prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(c1ncnc(Cl)c1[N+](=O)[O-])C1(C)Cc2ccccc2C1 | CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] | CCN(c1ncnc(Cl)c1[N+](=O)[O-])C1(C)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(C1=CC2=CC=C2OC(C)(C)C1)c1ncnc(Cl)c1[N+](=O)[O-] | CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] | CCN(C1=CC2=CC=C2OC(C)(C)C1)c1ncnc(Cl)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(c1ncnc(Cl)c1[N+](=O)[O-])N1CC(C)(C)Oc2ccccc21 | CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] | CCN(c1ncnc(Cl)c1[N+](=O)[O-])N1CC(C)(C)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CN&c2ccccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(c1ncnc(Cl)c1[N+](=O)[O-])N1CC(C)(C)Sc2ccccc21 | CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] | CCN(c1ncnc(Cl)c1[N+](=O)[O-])N1CC(C)(C)Sc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CN&c2ccccc2S1",
"old_substring": "CC2"
} |
Can you make molecule CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCN(c1ncnc(Cl)c1[N+](=O)[O-])C1C2CCC1CC2 | CCN(CC)c1ncnc(Cl)c1[N+](=O)[O-] | CCN(c1ncnc(Cl)c1[N+](=O)[O-])C1C2CCC1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2CCC1CC2",
"old_substring": "CC2"
} |
Can you make molecule COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)CCCC(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)CCCC(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)CCC(=O)CN[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)CCC(=O)CN[C@H](c1ccc(F)cc1)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC[S@+]([O-])CCC(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC[S@+]([O-])CCC(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)CCCS(=O)(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)CCCS(=O)(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)C(C)(F)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | COc1ccccc1NC(=O)C(C)(F)C(=O)N[C@H](c1ccc(F)cc1)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 | O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 | O=C(/C=C/S[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3CC4"
} |
Can you make molecule O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1cn2c(n1)SCC2)NN=C1CCC([NH+]2Cc3ccccc3O[C@H](c3ccccc3)C2)CC1 | O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 | O=C(NCc1cn2c(n1)SCC2)NN=C1CCC([NH+]2Cc3ccccc3O[C@H](c3ccccc3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3CC4"
} |
Can you make molecule O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONCc1cn2c(n1)SCC2)C(=O)S[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1 | O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 | C/C(=N\ONCc1cn2c(n1)SCC2)C(=O)S[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3CC4"
} |
Can you make molecule O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1cn2c(n1)SCC2)C1=CC[C@H]([NH+]2Cc3ccccc3O[C@H](c3ccccc3)C2)S1 | O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 | O=C(NCc1cn2c(n1)SCC2)C1=CC[C@H]([NH+]2Cc3ccccc3O[C@H](c3ccccc3)C2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3CC4"
} |
Can you make molecule O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONCc1cn2c(n1)SCC2)[C@H](C)[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1 | O=C(CC[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1)NCc1cn2c(n1)SCC2 | C/C(=N\ONCc1cn2c(n1)SCC2)[C@H](C)[NH+]1Cc2ccccc2O[C@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)[C@@H]&C",
"old_substring": "O=C3CC4"
} |
Can you make molecule NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1CCN(c2cc(N3CCCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CCCC3)ccc2[N+](=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1CCN(c2cc(N3CCCCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CCCCC3)ccc2[N+](=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1CCN(c2cc(N3CCSCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CCSCC3)ccc2[N+](=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1CCN(c2cc(N3CC=CC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CC=CC3)ccc2[N+](=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)C1CCN(c2cc(SSN3CCOCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(N3CCOCC3)ccc2[N+](=O)[O-])CC1 | NC(=O)C1CCN(c2cc(SSN3CCOCC3)ccc2[N+](=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1csc(CSc2ccc(N)cc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(CCCCSc2ccc(N)cc2Cl)n1 | Cc1csc(CSc2ccc(N)cc2Cl)n1 | Cc1csc(CCCCSc2ccc(N)cc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C34"
} |
Can you make molecule Cc1csc(CSc2ccc(N)cc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(CCCCCSc2ccc(N)cc2Cl)n1 | Cc1csc(CSc2ccc(N)cc2Cl)n1 | Cc1csc(CCCCCSc2ccc(N)cc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C34"
} |
Can you make molecule Cc1csc(CSc2ccc(N)cc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C2CC(Sc3ccc(N)cc3Cl)C2)n1 | Cc1csc(CSc2ccc(N)cc2Cl)n1 | Cc1csc(C2CC(Sc3ccc(N)cc3Cl)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C34"
} |
Can you make molecule Cc1csc(CSc2ccc(N)cc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(SC(=S)OSc2ccc(N)cc2Cl)n1 | Cc1csc(CSc2ccc(N)cc2Cl)n1 | Cc1csc(SC(=S)OSc2ccc(N)cc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C34"
} |
Can you make molecule Cc1csc(CSc2ccc(N)cc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(NC(=S)SSc2ccc(N)cc2Cl)n1 | Cc1csc(CSc2ccc(N)cc2Cl)n1 | Cc1csc(NC(=S)SSc2ccc(N)cc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C34"
} |
Can you make molecule CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1ncc(NC(=O)CC(C)(C)N2CCC[C@@H](C)[C@H]2CO)c1C | CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C | CCCCn1ncc(NC(=O)CC(C)(C)N2CCC[C@@H](C)[C@H]2CO)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1ncc(NC(=O)CCC(C)(C)N2CCC[C@@H](C)[C@H]2CO)c1C | CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C | CCCCn1ncc(NC(=O)CCC(C)(C)N2CCC[C@@H](C)[C@H]2CO)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1ncc(NC(=O)C[C@@H](Br)N2CCC[C@@H](C)[C@H]2CO)c1C | CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C | CCCCn1ncc(NC(=O)C[C@@H](Br)N2CCC[C@@H](C)[C@H]2CO)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1ncc(Nc2cc(C)n(N3CCC[C@@H](C)[C@H]3CO)c(=O)c2)c1C | CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C | CCCCn1ncc(Nc2cc(C)n(N3CCC[C@@H](C)[C@H]3CO)c(=O)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1ncc(Nc2c(C)n(N3CCC[C@@H](C)[C@H]3CO)ccc2=O)c1C | CCCCn1ncc(NC(=O)N2CCC[C@@H](C)[C@H]2CO)c1C | CCCCn1ncc(Nc2c(C)n(N3CCC[C@@H](C)[C@H]3CO)ccc2=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2CC[C@@H](c3ccccc3)C2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2CC[C@@H](c3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc([C@H]2CCCCN2C(=O)[C@H]2C=C[C@@H](c3ccccc3)C2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@H]2C=C[C@@H](c3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc([C@H]2CCCCN2C(=O)[C@H]2C=C[C@H](c3ccccc3)C2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@H]2C=C[C@H](c3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc([C@H]2CCCCN2C(=O)[C@H]2CCC[C@H](c3ccccc3)C2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@H]2CCC[C@H](c3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc([C@H]2CCCCN2C(=O)[C@H]2CCCC[C@H](c3ccccc3)C2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@@H]2C[C@@H]2c2ccccc2)n1 | Cc1noc([C@H]2CCCCN2C(=O)[C@H]2CCCC[C@H](c3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2SCCS2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2SCCS2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CCCCC2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CCCCC2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2SCCCS2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2SCCCS2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2SCSCS2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2SCSCS2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CCCCCC2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CC2)c(F)c1 | Cc1ccc(NC(=O)[C@@H](C)Sc2nnnn2C2CCCCCC2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(CC(=O)SNCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(CC(=O)SNCc2ccnc(OC(C)(C)C)c2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C39=O"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(C(=O)CCCC(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(C(=O)CCCC(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C39=O"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(C(C)(C)CC(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(C(C)(C)CC(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c(C(C)(C)CCC(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(C(C)(C)CCC(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(F)c([C@H](C)C(=O)SNCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c1F | CCOc1ccc(F)c([C@H](C)C(=O)SNCc2ccnc(OC(C)(C)C)c2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C39=O"
} |
Can you make molecule Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1cc2ccccc2o1)NC(=O)Cn1cnc2cc(C)c(C)cc21 | Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C | CC[C@@H](CCc1cc2ccccc2o1)NC(=O)Cn1cnc2cc(C)c(C)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(CC(=O)N[C@@H](CBr)CCc3cc4ccccc4o3)c2cc1C | Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C | Cc1cc2ncn(CC(=O)N[C@@H](CBr)CCc3cc4ccccc4o3)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(CC(=O)N[C@@H](CBr)CCCc3cc4ccccc4o3)c2cc1C | Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C | Cc1cc2ncn(CC(=O)N[C@@H](CBr)CCCc3cc4ccccc4o3)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(CC(=O)N[C@H](CCl)CCCc3cc4ccccc4o3)c2cc1C | Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C | Cc1cc2ncn(CC(=O)N[C@H](CCl)CCCc3cc4ccccc4o3)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(CC(=O)N[C@H]3CCC[C@H](c4cc5ccccc5o4)C3)c2cc1C | Cc1cc2ncn(CC(=O)N[C@H](C)c3cc4ccccc4o3)c2cc1C | Cc1cc2ncn(CC(=O)N[C@H]3CCC[C@H](c4cc5ccccc5o4)C3)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]68C"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NSC(=O)Cc1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NSC(=O)Cc1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NC(=O)CCCC(=O)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NC(=O)CCCC(=O)c1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C26=O"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NC(=O)CC(C)(C)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NC(=O)CC(C)(C)c1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NC(=O)CCC(C)(C)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NC(=O)CCC(C)(C)c1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NSC(=O)[C@@H](C)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NC(=O)c1ccnc(OC(C)(C)C)c1 | CC[C@@H](C)NSC(=O)[C@@H](C)c1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C26=O"
} |
Can you make molecule COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Nc2nc(N)nc(CSc3ccccc3C)n2)cc1I | COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 | COc1ccc(Nc2nc(N)nc(CSc3ccccc3C)n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c13ccccc16"
} |
Can you make molecule COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Nc2nc(N)nc(CSc3ccccc3C)n2)ccc1Br | COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 | COc1cc(Nc2nc(N)nc(CSc3ccccc3C)n2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c13ccccc16"
} |
Can you make molecule COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Nc2nc(N)nc(CSc3ccccc3C)n2)cc1Cl | COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 | COc1ccc(Nc2nc(N)nc(CSc3ccccc3C)n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c13ccccc16"
} |
Can you make molecule COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Nc2nc(N)nc(CSc3ccccc3C)n2)c1Br | COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 | COc1cccc(Nc2nc(N)nc(CSc3ccccc3C)n2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c13ccccc16"
} |
Can you make molecule COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Nc2nc(N)nc(CSc3ccccc3C)n2)c1Cl | COc1ccccc1Nc1nc(N)nc(CSc2ccccc2C)n1 | COc1cccc(Nc2nc(N)nc(CSc3ccccc3C)n2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c13ccccc16"
} |
Can you make molecule C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 less soluble in water? The output molecule should be similar to the input molecule. | C=C(Cl)CCOc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(Cl)CCOc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(Cl)CC&",
"old_substring": "C=C(C)C3"
} |
Can you make molecule C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC(C)(C)Oc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(C)CC(C)(C)Oc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC&(C)C",
"old_substring": "C=C(C)C3"
} |
Can you make molecule C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC[C@@H](C)Oc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(C)CC[C@@H](C)Oc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC[C@H]&C",
"old_substring": "C=C(C)C3"
} |
Can you make molecule C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C[C@@H](CC(C)C)Oc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(C)C[C@@H](CC(C)C)Oc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C[C@H]&CC(C)C",
"old_substring": "C=C(C)C3"
} |
Can you make molecule C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)c1ccc(Oc2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccc(O)cc2)N3)cc1 | C=C(C)COc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1ccc(O)cc1)N2 | C=C(C)c1ccc(Oc2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccc(O)cc2)N3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)c1ccc&cc1",
"old_substring": "C=C(C)C3"
} |
Can you make molecule C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)Nc1ccc(C=CC(=C)C(=O)c2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=CC(=C)C(=O)c2ccc(OC)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "C=7C6=O"
} |
Can you make molecule C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)Nc1ccc(C=CCCc2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=CCCc2ccc(OC)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C=7C6=O"
} |
Can you make molecule C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)Nc1ccc(C=C(C)CCc2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=C(C)CCc2ccc(OC)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C=7C6=O"
} |
Can you make molecule C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)Nc1ccc(C=CCCc2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=CCCc2ccc(OC)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C=7C6=O"
} |
Can you make molecule C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)Nc1ccc(C=C2CCC(O)(c3ccc(OC)cc3)CC2)cc1 | C=C(C)C(=O)Nc1ccc(C=CC(=O)c2ccc(OC)cc2)cc1 | C=C(C)C(=O)Nc1ccc(C=C2CCC(O)(c3ccc(OC)cc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(O)CC1",
"old_substring": "C=7C6=O"
} |
Can you make molecule Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1OCC(=O)Nc1ccc([N-]S(C)(=O)=O)cc1 | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 | Cc1ccoc1OCC(=O)Nc1ccc([N-]S(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccoc1&",
"old_substring": "Cc1cc5no1"
} |
Can you make molecule Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(OCC(=O)Nc3ccc([N-]S(C)(=O)=O)cc3)oc2c1 | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 | Cc1ccc2nc(OCC(=O)Nc3ccc([N-]S(C)(=O)=O)cc3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2nc&oc2c1",
"old_substring": "Cc1cc5no1"
} |
Can you make molecule Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)ncc1Br | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "Cc1cc5no1"
} |
Can you make molecule Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)n1OCC(=O)Nc1ccc([N-]S(C)(=O)=O)cc1 | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 | Cc1ccc(C)n1OCC(=O)Nc1ccc([N-]S(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)n1&",
"old_substring": "Cc1cc5no1"
} |
Can you make molecule Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)cnc1Cl | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)no1 | Cc1cc(OCC(=O)Nc2ccc([N-]S(C)(=O)=O)cc2)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cnc1Cl",
"old_substring": "Cc1cc5no1"
} |
Can you make molecule O=Cc1ccccc1OCCSc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccccc1-c1c(O)ccc(CCSc2ccc(Cl)cc2)c2noc1-2 | O=Cc1ccccc1OCCSc1ccc(Cl)cc1 | O=Cc1ccccc1-c1c(O)ccc(CCSc2ccc(Cl)cc2)c2noc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule O=Cc1ccccc1OCCSc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccccc1-c1ccc2c(c1)CN(CCSc1ccc(Cl)cc1)CCO2 | O=Cc1ccccc1OCCSc1ccc(Cl)cc1 | O=Cc1ccccc1-c1ccc2c(c1)CN(CCSc1ccc(Cl)cc1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule O=Cc1ccccc1OCCSc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccccc1-n1cnc2ccc-2cc(CCSc2ccc(Cl)cc2)c1=O | O=Cc1ccccc1OCCSc1ccc(Cl)cc1 | O=Cc1ccccc1-n1cnc2ccc-2cc(CCSc2ccc(Cl)cc2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule O=Cc1ccccc1OCCSc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccccc1-n1ccc2nc-2ccc(CCSc2ccc(Cl)cc2)c1=O | O=Cc1ccccc1OCCSc1ccc(Cl)cc1 | O=Cc1ccccc1-n1ccc2nc-2ccc(CCSc2ccc(Cl)cc2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule O=Cc1ccccc1OCCSc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccccc1-n1ccc2nc-2ncc(CCSc2ccc(Cl)cc2)c1=O | O=Cc1ccccc1OCCSc1ccc(Cl)cc1 | O=Cc1ccccc1-n1ccc2nc-2ncc(CCSc2ccc(Cl)cc2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | C=CSN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | C=CSN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | C=CCCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N(CCCCl)Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1 | CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | CC(=O)N(CCCCl)Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N(CCCCS)Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1 | CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | CC(=O)N(CCCCS)Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N(CCCBr)Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1 | CCN(Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1)C(C)=O | CC(=O)N(CCCBr)Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC6"
} |
Can you make molecule C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@@H]1NC(=O)CCCC(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)CCCC(=O)Nc1cccc(Cl)c1SCC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@@H]1NC(=O)CCC(=O)CNc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)CCC(=O)CNc1cccc(Cl)c1SCC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@@H]1NC[S@+]([O-])CCC(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC[S@+]([O-])CCC(=O)Nc1cccc(Cl)c1SCC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@@H]1NC(=O)CCCS(=O)(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)CCCS(=O)(=O)Nc1cccc(Cl)c1SCC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@@H]1NC(=O)C(C)(F)C(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)C(=O)Nc1cccc(Cl)c1SCC(F)F | C[C@H]1C[C@@H]1NC(=O)C(C)(F)C(=O)Nc1cccc(Cl)c1SCC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](CCC(CO)=Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | C[NH+](CCC(CO)=Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C3=O"
} |
Can you make molecule C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C/C(C[NH+](C)[C@H]1CCc2ccccc21)=N/ONc1ccc(OC(F)(F)F)cc1 | C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | C/C(C[NH+](C)[C@H]1CCc2ccccc21)=N/ONc1ccc(OC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C3=O"
} |
Can you make molecule C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNc1ccc(OC(F)(F)F)cc1)[NH+](C)[C@H]1CCc2ccccc21 | C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | CCC(CC)(C(=O)CNc1ccc(OC(F)(F)F)cc1)[NH+](C)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C3=O"
} |
Can you make molecule C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](SSC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | C[NH+](SSC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNc1ccc(OC(F)(F)F)cc1)[NH+](C)[C@H]1CCc2ccccc21 | C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)[C@H]1CCc2ccccc21 | CCC(CC)(C(=O)CCNc1ccc(OC(F)(F)F)cc1)[NH+](C)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C3=O"
} |
Can you make molecule COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | COCc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | COCSc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | CC(=O)Sc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | O=C(CS)c1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | COc1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | O=C(CI)c1cc2c(cc1NC(=O)[C@H]1COc3ccccc3O1)oc1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.