prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nc(C(=O)N3CC[C@H](C)[C@H](O)C3)cs2)sc1C | C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O | Cc1cc(-c2nc(C(=O)N3CC[C@H](C)[C@H](O)C3)cs2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "c16ccsc1"
} |
Can you make molecule C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nc(C(=O)N3CC[C@H](C)[C@H](O)C3)cs2)c(C)s1 | C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O | Cc1cc(-c2nc(C(=O)N3CC[C@H](C)[C@H](O)C3)cs2)c(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)sc1C",
"old_substring": "c16ccsc1"
} |
Can you make molecule C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)c2csc(-c3sccc3Br)n2)C[C@H]1O | C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O | C[C@H]1CCN(C(=O)c2csc(-c3sccc3Br)n2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c16ccsc1"
} |
Can you make molecule C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)c2csc(-c3cc4sccc4s3)n2)C[C@H]1O | C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O | C[C@H]1CCN(C(=O)c2csc(-c3cc4sccc4s3)n2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c16ccsc1"
} |
Can you make molecule C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)c2csc(-c3cc(Cl)sc3Cl)n2)C[C@H]1O | C[C@H]1CCN(C(=O)c2csc(-c3ccsc3)n2)C[C@H]1O | C[C@H]1CCN(C(=O)c2csc(-c3cc(Cl)sc3Cl)n2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c16ccsc1"
} |
Can you make molecule CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CCC(CO)=Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CCCC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CC(=O)SNc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CCCCC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CC(=O)Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | CCC(C=O)=Nc1ccc(C2=NN(C(C)=O)[C@@H](c3cccs3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C=CSN(C[C@H](C)CC)c1ncc(Br)cc1C[NH3+] | CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] | C=CSN(C[C@H](C)CC)c1ncc(Br)cc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "C3C"
} |
Can you make molecule CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C=CCCN(C[C@H](C)CC)c1ncc(Br)cc1C[NH3+] | CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] | C=CCCN(C[C@H](C)CC)c1ncc(Br)cc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "C3C"
} |
Can you make molecule CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)CN(CCCCl)c1ncc(Br)cc1C[NH3+] | CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] | CC[C@@H](C)CN(CCCCl)c1ncc(Br)cc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "C3C"
} |
Can you make molecule CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)CN(CCCCS)c1ncc(Br)cc1C[NH3+] | CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] | CC[C@@H](C)CN(CCCCS)c1ncc(Br)cc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "C3C"
} |
Can you make molecule CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)CN(CCCBr)c1ncc(Br)cc1C[NH3+] | CC[C@@H](C)CN(CC)c1ncc(Br)cc1C[NH3+] | CC[C@@H](C)CN(CCCBr)c1ncc(Br)cc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "C3C"
} |
Can you make molecule COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1-n1cc(CC(=O)SN2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(CC(=O)SN2CCc3[nH]c4ccccc4c3C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1-n1cc(C(=O)CCCC(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(C(=O)CCCC(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1-n1cc(C(C)(C)CC(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(C(C)(C)CC(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1-n1cc(C(C)(C)CCC(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(C(C)(C)CCC(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1-n1cc([C@H](C)C(=O)SN2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc(C(=O)N2CCc3[nH]c4ccccc4c3C2)cn1 | COc1ccccc1-n1cc([C@H](C)C(=O)SN2CCc3[nH]c4ccccc4c3C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1ncncc1Cl | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1ncncc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncncc1Cl",
"old_substring": "c17nccn1C"
} |
Can you make molecule COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1c(I)cnn1C | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1c(I)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(I)cnn1C",
"old_substring": "c17nccn1C"
} |
Can you make molecule COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1cccn1C | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1cccn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccn1C",
"old_substring": "c17nccn1C"
} |
Can you make molecule COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1cnn(C)c1Cl | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1cnn(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cn1ncc&c1Cl",
"old_substring": "c17nccn1C"
} |
Can you make molecule COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1cc(C)c(C)nn1 | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1nccn1C | COc1ccccc1[C@@H](NC(=O)[C@@H]1CC(=O)N(c2ccc(C)cc2)C1)c1cc(C)c(C)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&nnc1C",
"old_substring": "c17nccn1C"
} |
Can you make molecule C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H]1CC(=O)SN1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1CC(=O)SN1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H]1CC(=C=O)CN1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1CC(=C=O)CN1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H]1C(=O)CCCC(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1C(=O)CCCC(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H]1C(C)(C)CC(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1C(C)(C)CC(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H]1CCC[S@@+]([O-])CN1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1C(=O)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | C[C@@H]1C[C@H]1CCC[S@@+]([O-])CN1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C45=O"
} |
Can you make molecule CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C[C@H](NC(=O)C=Cc2cnc(C(Cl)(Cl)Cl)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(C(Cl)(Cl)Cl)s2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)CC(C)(C)C)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)CC(C)(C)C)s2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C[C@H](NC(=O)C=Cc2cnc(CCCC(C)(C)C)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(CCCC(C)(C)C)s2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C[C@H](NC(=O)C=Cc2cnc(CCCC(F)(F)F)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(CCCC(F)(F)F)s2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C[C@H](NC(=O)C=Cc2cnc(CCCCC(F)(F)F)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(C(C)(C)C)s2)CCC1=O | CN1C[C@H](NC(=O)C=Cc2cnc(CCCCC(F)(F)F)s2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1SC(=O)CSc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1SC(=O)CSc1nnnn1-c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)CCCC(=O)Sc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CCCC(=O)Sc1nnnn1-c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)CC(C)(C)Sc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CC(C)(C)Sc1nnnn1-c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C[S@+]([O-])CCCSc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C[S@+]([O-])CCCSc1nnnn1-c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)CCC(C)(C)Sc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CSc1nnnn1-c1ccc(Br)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CCC(C)(C)Sc1nnnn1-c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNc1cccc(C(F)(F)F)c1)c1cc(Cl)cc2cccnc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1cc(Cl)cc2cccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc2cccnc12",
"old_substring": "c13cccc2cccnc12"
} |
Can you make molecule O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNc1cccc(C(F)(F)F)c1)c1ccc(Br)c2cccnc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1ccc(Br)c2cccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c2cccnc12",
"old_substring": "c13cccc2cccnc12"
} |
Can you make molecule O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNc1cccc(C(F)(F)F)c1)c1ccc(Cl)c2cccnc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1ccc(Cl)c2cccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc&c2ncccc12",
"old_substring": "c13cccc2cccnc12"
} |
Can you make molecule O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNc1cccc(C(F)(F)F)c1)c1ccc(F)c2ccccc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1ccc(F)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1ccc&c2ccccc12",
"old_substring": "c13cccc2cccnc12"
} |
Can you make molecule O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NNc2cccc(C(F)(F)F)c2)c2ccccc12 | O=C(NNc1cccc(C(F)(F)F)c1)c1cccc2cccnc12 | Cc1ccc(C(=O)NNc2cccc(C(F)(F)F)c2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&c2ccccc12",
"old_substring": "c13cccc2cccnc12"
} |
Can you make molecule CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1I | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)ccc1Br | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 | CC(C)c1cc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1Cl | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)c1Br | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 | CC(C)c1cccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)c1Cl | CC(C)c1ccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)cc1 | CC(C)c1cccc([C@@H]2C[NH2+][C@@H](C)[C@@H](C)O2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)CS(=O)(=O)CC(=O)c1nc(C#N)c(Cc2cccs2)o1 | C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 | C[C@@H](CO)CS(=O)(=O)CC(=O)c1nc(C#N)c(Cc2cccs2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N23C"
} |
Can you make molecule C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)CS(=O)(=O)CC(=O)c1cc(C#N)c(Cc2cccs2)s1 | C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 | C[C@@H](CO)CS(=O)(=O)CC(=O)c1cc(C#N)c(Cc2cccs2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N23C"
} |
Can you make molecule C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)CS(=O)(=O)CC(=O)c1ccc(Cc2cccs2)c(C#N)c1 | C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 | C[C@@H](CO)CS(=O)(=O)CC(=O)c1ccc(Cc2cccs2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N23C"
} |
Can you make molecule C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)CS(=O)(=O)CC(=O)ON=C1CCN(Cc2cccs2)CC1 | C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 | C[C@@H](CO)CS(=O)(=O)CC(=O)ON=C1CCN(Cc2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N23C"
} |
Can you make molecule C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)CS(=O)(=O)CC(=O)c1cnc(C#N)c(Cc2cccs2)c1 | C[C@@H](CO)CS(=O)(=O)CC(=O)N(C)Cc1cccs1 | C[C@@H](CO)CS(=O)(=O)CC(=O)c1cnc(C#N)c(Cc2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N23C"
} |
Can you make molecule COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC(=O)SNc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(CC(=O)SNc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CCCC(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(C(=O)CCCC(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(C)(C)CC(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(C(C)(C)CC(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(C)(C)CCC(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(C(C)(C)CCC(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](C)C(=O)SNc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc(C(=O)Nc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | COc1ccc([C@H](C)C(=O)SNc2cccc(-c3cc4cc(F)ccc4[nH]3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C58=O"
} |
Can you make molecule CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCN1CCN(SC(=O)C[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(SC(=O)C[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCN1CCN(CC(=C=O)C[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(CC(=C=O)C[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCN1CCN(C(=O)CCCC(=O)[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(C(=O)CCCC(=O)[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCN1CCN(C(=O)CC(C)(C)[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(C(=O)CC(C)(C)[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCN1CCN(C[S@+]([O-])CCC[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(C(=O)[C@@H]2C[C@@H]2C)CC1 | CCOC(=O)CCN1CCN(C[S@+]([O-])CCC[C@@H]2C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C47=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CCC(CO)=Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CCCC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CC(=O)SNc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CCCCC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CC(=O)Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | CCC(C=O)=Nc1cc(NC(=O)N[C@@H](CCO)c2cccs2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC3=O"
} |
Can you make molecule Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(N)nc(SCCCCn2c(=O)oc3cccnc32)n1 | Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 | Nc1cc(N)nc(SCCCCn2c(=O)oc3cccnc32)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(N)nc(SCCCCCn2c(=O)oc3cccnc32)n1 | Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 | Nc1cc(N)nc(SCCCCCn2c(=O)oc3cccnc32)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(N)nc(SC2CC(n3c(=O)oc4cccnc43)C2)n1 | Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 | Nc1cc(N)nc(SC2CC(n3c(=O)oc4cccnc43)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCn1c(=O)oc2cccnc21)Sc1nc(N)cc(N)n1 | Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 | C[C@@H](CCn1c(=O)oc2cccnc21)Sc1nc(N)cc(N)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(N)nc(SC2CCC(n3c(=O)oc4cccnc43)CC2)n1 | Nc1cc(N)nc(SCCn2c(=O)oc3cccnc32)n1 | Nc1cc(N)nc(SC2CCC(n3c(=O)oc4cccnc43)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2snc(C(=O)C3=Cc4ccccc4OC=C3)c2N)c(OC)c1 | COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | COc1ccc(-c2snc(C(=O)C3=Cc4ccccc4OC=C3)c2N)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N47"
} |
Can you make molecule COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SC(=S)N(C)C(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | COc1ccc(SC(=S)N(C)C(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N47"
} |
Can you make molecule COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cc(C(=O)C3=Cc4ccccc4OC=C3)oc2N)c(OC)c1 | COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | COc1ccc(-c2cc(C(=O)C3=Cc4ccccc4OC=C3)oc2N)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N47"
} |
Can you make molecule COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SC2=NCCN2C(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | COc1ccc(SC2=NCCN2C(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N47"
} |
Can you make molecule COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C2CCN(CC(=O)C3=Cc4ccccc4OC=C3)CC2)c(OC)c1 | COc1ccc(NC(=O)C2=Cc3ccccc3OC=C2)c(OC)c1 | COc1ccc(C2CCN(CC(=O)C3=Cc4ccccc4OC=C3)CC2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N47"
} |
Can you make molecule COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | COCc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | COCSc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1nc(SC(C)=O)cc(C(=O)N[C@H]2CC(=O)N(C)C2)n1 | COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | COc1nc(SC(C)=O)cc(C(=O)N[C@H]2CC(=O)N(C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1nc(C(=O)CS)cc(C(=O)N[C@H]2CC(=O)N(C)C2)n1 | COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | COc1nc(C(=O)CS)cc(C(=O)N[C@H]2CC(=O)N(C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1nc(C(=O)CI)cc(C(=O)N[C@H]2CC(=O)N(C)C2)n1 | COc1cc(C(=O)N[C@H]2CC(=O)N(C)C2)nc(OC)n1 | COc1nc(C(=O)CI)cc(C(=O)N[C@H]2CC(=O)N(C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1nc(CCCCOc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(CCCCOc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C36"
} |
Can you make molecule O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1nc(CCCCCOc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(CCCCCOc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C36"
} |
Can you make molecule O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1nc(C2CC(Oc3ccc(Cl)cc3)C2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(C2CC(Oc3ccc(Cl)cc3)C2)n[nH]1)NNc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C36"
} |
Can you make molecule O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1nc(SC(=S)OOc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(SC(=S)OOc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C36"
} |
Can you make molecule O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1nc(NC(=S)SOc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(COc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | O=C(Cc1nc(NC(=S)SOc2ccc(Cl)cc2)n[nH]1)NNc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C36"
} |
Can you make molecule O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccc(F)cc1)Nc1cnn(C=C2CCC2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(C=C2CCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CCCCC2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccc(F)cc1)Nc1cnn(C=C2CCCC2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(C=C2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2SCCCS2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2SCCCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2SCSCS2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2CC2)c1 | O=C(CCc1ccc(F)cc1)Nc1cnn(CC2SCSCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N2CCCCC2)cn1.Cn1ccnc1.Cn1cnncc1=O | CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 | CCn1cc(C(=O)N2CCCCC2)cn1.Cn1ccnc1.Cn1cnncc1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&c(=O)n1C",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N2CCCCC2)cn1.Cc1cnnc2ccnn12.Cn1ccnc1 | CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 | CCn1cc(C(=O)N2CCCCC2)cn1.Cc1cnnc2ccnn12.Cn1ccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2c&cnn2c1C",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N2CCCCC2)cn1.Cc1cncnn1.Cn1ccnc1 | CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 | CCn1cc(C(=O)N2CCCCC2)cn1.Cc1cncnn1.Cn1ccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc(C)c&n1",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N2CCCCC2)cn1.Cn1ccnc1.Cn1ccnc1 | CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 | CCn1cc(C(=O)N2CCCCC2)cn1.Cn1ccnc1.Cn1ccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&n1C",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N2CCCCC2)cn1.Cn1cccn1.Cn1ccnc1 | CCn1cc(C(=O)N2CCC(c3nnc(Cn4ccnc4)n3C)CC2)cn1 | CCn1cc(C(=O)N2CCCCC2)cn1.Cn1cccn1.Cn1ccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nn1C",
"old_substring": "c1%10nnc9n1C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.