prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](CC(=O)Nc2ccc(NC(=O)c3ccccc3)cc2I)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2ccc(NC(=O)c3ccccc3)cc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17cccc8c1"
} |
Can you make molecule C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](CC(=O)Nc2cc(NC(=O)c3ccccc3)ccc2Br)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2cc(NC(=O)c3ccccc3)ccc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17cccc8c1"
} |
Can you make molecule C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](CC(=O)Nc2ccc(NC(=O)c3ccccc3)cc2Cl)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2ccc(NC(=O)c3ccccc3)cc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17cccc8c1"
} |
Can you make molecule C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2Br)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17cccc8c1"
} |
Can you make molecule C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2Cl)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)C1 | C[C@H]1CCC[NH+](CC(=O)Nc2cccc(NC(=O)c3ccccc3)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17cccc8c1"
} |
Can you make molecule CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)Cc1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNSC(=O)Cc1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCCC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNC(=O)CCCC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CC(C)(C)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNC(=O)CC(C)(C)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCC(C)(C)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNC(=O)CCC(C)(C)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)[C@@H](C)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNC(=O)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | CNSC(=O)[C@@H](C)c1nn(CN2CCN(c3cccc(C)c3C)CC2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccc(SC(=S)N(C)Cc2cn[nH]c2N)cc1 | CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 | CCCS(=O)(=O)c1ccc(SC(=S)N(C)Cc2cn[nH]c2N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccc(SC2=NCCN2Cc2cn[nH]c2N)cc1 | CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 | CCCS(=O)(=O)c1ccc(SC2=NCCN2Cc2cn[nH]c2N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N34"
} |
Can you make molecule CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccc(C2CCN(CCc3cn[nH]c3N)CC2)cc1 | CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 | CCCS(=O)(=O)c1ccc(C2CCN(CCc3cn[nH]c3N)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N34"
} |
Can you make molecule CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccc(-c2cccc(Cc3cn[nH]c3N)c2N)cc1 | CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 | CCCS(=O)(=O)c1ccc(-c2cccc(Cc3cn[nH]c3N)c2N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N34"
} |
Can you make molecule CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccc(-c2cc(N)cc(Cc3cn[nH]c3N)c2)cc1 | CCCS(=O)(=O)c1ccc(NCc2cn[nH]c2N)cc1 | CCCS(=O)(=O)c1ccc(-c2cc(N)cc(Cc3cn[nH]c3N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1cc&cc&c1",
"old_substring": "N34"
} |
Can you make molecule Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNc1ccc(Cl)cc1)c1c(C)[nH]c(=O)[nH]c1=O | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 | CCC(CC)(C(=O)CNc1ccc(Cl)cc1)c1c(C)[nH]c(=O)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4CC2=O"
} |
Can you make molecule Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNc1ccc(Cl)cc1)c1c(C)[nH]c(=O)[nH]c1=O | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 | CCC(CC)(C(=O)CCNc1ccc(Cl)cc1)c1c(C)[nH]c(=O)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4CC2=O"
} |
Can you make molecule Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](c1c(C)[nH]c(=O)[nH]c1=O)[S@+]([O-])CNc1ccc(Cl)cc1 | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 | CC[C@H](c1c(C)[nH]c(=O)[nH]c1=O)[S@+]([O-])CNc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&[S@](=O)C&",
"old_substring": "C4CC2=O"
} |
Can you make molecule Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C(=O)Nc1ccc(Cl)cc1)C(=O)c1c(C)[nH]c(=O)[nH]c1=O | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 | CCCC[C@@H](C(=O)Nc1ccc(Cl)cc1)C(=O)c1c(C)[nH]c(=O)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H](C&=O)C&=O",
"old_substring": "C4CC2=O"
} |
Can you make molecule Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c(=O)[nH]c(=O)c1CCC[S@+]([O-])[C@@H](C)Nc1ccc(Cl)cc1 | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(Cl)cc1 | Cc1[nH]c(=O)[nH]c(=O)c1CCC[S@+]([O-])[C@@H](C)Nc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "C4CC2=O"
} |
Can you make molecule Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)ccc1SC(=S)N(C)Cc1c(C)n(C)n(-c2ccccc2)c1=O | Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O | Cc1cc(Cl)ccc1SC(=S)N(C)Cc1c(C)n(C)n(-c2ccccc2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)ccc1SC1=NCCN1Cc1c(C)n(C)n(-c2ccccc2)c1=O | Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O | Cc1cc(Cl)ccc1SC1=NCCN1Cc1c(C)n(C)n(-c2ccccc2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N34"
} |
Can you make molecule Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)ccc1C1CCN(CCc2c(C)n(C)n(-c3ccccc3)c2=O)CC1 | Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O | Cc1cc(Cl)ccc1C1CCN(CCc2c(C)n(C)n(-c3ccccc3)c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N34"
} |
Can you make molecule Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)ccc1-c1cccc(Cc2c(C)n(C)n(-c3ccccc3)c2=O)c1N | Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O | Cc1cc(Cl)ccc1-c1cccc(Cc2c(C)n(C)n(-c3ccccc3)c2=O)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N34"
} |
Can you make molecule Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)ccc1-c1cc(N)cc(Cc2c(C)n(C)n(-c3ccccc3)c2=O)c1 | Cc1cc(Cl)ccc1NCc1c(C)n(C)n(-c2ccccc2)c1=O | Cc1cc(Cl)ccc1-c1cc(N)cc(Cc2c(C)n(C)n(-c3ccccc3)c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1cc&cc&c1",
"old_substring": "N34"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccc(I)cc1F | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccc(I)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c14ccccc1F"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cc(I)ccc1F | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cc(I)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c14ccccc1F"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1Cl | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1F"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=O)CCC(=O)N1CCC(c2ccccc2)=N1)c1ccccc1F | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F | CC(=NC(=O)CCC(=O)N1CCC(c2ccccc2)=N1)c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1ccccc1F",
"old_substring": "c14ccccc1F"
} |
Can you make molecule O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cc(F)ccc1Br | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1ccccc1F | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)Nc1cc(F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c14ccccc1F"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(C(C)(C)C)C[NH+](Cc2ncoc2[C@H]2CCCCO2)C1 | CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 | CCC1(C(C)(C)C)C[NH+](Cc2ncoc2[C@H]2CCCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CC2)C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC1(C(C)(C)C)C[NH+](Cc2ncoc2[C@H]2CCCCO2)C1 | CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 | CCCC1(C(C)(C)C)C[NH+](Cc2ncoc2[C@H]2CCCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCC2)C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C.N#[N+]Cc1ncoc1[C@H]1CCCCO1 | CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 | CC(C)C.N#[N+]Cc1ncoc1[C@H]1CCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "[N+]&#N",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C.c1nc(C[NH+]2CCCC2)c([C@H]2CCCCO2)o1 | CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 | CC(C)C.c1nc(C[NH+]2CCCC2)c([C@H]2CCCCO2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C.CC1C[NH+](Cc2ncoc2[C@H]2CCCCO2)C1 | CC(C)(C)[NH2+]Cc1ncoc1[C@H]1CCCCO1 | CC(C)C.CC1C[NH+](Cc2ncoc2[C@H]2CCCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1C[NH+]&C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC(CC)([C@@H](CNC(=O)c2ccncc2Cl)c2ccccc2)C1 | CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | CC[NH+]1CCC(CC)([C@@H](CNC(=O)c2ccncc2Cl)c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH+]345"
} |
Can you make molecule CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@](CC)([C@@H](CNC(=O)c2ccncc2Cl)c2ccccc2)C1 | CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | CC[NH+]1CCC[C@](CC)([C@@H](CNC(=O)c2ccncc2Cl)c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH+]345"
} |
Can you make molecule CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1[nH+]cn(CC)c1[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | CCc1[nH+]cn(CC)c1[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH+]345"
} |
Can you make molecule CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc([C@@H](CNC(=O)c2ccncc2Cl)c2ccccc2)n(CC)[nH+]1 | CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | CCc1cc([C@@H](CNC(=O)c2ccncc2Cl)c2ccccc2)n(CC)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH+]345"
} |
Can you make molecule CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1[nH+]n(C)c(CC)c1[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | CC[NH+](CC)[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | CCc1[nH+]n(C)c(CC)c1[C@@H](CNC(=O)c1ccncc1Cl)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH+]345"
} |
Can you make molecule C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H](C(N)=O)CN1SC(=O)Cn1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1SC(=O)Cn1ncc(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)CCCC(=O)n1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)CCCC(=O)n1ncc(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)CC(C)(C)n1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)CC(C)(C)n1ncc(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H](C(N)=O)CN1C[S@+]([O-])CCCn1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C[S@+]([O-])CCCn1ncc(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)CCC(C)(C)n1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Cn1ncc(=O)c2ccccc21 | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)CCC(C)(C)n1ncc(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)C[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOSC(=O)C[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCC(=C=O)C[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOCC(=C=O)C[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOC(=O)CCCC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOC(=O)CC(C)(C)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[S@+]([O-])CCC[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOC(=O)[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | CCOC[S@+]([O-])CCC[C@H]1CCCN(c2ncnc(NNC(=O)c3ccccc3)c2N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C47=O"
} |
Can you make molecule CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1SCCS1 | CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "CS5"
} |
Can you make molecule CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1SCCCS1 | CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "CS5"
} |
Can you make molecule CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1(C)SCCS1 | CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1(C)SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&SCCS1",
"old_substring": "CS5"
} |
Can you make molecule CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1SCSCS1 | CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "CS5"
} |
Can you make molecule CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1CSCCSC1 | CSC[C@@](C)(O)CNC(=O)c1c(C)nc2ccccn12 | Cc1nc2ccccn2c1C(=O)NC[C@](C)(O)CC1CSCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "CS5"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@](C)(O)Cc1nc2c(s1)CN(C(=O)C1CCC(C[NH3+])CC1)C2 | CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 | CC(C)C[C@](C)(O)Cc1nc2c(s1)CN(C(=O)C1CCC(C[NH3+])CC1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@](C)(O)Cn1ncc2c1CN(C(=O)C1CCC(C[NH3+])CC1)C2 | CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 | CC(C)C[C@](C)(O)Cn1ncc2c1CN(C(=O)C1CCC(C[NH3+])CC1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N23"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@](C)(O)Cc1onc2c1CN(C(=O)C1CCC(C[NH3+])CC1)CC2 | CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 | CC(C)C[C@](C)(O)Cc1onc2c1CN(C(=O)C1CCC(C[NH3+])CC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@](C)(O)Cc1cc2n(n1)CCCN2C(=O)C1CCC(C[NH3+])CC1 | CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 | CC(C)C[C@](C)(O)Cc1cc2n(n1)CCCN2C(=O)C1CCC(C[NH3+])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@](C)(O)Cc1ccc2c(c1)CCN2C(=O)C1CCC(C[NH3+])CC1 | CC(C)C[C@](C)(O)CNC(=O)C1CCC(C[NH3+])CC1 | CC(C)C[C@](C)(O)Cc1ccc2c(c1)CCN2C(=O)C1CCC(C[NH3+])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CC(C)CCCC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC(C)CC3=O"
} |
Can you make molecule CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CC(=O)CCN1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CC(C)(C)CC(=O)CCN1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC(=O)CC&",
"old_substring": "CC(C)CC3=O"
} |
Can you make molecule CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)CCCCN1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CC(C)(C)C(=O)CCCCN1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C(=O)CCCC&",
"old_substring": "CC(C)CC3=O"
} |
Can you make molecule CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)=NON1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CCC(CC)=NON1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(CC)=NO&",
"old_substring": "CC(C)CC3=O"
} |
Can you make molecule CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)C(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CC(C)CC(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | CCCC(CCC)C(=O)N1CCC[C@H](NS(=O)(=O)c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC(CCC)C&=O",
"old_substring": "CC(C)CC3=O"
} |
Can you make molecule C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2ccc(Br)cc2I)C1 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2ccc(Br)cc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c13cccc(Br)c1"
} |
Can you make molecule C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(/C=C/Br)c2)C1 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(/C=C/Br)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(/C=C/Br)c1",
"old_substring": "c13cccc(Br)c1"
} |
Can you make molecule C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2ccc(Br)cc2Br)C1 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2ccc(Br)cc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c13cccc(Br)c1"
} |
Can you make molecule C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H]2C[NH2+]CC[C@]23CCC[C@H](C)C3)oc2ccc(Br)cc12 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 | Cc1c([C@H]2C[NH2+]CC[C@]23CCC[C@H](C)C3)oc2ccc(Br)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(Br)cc2c1C",
"old_substring": "c13cccc(Br)c1"
} |
Can you make molecule C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cc(Br)ccc2I)C1 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cccc(Br)c2)C1 | C[C@H]1CCC[C@]2(CC[NH2+]C[C@@H]2c2cc(Br)ccc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c13cccc(Br)c1"
} |
Can you make molecule CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnn(SCC(=O)c2ccc(OC)cc2OC)c1=S | CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC | CCn1cnn(SCC(=O)c2ccc(OC)cc2OC)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnn&c1=S",
"old_substring": "n16cnnc17"
} |
Can you make molecule CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnc(SCC(=O)c2ccc(OC)cc2OC)c1 | CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC | CCn1cnc(SCC(=O)c2ccc(OC)cc2OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc&c1",
"old_substring": "n16cnnc17"
} |
Can you make molecule CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(SCC(=O)c2ccc(OC)cc2OC)nc1Cl | CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC | CCn1nc(SCC(=O)c2ccc(OC)cc2OC)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc&nc1Cl",
"old_substring": "n16cnnc17"
} |
Can you make molecule CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnc(SCC(=O)c2ccc(OC)cc2OC)cc1=O | CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC | CCn1cnc(SCC(=O)c2ccc(OC)cc2OC)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc&cc1=O",
"old_substring": "n16cnnc17"
} |
Can you make molecule CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCn1cncc(SCC(=O)c2ccc(OC)cc2OC)c1=O | CCn1cnnc1SCC(=O)c1ccc(OC)cc1OC | CCn1cncc(SCC(=O)c2ccc(OC)cc2OC)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cncc&c1=O",
"old_substring": "n16cnnc17"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCCCC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N13CCCCCC1"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCC(C)(C)CC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N13CCCCCC1"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)C1CCCCC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "N13CCCCCC1"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCC2(CCCCC2)C1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCC2(CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCCCC2)C1",
"old_substring": "N13CCCCCC1"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCC2(CCCC2)CC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCCCCC1 | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCC2(CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCCC2)CC1",
"old_substring": "N13CCCCCC1"
} |
Can you make molecule CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)c1ccc(C=CC2=CN=N[C@H]2[C@H](C)C(=O)OC)cc1 | CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 | CCN(CC)c1ccc(C=CC2=CN=N[C@H]2[C@H](C)C(=O)OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C1=7SC(=O)N8C1=O"
} |
Can you make molecule CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)c1ccc(C=C2CC(F)([C@H](C)C(=O)OC)C2)cc1 | CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 | CCN(CC)c1ccc(C=C2CC(F)([C@H](C)C(=O)OC)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C1=7SC(=O)N8C1=O"
} |
Can you make molecule CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)c1ccc(C=NC(=S)N2CCC([C@H](C)C(=O)OC)CC2)cc1 | CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 | CCN(CC)c1ccc(C=NC(=S)N2CCC([C@H](C)C(=O)OC)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "C1=7SC(=O)N8C1=O"
} |
Can you make molecule CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)c1ccc(C=C2CC(C#N)([C@H](C)C(=O)OC)C2)cc1 | CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 | CCN(CC)c1ccc(C=C2CC(C#N)([C@H](C)C(=O)OC)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(C#N)C1",
"old_substring": "C1=7SC(=O)N8C1=O"
} |
Can you make molecule CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)c1ccc(C=CC2=CN=N[C@@H]2[C@H](C)C(=O)OC)cc1 | CCN(CC)c1ccc(C=C2SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1 | CCN(CC)c1ccc(C=CC2=CN=N[C@@H]2[C@H](C)C(=O)OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@@H]&N=N1",
"old_substring": "C1=7SC(=O)N8C1=O"
} |
Can you make molecule CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)c1 | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c16csc8n1"
} |
Can you make molecule CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)N(C)Cc2ccc(OC(F)(F)F)cc2)csc1-c1cccs1 | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 | Cc1c(C(=O)N(C)Cc2ccc(OC(F)(F)F)cc2)csc1-c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1C",
"old_substring": "c16csc8n1"
} |
Can you make molecule CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1ccc(-c2cccs2)s1 | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1ccc(-c2cccs2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c16csc8n1"
} |
Can you make molecule CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1cc(-c2cccs2)cnc1Cl | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1cc(-c2cccs2)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c16csc8n1"
} |
Can you make molecule CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1cc(-c2cccs2)ncc1Cl | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1csc(-c2cccs2)n1 | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1cc(-c2cccs2)ncc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ncc1Cl",
"old_substring": "c16csc8n1"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2cc(I)ccc2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2cc(I)ccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c17ccccc1Cl"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2cc(Br)ccc2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2cc(Br)ccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c17ccccc1Cl"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2sc3sccc3c2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2sc3sccc3c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c17ccccc1Cl"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2sc3ccccc3c2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2sc3ccccc3c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c17ccccc1Cl"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2cc(Br)c(F)cc2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2ccccc2Cl)c1 | COc1ccc(OC)c([C@H]2CCCN2C(=O)Nc2cc(Br)c(F)cc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c17ccccc1Cl"
} |
Can you make molecule C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNSC(=O)Cc1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNSC(=O)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)CCCC(=O)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)CCCC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)CC(C)(C)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)CC(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)CCC(C)(C)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)CCC(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNSC(=O)[C@@H](C)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNC(=O)c1ccccc1 | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCNSC(=O)[C@@H](C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.