prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCCCC1 | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCCCCC1 | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCCC1",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1(C)C | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[NH+]1[C@@H](C)c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1 | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 | C[C@@H]1CCCC[NH+]1[C@@H](C)c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC[C@H]1C",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCC(C)(C)C1 | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCCC1 | C[C@@H](c1cccc(-c2ccc(C3(O)CC[NH2+]CC3)cc2)c1)[NH+]1CCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[C@@H]1COc2ccccc2O1)Nc1ccnn1Cc1ccc(Cl)cc1 | O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 | O=C(/C=C/S[C@@H]1COc2ccccc2O1)Nc1ccnn1Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2ccnn2Cc2ccc(Cl)cc2)nc1[C@@H]1COc2ccccc2O1 | O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 | O=Cc1sc(Nc2ccnn2Cc2ccc(Cl)cc2)nc1[C@@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2ccnn2Cc2ccc(Cl)cc2)sc1[C@@H]1COc2ccccc2O1 | O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 | O=Cc1nc(Nc2ccnn2Cc2ccc(Cl)cc2)sc1[C@@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/C[C@@H]1COc2ccccc2O1)Nc1ccnn1Cc1ccc(Cl)cc1 | O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 | O=C(N/N=C/C[C@@H]1COc2ccccc2O1)Nc1ccnn1Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(Cn2nccc2NON=C2CCN([C@@H]3COc4ccccc4O3)CC2)cc1 | O=C(Nc1ccnn1Cc1ccc(Cl)cc1)[C@@H]1COc2ccccc2O1 | Clc1ccc(Cn2nccc2NON=C2CCN([C@@H]3COc4ccccc4O3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C35"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCCCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C19CCC1"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)C=C1CCCCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)C=C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C19CCC1"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCCCCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C19CCC1"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(CC(=O)N[C@H]2CCCC[C@H]2CNC(=O)OC(C)(C)C)CCCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 | CC1(CC(=O)N[C@H]2CCCC[C@H]2CNC(=O)OC(C)(C)C)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C19CCC1"
} |
Can you make molecule CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCCCCCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCC1 | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1NC(=O)CC1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C19CCC1"
} |
Can you make molecule C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2Cl)cs1 | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2Cl)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c15ccncc1"
} |
Can you make molecule C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccccc2)cs1 | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c15ccncc1"
} |
Can you make molecule C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2cnccc2Cl)cs1 | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2cnccc2Cl)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c15ccncc1"
} |
Can you make molecule C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2cc(Br)ncc2F)cs1 | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2cc(Br)ncc2F)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c15ccncc1"
} |
Can you make molecule C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2csc([C@@H](C)N[C@H]3CCCSc4ccccc43)n2)ncc1Br | C[C@@H](N[C@H]1CCCSc2ccccc21)c1nc(-c2ccncc2)cs1 | Cc1cc(-c2csc([C@@H](C)N[C@H]3CCCSc4ccccc43)n2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "c15ccncc1"
} |
Can you make molecule CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(I)=C1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | CC(I)=C1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&I",
"old_substring": "CC5"
} |
Can you make molecule CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | C=CCCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | ClCCCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | ClCCCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | SCCCCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | SCCCCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(Br)=C1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | CCC1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | CC(Br)=C1CCC(C[NH2+][C@@H]2CCC[C@H]2[C@@H]2CCCC[NH2+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&Br",
"old_substring": "CC5"
} |
Can you make molecule CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(n2c(=C(C#N)C#N)s/c(=C/c3ccccn3)c2=O)C1 | CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | CC1CC(n2c(=C(C#N)C#N)s/c(=C/c3ccccn3)c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | CC(C)CCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C#N)=c1s/c(=C/c2ccccn2)c(=O)n1CCCCBr | CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | N#CC(C#N)=c1s/c(=C/c2ccccn2)c(=O)n1CCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | C=CCCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C#N)=c1s/c(=C/c2ccccn2)c(=O)n1CCCCCl | CCCn1c(=C(C#N)C#N)s/c(=C/c2ccccn2)c1=O | N#CC(C#N)=c1s/c(=C/c2ccccn2)c(=O)n1CCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC3"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(CC(N)=O)CCN(C(=O)c2ccc3cc[nH]c3c2)C1 | CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 | CC(C)C1(CC(N)=O)CCN(C(=O)c2ccc3cc[nH]c3c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N345"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(CC(N)=O)CCCN(C(=O)c2ccc3cc[nH]c3c2)C1 | CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 | CC(C)C1(CC(N)=O)CCCN(C(=O)c2ccc3cc[nH]c3c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N345"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1oc(C(=O)c2ccc3cc[nH]c3c2)c(C#N)c1CC(N)=O | CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 | CC(C)c1oc(C(=O)c2ccc3cc[nH]c3c2)c(C#N)c1CC(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N345"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(CC(N)=O)CCC(=O)N(C(=O)c2ccc3cc[nH]c3c2)C1 | CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 | CC(C)C1(CC(N)=O)CCC(=O)N(C(=O)c2ccc3cc[nH]c3c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N345"
} |
Can you make molecule CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@]1(CC(N)=O)CCCN(C(=O)c2ccc3cc[nH]c3c2)C1 | CC(C)N(CC(N)=O)C(=O)c1ccc2cc[nH]c2c1 | CC(C)[C@@]1(CC(N)=O)CCCN(C(=O)c2ccc3cc[nH]c3c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N345"
} |
Can you make molecule C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC2CC[NH+](CC2)CC1=O.Cc1nsc(N)c1C(=O)[O-] | C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] | C[C@H]1CC2CC[NH+](CC2)CC1=O.Cc1nsc(N)c1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[NH+]2CCC=C(CC1=O)C2.Cc1nsc(N)c1C(=O)[O-] | C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] | C[C@H]1C[NH+]2CCC=C(CC1=O)C2.Cc1nsc(N)c1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCC[NH+]&C1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[NH+]2CCC(C)(CC2)C1=O.Cc1nsc(N)c1C(=O)[O-] | C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] | C[C@H]1C[NH+]2CCC(C)(CC2)C1=O.Cc1nsc(N)c1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CC[NH+]&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC2(C)CC[NH+](CC2)CC1=O.Cc1nsc(N)c1C(=O)[O-] | C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] | C[C@H]1CC2(C)CC[NH+](CC2)CC1=O.Cc1nsc(N)c1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&(C)CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC2CC[NH+](CC2)C1=O.Cc1nsc(N)c1C(=O)[O-] | C[NH2+]C[C@H](C)C(=O)Nc1snc(C)c1C(=O)[O-] | C[C@H]1CC2CC[NH+](CC2)C1=O.Cc1nsc(N)c1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1NCCC(CO)=Nc1cccc(S(=O)(=O)N2CCCC2)c1 | Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 | Cc1ccc(Cl)cc1NCCC(CO)=Nc1cccc(S(=O)(=O)N2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C4C3=O"
} |
Can you make molecule Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CNc1cc(Cl)ccc1C)=N/ONc1cccc(S(=O)(=O)N2CCCC2)c1 | Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 | C/C(CNc1cc(Cl)ccc1C)=N/ONc1cccc(S(=O)(=O)N2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C4C3=O"
} |
Can you make molecule Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Nc1cc(Cl)ccc1C)C(=O)CNc1cccc(S(=O)(=O)N2CCCC2)c1 | Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 | CCC(CC)(Nc1cc(Cl)ccc1C)C(=O)CNc1cccc(S(=O)(=O)N2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C3=O"
} |
Can you make molecule Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1NSSC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 | Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 | Cc1ccc(Cl)cc1NSSC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Nc1cc(Cl)ccc1C)C(=O)CCNc1cccc(S(=O)(=O)N2CCCC2)c1 | Cc1ccc(Cl)cc1NCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 | CCC(CC)(Nc1cc(Cl)ccc1C)C(=O)CCNc1cccc(S(=O)(=O)N2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4C3=O"
} |
Can you make molecule CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CSCc1ccnc(NC2CCC(C(=O)c3cnccn3)CC2)c1 | CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 | CSCc1ccnc(NC2CCC(C(=O)c3cnccn3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CSCc1ccnc(NC2CCC(C)(C(=O)c3cnccn3)CC2)c1 | CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 | CSCc1ccnc(NC2CCC(C)(C(=O)c3cnccn3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CSCc1ccnc(NC2(C#N)CCC(C(=O)c3cnccn3)CC2)c1 | CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 | CSCc1ccnc(NC2(C#N)CCC(C(=O)c3cnccn3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CSCc1ccnc(NCCCCCC(=O)c2cnccn2)c1 | CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 | CSCc1ccnc(NCCCCCC(=O)c2cnccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CSCc1ccnc(NN2CCC=C(CC(=O)c3cnccn3)C2)c1 | CSCc1ccnc(NC2CCN(C(=O)c3cnccn3)CC2)c1 | CSCc1ccnc(NN2CCC=C(CC(=O)c3cnccn3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)C(C)(C)N1CCOCC1 | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)C(C)(C)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C3[C@@H](O)C4"
} |
Can you make molecule C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[NH+](C)Cc1c[nH]nc1-c1ccccc1)C(=O)N1CCOCC1 | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 | C[C@H](C[NH+](C)Cc1c[nH]nc1-c1ccccc1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C3[C@@H](O)C4"
} |
Can you make molecule C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@H](S)CN1CCOCC1 | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@H](S)CN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](S)C&",
"old_substring": "C3[C@@H](O)C4"
} |
Can you make molecule C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC[NH+](C)Cc1c[nH]nc1-c1ccccc1)CC(=O)N1CCOCC1 | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 | C[C@@H](CC[NH+](C)Cc1c[nH]nc1-c1ccccc1)CC(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C3[C@@H](O)C4"
} |
Can you make molecule C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)[NH+](C)Cc1c[nH]nc1-c1ccccc1)C(=O)N1CCOCC1 | C[NH+](Cc1c[nH]nc1-c1ccccc1)C[C@@H](O)CN1CCOCC1 | C[C@@H](CC(=O)[NH+](C)Cc1c[nH]nc1-c1ccccc1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C3[C@@H](O)C4"
} |
Can you make molecule CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O | CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O | C=CCC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "C4C"
} |
Can you make molecule CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1C(=O)N[C@H](CCCCl)C(=O)N1Cc1cscc1C | CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O | CC[C@H]1C(=O)N[C@H](CCCCl)C(=O)N1Cc1cscc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "C4C"
} |
Can you make molecule CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1C(=O)N[C@H](CCCCS)C(=O)N1Cc1cscc1C | CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O | CC[C@H]1C(=O)N[C@H](CCCCS)C(=O)N1Cc1cscc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "C4C"
} |
Can you make molecule CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1C(=O)N[C@H](CCCBr)C(=O)N1Cc1cscc1C | CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O | CC[C@H]1C(=O)N[C@H](CCCBr)C(=O)N1Cc1cscc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "C4C"
} |
Can you make molecule CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1C(=O)N[C@H](CCCCF)C(=O)N1Cc1cscc1C | CC[C@H]1NC(=O)[C@H](CC)N(Cc2cscc2C)C1=O | CC[C@H]1C(=O)N[C@H](CCCCF)C(=O)N1Cc1cscc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "C4C"
} |
Can you make molecule CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC(=O)C=NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | CC(=CC(=O)C=NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C(=O)C=&",
"old_substring": "C=5C3=O"
} |
Can you make molecule CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C=C(C)NNC(=O)Cc1cccc2ccccc12)C(=O)NC[C@H]1CCCO1 | CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | C=C(C=C(C)NNC(=O)Cc1cccc2ccccc12)C(=O)NC[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "C=5C3=O"
} |
Can you make molecule CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(NNC(=O)Cc1cccc2ccccc12)=[SH]C1=NC(=O)C(=NC[C@H]2CCCO2)S1 | CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | CC(NNC(=O)Cc1cccc2ccccc12)=[SH]C1=NC(=O)C(=NC[C@H]2CCCO2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NC(=O)C=&S1",
"old_substring": "C=5C3=O"
} |
Can you make molecule CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(NNC(=O)Cc1cccc2ccccc12)=[SH]C1=NC(=NC[C@H]2CCCO2)C(=O)S1 | CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | CC(NNC(=O)Cc1cccc2ccccc12)=[SH]C1=NC(=NC[C@H]2CCCO2)C(=O)S1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NC=&C(=O)S1",
"old_substring": "C=5C3=O"
} |
Can you make molecule CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CCCC(C)=NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | CC(=CC(=O)NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | CC(=CCCC(C)=NC[C@H]1CCCO1)NNC(=O)Cc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCC=&C",
"old_substring": "C=5C3=O"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)c(Cl)c2C)cc1 | COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 | COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)c(Cl)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc&c(Cl)c1C",
"old_substring": "n18nc7cc1C"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2ccn(C(=O)N[C@H](C)[C@H](CO)SC)c2=S)cc1 | COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 | COc1ccc(-n2ccn(C(=O)N[C@H](C)[C@H](CO)SC)c2=S)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccn&c1=S",
"old_substring": "n18nc7cc1C"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2ncc(C(=O)N[C@H](C)[C@H](CO)SC)c(Cl)c2=O)cc1 | COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 | COc1ccc(-n2ncc(C(=O)N[C@H](C)[C@H](CO)SC)c(Cl)c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ncc&c(Cl)c1=O",
"old_substring": "n18nc7cc1C"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2cc(C(=O)N[C@H](C)[C@H](CO)SC)c(=O)cc2C)cc1 | COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 | COc1ccc(-n2cc(C(=O)N[C@H](C)[C@H](CO)SC)c(=O)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&c(=O)cc1C",
"old_substring": "n18nc7cc1C"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2cc(C(=O)N[C@H](C)[C@H](CO)SC)cc2Br)cc1 | COc1ccc(-n2nc(C(=O)N[C@H](C)[C@H](CO)SC)cc2C)cc1 | COc1ccc(-n2cc(C(=O)N[C@H](C)[C@H](CO)SC)cc2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&cc1Br",
"old_substring": "n18nc7cc1C"
} |
Can you make molecule Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(CC(=O)SNc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(CC(=O)SNc2ccc(Oc3ccccc3)cn2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(=O)CCCC(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(C(=O)CCCC(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(C)(C)CC(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(C(C)(C)CC(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(C)(C)CCC(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(C(C)(C)CCC(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c([C@H](C)C(=O)SNc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cn2)o1 | Cc1nc(C)c([C@H](C)C(=O)SNc2ccc(Oc3ccccc3)cn2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C[C@@H](C(=O)Nc3nc(-c4sc(C)nc4C)co3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nc(-c4sc(C)nc4C)co3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c16nnc9o1"
} |
Can you make molecule Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C[C@@H](C(=O)Nc3nn(-c4sc(C)nc4C)c(=S)o3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nn(-c4sc(C)nc4C)c(=S)o3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)o1",
"old_substring": "c16nnc9o1"
} |
Can you make molecule Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C[C@@H](C(=O)Nc3cc(-c4sc(C)nc4C)on3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3cc(-c4sc(C)nc4C)on3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&on1",
"old_substring": "c16nnc9o1"
} |
Can you make molecule Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C[C@@H](C(=O)Nc3nc(C)c(-c4sc(C)nc4C)o3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nc(C)c(-c4sc(C)nc4C)o3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c&o1",
"old_substring": "c16nnc9o1"
} |
Can you make molecule Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C[C@@H](C(=O)Nc3nn(-c4sc(C)nc4C)c(=S)s3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(-c4sc(C)nc4C)o3)CC2=O)cc1 | Cc1ccc(N2C[C@@H](C(=O)Nc3nn(-c4sc(C)nc4C)c(=S)s3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)s1",
"old_substring": "c16nnc9o1"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(SC(=O)COc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(SC(=O)COc2ccc(Nc3ccccc3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(C(=O)CCCC(=O)Oc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C(=O)CCCC(=O)Oc2ccc(Nc3ccccc3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(C(=O)CC(C)(C)Oc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C(=O)CC(C)(C)Oc2ccc(Nc3ccccc3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(C[S@+]([O-])CCCOc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C[S@+]([O-])CCCOc2ccc(Nc3ccccc3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(C(=O)CCC(C)(C)Oc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C(=O)COc2ccc(Nc3ccccc3)cc2)C1 | C[C@@H]1CCCN(C(=O)CCC(C)(C)Oc2ccc(Nc3ccccc3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C5"
} |
Can you make molecule COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1NC(=O)C(=O)Nc1c3c(nn1-c1ccccc1C)CSC3)CC(OC)C2 | COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC | COc1cc2c(cc1NC(=O)C(=O)Nc1c3c(nn1-c1ccccc1C)CSC3)CC(OC)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&Cc2cc&c&cc2C1",
"old_substring": "C56C7"
} |
Can you make molecule COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CC[C@@](NC(=O)C(=O)Nc2c3c(nn2-c2ccccc2C)CSC3)(OC)C1 | COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC | CO[C@H]1CC[C@@](NC(=O)C(=O)Nc2c3c(nn2-c2ccccc2C)CSC3)(OC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "C56C7"
} |
Can you make molecule COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CC[C@](NC(=O)C(=O)Nc2c3c(nn2-c2ccccc2C)CSC3)(OC)C1 | COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC | CO[C@H]1CC[C@](NC(=O)C(=O)Nc2c3c(nn2-c2ccccc2C)CSC3)(OC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "C56C7"
} |
Can you make molecule COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC less soluble in water? The output molecule should be similar to the input molecule. | COc1sc2c(c1NC(=O)C(=O)Nc1c3c(nn1-c1ccccc1C)CSC3)CCN(OC)C2 | COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC | COc1sc2c(c1NC(=O)C(=O)Nc1c3c(nn1-c1ccccc1C)CSC3)CCN(OC)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c(sc&c2&)C1",
"old_substring": "C56C7"
} |
Can you make molecule COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC less soluble in water? The output molecule should be similar to the input molecule. | COCCC[C@H](OC)C(C)(C)NC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2 | COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2)OC | COCCC[C@H](OC)C(C)(C)NC(=O)C(=O)Nc1c2c(nn1-c1ccccc1C)CSC2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "C56C7"
} |
Can you make molecule CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nnc(SCn3cc([N+](=O)[O-])cn3)n2C2CC(C)C2)cs1 | CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 | Cc1cc(-c2nnc(SCn3cc([N+](=O)[O-])cn3)n2C2CC(C)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nnc(SCn3cc([N+](=O)[O-])cn3)n2CCC(C)C)cs1 | CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 | Cc1cc(-c2nnc(SCn3cc([N+](=O)[O-])cn3)n2CCC(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nnc(SCn3cc([N+](=O)[O-])cn3)n2CCCCBr)cs1 | CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 | Cc1cc(-c2nnc(SCn3cc([N+](=O)[O-])cn3)n2CCCCBr)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 | CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 | C=CCCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nnc(SCn3cc([N+](=O)[O-])cn3)n2CCCCCl)cs1 | CCCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1csc(C)c1 | Cc1cc(-c2nnc(SCn3cc([N+](=O)[O-])cn3)n2CCCCCl)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC3"
} |
Can you make molecule CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2I)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2Br)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)c(I)c2)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)c(I)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2cc(Cl)ccc2Cl)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2cc(Cl)ccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@](C)(CO)NC(=O)Nc1cnn(C=Cc2ccc(Cl)cc2)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1 | CCC[C@](C)(CO)NC(=O)Nc1cnn(C=Cc2ccc(Cl)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(Cl)cc1",
"old_substring": "c18ccc(Cl)cc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.