)CNC2=S)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(N2CN(CCc3ccccc3)CNC2=S)c1Cl | CCOC(=O)c1ccc(N2CN(CCc3ccccc3)CNC2=S)cc1 | CCOC(=O)c1cccc(N2CN(CCc3ccccc3)CNC2=S)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2[nH+]c(CNC(=O)NCCCCNc3ccc4ccccc4n3)cn12 | Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 | Cc1cccc2[nH+]c(CNC(=O)NCCCCNc3ccc4ccccc4n3)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C8C9"
} |
Can you make molecule Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2[nH+]c(CNC(=O)N=CCCNc3ccc4ccccc4n3)cn12 | Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 | Cc1cccc2[nH+]c(CNC(=O)N=CCCNc3ccc4ccccc4n3)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C8C9"
} |
Can you make molecule Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2[nH+]c(CNC(=O)NCCCCCNc3ccc4ccccc4n3)cn12 | Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 | Cc1cccc2[nH+]c(CNC(=O)NCCCCCNc3ccc4ccccc4n3)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C8C9"
} |
Can you make molecule Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2[nH+]c(CNC(=O)NC3CC(Nc4ccc5ccccc5n4)C3)cn12 | Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 | Cc1cccc2[nH+]c(CNC(=O)NC3CC(Nc4ccc5ccccc5n4)C3)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C8C9"
} |
Can you make molecule Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCNc1ccc2ccccc2n1)=NC(=O)NCc1cn2c(C)cccc2[nH+]1 | Cc1cccc2[nH+]c(CNC(=O)NCCNc3ccc4ccccc4n3)cn12 | CC(CCNc1ccc2ccccc2n1)=NC(=O)NCc1cn2c(C)cccc2[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C8C9"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NSC(=O)C[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NSC(=O)C[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NCC(=C=O)C[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NCC(=C=O)C[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)CCCC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NC(=O)CCCC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)CC(C)(C)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NC(=O)CC(C)(C)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC[S@+]([O-])CCC[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NC(=O)[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | CC(C)[C@@H](NC[S@+]([O-])CCC[C@]12CC[C@H](C[C@@H]1Br)C2)c1nc(C2CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CC(=O)N1CCN(C(=O)CC(C)(C)c2nc3ccccc3n2-c2ccccc2)CC1 | C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 | C[NH+](C)CC(=O)N1CCN(C(=O)CC(C)(C)c2nc3ccccc3n2-c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)CC7"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CC(=O)N1CCN(C(=O)CCC(C)(C)c2nc3ccccc3n2-c2ccccc2)CC1 | C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 | C[NH+](C)CC(=O)N1CCN(C(=O)CCC(C)(C)c2nc3ccccc3n2-c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)CC7"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)N1CCN(C(=O)C[NH+](C)C)CC1)c1nc2ccccc2n1-c1ccccc1 | C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 | C[C@@H](CC(=O)N1CCN(C(=O)C[NH+](C)C)CC1)c1nc2ccccc2n1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C5(=O)CC7"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CC(=O)N1CCN(C(=O)C[C@@H](Br)c2nc3ccccc3n2-c2ccccc2)CC1 | C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 | C[NH+](C)CC(=O)N1CCN(C(=O)C[C@@H](Br)c2nc3ccccc3n2-c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C5(=O)CC7"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN1CCN(C(=O)C[NH+](C)C)CC1)c1nc2ccccc2n1-c1ccccc1 | C[NH+](C)CC(=O)N1CCN(C(=O)CCc2nc3ccccc3n2-c2ccccc2)CC1 | C[C@H](C(=O)SN1CCN(C(=O)C[NH+](C)C)CC1)c1nc2ccccc2n1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C5(=O)CC7"
} |
Can you make molecule CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C[NH+]1CC=C(CCOc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | CC(C)(C)C[NH+]1CC=C(CCOc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(CC&)CC1",
"old_substring": "[NH+]17CCC5CC1"
} |
Can you make molecule CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C[NH+]1CCc2sc(Oc3ccc(C(=O)N[C@@H]4CCOC4)cc3Cl)cc2C1 | CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | CC(C)(C)C[NH+]1CCc2sc(Oc3ccc(C(=O)N[C@@H]4CCOC4)cc3Cl)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCc2sc&cc2C1",
"old_substring": "[NH+]17CCC5CC1"
} |
Can you make molecule CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C[NH+]1Cc2cc(Oc3ccc(C(=O)N[C@@H]4CCOC4)cc3Cl)sc2C1 | CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | CC(C)(C)C[NH+]1Cc2cc(Oc3ccc(C(=O)N[C@@H]4CCOC4)cc3Cl)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]17CCC5CC1"
} |
Can you make molecule CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C[C@H]1CN(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)C(C)(C)C1 | CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | CC(C)(C)C[C@H]1CN(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C(C)(C)C1",
"old_substring": "[NH+]17CCC5CC1"
} |
Can you make molecule CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CN1CCCN(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | CC(C)(C)C[NH+]1CCC(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | CC(C)(C)CN1CCCN(Oc2ccc(C(=O)N[C@@H]3CCOC3)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&CC1",
"old_substring": "[NH+]17CCC5CC1"
} |
Can you make molecule Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(I)ccc(N[C@@H]2CCc3cc(N)ccc32)c1C | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 | Cc1c(I)ccc(N[C@@H]2CCc3cc(N)ccc32)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)c(C)c1C",
"old_substring": "c13ccc(I)cc1"
} |
Can you make molecule Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(Cl)cc1I | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c13ccc(I)cc1"
} |
Can you make molecule Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(Br)cc1I | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(Br)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c13ccc(I)cc1"
} |
Can you make molecule Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CC[C@H]2Nc1cc(I)ccc1Cl | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 | Nc1ccc2c(c1)CC[C@H]2Nc1cc(I)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c13ccc(I)cc1"
} |
Can you make molecule Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(Cl)c(I)c1 | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(I)cc1 | Nc1ccc2c(c1)CC[C@H]2Nc1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c13ccc(I)cc1"
} |
Can you make molecule O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 | O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 | O=C(/C=C/SN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)[C@H]1CCCN(ON=C2CCN(N3CCN(Cc4cccnc4)CC3)CC2)C1 | O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 | FC(F)(F)[C@H]1CCCN(ON=C2CCN(N3CCN(Cc4cccnc4)CC3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCN(N2CCN(Cc3cccnc3)CC2)CC1)N1CCC[C@H](C(F)(F)F)C1 | O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 | O=C(NN=C1CCN(N2CCN(Cc3cccnc3)CC2)CC1)N1CCC[C@H](C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(N2CCN(Cc3cccnc3)CC2)CC1)N1CCC[C@H](C(F)(F)F)C1 | O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 | O=C(NN=C1CCC(N2CCN(Cc3cccnc3)CC2)CC1)N1CCC[C@H](C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON1CCC[C@H](C(F)(F)F)C1)C(=O)SN1CCN(Cc2cccnc2)CC1 | O=C(CN1CCN(Cc2cccnc2)CC1)N1CCC[C@H](C(F)(F)F)C1 | C/C(=N\ON1CCC[C@H](C(F)(F)F)C1)C(=O)SN1CCN(Cc2cccnc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C4"
} |
Can you make molecule C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 | C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 | C[C@H](CC(C)(C)c1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]4C6"
} |
Can you make molecule C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)CCC(=O)NC1CCCC1)CC(=O)c1c(Cl)cccc1Cl | C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 | C[C@@H](CCNC(=O)CCC(=O)NC1CCCC1)CC(=O)c1c(Cl)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]4C6"
} |
Can you make molecule C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNC(=O)CCC(=O)NC1CCCC1)CC(=O)c1c(Cl)cccc1Cl | C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 | C[C@H](CCNC(=O)CCC(=O)NC1CCCC1)CC(=O)c1c(Cl)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@@H]4C6"
} |
Can you make molecule C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)NC1CCCC1)NC[C@@H](Cl)CCc1c(Cl)cccc1Cl | C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 | O=C(CCC(=O)NC1CCCC1)NC[C@@H](Cl)CCc1c(Cl)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cl[C@H](C&)CC&",
"old_substring": "C[C@@H]4C6"
} |
Can you make molecule C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(NC(=O)CCC(=O)NC2CCCC2)O[C@@H](c2c(Cl)cccc2Cl)CS1 | C[C@H](Cc1c(Cl)cccc1Cl)NC(=O)CCC(=O)NC1CCCC1 | C[C@@]1(NC(=O)CCC(=O)NC2CCCC2)O[C@@H](c2c(Cl)cccc2Cl)CS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@]1&O[C@@H]&CS1",
"old_substring": "C[C@@H]4C6"
} |
Can you make molecule Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(CC(=O)SN2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(CC(=O)SN2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(C(=O)CCCC(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(C(=O)CCCC(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(C(C)(C)CC(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(C(C)(C)CC(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(C(C)(C)CCC(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(C(C)(C)CCC(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc([C@H](C)C(=O)SN2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc(C(=O)N2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | Cc1oc([C@H](C)C(=O)SN2CCCC(C)(C)CC2)cc1S(=O)(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN1CCC([C@@H](O)c2ccc(Cl)cc2)CC1)Nc1ccccc1 | O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 | O=C(/C=C/SN1CCC([C@@H](O)c2ccc(Cl)cc2)CC1)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H](c1ccc(Cl)cc1)C1CCN(c2ccc(/C=N/ONc3ccccc3)o2)CC1 | O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 | O[C@@H](c1ccc(Cl)cc1)C1CCN(c2ccc(/C=N/ONc3ccccc3)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(N2CCC([C@@H](O)c3ccc(Cl)cc3)CC2)CC1)Nc1ccccc1 | O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 | O=C(NN=C1CCC(N2CCC([C@@H](O)c3ccc(Cl)cc3)CC2)CC1)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)C1=CC[C@H](N2CCC([C@@H](O)c3ccc(Cl)cc3)CC2)S1 | O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 | O=C(Nc1ccccc1)C1=CC[C@H](N2CCC([C@@H](O)c3ccc(Cl)cc3)CC2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/N=c1\ccccn1N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1)Nc1ccccc1 | O=C(Nc1ccccc1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 | O=C(/N=c1\ccccn1N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/N=c1\\ccccn1&",
"old_substring": "O=C34"
} |
Can you make molecule COc1ccc(N)cc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N)cc1-c1ccccc1Cl | COc1ccc(N)cc1-c1ccccc1 | COc1ccc(N)cc1-c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c13ccccc1"
} |
Can you make molecule COc1ccc(N)cc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N)cc1-c1ccc(I)cc1 | COc1ccc(N)cc1-c1ccccc1 | COc1ccc(N)cc1-c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c13ccccc1"
} |
Can you make molecule COc1ccc(N)cc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N)cc1-c1ccc(C)c(I)c1 | COc1ccc(N)cc1-c1ccccc1 | COc1ccc(N)cc1-c1ccc(C)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c13ccccc1"
} |
Can you make molecule COc1ccc(N)cc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N)cc1-c1cccc(Br)c1 | COc1ccc(N)cc1-c1ccccc1 | COc1ccc(N)cc1-c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c13ccccc1"
} |
Can you make molecule COc1ccc(N)cc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N)cc1-c1cccc(C)c1C | COc1ccc(N)cc1-c1ccccc1 | COc1ccc(N)cc1-c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c13ccccc1"
} |
Can you make molecule C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(C[NH+]2CCC[C@@H]2C[C@@H](C)O)cc1 | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 | CC(C)c1ccc(C[NH+]2CCC[C@@H]2C[C@@H](C)O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "N3(C)C"
} |
Can you make molecule C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(CC(=N)S)cc1 | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(CC(=N)S)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N=C(S)C&",
"old_substring": "N3(C)C"
} |
Can you make molecule C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C2=CCCC2)cc1 | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C2=CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&(C)C1=CCCC1",
"old_substring": "N3(C)C"
} |
Can you make molecule C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(C(F)(F)C#N)cc1 | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(C(F)(F)C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N3(C)C"
} |
Can you make molecule C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc(C[NH+]3CCC[C@@H]3C[C@@H](C)O)cc2)CC1 | C[C@@H](O)C[C@H]1CCC[NH+]1Cc1ccc(N(C)C)cc1 | CC1CCN(c2ccc(C[NH+]3CCC[C@@H]3C[C@@H](C)O)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N3(C)C"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)c1nn(C(=O)CNC(=O)c2cccc(C)c2)cc1C#N | CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 | CC[C@@H](C)c1nn(C(=O)CNC(=O)c2cccc(C)c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cn&nc1&",
"old_substring": "N24C"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)c1oc(C(=O)CNC(=O)c2cccc(C)c2)nc1C#N | CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 | CC[C@@H](C)c1oc(C(=O)CNC(=O)c2cccc(C)c2)nc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N24C"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)c1sc(C(=O)CNC(=O)c2cccc(C)c2)cc1C#N | CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 | CC[C@@H](C)c1sc(C(=O)CNC(=O)c2cccc(C)c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N24C"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)c1ccc(C(=O)CNC(=O)c2cccc(C)c2)cc1C#N | CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 | CC[C@@H](C)c1ccc(C(=O)CNC(=O)c2cccc(C)c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N24C"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N1CCC(=NOC(=O)CNC(=O)c2cccc(C)c2)CC1 | CC[C@@H](C)N(C)C(=O)CNC(=O)c1cccc(C)c1 | CC[C@@H](C)N1CCC(=NOC(=O)CNC(=O)c2cccc(C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N24C"
} |
Can you make molecule CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccncc1)SC(=O)Cc1ccc(I)cc1 | CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 | CN(Cc1ccncc1)SC(=O)Cc1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccncc1)C(=O)CCCC(=O)c1ccc(I)cc1 | CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 | CN(Cc1ccncc1)C(=O)CCCC(=O)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccncc1)C(=O)CC(C)(C)c1ccc(I)cc1 | CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 | CN(Cc1ccncc1)C(=O)CC(C)(C)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccncc1)C(=O)CCC(C)(C)c1ccc(I)cc1 | CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 | CN(Cc1ccncc1)C(=O)CCC(C)(C)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN(C)Cc1ccncc1)c1ccc(I)cc1 | CN(Cc1ccncc1)C(=O)c1ccc(I)cc1 | C[C@H](C(=O)SN(C)Cc1ccncc1)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)N(C)C(=O)CC(C)(C)Nc1ccc(C)cc1F | CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F | CC[C@H](CSC)N(C)C(=O)CC(C)(C)Nc1ccc(C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)N(C)C(=O)CCC(C)(C)Nc1ccc(C)cc1F | CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F | CC[C@H](CSC)N(C)C(=O)CCC(C)(C)Nc1ccc(C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)N(C)C(=O)C[C@@H](Br)Nc1ccc(C)cc1F | CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F | CC[C@H](CSC)N(C)C(=O)C[C@@H](Br)Nc1ccc(C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)N(C)c1cc(C)n(Nc2ccc(C)cc2F)c(=O)c1 | CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F | CC[C@H](CSC)N(C)c1cc(C)n(Nc2ccc(C)cc2F)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)N(C)c1c(C)n(Nc2ccc(C)cc2F)ccc1=O | CC[C@H](CSC)N(C)C(=O)Nc1ccc(C)cc1F | CC[C@H](CSC)N(C)c1c(C)n(Nc2ccc(C)cc2F)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CC(C)(C)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | Cc1cccc(NC(=O)CC(C)(C)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CCC(C)(C)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | Cc1cccc(NC(=O)CCC(C)(C)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C[C@@H](Br)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | Cc1cccc(NC(=O)C[C@@H](Br)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(Nc2cc(C)n(NC(=O)CN3C(=O)c4ccccc4S3(=O)=O)c(=O)c2)c1C | Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | Cc1cccc(Nc2cc(C)n(NC(=O)CN3C(=O)c4ccccc4S3(=O)=O)c(=O)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(Nc2c(C)n(NC(=O)CN3C(=O)c4ccccc4S3(=O)=O)ccc2=O)c1C | Cc1cccc(NC(=O)NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1C | Cc1cccc(Nc2c(C)n(NC(=O)CN3C(=O)c4ccccc4S3(=O)=O)ccc2=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cc2cc(F)ccc2s1 | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cc2cc(F)ccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(F)ccc2s1",
"old_substring": "c16cccc(F)c1"
} |
Can you make molecule COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(Br)c1C | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(Br)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c16cccc(F)c1"
} |
Can you make molecule COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1oc2ccc(F)cc2c1C | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1oc2ccc(F)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(F)cc2c1C",
"old_substring": "c16cccc(F)c1"
} |
Can you make molecule COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cc(F)ccc1Br | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cc(F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c16cccc(F)c1"
} |
Can you make molecule COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1ccc(F)cc1Cl | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1cccc(F)c1 | COc1cc(Cl)c(C)cc1NC(=O)CSc1nnnn1-c1ccc(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c16cccc(F)c1"
} |
Can you make molecule Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1NC(=O)c1cc(C#N)c([C@@H](C)c2cccc(O)c2)s1 | Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 | Cc1c(Cl)cccc1NC(=O)c1cc(C#N)c([C@@H](C)c2cccc(O)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N34C"
} |
Can you make molecule Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1NC(=O)c1ccc([C@@H](C)c2cccc(O)c2)c(C#N)c1 | Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 | Cc1c(Cl)cccc1NC(=O)c1ccc([C@@H](C)c2cccc(O)c2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N34C"
} |
Can you make molecule Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1NC(=O)ON=C1CCN([C@@H](C)c2cccc(O)c2)CC1 | Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 | Cc1c(Cl)cccc1NC(=O)ON=C1CCN([C@@H](C)c2cccc(O)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N34C"
} |
Can you make molecule Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1NC(=O)N1CCC=C(C[C@@H](C)c2cccc(O)c2)C1 | Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 | Cc1c(Cl)cccc1NC(=O)N1CCC=C(C[C@@H](C)c2cccc(O)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N34C"
} |
Can you make molecule Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1NC(=O)N1CCC(C#N)([C@@H](C)c2cccc(O)c2)CC1 | Cc1c(Cl)cccc1NC(=O)N(C)[C@@H](C)c1cccc(O)c1 | Cc1c(Cl)cccc1NC(=O)N1CCC(C#N)([C@@H](C)c2cccc(O)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&(C#N)CC1",
"old_substring": "N34C"
} |
Can you make molecule O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccc(Br)cc1F | O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | O=C(/C=C/S[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccc(Br)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C47"
} |
Can you make molecule O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2ccc(Br)cc2F)nc1[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | O=Cc1sc(Nc2ccc(Br)cc2F)nc1[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C47"
} |
Can you make molecule O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2ccc(Br)cc2F)sc1[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | O=Cc1nc(Nc2ccc(Br)cc2F)sc1[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C47"
} |
Can you make molecule O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/C[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccc(Br)cc1F | O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | O=C(N/N=C/C[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccc(Br)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C47"
} |
Can you make molecule O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N1CCC[C@@H]1N1CCC(=NONc2ccc(Br)cc2F)CC1)C12CC3CC(CC(C3)C1)C2 | O=C(Nc1ccc(Br)cc1F)[C@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 | O=C(N1CCC[C@@H]1N1CCC(=NONc2ccc(Br)cc2F)CC1)C12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C47"
} |
Can you make molecule Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC(=O)Nc2ccc(OC(F)(F)Cl)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(OC(F)(F)Cl)c3ncccc23)no1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(F)(F)Cl",
"old_substring": "O5C(F)F"
} |
Can you make molecule Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC(=O)Nc2ccc(C(F)(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(C(F)(F)F)c3ncccc23)no1 | 102 | {
"fragment_index": 0,
"new_substring": "FC&(F)F",
"old_substring": "O5C(F)F"
} |
Can you make molecule Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC(=O)Nc2ccc(SC(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(SC(F)F)c3ncccc23)no1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "O5C(F)F"
} |
Can you make molecule Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC(=O)Nc2ccc([C@@H](O)CC(F)(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc([C@@H](O)CC(F)(F)F)c3ncccc23)no1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CC(F)(F)F",
"old_substring": "O5C(F)F"
} |
Can you make molecule Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC(=O)Nc2ccc(-c3c(F)cc(C=O)cc3F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(OC(F)F)c3ncccc23)no1 | Cc1cc(CC(=O)Nc2ccc(-c3c(F)cc(C=O)cc3F)c3ncccc23)no1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1cc(F)c&c(F)c1",
"old_substring": "O5C(F)F"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.