prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(CN2CCN([C@@H]3CC[C@H](c4cccc(Cl)c4)O3)CC2)cn1 | Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 | Cn1cc(CN2CCN([C@@H]3CC[C@H](c4cccc(Cl)c4)O3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]57CO"
} |
Can you make molecule Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(CN2CCN([C@@H]3CCCCN(c4cccc(Cl)c4)C3=O)CC2)cn1 | Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 | Cn1cc(CN2CCN([C@@H]3CCCCN(c4cccc(Cl)c4)C3=O)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCN&C1=O",
"old_substring": "[C@@H]57CO"
} |
Can you make molecule Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(CN2CCN([C@@H]3CC[C@@H](c4cccc(Cl)c4)O3)CC2)cn1 | Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 | Cn1cc(CN2CCN([C@@H]3CC[C@@H](c4cccc(Cl)c4)O3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&O1",
"old_substring": "[C@@H]57CO"
} |
Can you make molecule Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(CN2CCN([C@@H]3CN(c4cccc(Cl)c4)CCS3)CC2)cn1 | Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 | Cn1cc(CN2CCN([C@@H]3CN(c4cccc(Cl)c4)CCS3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&CCS1",
"old_substring": "[C@@H]57CO"
} |
Can you make molecule Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(CN2CCN([C@@H]3CCCN(c4cccc(Cl)c4)CC3)CC2)cn1 | Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 | Cn1cc(CN2CCN([C@@H]3CCCN(c4cccc(Cl)c4)CC3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@@H]57CO"
} |
Can you make molecule Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([N-]S(=O)(=O)c2cc(N)cc(Br)c2F)ccc1I | Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F | Cc1nc([N-]S(=O)(=O)c2cc(N)cc(Br)c2F)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&ccc1I",
"old_substring": "Cc1ncccc13"
} |
Can you make molecule Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([N-]S(=O)(=O)c2cc(N)cc(Br)c2F)ccc1Br | Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F | Cc1nc([N-]S(=O)(=O)c2cc(N)cc(Br)c2F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&ccc1Br",
"old_substring": "Cc1ncccc13"
} |
Can you make molecule Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([N-]S(=O)(=O)c2cc(N)cc(Br)c2F)ccc1Cl | Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F | Cc1nc([N-]S(=O)(=O)c2cc(N)cc(Br)c2F)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&ccc1Cl",
"old_substring": "Cc1ncccc13"
} |
Can you make molecule Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([N-]S(=O)(=O)c2cc(N)cc(Br)c2F)c1 | Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F | Cc1cccc([N-]S(=O)(=O)c2cc(N)cc(Br)c2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1",
"old_substring": "Cc1ncccc13"
} |
Can you make molecule Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(S(=O)(=O)c2cc(N)cc(Br)c2F)ccc2cc(s1)[N-]2 | Cc1ncccc1[N-]S(=O)(=O)c1cc(N)cc(Br)c1F | Cc1nc(S(=O)(=O)c2cc(N)cc(Br)c2F)ccc2cc(s1)[N-]2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc2ccc&cc2s1",
"old_substring": "Cc1ncccc13"
} |
Can you make molecule Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CN2CCN(SC(=O)Cc3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(SC(=O)Cc3cccs3)CC2)c(=S)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CN2CCN(C(=O)CCCC(=O)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(C(=O)CCCC(=O)c3cccs3)CC2)c(=S)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C45=O"
} |
Can you make molecule Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CN2CCN(C(=O)CC(C)(C)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(C(=O)CC(C)(C)c3cccs3)CC2)c(=S)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CN2CCN(C(=O)CCC(C)(C)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(C(=O)CCC(C)(C)c3cccs3)CC2)c(=S)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CN2CCN(SC(=O)[C@@H](C)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(C(=O)c3cccs3)CC2)c(=S)n1C1CC1 | Cc1nn(CN2CCN(SC(=O)[C@@H](C)c3cccs3)CC2)c(=S)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)C(=O)c1nn(C)c(C)c1Cl | Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C | CCCC[C@@H](C)C(=O)c1nn(C)c(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&C",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)C(=O)c1nn(C)c(C)c1Cl | Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C | CCCCC[C@@H](C)C(=O)c1nn(C)c(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H](CC)C(=O)c1nn(C)c(C)c1Cl | Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C | C=CCC[C@H](CC)C(=O)c1nn(C)c(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC[C@@H]&CC",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)c(C(=O)N2CCCCCCCC2)nn1C | Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C | Cc1c(Cl)c(C(=O)N2CCCCCCCC2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)c(C(=O)N2CCc3sccc3[C@H]2C)nn1C | Cc1c(Cl)c(C(=O)N2CCCC[C@H]2C)nn1C | Cc1c(Cl)c(C(=O)N2CCc3sccc3[C@H]2C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2sccc2[C@H]1C",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@]1(C)C[C@H](N(C)SC(=O)Cc2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)SC(=O)Cc2ccc3c(c2)C(=O)NC3=O)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@]1(C)C[C@H](N(C)C(=O)CCCC(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)C(=O)CCCC(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@]1(C)C[C@H](N(C)C(=O)CC(C)(C)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)C(=O)CC(C)(C)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@]1(C)C[C@H](N(C)C(=O)CCC(C)(C)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)C(=O)CCC(C)(C)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@]1(C)C[C@H](N(C)SC(=O)[C@@H](C)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | CO[C@]1(C)C[C@H](N(C)SC(=O)[C@@H](C)c2ccc3c(c2)C(=O)NC3=O)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1S(=O)(=O)N[C@H](C)CC(C)(C)N1CC[NH+](C)CC1 | Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 | Cc1c(Cl)cccc1S(=O)(=O)N[C@H](C)CC(C)(C)N1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C2[C@@H](C)C3"
} |
Can you make molecule Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(CCN1CC[NH+](C)CC1)NS(=O)(=O)c1cccc(Cl)c1C | Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 | CC[C@](C)(CCN1CC[NH+](C)CC1)NS(=O)(=O)c1cccc(Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CC&",
"old_substring": "C2[C@@H](C)C3"
} |
Can you make molecule Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1S(=O)(=O)NCC[C@H](Br)CN1CC[NH+](C)CC1 | Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 | Cc1c(Cl)cccc1S(=O)(=O)NCC[C@H](Br)CN1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@H](Br)C&",
"old_substring": "C2[C@@H](C)C3"
} |
Can you make molecule Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1S(=O)(=O)N[C@H](CCl)CCCN1CC[NH+](C)CC1 | Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 | Cc1c(Cl)cccc1S(=O)(=O)N[C@H](CCl)CCCN1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "C2[C@@H](C)C3"
} |
Can you make molecule Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cccc1S(=O)(=O)N=CCC[C@@H](C)CN1CC[NH+](C)CC1 | Cc1c(Cl)cccc1S(=O)(=O)NC[C@@H](C)CN1CC[NH+](C)CC1 | Cc1c(Cl)cccc1S(=O)(=O)N=CCC[C@@H](C)CN1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC[C@@H](C)C&",
"old_substring": "C2[C@@H](C)C3"
} |
Can you make molecule C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CN(CC)C(=O)[C@@H](C)CCN1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)[C@@H](C)CCN1CCN(C(=O)C2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](C)CC&",
"old_substring": "C3(=O)[C@@H]7C"
} |
Can you make molecule C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CN(CC)SC(=O)[C@@H](C)N1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)SC(=O)[C@@H](C)N1CCN(C(=O)C2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C3(=O)[C@@H]7C"
} |
Can you make molecule C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CN(CC)C(=O)[C@H](C)CCN1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)[C@H](C)CCN1CCN(C(=O)C2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C3(=O)[C@@H]7C"
} |
Can you make molecule C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CN(CC)C(=O)C[C@@H](C)CN1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)C[C@@H](C)CN1CCN(C(=O)C2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H](C)C&",
"old_substring": "C3(=O)[C@@H]7C"
} |
Can you make molecule C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CN(CC)C(=O)C[C@@H](Br)N1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)[C@H](C)N1CCN(C(=O)C2CCCC2)CC1 | C=C(C)CN(CC)C(=O)C[C@@H](Br)N1CCN(C(=O)C2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C3(=O)[C@@H]7C"
} |
Can you make molecule N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)CCO/N=C(/N)c1cc2ccccc2o1 | N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 | CCCS(=O)(=O)CCO/N=C(/N)c1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCS&(=O)=O",
"old_substring": "N14CCCS1(=O)=O"
} |
Can you make molecule N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)CCO/N=C(/N)c1cc2ccccc2o1 | N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 | CCCCS(=O)(=O)CCO/N=C(/N)c1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCS&(=O)=O",
"old_substring": "N14CCCS1(=O)=O"
} |
Can you make molecule N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCS(=O)(=O)CCO/N=C(/N)c1cc2ccccc2o1 | N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 | C=CCS(=O)(=O)CCO/N=C(/N)c1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCS&(=O)=O",
"old_substring": "N14CCCS1(=O)=O"
} |
Can you make molecule N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | N/C(=N/OCCN1C(=O)CCCC1=O)c1cc2ccccc2o1 | N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 | N/C(=N/OCCN1C(=O)CCCC1=O)c1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CCCC1=O",
"old_substring": "N14CCCS1(=O)=O"
} |
Can you make molecule N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | N/C(=N/OCCN1C(=O)CSC1=S)c1cc2ccccc2o1 | N/C(=N/OCCN1CCCS1(=O)=O)c1cc2ccccc2o1 | N/C(=N/OCCN1C(=O)CSC1=S)c1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CSC1=S",
"old_substring": "N14CCCS1(=O)=O"
} |
Can you make molecule Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC/[NH+]=C(/Nn1c(C)nc2ccccc21)N(C)C1CCCCCC1 | Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 | CC/[NH+]=C(/Nn1c(C)nc2ccccc21)N(C)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC/[NH+]=C(/N&)N&C",
"old_substring": "C4C/[NH+]=C(/N)N3"
} |
Can you make molecule Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC/[NH+]=C(/NC1CCCCCC1)Nn1c(C)nc2ccccc21 | Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 | CC/[NH+]=C(/NC1CCCCCC1)Nn1c(C)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC/[NH+]=C(\\N&)N&",
"old_substring": "C4C/[NH+]=C(/N)N3"
} |
Can you make molecule Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/Nn1c(C)nc2ccccc21)N(C)C1CCCCCC1 | Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 | C/[NH+]=C(/Nn1c(C)nc2ccccc21)N(C)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/[NH+]=C(/N&)N&C",
"old_substring": "C4C/[NH+]=C(/N)N3"
} |
Can you make molecule Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CC/[NH+]=C(/NC1CCCCCC1)Nn1c(C)nc2ccccc21 | Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 | C=CC/[NH+]=C(/NC1CCCCCC1)Nn1c(C)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC/[NH+]=C(\\N&)N&",
"old_substring": "C4C/[NH+]=C(/N)N3"
} |
Can you make molecule Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CN/C(=[NH+]\Cn1c(C)nc2ccccc21)N(C)C1CCCCCC1 | Cc1nc2ccccc2n1CC/[NH+]=C(/N)NC1CCCCCC1 | CN/C(=[NH+]\Cn1c(C)nc2ccccc21)N(C)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN/C(=[NH+]\\C&)N&C",
"old_substring": "C4C/[NH+]=C(/N)N3"
} |
Can you make molecule CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CN(SC(=O)Cc1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | CN(SC(=O)Cc1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCCC(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | CN(C(=O)CCCC(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CC(C)(C)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | CN(C(=O)CC(C)(C)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCC(C)(C)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | CN(C(=O)CCC(C)(C)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN(C)[C@H]1CCC[C@H]1C[NH3+])c1nnn[n-]1 | CN(C(=O)c1nnn[n-]1)[C@H]1CCC[C@H]1C[NH3+] | C[C@H](C(=O)SN(C)[C@H]1CCC[C@H]1C[NH3+])c1nnn[n-]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule CC[C@H]1COCCN1Cc1cccc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H]1COCCN1Cc1cccc(C)c1C | CC[C@H]1COCCN1Cc1cccc(C)c1C | C=CCC[C@H]1COCCN1Cc1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[C@H]1COCCN1Cc1cccc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CN2CCOC[C@@H]2CCCCl)c1C | CC[C@H]1COCCN1Cc1cccc(C)c1C | Cc1cccc(CN2CCOC[C@@H]2CCCCl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[C@H]1COCCN1Cc1cccc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CN2CCOC[C@@H]2CCCCS)c1C | CC[C@H]1COCCN1Cc1cccc(C)c1C | Cc1cccc(CN2CCOC[C@@H]2CCCCS)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[C@H]1COCCN1Cc1cccc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CN2CCOC[C@@H]2CCCBr)c1C | CC[C@H]1COCCN1Cc1cccc(C)c1C | Cc1cccc(CN2CCOC[C@@H]2CCCBr)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule CC[C@H]1COCCN1Cc1cccc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CN2CCOC[C@@H]2CCCCF)c1C | CC[C@H]1COCCN1Cc1cccc(C)c1C | Cc1cccc(CN2CCOC[C@@H]2CCCCF)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC3"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C[C@H]2C)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C[C@H]2C)cc1C(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&C[C@H]1C",
"old_substring": "N15CC[C@H]8C1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)N2CCCC[C@@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)N2CCCC[C@@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC[C@@H]&C1",
"old_substring": "N15CC[C@H]8C1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)N2CCC[C@H]([NH+]3CCCC3)CC2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)N2CCC[C@H]([NH+]3CCCC3)CC2)cc1C(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H]&CC1",
"old_substring": "N15CC[C@H]8C1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)CC2=N[C@H]([NH+]3CCCC3)SC2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)CC2=N[C@H]([NH+]3CCCC3)SC2)cc1C(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=N[C@H]&SC1",
"old_substring": "N15CC[C@H]8C1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)CC2=N[C@@H]([NH+]3CCCC3)SC2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)N2CC[C@H]([NH+]3CCCC3)C2)cc1C(=O)N(C)C | Cc1ccc(NC(=O)C(=O)CC2=N[C@@H]([NH+]3CCCC3)SC2)cc1C(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=N[C@@H]&SC1",
"old_substring": "N15CC[C@H]8C1"
} |
Can you make molecule Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(n1)oc1c(N3CCN(CC(N)=O)CC3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CCN(CC(N)=O)CC3)ncnc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&CC1",
"old_substring": "N15CC[NH+]4CC1"
} |
Can you make molecule Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(n1)oc1c(N3CCO[C@H](CC(N)=O)C3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CCO[C@H](CC(N)=O)C3)ncnc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCO[C@H]&C1",
"old_substring": "N15CC[NH+]4CC1"
} |
Can you make molecule Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(n1)oc1c(N3C[C@H](CC(N)=O)CC3=O)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3C[C@H](CC(N)=O)CC3=O)ncnc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H]&CC1=O",
"old_substring": "N15CC[NH+]4CC1"
} |
Can you make molecule Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(n1)oc1c(N3CCO[C@@H](CC(N)=O)C3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CCO[C@@H](CC(N)=O)C3)ncnc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCO[C@@H]&C1",
"old_substring": "N15CC[NH+]4CC1"
} |
Can you make molecule Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(n1)oc1c(N3CCS[C@@H](CC(N)=O)C3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CC[NH+](CC(N)=O)CC3)ncnc12 | Cc1cc(C)c2c(n1)oc1c(N3CCS[C@@H](CC(N)=O)C3)ncnc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCS[C@@H]&C1",
"old_substring": "N15CC[NH+]4CC1"
} |
Can you make molecule Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)COCc1nnc(-c2ccccc2Cl)o1)c1cccc(C)c1 | Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 | CCC(CC)(C(=O)COCc1nnc(-c2ccccc2Cl)o1)c1cccc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCOCc1nnc(-c2ccccc2Cl)o1)c1cccc(C)c1 | Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 | CCC(CC)(C(=O)CCOCc1nnc(-c2ccccc2Cl)o1)c1cccc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](c1cccc(C)c1)[S@+]([O-])COCc1nnc(-c2ccccc2Cl)o1 | Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 | CC[C@H](c1cccc(C)c1)[S@+]([O-])COCc1nnc(-c2ccccc2Cl)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&[S@](=O)C&",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C(=O)OCc1nnc(-c2ccccc2Cl)o1)C(=O)c1cccc(C)c1 | Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 | CCCC[C@@H](C(=O)OCc1nnc(-c2ccccc2Cl)o1)C(=O)c1cccc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H](C&=O)C&=O",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCC[S@+]([O-])[C@@H](C)OCc2nnc(-c3ccccc3Cl)o2)c1 | Cc1cccc(CCC(=O)OCc2nnc(-c3ccccc3Cl)o2)c1 | Cc1cccc(CCC[S@+]([O-])[C@@H](C)OCc2nnc(-c3ccccc3Cl)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "C7CC4=O"
} |
Can you make molecule CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4cccc(C(=N)O)c4)cc3)c2O1 | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4cccc(C(=N)O)c4)cc3)c2O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C(=N)O)c1",
"old_substring": "c18ccc(S(N)(=O)=O)cc1"
} |
Can you make molecule CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(C(N)=S)cc4Cl)cc3)c2O1 | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(C(N)=S)cc4Cl)cc3)c2O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C(N)=S)cc1Cl",
"old_substring": "c18ccc(S(N)(=O)=O)cc1"
} |
Can you make molecule CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(N)cc4F)cc3)c2O1 | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(N)cc4F)cc3)c2O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(N)cc1F",
"old_substring": "c18ccc(S(N)(=O)=O)cc1"
} |
Can you make molecule CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(=O)c(N)cc1NC(=O)c1ccc(COc2cccc3c2OC(C)(C)C3)cc1 | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 | Cc1oc(=O)c(N)cc1NC(=O)c1ccc(COc2cccc3c2OC(C)(C)C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(N)c(=O)oc1C",
"old_substring": "c18ccc(S(N)(=O)=O)cc1"
} |
Can you make molecule CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)c2ccc(COc3cccc4c3OC(C)(C)C4)cc2)ccc1O | CC1(C)Cc2cccc(OCc3ccc(C(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c2O1 | Cc1cc(NC(=O)c2ccc(COc3cccc4c3OC(C)(C)C4)cc2)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)c(C)c1",
"old_substring": "c18ccc(S(N)(=O)=O)cc1"
} |
Can you make molecule COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1sc(S(=O)(=O)N2CCSC23CCN(C(N)=O)CC3)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)N2CCSC23CCN(C(N)=O)CC3)c(C(=O)OC)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC12CCN&CC2",
"old_substring": "N15CCC7CC1"
} |
Can you make molecule COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1sc(S(=O)(=O)N2CCCc3cc(C(N)=O)ccc3C2)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)N2CCCc3cc(C(N)=O)ccc3C2)c(C(=O)OC)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "N15CCC7CC1"
} |
Can you make molecule COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1sc(S(=O)(=O)C2CCC(C(N)=O)CC2)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)C2CCC(C(N)=O)CC2)c(C(=O)OC)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "N15CCC7CC1"
} |
Can you make molecule COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1sc(S(=O)(=O)CCCCCC(N)=O)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)CCCCCC(N)=O)c(C(=O)OC)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "N15CCC7CC1"
} |
Can you make molecule COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1sc(S(=O)(=O)C2(C#N)CCC(C(N)=O)CC2)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C(=O)OC)c1C | COC(=O)c1sc(S(=O)(=O)C2(C#N)CCC(C(N)=O)CC2)c(C(=O)OC)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "N15CCC7CC1"
} |
Can you make molecule CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCc1c(CC(=O)SN2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(CC(=O)SN2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C34=O"
} |
Can you make molecule CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCc1c(C(=O)CCCC(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(C(=O)CCCC(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C34=O"
} |
Can you make molecule CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCc1c(C(C)(C)CC(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(C(C)(C)CC(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCc1c(C(C)(C)CCC(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(C(C)(C)CCC(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCc1c([C@H](C)C(=O)SN2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c(C(=O)N2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | CCCc1c([C@H](C)C(=O)SN2CCO[C@@H](CCC)C2)[nH]c(C)c1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C34=O"
} |
Can you make molecule COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)cc1I | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 | COc1ccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15cccc8c1"
} |
Can you make molecule COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)ccc1Br | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 | COc1cc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)cc1Cl | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 | COc1ccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1Br | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1Cl | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1 | COc1cccc(Cc2c(C)nc(C)nc2N2CCN(C(=O)c3cccc(Br)c3)CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccccc1C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | CC[C@@H](CCc1ccccc1C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]46C"
} |
Can you make molecule Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CC[C@H](CBr)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | Cc1ccccc1CC[C@H](CBr)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]46C"
} |
Can you make molecule Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCC[C@H](CBr)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | Cc1ccccc1CCC[C@H](CBr)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]46C"
} |
Can you make molecule Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCC[C@@H](CCl)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | Cc1ccccc1CCC[C@@H](CCl)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]46C"
} |
Can you make molecule Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@H]1CCC[C@H](NC(=O)c2cc(-c3ccncc3)nc3ccccc23)C1 | Cc1ccccc1[C@@H](C)NC(=O)c1cc(-c2ccncc2)nc2ccccc12 | Cc1ccccc1[C@H]1CCC[C@H](NC(=O)c2cc(-c3ccncc3)nc3ccccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]46C"
} |
Can you make molecule CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(CC2CCN(c3nc4nonc4nc3N3CCCO3)CC2)cc1 | CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 | c1ccc(CC2CCN(c3nc4nonc4nc3N3CCCO3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccccc1)C(=S)Sc1nc2nonc2nc1N1CCCO1 | CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 | CN(Cc1ccccc1)C(=S)Sc1nc2nonc2nc1N1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN34"
} |
Can you make molecule CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(CCN2CCC(c3nc4nonc4nc3N3CCCO3)CC2)cc1 | CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 | c1ccc(CCN2CCC(c3nc4nonc4nc3N3CCCO3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | S=C1SCN(Cc2ccccc2)CN1c1nc2nonc2nc1N1CCCO1 | CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 | S=C1SCN(Cc2ccccc2)CN1c1nc2nonc2nc1N1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN34"
} |
Can you make molecule CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(Cc2ccccc2)CCC(c2nc3nonc3nc2N2CCCO2)CC1 | CN(Cc1ccccc1)c1nc2nonc2nc1N1CCCO1 | N#CC1(Cc2ccccc2)CCC(c2nc3nonc3nc2N2CCCO2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN34"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.