prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CCc1onc(C)c1NSC(=O)Cc1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NSC(=O)Cc1c(C)oc(-n2cccc2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CCc1onc(C)c1NC(=O)CCCC(=O)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NC(=O)CCCC(=O)c1c(C)oc(-n2cccc2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CCc1onc(C)c1NC(=O)CC(C)(C)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NC(=O)CC(C)(C)c1c(C)oc(-n2cccc2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CCc1onc(C)c1NC(=O)CCC(C)(C)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NC(=O)CCC(C)(C)c1c(C)oc(-n2cccc2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N less soluble in water? The output molecule should be similar to the input molecule. | CCc1onc(C)c1NSC(=O)[C@@H](C)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NC(=O)c1c(C)oc(-n2cccc2)c1C#N | CCc1onc(C)c1NSC(=O)[C@@H](C)c1c(C)oc(-n2cccc2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2scc(C)n2c1CCCCNc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1CCCCNc1ccc(C(=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C36"
} |
Can you make molecule Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2scc(C)n2c1CCC=Nc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1CCC=Nc1ccc(C(=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C36"
} |
Can you make molecule Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2scc(C)n2c1CCCCCNc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1CCCCCNc1ccc(C(=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C36"
} |
Can you make molecule Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2scc(C)n2c1C1CC(Nc2ccc(C(=O)[O-])cc2)C1 | Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1C1CC(Nc2ccc(C(=O)[O-])cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C36"
} |
Can you make molecule Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2scc(C)n2c1SC(=S)ONc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1CNc1ccc(C(=O)[O-])cc1 | Cc1nc2scc(C)n2c1SC(=S)ONc1ccc(C(=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C36"
} |
Can you make molecule C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](N)(C(=O)CCC1=CCC[C@@H]1CCC(=O)[O-])C(F)(F)F | C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F | C[C@@](N)(C(=O)CCC1=CCC[C@@H]1CCC(=O)[O-])C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "N12CCCC[C@@H]13"
} |
Can you make molecule C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCCCC(=O)[O-])C(=O)[C@@](C)(N)C(F)(F)F | C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F | CCCC[C@@H](CCCCC(=O)[O-])C(=O)[C@@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "N12CCCC[C@@H]13"
} |
Can you make molecule C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](N)(C(=O)[C@H]1CCC[C@H](CCC(=O)[O-])C1)C(F)(F)F | C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F | C[C@@](N)(C(=O)[C@H]1CCC[C@H](CCC(=O)[O-])C1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "N12CCCC[C@@H]13"
} |
Can you make molecule C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](N)(C(=O)CC[C@H](Cl)CCC(=O)[O-])C(F)(F)F | C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F | C[C@@](N)(C(=O)CC[C@H](Cl)CCC(=O)[O-])C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "N12CCCC[C@@H]13"
} |
Can you make molecule C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@](N)(C(=O)[C@H]1CCCC[C@H](CCC(=O)[O-])C1)C(F)(F)F | C[C@@](N)(C(=O)N1CCCC[C@@H]1CCC(=O)[O-])C(F)(F)F | C[C@@](N)(C(=O)[C@H]1CCCC[C@H](CCC(=O)[O-])C1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "N12CCCC[C@@H]13"
} |
Can you make molecule COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(Cl)cc1C(=O)N/N=C(\C)c1ccc(OC)c(OC)c1 | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC | COCc1ccc(Cl)cc1C(=O)N/N=C(\C)c1ccc(OC)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "O4C"
} |
Can you make molecule COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2C(=O)F)cc1OC | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2C(=O)F)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O=C&F",
"old_substring": "O4C"
} |
Can you make molecule COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(Cl)cc1C(=O)N/N=C(\C)c1ccc(OC)c(OC)c1 | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC | COCSc1ccc(Cl)cc1C(=O)N/N=C(\C)c1ccc(OC)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "O4C"
} |
Can you make molecule COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OCCl)cc1OC | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OCCl)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O&CCl",
"old_substring": "O4C"
} |
Can you make molecule COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2C(=O)Cl)cc1OC | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2OC)cc1OC | COc1ccc(/C(C)=N/NC(=O)c2cc(Cl)ccc2C(=O)Cl)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O=C&Cl",
"old_substring": "O4C"
} |
Can you make molecule O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OC(=S)SCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 | O=C(OC(=S)SCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SCc1cc([N+](=O)[O-])cc2c1OCOC2)C(=O)c1cnc2ccccc2n1 | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 | O=C(/C=C/SCc1cc([N+](=O)[O-])cc2c1OCOC2)C(=O)c1cnc2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cnc2ccccc2n1)[C@H](O)CCCCc1cc([N+](=O)[O-])cc2c1OCOC2 | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 | O=C(c1cnc2ccccc2n1)[C@H](O)CCCCc1cc([N+](=O)[O-])cc2c1OCOC2 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "O34"
} |
Can you make molecule O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(C(=O)c2cnc3ccccc3n2)nc1Cc1cc([N+](=O)[O-])cc2c1OCOC2 | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 | O=Cc1sc(C(=O)c2cnc3ccccc3n2)nc1Cc1cc([N+](=O)[O-])cc2c1OCOC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O34"
} |
Can you make molecule O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(C(=O)c2cnc3ccccc3n2)sc1Cc1cc([N+](=O)[O-])cc2c1OCOC2 | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cnc2ccccc2n1 | O=Cc1nc(C(=O)c2cnc3ccccc3n2)sc1Cc1cc([N+](=O)[O-])cc2c1OCOC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O34"
} |
Can you make molecule CCSc1nnc2n(N)c(=O)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | C=CSSc1nnc2n(N)c(=O)c3ccccc3n12 | CCSc1nnc2n(N)c(=O)c3ccccc3n12 | C=CSSc1nnc2n(N)c(=O)c3ccccc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCSc1nnc2n(N)c(=O)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCSc1nnc2n(N)c(=O)c3ccccc3n12 | CCSc1nnc2n(N)c(=O)c3ccccc3n12 | C=CCCSc1nnc2n(N)c(=O)c3ccccc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCSc1nnc2n(N)c(=O)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | Nn1c(=O)c2ccccc2n2c(SCCCCl)nnc12 | CCSc1nnc2n(N)c(=O)c3ccccc3n12 | Nn1c(=O)c2ccccc2n2c(SCCCCl)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCSc1nnc2n(N)c(=O)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | Nn1c(=O)c2ccccc2n2c(SCCCCS)nnc12 | CCSc1nnc2n(N)c(=O)c3ccccc3n12 | Nn1c(=O)c2ccccc2n2c(SCCCCS)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCSc1nnc2n(N)c(=O)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | Nn1c(=O)c2ccccc2n2c(SCCCBr)nnc12 | CCSc1nnc2n(N)c(=O)c3ccccc3n12 | Nn1c(=O)c2ccccc2n2c(SCCCBr)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | COCc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | COCSc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | CC(=O)Sc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2sc(NC(=O)c3cnc(C(=O)CS)nc3)nc2cc1Cl | COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | Cc1cc2sc(NC(=O)c3cnc(C(=O)CS)nc3)nc2cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2sc(NC(=O)c3cnc(C(=O)CI)nc3)nc2cc1Cl | COc1ncc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cn1 | Cc1cc2sc(NC(=O)c3cnc(C(=O)CI)nc3)nc2cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCN(SC(=O)CC23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(SC(=O)CC23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCN(CC(=C=O)CC23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(CC(=C=O)CC23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCN(C(=O)CCCC(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(C(=O)CCCC(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C57=O"
} |
Can you make molecule CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCN(C(=O)CC(C)(C)C23CC4CC(CC(C(=O)N5CCC(C)(C)C5)(C4)C2)C3)C1 | CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(C(=O)CC(C)(C)C23CC4CC(CC(C(=O)N5CCC(C)(C)C5)(C4)C2)C3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCN(C[S@+]([O-])CCCC23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(C(=O)C23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | CC1(C)CCN(C[S@+]([O-])CCCC23CC4CC(C2)CC(C(=O)N2CCC(C)(C)C2)(C4)C3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C57=O"
} |
Can you make molecule CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH2+]CCCCN1CCCS1(=O)=O)c1ccc(OC)cc1 | CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 | CC[C@@H]([NH2+]CCCCN1CCCS1(=O)=O)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH2+]CCCCCN1CCCS1(=O)=O)c1ccc(OC)cc1 | CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 | CC[C@@H]([NH2+]CCCCCN1CCCS1(=O)=O)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH2+]C1CC(N2CCCS2(=O)=O)C1)c1ccc(OC)cc1 | CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 | CC[C@@H]([NH2+]C1CC(N2CCCS2(=O)=O)C1)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH2+][C@@H](C)CCN1CCCS1(=O)=O)c1ccc(OC)cc1 | CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 | CC[C@@H]([NH2+][C@@H](C)CCN1CCCS1(=O)=O)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH2+]C1CCC(N2CCCS2(=O)=O)CC1)c1ccc(OC)cc1 | CC[C@@H]([NH2+]CCN1CCCS1(=O)=O)c1ccc(OC)cc1 | CC[C@@H]([NH2+]C1CCC(N2CCCS2(=O)=O)CC1)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCSC[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F | CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F | CC1(C)CCSC[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCSC[C@@H]1&",
"old_substring": "CC1(C)C[C@@H]13"
} |
Can you make molecule CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@]1(C#N)NC(=O)[C@@](C)(N)C(F)(F)F | CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F | CC1(C)CCC[C@]1(C#N)NC(=O)[C@@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC[C@@]1&C#N",
"old_substring": "CC1(C)C[C@@H]13"
} |
Can you make molecule CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H](C)NC(=O)[C@@](C)(N)C(F)(F)F | CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F | CC(C)CC[C@H](C)NC(=O)[C@@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC[C@@H]&C",
"old_substring": "CC1(C)C[C@@H]13"
} |
Can you make molecule CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(NC(=O)[C@@](C)(N)C(F)(F)F)CC1 | CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F | CC1(C)CCC(NC(=O)[C@@](C)(N)C(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC1(C)C[C@@H]13"
} |
Can you make molecule CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCC[C@H](C)NC(=O)[C@@](C)(N)C(F)(F)F | CC1(C)C[C@@H]1NC(=O)[C@@](C)(N)C(F)(F)F | CC(C)CCC[C@H](C)NC(=O)[C@@](C)(N)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC[C@@H]&C",
"old_substring": "CC1(C)C[C@@H]13"
} |
Can you make molecule Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCCCC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CCOCC1"
} |
Can you make molecule Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCCCCC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CCOCC1"
} |
Can you make molecule Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CSCCSC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CSCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C16CCOCC1"
} |
Can you make molecule Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CC(C)C1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CC(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "C16CCOCC1"
} |
Can you make molecule Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1(C)CCCC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1CCOCC1 | Cc1ccccc1C(C)(C)CNC(=O)NC[C@@H](O)C1(C)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C16CCOCC1"
} |
Can you make molecule Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2ccccc2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c17ccccn1"
} |
Can you make molecule Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccc(I)cn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2ccc(I)cn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cn1",
"old_substring": "c17ccccn1"
} |
Can you make molecule Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2cccc(Cl)n2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2cccc(Cl)n2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Cl)n1",
"old_substring": "c17ccccn1"
} |
Can you make molecule Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2cc(Br)ccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2cc(Br)ccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccn1",
"old_substring": "c17ccccn1"
} |
Can you make molecule Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2cc3sccn3c2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2ccccn2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | Cc1nn(-c2cc3sccn3c2)c(C)c1N1CCN(C(=O)Cn2ccc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccn2c1",
"old_substring": "c17ccccn1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.Clc1ccccc1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.Clc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.c1cc2ccsc2o1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.c1cc2ccsc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccoc2s1",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.c1cc2sccc2s1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.c1cc2sccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.Ic1ccccc1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.Ic1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.c1ccc2sccc2c1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCNCC3)ncn2)c1.c1ccc2sccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2ccccc12",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(CC(F)(F)F)cc1 | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(CC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)F",
"old_substring": "O2C(F)(F)F"
} |
Can you make molecule O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(SC(F)(F)F)cc1 | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(SC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "O2C(F)(F)F"
} |
Can you make molecule O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc([C@@H](O)CCC(F)(F)F)cc1 | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc([C@@H](O)CCC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CCC(F)(F)F",
"old_substring": "O2C(F)(F)F"
} |
Can you make molecule O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(CCCC(F)(F)F)cc1 | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(CCCC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "O2C(F)(F)F"
} |
Can you make molecule O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(S(=O)(=O)[N-]c2ccccc2-n2cnnn2)cc1)C(F)(F)C(F)(F)F | O=S(=O)([N-]c1ccccc1-n1cnnn1)c1ccc(OC(F)(F)F)cc1 | O=C(c1ccc(S(=O)(=O)[N-]c2ccccc2-n2cnnn2)cc1)C(F)(F)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C(F)(F)C(F)(F)F",
"old_substring": "O2C(F)(F)F"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NC(=O)C2=C(N=Cc3ccccc3)CCS2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)C2=C(N=Cc3ccccc3)CCS2)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C3(=O)C=5C#N"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NC(=O)C(N=Cc2ccccc2)=C(Cl)Cl)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)C(N=Cc2ccccc2)=C(Cl)Cl)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C3(=O)C=5C#N"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](N=C/C=C/N=Cc2ccccc2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C | C[C@H]1[C@@H](N=C/C=C/N=Cc2ccccc2)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&/C=C/N&",
"old_substring": "C3(=O)C=5C#N"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NSC(=O)C=Cc2ccccc2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C | C[C@H]1[C@@H](NSC(=O)C=Cc2ccccc2)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C=5C#N"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](NC[S@+]([O-])CCC=Cc2ccccc2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)C(C#N)=Cc2ccccc2)CCC[C@@H]1C | C[C@H]1[C@@H](NC[S@+]([O-])CCC=Cc2ccccc2)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C=5C#N"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NSC(=O)Cc1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NSC(=O)Cc1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)CCCC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NC(=O)CCCC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)CC(C)(C)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NC(=O)CC(C)(C)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)CCC(C)(C)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NC(=O)CCC(C)(C)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NSC(=O)[C@@H](C)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NC(=O)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | COc1ccc(C)cc1NSC(=O)[C@@H](C)c1cn(-c2ccc(C)c(C)c2)c(=O)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nc1)c1ccccc1 | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nc1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1",
"old_substring": "c19ccc8nn1"
} |
Can you make molecule CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)n1C)c1ccccc1 | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)n1C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&n1C",
"old_substring": "c19ccc8nn1"
} |
Can you make molecule CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nc1C)c1ccccc1 | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nc1C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c19ccc8nn1"
} |
Can you make molecule CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CSc1ccn(-n2nc3c(c2C)CCC3)c1)c1ccccc1 | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 | CCN(C(=O)CSc1ccn(-n2nc3c(c2C)CCC3)c1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c19ccc8nn1"
} |
Can you make molecule CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CSc1ccc2nc(-n3nc4c(c3C)CCC4)cn2c1)c1ccccc1 | CCN(C(=O)CSc1ccc(-n2nc3c(c2C)CCC3)nn1)c1ccccc1 | CCN(C(=O)CSc1ccc2nc(-n3nc4c(c3C)CCC4)cn2c1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nc&cn2c1",
"old_substring": "c19ccc8nn1"
} |
Can you make molecule Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(CC(=O)NCCCC[NH+]3CCOCC3)cc(=O)oc2c1 | Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 | Cc1ccc2c(CC(=O)NCCCC[NH+]3CCOCC3)cc(=O)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C6"
} |
Can you make molecule Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(CC(=O)N=CCC[NH+]3CCOCC3)cc(=O)oc2c1 | Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 | Cc1ccc2c(CC(=O)N=CCC[NH+]3CCOCC3)cc(=O)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C5C6"
} |
Can you make molecule Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(CC(=O)NCCCCC[NH+]3CCOCC3)cc(=O)oc2c1 | Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 | Cc1ccc2c(CC(=O)NCCCCC[NH+]3CCOCC3)cc(=O)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C6"
} |
Can you make molecule Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(CC(=O)NC3CC([NH+]4CCOCC4)C3)cc(=O)oc2c1 | Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 | Cc1ccc2c(CC(=O)NC3CC([NH+]4CCOCC4)C3)cc(=O)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C6"
} |
Can you make molecule Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CC[NH+]1CCOCC1)=NC(=O)Cc1cc(=O)oc2cc(C)ccc12 | Cc1ccc2c(CC(=O)NCC[NH+]3CCOCC3)cc(=O)oc2c1 | CC(CC[NH+]1CCOCC1)=NC(=O)Cc1cc(=O)oc2cc(C)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C5C6"
} |
Can you make molecule O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CNC[C@H]1[C@H]1CCC[C@@H]1[NH2+][C@@H]1CCS(=O)(=O)C1 | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 | C[C@@H]1CNC[C@H]1[C@H]1CCC[C@@H]1[NH2+][C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C[C@H]1C",
"old_substring": "[C@@H]15CCCC[NH2+]1"
} |
Can you make molecule O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2C2CCCC2)C1 | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2C2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]15CCCC[NH2+]1"
} |
Can you make molecule O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCO2)C1 | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]15CCCC[NH2+]1"
} |
Can you make molecule O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCNCC2)C1 | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCNCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@@H]15CCCC[NH2+]1"
} |
Can you make molecule O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NCCCC[C@H]1[C@H]1CCC[C@@H]1[NH2+][C@@H]1CCS(=O)(=O)C1 | O=S1(=O)CC[C@@H]([NH2+][C@H]2CCC[C@@H]2[C@@H]2CCCC[NH2+]2)C1 | O=C1NCCCC[C@H]1[C@H]1CCC[C@@H]1[NH2+][C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCN&C1=O",
"old_substring": "[C@@H]15CCCC[NH2+]1"
} |
Can you make molecule C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(F)c(OCCOc2ccccc2Cl)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2ccccc2Cl)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(F)c(OCCOc2ccc(I)cc2)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2ccc(I)cc2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(F)c(OCCOc2ccc(C)c(I)c2)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2ccc(C)c(I)c2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(F)c(OCCOc2cccc(Br)c2)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2cccc(Br)c2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]Cc1cc(F)c(OCCOc2cccc(C)c2C)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2ccccc2)c(F)c1 | C[NH2+]Cc1cc(F)c(OCCOc2cccc(C)c2C)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.