prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1C[NH2+]CCN(C(=O)C(C)C)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(C(=O)C(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C3(C)=O"
} |
Can you make molecule CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)N1CC[NH2+]C[C@@H](C(=O)NC)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 | C=C(C)C(=O)N1CC[NH2+]C[C@@H](C(=O)NC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C&=O",
"old_substring": "C3(C)=O"
} |
Can you make molecule CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1C[NH2+]CCN(C(=O)CC(C)C)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(C(=O)CC(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&=O",
"old_substring": "C3(C)=O"
} |
Can you make molecule CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1C[NH2+]CCN(SC(C)=O)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(SC(C)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "C3(C)=O"
} |
Can you make molecule CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@@H]1C[NH2+]CCN(C(C)C)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(C(C)=O)C1 | CNC(=O)[C@@H]1C[NH2+]CCN(C(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "C3(C)=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CC(C)(C)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | C[C@@H](NC(=O)CC(C)(C)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CCC(C)(C)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | C[C@@H](NC(=O)CCC(C)(C)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)C[C@@H](Br)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | C[C@@H](NC(=O)C[C@@H](Br)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N[C@H](C)C(C)(C)c2ccccc2)cc(=O)n1N1CCC[C@@H](O)C1 | C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | Cc1cc(N[C@H](C)C(C)(C)c2ccccc2)cc(=O)n1N1CCC[C@@H](O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N[C@H](C)C(C)(C)c2ccccc2)c(=O)ccn1N1CCC[C@@H](O)C1 | C[C@@H](NC(=O)N1CCC[C@@H](O)C1)C(C)(C)c1ccccc1 | Cc1c(N[C@H](C)C(C)(C)c2ccccc2)c(=O)ccn1N1CCC[C@@H](O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc2cc([N+](=O)[O-])ccc2s1)Nc1ccc2c(c1)OCCO2 | O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 | O=C(/C=C/Sc1cc2cc([N+](=O)[O-])ccc2s1)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2ccc3c(c2)OCCO3)nc1-c1cc2cc([N+](=O)[O-])ccc2s1 | O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 | O=Cc1sc(Nc2ccc3c(c2)OCCO3)nc1-c1cc2cc([N+](=O)[O-])ccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2ccc3c(c2)OCCO3)sc1-c1cc2cc([N+](=O)[O-])ccc2s1 | O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 | O=Cc1nc(Nc2ccc3c(c2)OCCO3)sc1-c1cc2cc([N+](=O)[O-])ccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc2c(c1)OCCO2)n1nc(-c2cc3cc([N+](=O)[O-])ccc3s2)oc1=S | O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 | O=C(Nc1ccc2c(c1)OCCO2)n1nc(-c2cc3cc([N+](=O)[O-])ccc3s2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1ccc2sc(-c3ccc(/C=N/ONc4ccc5c(c4)OCCO5)o3)cc2c1 | O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc([N+](=O)[O-])ccc2s1 | O=[N+]([O-])c1ccc2sc(-c3ccc(/C=N/ONc4ccc5c(c4)OCCO5)o3)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule CCn1nnnc1NCc1c(Cl)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCn1nnnc1C1=C(Cc2c(Cl)cccc2Cl)CN2CCC2=NO1 | CCn1nnnc1NCc1c(Cl)cccc1Cl | CCn1nnnc1C1=C(Cc2c(Cl)cccc2Cl)CN2CCC2=NO1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule CCn1nnnc1NCc1c(Cl)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCn1nnnc1C1=CC=C(Cc2c(Cl)cccc2Cl)N2CCC2=C1 | CCn1nnnc1NCc1c(Cl)cccc1Cl | CCn1nnnc1C1=CC=C(Cc2c(Cl)cccc2Cl)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule CCn1nnnc1NCc1c(Cl)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCn1nnnc1-c1snc2sc-2c(N)c1Cc1c(Cl)cccc1Cl | CCn1nnnc1NCc1c(Cl)cccc1Cl | CCn1nnnc1-c1snc2sc-2c(N)c1Cc1c(Cl)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N23"
} |
Can you make molecule CCn1nnnc1NCc1c(Cl)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCn1nnnc1C1=C(Cc2c(Cl)cccc2Cl)CN2CCN2N=N1 | CCn1nnnc1NCc1c(Cl)cccc1Cl | CCn1nnnc1C1=C(Cc2c(Cl)cccc2Cl)CN2CCN2N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCn2nnc&c2C1",
"old_substring": "N23"
} |
Can you make molecule CCn1nnnc1NCc1c(Cl)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCn1nnnc1C1=CC=C2SCCN2C(Cc2c(Cl)cccc2Cl)=C1 | CCn1nnnc1NCc1c(Cl)cccc1Cl | CCn1nnnc1C1=CC=C2SCCN2C(Cc2c(Cl)cccc2Cl)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "N23"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCCCNC(=O)CCc1nc(C2CC2)no1 | Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 | Cc1cc(F)ccc1CCCCNC(=O)CCc1nc(C2CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C4"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCCCCNC(=O)CCc1nc(C2CC2)no1 | Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 | Cc1cc(F)ccc1CCCCCNC(=O)CCc1nc(C2CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C4"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1C1CC(NC(=O)CCc2nc(C3CC3)no2)C1 | Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 | Cc1cc(F)ccc1C1CC(NC(=O)CCc2nc(C3CC3)no2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C4"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1C1CCN(NC(=O)CCc2nc(C3CC3)no2)CC1 | Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 | Cc1cc(F)ccc1C1CCN(NC(=O)CCc2nc(C3CC3)no2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C6C4"
} |
Can you make molecule Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1[C@@H](C)CCNC(=O)CCc1nc(C2CC2)no1 | Cc1cc(F)ccc1CCNC(=O)CCc1nc(C2CC2)no1 | Cc1cc(F)ccc1[C@@H](C)CCNC(=O)CCc1nc(C2CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6C4"
} |
Can you make molecule CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1Cl | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c15ccccc1"
} |
Can you make molecule CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccc(I)cc1 | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c15ccccc1"
} |
Can you make molecule CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccc(C)c(I)c1 | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccc(C)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c15ccccc1"
} |
Can you make molecule CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1cccc(Br)c1 | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c15ccccc1"
} |
Can you make molecule CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1cccc(C)c1C | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1 | CC[C@H](C(=O)Nc1cccc(CS(=O)(=O)c2ccccc2)c1)c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\O)c1ccccc1-c1cc(=O)n2ccccc2n1 | O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 | C/C(=N\O)c1ccccc1-c1cc(=O)n2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(=N\\O)c1ccccc1&",
"old_substring": "C3S(=O)(=O)c1ncccc1Cl"
} |
Can you make molecule O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C(=O)c1cc(=O)n2ccccc2n1)c1ccccc1 | O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 | C=C(C(=O)c1cc(=O)n2ccccc2n1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&=O)c1ccccc1",
"old_substring": "C3S(=O)(=O)c1ncccc1Cl"
} |
Can you make molecule O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C=C(Cc1cc(=O)n2ccccc2n1)c1ccccn1 | O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 | C=C(Cc1cc(=O)n2ccccc2n1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)c1ccccn1",
"old_substring": "C3S(=O)(=O)c1ncccc1Cl"
} |
Can you make molecule O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | CC/C(=N/O)c1ccc(-c2cc(=O)n3ccccc3n2)cc1 | O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 | CC/C(=N/O)c1ccc(-c2cc(=O)n3ccccc3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC/C(=N/O)c1ccc&cc1",
"old_substring": "C3S(=O)(=O)c1ncccc1Cl"
} |
Can you make molecule O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)c1ccc(-c2cc(=O)n3ccccc3n2)cc1 | O=c1cc(CS(=O)(=O)c2ncccc2Cl)nc2ccccn12 | C=C(C)c1ccc(-c2cc(=O)n3ccccc3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)c1ccc&cc1",
"old_substring": "C3S(=O)(=O)c1ncccc1Cl"
} |
Can you make molecule CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nncn1N1CCC2=CC2=CC=C1[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | CCc1nncn1N1CCC2=CC2=CC=C1[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C4C2"
} |
Can you make molecule CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nncn1N1CCSC2=CC=C2C=C1[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | CCc1nncn1N1CCSC2=CC=C2C=C1[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C4C2"
} |
Can you make molecule CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nncn1N1CCCC2=CC=CC2=C1[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | CCc1nncn1N1CCCC2=CC=CC2=C1[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cccc&c21",
"old_substring": "C4C2"
} |
Can you make molecule CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nncn1N1CCOC2=CC=C2C=C([NH2+][C@H](C)Cn2c[nH+]c(C)c2C)C1 | CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | CCc1nncn1N1CCOC2=CC=C2C=C([NH2+][C@H](C)Cn2c[nH+]c(C)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "C4C2"
} |
Can you make molecule CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nncn1N1CCCC2=CC2=CC=C([NH2+][C@H](C)Cn2c[nH+]c(C)c2C)C1 | CCc1nncn1CC[NH2+][C@H](C)Cn1c[nH+]c(C)c1C | CCc1nncn1N1CCCC2=CC2=CC=C([NH2+][C@H](C)Cn2c[nH+]c(C)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "C4C2"
} |
Can you make molecule COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | COCc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | COCSc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SC(C)=O)cc1[C@@H](O)Cc1[nH+]ccn1C | COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | COc1ccc(SC(C)=O)cc1[C@@H](O)Cc1[nH+]ccn1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CS)cc1[C@@H](O)Cc1[nH+]ccn1C | COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | COc1ccc(C(=O)CS)cc1[C@@H](O)Cc1[nH+]ccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CI)cc1[C@@H](O)Cc1[nH+]ccn1C | COc1ccc(OC)c([C@@H](O)Cc2[nH+]ccn2C)c1 | COc1ccc(C(=O)CI)cc1[C@@H](O)Cc1[nH+]ccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CC[NH+](CC)C[C@H]1CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH+](CC)C[C@H]1CC[NH2+]C1 | CC[NH+](CC)C[C@H]1CC[NH2+]C1 | C=CS[NH+](CC)C[C@H]1CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "C3C"
} |
Can you make molecule CC[NH+](CC)C[C@H]1CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH+](CC)C[C@H]1CC[NH2+]C1 | CC[NH+](CC)C[C@H]1CC[NH2+]C1 | C=CCC[NH+](CC)C[C@H]1CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "C3C"
} |
Can you make molecule CC[NH+](CC)C[C@H]1CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CCCCl)C[C@H]1CC[NH2+]C1 | CC[NH+](CC)C[C@H]1CC[NH2+]C1 | CC[NH+](CCCCl)C[C@H]1CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "C3C"
} |
Can you make molecule CC[NH+](CC)C[C@H]1CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CCCCS)C[C@H]1CC[NH2+]C1 | CC[NH+](CC)C[C@H]1CC[NH2+]C1 | CC[NH+](CCCCS)C[C@H]1CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "C3C"
} |
Can you make molecule CC[NH+](CC)C[C@H]1CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CCCBr)C[C@H]1CC[NH2+]C1 | CC[NH+](CC)C[C@H]1CC[NH2+]C1 | CC[NH+](CCCBr)C[C@H]1CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "C3C"
} |
Can you make molecule Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(OCC[NH+]2CCC([C@@H](C)c3ccc(S(N)(=O)=O)cc3)CC2)c1 | Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 | Cc1ccc(C)c(OCC[NH+]2CCC([C@@H](C)c3ccc(S(N)(=O)=O)cc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]56C"
} |
Can you make molecule Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(OCCC[NH+]2CCC([C@@H](C)c3ccc(S(N)(=O)=O)cc3)CC2)c1 | Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 | Cc1ccc(C)c(OCCC[NH+]2CCC([C@@H](C)c3ccc(S(N)(=O)=O)cc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]56C"
} |
Can you make molecule Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(OCC[NH+]2CC=C(C[C@@H](C)c3ccc(S(N)(=O)=O)cc3)CC2)c1 | Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 | Cc1ccc(C)c(OCC[NH+]2CC=C(C[C@@H](C)c3ccc(S(N)(=O)=O)cc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]56C"
} |
Can you make molecule Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(OCC[NH+]2Cc3cc([C@@H](C)c4ccc(S(N)(=O)=O)cc4)sc3C2)c1 | Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 | Cc1ccc(C)c(OCC[NH+]2Cc3cc([C@@H](C)c4ccc(S(N)(=O)=O)cc4)sc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]56C"
} |
Can you make molecule Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(OCC[NH+]2CCC[C@H]([C@@H](C)c3ccc(S(N)(=O)=O)cc3)CC2)c1 | Cc1ccc(C)c(OCC[NH+](C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 | Cc1ccc(C)c(OCC[NH+]2CCC[C@H]([C@@H](C)c3ccc(S(N)(=O)=O)cc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@H]&CC1",
"old_substring": "[NH+]56C"
} |
Can you make molecule C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Brc1ccccc1[C@@H]1C[C@@H]1C=C1CC[NH2+]C1 | C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br | Brc1ccccc1[C@@H]1C[C@@H]1C=C1CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=2CC[NH2+]C1",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | C.CCC([NH3+])(CC)[C@H]1C[C@H]1c1ccccc1Br | C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br | C.CCC([NH3+])(CC)[C@H]1C[C@H]1c1ccccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CCC3([NH3+])CC",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Brc1ccccc1[C@@H]1C[C@@H]1C=C1CC[NH2+]CC1 | C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br | Brc1ccccc1[C@@H]1C[C@@H]1C=C1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=2CC[NH2+]CC1",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | C.CC(C)([NH3+])C[C@H]1C[C@H]1c1ccccc1Br | C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br | C.CC(C)([NH3+])C[C@H]1C[C@H]1c1ccccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)([NH3+])C3",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | C.CCCC(C[NH3+])(CCC)[C@H]1C[C@H]1c1ccccc1Br | C[NH2+]C[C@H]1C[C@H]1c1ccccc1Br | C.CCCC(C[NH3+])(CCC)[C@H]1C[C@H]1c1ccccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CCCC3(C[NH3+])CCC",
"old_substring": "C[NH2+]2"
} |
Can you make molecule CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1[n-]c(-c2ccc3nc(SCc4ccccn4)sc3c2)c(Br)c1C#N | CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 | CS(=O)(=O)c1[n-]c(-c2ccc3nc(SCc4ccccn4)sc3c2)c(Br)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&[n-]c&c1Br",
"old_substring": "[N-]56"
} |
Can you make molecule CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCc1ccc2nc(SCc3ccccn3)sc2c1)S(C)(=O)=O | CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 | C[C@@H](CCc1ccc2nc(SCc3ccccn3)sc2c1)S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "[N-]56"
} |
Can you make molecule CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccc2nc(SCc3ccccn3)sc2c1)S(C)(=O)=O | CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 | CCC[C@@H](CCc1ccc2nc(SCc3ccccn3)sc2c1)S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "[N-]56"
} |
Can you make molecule CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)CC[C@H](Cl)c1ccc2nc(SCc3ccccn3)sc2c1 | CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 | CS(=O)(=O)CC[C@H](Cl)c1ccc2nc(SCc3ccccn3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "[N-]56"
} |
Can you make molecule CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)c1ccc2nc(SCc3ccccn3)sc2c1)S(C)(=O)=O | CS(=O)(=O)[N-]c1ccc2nc(SCc3ccccn3)sc2c1 | CC[C@@H](CC(=O)c1ccc2nc(SCc3ccccn3)sc2c1)S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&CC&=O",
"old_substring": "[N-]56"
} |
Can you make molecule COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1csc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)c1C | COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 | COC(=O)c1csc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1C",
"old_substring": "c15ccc8o1"
} |
Can you make molecule COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc2cc(CN3C(=O)N[C@H](Cc4ccccc4)C3=O)ccc2o1 | COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 | COC(=O)c1cc2cc(CN3C(=O)N[C@H](Cc4ccccc4)C3=O)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&ccc2o1",
"old_substring": "c15ccc8o1"
} |
Can you make molecule COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc2cc(CN3C(=O)N[C@H](Cc4ccccc4)C3=O)oc12 | COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 | COC(=O)c1cccc2cc(CN3C(=O)N[C@H](Cc4ccccc4)C3=O)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc2cc&oc12",
"old_substring": "c15ccc8o1"
} |
Can you make molecule COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc2c(CN3C(=O)N[C@H](Cc4ccccc4)C3=O)coc2c1 | COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 | COC(=O)c1ccc2c(CN3C(=O)N[C@H](Cc4ccccc4)C3=O)coc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c&coc2c1",
"old_substring": "c15ccc8o1"
} |
Can you make molecule COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)cc2occc12 | COC(=O)c1ccc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)o1 | COC(=O)c1cc(CN2C(=O)N[C@H](Cc3ccccc3)C2=O)cc2occc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2occc12",
"old_substring": "c15ccc8o1"
} |
Can you make molecule O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc2c(c1)NC(=O)[C@@H]1CCCCN21)NCCC[NH+]1CCCC1 | O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | O=C(/C=C/Sc1ccc2c(c1)NC(=O)[C@@H]1CCCCN21)NCCC[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCCC[NH+]2CCCC2)nc1-c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | O=Cc1sc(NCCC[NH+]2CCCC2)nc1-c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCCC[NH+]2CCCC2)sc1-c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | O=Cc1nc(NCCC[NH+]2CCCC2)sc1-c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1Nc2cc(-c3nn(C(=O)NCCC[NH+]4CCCC4)c(=S)o3)ccc2N2CCCC[C@@H]12 | O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | O=C1Nc2cc(-c3nn(C(=O)NCCC[NH+]4CCCC4)c(=S)o3)ccc2N2CCCC[C@@H]12 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1Nc2cc(-c3ccc(/C=N/ONCCC[NH+]4CCCC4)o3)ccc2N2CCCC[C@@H]12 | O=C(NCCC[NH+]1CCCC1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 | O=C1Nc2cc(-c3ccc(/C=N/ONCCC[NH+]4CCCC4)o3)ccc2N2CCCC[C@@H]12 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(CC(=O)SNCCc2ccccc2)cc1)NC1CC1 | O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 | O=C(Nc1ccc(CC(=O)SNCCc2ccccc2)cc1)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C59=O"
} |
Can you make molecule O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCC(=O)c1ccc(NC(=O)NC2CC2)cc1)NCCc1ccccc1 | O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 | O=C(CCCC(=O)c1ccc(NC(=O)NC2CC2)cc1)NCCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C59=O"
} |
Can you make molecule O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)NCCc1ccccc1)c1ccc(NC(=O)NC2CC2)cc1 | O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 | CC(C)(CC(=O)NCCc1ccccc1)c1ccc(NC(=O)NC2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C59=O"
} |
Can you make molecule O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)NCCc1ccccc1)c1ccc(NC(=O)NC2CC2)cc1 | O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 | CC(C)(CCC(=O)NCCc1ccccc1)c1ccc(NC(=O)NC2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C59=O"
} |
Can you make molecule O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNCCc1ccccc1)c1ccc(NC(=O)NC2CC2)cc1 | O=C(Nc1ccc(C(=O)NCCc2ccccc2)cc1)NC1CC1 | C[C@H](C(=O)SNCCc1ccccc1)c1ccc(NC(=O)NC2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C59=O"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=CC=C([NH2+][C@H]2CCC[C@@H](C)C2)N2CCC2=C1 | Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 | Cc1cscc1C1=CC=C([NH2+][C@H]2CCC[C@@H](C)C2)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C24"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1-c1ncnc2sc-2c(C)c1[NH2+][C@H]1CCC[C@@H](C)C1 | Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 | Cc1cscc1-c1ncnc2sc-2c(C)c1[NH2+][C@H]1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C24"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=CC=C2SCCN2C([NH2+][C@H]2CCC[C@@H](C)C2)=C1 | Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 | Cc1cscc1C1=CC=C2SCCN2C([NH2+][C@H]2CCC[C@@H](C)C2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C24"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=C2CCN2CC([NH2+][C@H]2CCC[C@@H](C)C2)=CC=C1 | Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 | Cc1cscc1C1=C2CCN2CC([NH2+][C@H]2CCC[C@@H](C)C2)=CC=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C24"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1-c1ccc([NH2+][C@H]2CCC[C@@H](C)C2)c(C)c2sc-2n1 | Cc1cscc1C[NH2+][C@H]1CCC[C@@H](C)C1 | Cc1cscc1-c1ccc([NH2+][C@H]2CCC[C@@H](C)C2)c(C)c2sc-2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2nc&ccc12",
"old_substring": "C24"
} |
Can you make molecule COc1ccc(C=CC2=[NH+]CCN2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=CC2=NOCC2)cc1 | COc1ccc(C=CC2=[NH+]CCN2)cc1 | COc1ccc(C=CC2=NOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1=NOCC1",
"old_substring": "C=4C1=[NH+]CCN1"
} |
Can you make molecule COc1ccc(C=CC2=[NH+]CCN2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=NC2=[NH+]CCCCC2)cc1 | COc1ccc(C=CC2=[NH+]CCN2)cc1 | COc1ccc(C=NC2=[NH+]CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C1=[NH+]CCCCC1",
"old_substring": "C=4C1=[NH+]CCN1"
} |
Can you make molecule COc1ccc(C=CC2=[NH+]CCN2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=C[C@H]2C=NC=N2)cc1 | COc1ccc(C=CC2=[NH+]CCN2)cc1 | COc1ccc(C=C[C@H]2C=NC=N2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&[C@H]1C=NC=N1",
"old_substring": "C=4C1=[NH+]CCN1"
} |
Can you make molecule COc1ccc(C=CC2=[NH+]CCN2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=CC2=NC=CC2)cc1 | COc1ccc(C=CC2=[NH+]CCN2)cc1 | COc1ccc(C=CC2=NC=CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1=NC=CC1",
"old_substring": "C=4C1=[NH+]CCN1"
} |
Can you make molecule COc1ccc(C=CC2=[NH+]CCN2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=CC2=CN=N[C@@H]2C)cc1 | COc1ccc(C=CC2=[NH+]CCN2)cc1 | COc1ccc(C=CC2=CN=N[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1N=NC=C1C&",
"old_substring": "C=4C1=[NH+]CCN1"
} |
Can you make molecule O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccccc1O)N1Cc2nc(C[C@H]3CCCC[C@H]3O)sc2C1 | O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O | O=C(Cc1ccccc1O)N1Cc2nc(C[C@H]3CCCC[C@H]3O)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccccc1O)N1Cc2cnn(C[C@H]3CCCC[C@H]3O)c2C1 | O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O | O=C(Cc1ccccc1O)N1Cc2cnn(C[C@H]3CCCC[C@H]3O)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccccc1O)N1CCc2noc(C[C@H]3CCCC[C@H]3O)c2C1 | O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O | O=C(Cc1ccccc1O)N1CCc2noc(C[C@H]3CCCC[C@H]3O)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccccc1O)N1CCCn2nc(C[C@H]3CCCC[C@H]3O)cc21 | O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O | O=C(Cc1ccccc1O)N1CCCn2nc(C[C@H]3CCCC[C@H]3O)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccccc1O)N1CCc2cc(C[C@H]3CCCC[C@H]3O)ccc21 | O=C(Cc1ccccc1O)NC[C@H]1CCCC[C@H]1O | O=C(Cc1ccccc1O)N1CCc2cc(C[C@H]3CCCC[C@H]3O)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CN(C(=O)c2cc(Br)c(F)cc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2cc(Br)c(F)cc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c14c(F)cccc1Cl"
} |
Can you make molecule O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CN(C(=O)c2cc(Br)ccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2cc(Br)ccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c14c(F)cccc1Cl"
} |
Can you make molecule O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CN(C(=O)c2sc3cc(F)ccc3c2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2sc3cc(F)ccc3c2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cc(F)ccc2c1Cl",
"old_substring": "c14c(F)cccc1Cl"
} |
Can you make molecule O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CN(C(=O)c2cc(Br)cc(Br)c2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2cc(Br)cc(Br)c2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc(Br)c1Cl",
"old_substring": "c14c(F)cccc1Cl"
} |
Can you make molecule O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CN(C(=O)c2sc3cccc(F)c3c2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2c(F)cccc2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | O=C1CN(C(=O)c2sc3cccc(F)c3c2Cl)[C@@H](c2ccccc2)c2cc(Cl)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cccc(F)c2c1Cl",
"old_substring": "c14c(F)cccc1Cl"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.