prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)(C#N)CCN1CCOCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)CCN1CCCOC1=O | CC(C)(C#N)CCN1CCOCC1=O | CC(C)(C#N)CCN1CCCOC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCOC1=O",
"old_substring": "N12CCOCC1=O"
} |
Can you make molecule CC(C)(C#N)CCN1CCOCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)CCN1CCOC1=O | CC(C)(C#N)CCN1CCOCC1=O | CC(C)(C#N)CCN1CCOC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC1=O",
"old_substring": "N12CCOCC1=O"
} |
Can you make molecule CC(C)(C#N)CCN1CCOCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)CCN1CCCCC1=O | CC(C)(C#N)CCN1CCOCC1=O | CC(C)(C#N)CCN1CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1=O",
"old_substring": "N12CCOCC1=O"
} |
Can you make molecule CC(C)(C#N)CCN1CCOCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)CCN1CCCNC1=O | CC(C)(C#N)CCN1CCOCC1=O | CC(C)(C#N)CCN1CCCNC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCNC1=O",
"old_substring": "N12CCOCC1=O"
} |
Can you make molecule CC(C)(C#N)CCN1CCOCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)CCN1CCCC1 | CC(C)(C#N)CCN1CCOCC1=O | CC(C)(C#N)CCN1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N12CCOCC1=O"
} |
Can you make molecule Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(C(=O)[C@H](N)CCCC2CCCC2)c(Br)c1Cl | Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl | Cc1ncc(C(=O)[C@H](N)CCCC2CCCC2)c(Br)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N34C"
} |
Can you make molecule Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(C(=O)N2CCN=C2CCC2CCCC2)c(Br)c1Cl | Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl | Cc1ncc(C(=O)N2CCN=C2CCC2CCCC2)c(Br)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N34C"
} |
Can you make molecule Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(C(=O)c2cc(C#N)c(CC3CCCC3)s2)c(Br)c1Cl | Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl | Cc1ncc(C(=O)c2cc(C#N)c(CC3CCCC3)s2)c(Br)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N34C"
} |
Can you make molecule Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(C(=O)c2ccc(CC3CCCC3)c(C#N)c2)c(Br)c1Cl | Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl | Cc1ncc(C(=O)c2ccc(CC3CCCC3)c(C#N)c2)c(Br)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N34C"
} |
Can you make molecule Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(C(=O)ON=C2CCN(CC3CCCC3)CC2)c(Br)c1Cl | Cc1ncc(C(=O)N(C)CC2CCCC2)c(Br)c1Cl | Cc1ncc(C(=O)ON=C2CCN(CC3CCCC3)CC2)c(Br)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N34C"
} |
Can you make molecule Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(SC(=S)OCC(=O)Nc2cccc3ccccc23)cc1 | Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 | Nc1ccc(SC(=S)OCC(=O)Nc2cccc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O56"
} |
Can you make molecule Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1ccc(N)cc1)OCC(=O)Nc1cccc2ccccc12 | Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 | N=C(Cc1ccc(N)cc1)OCC(=O)Nc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O56"
} |
Can you make molecule Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(C(=O)CCC(=O)CC(=O)Nc2cccc3ccccc23)cc1 | Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 | Nc1ccc(C(=O)CCC(=O)CC(=O)Nc2cccc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O56"
} |
Can you make molecule Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(CC[C@@H](O)CC(=O)Nc2cccc3ccccc23)cc1 | Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 | Nc1ccc(CC[C@@H](O)CC(=O)Nc2cccc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O56"
} |
Can you make molecule Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(S/C=C/C(=O)CC(=O)Nc2cccc3ccccc23)cc1 | Nc1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 | Nc1ccc(S/C=C/C(=O)CC(=O)Nc2cccc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O56"
} |
Can you make molecule Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2[nH]c(=O)c(CCCCNc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(CCCCNc3ccc(OC(C)C)cc3)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C68"
} |
Can you make molecule Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2[nH]c(=O)c(CCC=Nc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(CCC=Nc3ccc(OC(C)C)cc3)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C68"
} |
Can you make molecule Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2[nH]c(=O)c(CCCCCNc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(CCCCCNc3ccc(OC(C)C)cc3)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C68"
} |
Can you make molecule Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2[nH]c(=O)c(C3CC(Nc4ccc(OC(C)C)cc4)C3)cc2c1 | Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(C3CC(Nc4ccc(OC(C)C)cc4)C3)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C68"
} |
Can you make molecule Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2[nH]c(=O)c(SC(=S)ONc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(CNc3ccc(OC(C)C)cc3)cc2c1 | Cc1ccc2[nH]c(=O)c(SC(=S)ONc3ccc(OC(C)C)cc3)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C68"
} |
Can you make molecule COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN2CCN(SC(=O)CC34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(SC(=O)CC34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C68=O"
} |
Can you make molecule COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN2CCN(CC(=C=O)CC34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(CC(=C=O)CC34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C68=O"
} |
Can you make molecule COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN2CCN(C(=O)CCCC(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(C(=O)CCCC(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C68=O"
} |
Can you make molecule COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN2CCN(C(=O)CC(C)(C)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(C(=O)CC(C)(C)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C68=O"
} |
Can you make molecule COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN2CCN(C[S@+]([O-])CCCC34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | COc1ccc(CN2CCN(C[S@+]([O-])CCCC34CC5CC(CC(C5)C3)C4)CCC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C68=O"
} |
Can you make molecule CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(Cc2c(C)nn(C)c2N2CCN3C(=O)NC[C@@H]3C2)CC[NH2+]C1 | CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 | CCC1(Cc2c(C)nn(C)c2N2CCN3C(=O)NC[C@@H]3C2)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@]1(Cc2c(C)nn(C)c2N2CCN3C(=O)NC[C@@H]3C2)CCC[NH2+]C1 | CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 | CC[C@]1(Cc2c(C)nn(C)c2N2CCN3C(=O)NC[C@@H]3C2)CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1c[nH+]cc1Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 | CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 | CCn1c[nH+]cc1Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(Cc2c(C)nn(C)c2N2CCN3C(=O)NC[C@@H]3C2)[nH][nH+]1 | CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 | CCc1cc(Cc2c(C)nn(C)c2N2CCN3C(=O)NC[C@@H]3C2)[nH][nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(Cc2c(C)nn(C)c2N2CCN3C(=O)NC[C@@H]3C2)c[nH+]n1C | CC[NH2+]Cc1c(C)nn(C)c1N1CCN2C(=O)NC[C@@H]2C1 | CCc1c(Cc2c(C)nn(C)c2N2CCN3C(=O)NC[C@@H]3C2)c[nH+]n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(C[NH2+]Cc2ccc(F)cc2Cl)c1 | COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 | COCc1cccc(C[NH2+]Cc2ccc(F)cc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(C[NH2+]Cc2ccc(F)cc2Br)c1 | COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 | COCc1cccc(C[NH2+]Cc2ccc(F)cc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(C[NH2+]Cc2ccc(F)c(Cl)c2)c1 | COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 | COCc1cccc(C[NH2+]Cc2ccc(F)c(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(C[NH2+]Cc2ccc(I)cc2F)c1 | COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 | COCc1cccc(C[NH2+]Cc2ccc(I)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(C[NH2+]Cc2cc3c(F)cccc3s2)c1 | COCc1cccc(C[NH2+]Cc2ccc(F)cc2)c1 | COCc1cccc(C[NH2+]Cc2cc3c(F)cccc3s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCCCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | C[NH+](C)CCCCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCCCCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | C[NH+](C)CCCCCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)C1CC(N(C(=O)c2cnccn2)c2nc3c(F)cc(F)cc3s2)C1 | C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | C[NH+](C)C1CC(N(C(=O)c2cnccn2)c2nc3c(F)cc(F)cc3s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1)[NH+](C)C | C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | C[C@@H](CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1)[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)C1CCC(N(C(=O)c2cnccn2)c2nc3c(F)cc(F)cc3s2)CC1 | C[NH+](C)CCN(C(=O)c1cnccn1)c1nc2c(F)cc(F)cc2s1 | C[NH+](C)C1CCC(N(C(=O)c2cnccn2)c2nc3c(F)cc(F)cc3s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1Br | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c13cc(Cl)cc(Cl)c1"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1c(Cl)ccc(Cl)c1Cl | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1c(Cl)ccc(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c13cc(Cl)cc(Cl)c1"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1ccc(Cl)c(Cl)c1Cl | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1ccc(Cl)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c13cc(Cl)cc(Cl)c1"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1c(Cl)cc(Cl)cc1Cl | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1c(Cl)cc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)cc1Cl",
"old_substring": "c13cc(Cl)cc(Cl)c1"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Br)cc(Br)c1Cl | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Cl)cc(Cl)c1 | CC(C)[C@@H]1C(=O)NC(=O)C[C@H]1c1cc(Br)cc(Br)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc(Br)c1Cl",
"old_substring": "c13cc(Cl)cc(Cl)c1"
} |
Can you make molecule CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSCC[C@@H](C)NC(=O)CC(C)(C)N1CCN(C(=O)c2ccc(C)cc2)CC1 | CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 | CCSCC[C@@H](C)NC(=O)CC(C)(C)N1CCN(C(=O)c2ccc(C)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSCC[C@@H](C)NC(=O)CCC(C)(C)N1CCN(C(=O)c2ccc(C)cc2)CC1 | CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 | CCSCC[C@@H](C)NC(=O)CCC(C)(C)N1CCN(C(=O)c2ccc(C)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSCC[C@@H](C)NC(=O)C[C@@H](Br)N1CCN(C(=O)c2ccc(C)cc2)CC1 | CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 | CCSCC[C@@H](C)NC(=O)C[C@@H](Br)N1CCN(C(=O)c2ccc(C)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSCC[C@@H](C)Nc1cc(C)n(N2CCN(C(=O)c3ccc(C)cc3)CC2)c(=O)c1 | CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 | CCSCC[C@@H](C)Nc1cc(C)n(N2CCN(C(=O)c3ccc(C)cc3)CC2)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCSCC[C@@H](C)Nc1c(C)n(N2CCN(C(=O)c3ccc(C)cc3)CC2)ccc1=O | CCSCC[C@@H](C)NC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 | CCSCC[C@@H](C)Nc1c(C)n(N2CCN(C(=O)c3ccc(C)cc3)CC2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1I | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c19ccc7cc1"
} |
Can you make molecule CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1cc(NC(=O)c2nc3nc(C)cc(C)n3n2)ccc1Br | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 | CCOCc1cc(NC(=O)c2nc3nc(C)cc(C)n3n2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c19ccc7cc1"
} |
Can you make molecule CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1Cl | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c19ccc7cc1"
} |
Can you make molecule CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1cccc(NC(=O)c2nc3nc(C)cc(C)n3n2)c1Br | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 | CCOCc1cccc(NC(=O)c2nc3nc(C)cc(C)n3n2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c19ccc7cc1"
} |
Can you make molecule CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1cccc(NC(=O)c2nc3nc(C)cc(C)n3n2)c1Cl | CCOCc1ccc(NC(=O)c2nc3nc(C)cc(C)n3n2)cc1 | CCOCc1cccc(NC(=O)c2nc3nc(C)cc(C)n3n2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c19ccc7cc1"
} |
Can you make molecule CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)NCCC(=O)C1CCN(C2CCCCC2)CC1 | CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 | CS(=O)(=O)NCCC(=O)C1CCN(C2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCNS(C)(=O)=O)C(=S)SC1CCCCC1 | CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 | CN(C(=O)CCNS(C)(=O)=O)C(=S)SC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)NCCC(=O)CN1CCC(C2CCCCC2)CC1 | CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 | CS(=O)(=O)NCCC(=O)CN1CCC(C2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)NCCC(=O)N1CSC(=S)N(C2CCCCC2)C1 | CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 | CS(=O)(=O)NCCC(=O)N1CSC(=S)N(C2CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)NCCC(=O)C1(C#N)CCC(C2CCCCC2)CC1 | CN(C(=O)CCNS(C)(=O)=O)C1CCCCC1 | CS(=O)(=O)NCCC(=O)C1(C#N)CCC(C2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CCCC(F)(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CCCC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C8C(F)F"
} |
Can you make molecule CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CCCCC(F)(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CCCCC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C8C(F)F"
} |
Can you make molecule CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)(F)C(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)(F)C(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "C8C(F)F"
} |
Can you make molecule CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(C2CCC(F)(F)CC2)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(C2CCC(F)(F)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC(F)(F)CC1",
"old_substring": "C8C(F)F"
} |
Can you make molecule CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)(F)C(F)(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)F)c1 | CC(C)(C)NC(=O)CNC(=O)Nc1cnn(CC(F)(F)C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C8C(F)F"
} |
Can you make molecule C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NSC(=O)Cc1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NSC(=O)Cc1ccc(Cl)cc1F)c1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CCCC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NC(=O)CCCC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CC(C)(C)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NC(=O)CC(C)(C)c1ccc(Cl)cc1F)c1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CCC(C)(C)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NC(=O)CCC(C)(C)c1ccc(Cl)cc1F)c1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NSC(=O)[C@@H](C)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NC(=O)c1ccc(Cl)cc1F)c1ccc(N)cc1 | C[C@H](NSC(=O)[C@@H](C)c1ccc(Cl)cc1F)c1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | C=CSn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(S(=O)(=O)N[C@H](C)c2ccccc2)cnn1C(C)C | CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | Cc1c(S(=O)(=O)N[C@H](C)c2ccccc2)cnn1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | C=CCCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(S(=O)(=O)N[C@H](C)c2ccccc2)cnn1CCCCl | CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | Cc1c(S(=O)(=O)N[C@H](C)c2ccccc2)cnn1CCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(S(=O)(=O)N[C@H](C)c2ccccc2)cnn1CCCCS | CCn1ncc(S(=O)(=O)N[C@H](C)c2ccccc2)c1C | Cc1c(S(=O)(=O)N[C@H](C)c2ccccc2)cnn1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(CCS(=O)(=O)[O-])cc3)cc21 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(CCS(=O)(=O)[O-])cc3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)CO)cc3)cc21 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)CO)cc3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(O)O)cc3)cc21 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(O)O)cc3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])c1ccc(C(=O)Nc2ccc3c(c2)C(C)(C)CC(=O)C3(C)C)cc1 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 | CCC(CC)(C(=O)[O-])c1ccc(C(=O)Nc2ccc3c(c2)C(C)(C)CC(=O)C3(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(CCCS(=O)(=O)[O-])cc3)cc21 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(C(=O)[O-])cc3)cc21 | CC1(C)CC(=O)C(C)(C)c2ccc(NC(=O)c3ccc(CCCS(=O)(=O)[O-])cc3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(N=C(C)O)sc([C@H](C)O)c1-c1ccccc1 | CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 | CCOC(=O)c1c(N=C(C)O)sc([C@H](C)O)c1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)O",
"old_substring": "C3(C)=O"
} |
Can you make molecule CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(NC(=O)C(C)C)sc([C@H](C)O)c1-c1ccccc1 | CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 | CCOC(=O)c1c(NC(=O)C(C)C)sc([C@H](C)O)c1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C3(C)=O"
} |
Can you make molecule CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(N=C(C)OC)sc([C@H](C)O)c1-c1ccccc1 | CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 | CCOC(=O)c1c(N=C(C)OC)sc([C@H](C)O)c1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)OC",
"old_substring": "C3(C)=O"
} |
Can you make molecule CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)Nc1sc([C@H](C)O)c(-c2ccccc2)c1C(=O)OCC | CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 | C=C(C)C(=O)Nc1sc([C@H](C)O)c(-c2ccccc2)c1C(=O)OCC | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C&=O",
"old_substring": "C3(C)=O"
} |
Can you make molecule CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(NC(=O)CC(C)C)sc([C@H](C)O)c1-c1ccccc1 | CCOC(=O)c1c(NC(C)=O)sc([C@H](C)O)c1-c1ccccc1 | CCOC(=O)c1c(NC(=O)CC(C)C)sc([C@H](C)O)c1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&=O",
"old_substring": "C3(C)=O"
} |
Can you make molecule O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(I)cc(OCC(F)F)n1 | O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 | O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(I)cc(OCC(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)cc&n1",
"old_substring": "c16cccc4n1"
} |
Can you make molecule O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(OCC(F)F)cc(Cl)n1 | O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 | O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(OCC(F)F)cc(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(Cl)n1",
"old_substring": "c16cccc4n1"
} |
Can you make molecule O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(Cl)cc(OCC(F)F)n1 | O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 | O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(Cl)cc(OCC(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc&n1",
"old_substring": "c16cccc4n1"
} |
Can you make molecule O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](O)c1c(F)cccc1F)c1ncc(OCC(F)F)cc1Cl | O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 | O=C(NC[C@H](O)c1c(F)cccc1F)c1ncc(OCC(F)F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&cc1Cl",
"old_substring": "c16cccc4n1"
} |
Can you make molecule O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(OCC(F)F)cnc1Cl | O=C(NC[C@H](O)c1c(F)cccc1F)c1cccc(OCC(F)F)n1 | O=C(NC[C@H](O)c1c(F)cccc1F)c1cc(OCC(F)F)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c16cccc4n1"
} |
Can you make molecule COCC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC/C(C)=N\ON1C[C@@H](C)c2ccccc21 | COCC(=O)N1C[C@@H](C)c2ccccc21 | COC/C(C)=N\ON1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C4C3=O"
} |
Can you make molecule COCC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(OC)C(=O)CN1C[C@@H](C)c2ccccc21 | COCC(=O)N1C[C@@H](C)c2ccccc21 | CCC(CC)(OC)C(=O)CN1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C3=O"
} |
Can you make molecule COCC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | COSSC(=O)N1C[C@@H](C)c2ccccc21 | COCC(=O)N1C[C@@H](C)c2ccccc21 | COSSC(=O)N1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule COCC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(OC)C(=O)CCN1C[C@@H](C)c2ccccc21 | COCC(=O)N1C[C@@H](C)c2ccccc21 | CCC(CC)(OC)C(=O)CCN1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4C3=O"
} |
Can you make molecule COCC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)OC)C(=O)N1C[C@@H](C)c2ccccc21 | COCC(=O)N1C[C@@H](C)c2ccccc21 | CC[C@H](C(=O)OC)C(=O)N1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | COCc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | COCSc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | CC(=O)Sc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)NNC(=O)NCCCc1ccc(C(=O)CS)cc1 | COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | CC(C)(C)C(=O)NNC(=O)NCCCc1ccc(C(=O)CS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)NNC(=O)NCCCc1ccc(C(=O)CI)cc1 | COc1ccc(CCCNC(=O)NNC(=O)C(C)(C)C)cc1 | CC(C)(C)C(=O)NNC(=O)NCCCc1ccc(C(=O)CI)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.