prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3Cl)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3Cl)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1Cl",
"old_substring": "c18ccc(C#N)cc1"
} |
Can you make molecule CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)c(Cl)c3)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)c(Cl)c3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)c(Cl)c1",
"old_substring": "c18ccc(C#N)cc1"
} |
Can you make molecule CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C)cc3Cl)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C)cc3Cl)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c18ccc(C#N)cc1"
} |
Can you make molecule CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(Cl)cc3I)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(Cl)cc3I)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c18ccc(C#N)cc1"
} |
Can you make molecule CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2[nH]c(SCC(=O)Nc3cc(C#N)ccc3I)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3ccc(C#N)cc3)nc2c1 | CCOc1ccc2[nH]c(SCC(=O)Nc3cc(C#N)ccc3I)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C#N)ccc1I",
"old_substring": "c18ccc(C#N)cc1"
} |
Can you make molecule CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cccc(CNC(=O)N2CCCCCC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N15CCSCC1"
} |
Can you make molecule CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cccc(CNC(=O)N2CCSC(C)(C)C2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCSC(C)(C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC(C)(C)C1",
"old_substring": "N15CCSCC1"
} |
Can you make molecule CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cccc(CNC(=O)N2CCCCCCC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N15CCSCC1"
} |
Can you make molecule CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cccc(CNC(=O)N2CCC(C)CC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCC(C)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N15CCSCC1"
} |
Can you make molecule CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cccc(CNC(=O)N2CCCCCCCC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCSCC2)c1 | CCCC(=O)Nc1cccc(CNC(=O)N2CCCCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N15CCSCC1"
} |
Can you make molecule CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC[C@@H](N)C(=O)[C@@H](c1ccccc1C)N(C)C | CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C | CCCCCC[C@@H](N)C(=O)[C@@H](c1ccccc1C)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N23C"
} |
Can you make molecule CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC1=NCCN1C(=O)[C@@H](c1ccccc1C)N(C)C | CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C | CCCCCC1=NCCN1C(=O)[C@@H](c1ccccc1C)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N23C"
} |
Can you make molecule CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1oc(C(=O)[C@@H](c2ccccc2C)N(C)C)nc1C#N | CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C | CCCCc1oc(C(=O)[C@@H](c2ccccc2C)N(C)C)nc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N23C"
} |
Can you make molecule CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1sc(C(=O)[C@@H](c2ccccc2C)N(C)C)cc1C#N | CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C | CCCCc1sc(C(=O)[C@@H](c2ccccc2C)N(C)C)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N23C"
} |
Can you make molecule CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1ccc(C(=O)[C@@H](c2ccccc2C)N(C)C)cc1C#N | CCCCN(C)C(=O)[C@@H](c1ccccc1C)N(C)C | CCCCc1ccc(C(=O)[C@@H](c2ccccc2C)N(C)C)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N23C"
} |
Can you make molecule Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OSC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OSC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC(=O)CCCC(=O)c2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC(=O)CCCC(=O)c2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C6"
} |
Can you make molecule Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC(=O)CC(C)(C)c2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC(=O)CC(C)(C)c2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC[S@+]([O-])CCCc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC[S@+]([O-])CCCc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC(=O)CCC(C)(C)c2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC(=O)Cc2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | Cc1cc(OC(=O)CCC(C)(C)c2cccs2)cc2c1C(=O)C(=Cc1ccccn1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | C=CS[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | C=CCC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CCCCl)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | CC[NH+](CCCCl)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CCCCS)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | CC[NH+](CCCCS)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CCCBr)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | CC[NH+](CC)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | CC[NH+](CCCBr)CCN1C(N)=[NH+]C[C@@]12CCCC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccccc2c1CC(=O)SNc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1CC(=O)SNc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccccc2c1C(=O)CCCC(=O)Nc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1C(=O)CCCC(=O)Nc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccccc2c1C(C)(C)CC(=O)Nc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1C(C)(C)CC(=O)Nc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccccc2c1C(C)(C)CCC(=O)Nc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1C(C)(C)CCC(=O)Nc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccccc2c1[C@H](C)C(=O)SNc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1C(=O)Nc1ccn(-c2ncccc2Cl)n1 | Cc1[nH]c2ccccc2c1[C@H](C)C(=O)SNc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)c1cc(C[NH+]2CCCCC2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCCCC2)on1)c1cn(C)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCC1",
"old_substring": "[NH+]15CCC(O)CC1"
} |
Can you make molecule C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)c1cc(C[NH+]2CC(C)(C)C2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CC(C)(C)C2)on1)c1cn(C)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC(C)(C)C1",
"old_substring": "[NH+]15CCC(O)CC1"
} |
Can you make molecule C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)c1cc(C[NH+]2CCCSCC2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCCSCC2)on1)c1cn(C)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCSCC1",
"old_substring": "[NH+]15CCC(O)CC1"
} |
Can you make molecule C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)c1cc(C[NH+]2CCCCCC2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCCCCC2)on1)c1cn(C)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]15CCC(O)CC1"
} |
Can you make molecule C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)c1cc(C[NH+]2CCCC2(C)C)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCC(O)CC2)on1)c1cn(C)c2ccccc12 | C[C@@H](NC(=O)c1cc(C[NH+]2CCCC2(C)C)on1)c1cn(C)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]15CCC(O)CC1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2ccc(I)o2)n1-c1ccccc1)c1c[nH]c2ccccc12 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 | O=C(CSc1nnc(-c2ccc(I)o2)n1-c1ccccc1)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2ccc(Br)o2)n1-c1ccccc1)c1c[nH]c2ccccc12 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 | O=C(CSc1nnc(-c2ccc(Br)o2)n1-c1ccccc1)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2ccc(Cl)o2)n1-c1ccccc1)c1c[nH]c2ccccc12 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 | O=C(CSc1nnc(-c2ccc(Cl)o2)n1-c1ccccc1)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2occc2Br)n1-c1ccccc1)c1c[nH]c2ccccc12 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 | O=C(CSc1nnc(-c2occc2Br)n1-c1ccccc1)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1-c1nnc(SCC(=O)c2c[nH]c3ccccc23)n1-c1ccccc1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1c[nH]c2ccccc12 | Cc1ccsc1-c1nnc(SCC(=O)c2c[nH]c3ccccc23)n1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c17ccco1"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)CNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@H](C)CNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](C)C&",
"old_substring": "CC(C)[C@H](O)CC5"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](CS)CNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@@H](CS)CNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](C&)CS",
"old_substring": "CC(C)[C@H](O)CC5"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)CC(=O)NC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@@H](C)CC(=O)NC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H](C)CC&=O",
"old_substring": "CC(C)[C@H](O)CC5"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](CCl)CNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@@H](CCl)CNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](C&)CCl",
"old_substring": "CC(C)[C@H](O)CC5"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](Br)C(=O)NC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@H](O)CCNC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | CC(C)[C@H](Br)C(=O)NC(=O)Nc1ncn(Cc2ccc(C#N)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](Br)C&=O",
"old_substring": "CC(C)[C@H](O)CC5"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@H]2CC(Cc3ccc(F)cc3)=NO2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@H]2CC(Cc3ccc(F)cc3)=NO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(C&)=NO1",
"old_substring": "[C@@H]19CC(=O)N8C1"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CCN(Cc3ccc(F)cc3)C2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CCN(Cc3ccc(F)cc3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCN(C&)C1",
"old_substring": "[C@@H]19CC(=O)N8C1"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@H]2C=C(Cc3ccc(F)cc3)ON2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@H]2C=C(Cc3ccc(F)cc3)ON2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C(C&)ON1",
"old_substring": "[C@@H]19CC(=O)N8C1"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2C=C(Cc3ccc(F)cc3)N=N2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2C=C(Cc3ccc(F)cc3)N=N2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]19CC(=O)N8C1"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CCCCN(c3ccc(F)cc3)C2=O)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1nnc([C@@H]2CCCCN(c3ccc(F)cc3)C2=O)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCN&C1=O",
"old_substring": "[C@@H]19CC(=O)N8C1"
} |
Can you make molecule Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC(=O)SNC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(CC(=O)SNC[C@H](CCO)c2ccccc2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)CCCC(=O)NC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(C(=O)CCCC(=O)NC[C@H](CCO)c2ccccc2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(C)(C)CC(=O)NC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(C(C)(C)CC(=O)NC[C@H](CCO)c2ccccc2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(C)(C)CCC(=O)NC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(C(C)(C)CCC(=O)NC[C@H](CCO)c2ccccc2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@H](C)C(=O)SNC[C@H](CCO)c2ccccc2)nn1C | Cc1cc(C(=O)NC[C@H](CCO)c2ccccc2)nn1C | Cc1cc([C@H](C)C(=O)SNC[C@H](CCO)c2ccccc2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2cc(C(F)(F)CBr)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(C(F)(F)CBr)c3c(C)noc3n2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)CBr",
"old_substring": "C5(F)F"
} |
Can you make molecule CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2cc(SC(F)(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(SC(F)(F)F)c3c(C)noc3n2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C5(F)F"
} |
Can you make molecule CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2cc(CCCC(F)(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(CCCC(F)(F)F)c3c(C)noc3n2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(F)F"
} |
Can you make molecule CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2cc(CCCCC(F)(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(CCCCC(F)(F)F)c3c(C)noc3n2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5(F)F"
} |
Can you make molecule CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2cc(CC(F)(F)C(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(C(F)F)c3c(C)noc3n2)c(C)n1 | CCn1cc(-c2cc(CC(F)(F)C(F)F)c3c(C)noc3n2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "C5(F)F"
} |
Can you make molecule O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CC[C@@H](CCS(=O)(=O)[O-])O1)c1ccc(Br)c(F)c1 | O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 | O=C(NC[C@H]1CC[C@@H](CCS(=O)(=O)[O-])O1)c1ccc(Br)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CC[C@@H](C(=O)CO)O1)c1ccc(Br)c(F)c1 | O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 | O=C(NC[C@H]1CC[C@@H](C(=O)CO)O1)c1ccc(Br)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CC[C@@H](C(O)O)O1)c1ccc(Br)c(F)c1 | O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 | O=C(NC[C@H]1CC[C@@H](C(O)O)O1)c1ccc(Br)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CC[C@@H](C(F)(F)C(=O)[O-])O1)c1ccc(Br)c(F)c1 | O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 | O=C(NC[C@H]1CC[C@@H](C(F)(F)C(=O)[O-])O1)c1ccc(Br)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])[C@@H]1CC[C@H](CNC(=O)c2ccc(Br)c(F)c2)O1 | O=C(NC[C@H]1CC[C@@H](C(=O)[O-])O1)c1ccc(Br)c(F)c1 | CCC(CC)(C(=O)[O-])[C@@H]1CC[C@H](CNC(=O)c2ccc(Br)c(F)c2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1c[nH]c(=O)[nH]c1=O)N1Cc2nc(-c3ccc(F)cc3F)sc2C1 | O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O | O=C(Nc1c[nH]c(=O)[nH]c1=O)N1Cc2nc(-c3ccc(F)cc3F)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N24"
} |
Can you make molecule O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1c[nH]c(=O)[nH]c1=O)N1CCc2cc(-c3ccc(F)cc3F)ccc21 | O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O | O=C(Nc1c[nH]c(=O)[nH]c1=O)N1CCc2cc(-c3ccc(F)cc3F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N24"
} |
Can you make molecule O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)Nc2c[nH]c(=O)[nH]c2=O)sc2nsc(-c3ccc(F)cc3F)c12 | O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O | Nc1c(C(=O)Nc2c[nH]c(=O)[nH]c2=O)sc2nsc(-c3ccc(F)cc3F)c12 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N24"
} |
Can you make molecule O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1c[nH]c(=O)[nH]c1=O)N1CCSc2ccc(-c3ccc(F)cc3F)cc21 | O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O | O=C(Nc1c[nH]c(=O)[nH]c1=O)N1CCSc2ccc(-c3ccc(F)cc3F)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "N24"
} |
Can you make molecule O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1c[nH]c(=O)[nH]c1=O)N1CCCn2nc(-c3ccc(F)cc3F)cc2C1 | O=C(Nc1ccc(F)cc1F)Nc1c[nH]c(=O)[nH]c1=O | O=C(Nc1c[nH]c(=O)[nH]c1=O)N1CCCn2nc(-c3ccc(F)cc3F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc2C1",
"old_substring": "N24"
} |
Can you make molecule CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C(=O)N1CCC[C@H](n2cc(I)cn2)C1)n1cncn1 | CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 | CC(C)[C@H](C(=O)N1CCC[C@H](n2cc(I)cn2)C1)n1cncn1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cn1",
"old_substring": "n15cccn1"
} |
Can you make molecule CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | C=Cn1cc([C@H]2CCCN(C(=O)[C@@H](C(C)C)n3cncn3)C2)cn1 | CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 | C=Cn1cc([C@H]2CCCN(C(=O)[C@@H](C(C)C)n3cncn3)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=Cn1cc&cn1",
"old_substring": "n15cccn1"
} |
Can you make molecule CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn([C@H]2CCCN(C(=O)[C@@H](C(C)C)n3cncn3)C2)nc1I | CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 | Cc1cn([C@H]2CCCN(C(=O)[C@@H](C(C)C)n3cncn3)C2)nc1I | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(C)c(I)n1",
"old_substring": "n15cccn1"
} |
Can you make molecule CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C(=O)N1CCC[C@H](n2ccsc2=O)C1)n1cncn1 | CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 | CC(C)[C@H](C(=O)N1CCC[C@H](n2ccsc2=O)C1)n1cncn1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccsc1=O",
"old_substring": "n15cccn1"
} |
Can you make molecule CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n([C@H]2CCCN(C(=O)[C@@H](C(C)C)n3cncn3)C2)n1 | CC(C)[C@H](C(=O)N1CCC[C@H](n2cccn2)C1)n1cncn1 | Cc1cc(C)n([C@H]2CCCN(C(=O)[C@@H](C(C)C)n3cncn3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc(C)cc1C",
"old_substring": "n15cccn1"
} |
Can you make molecule CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNSC(=O)C[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNSC(=O)C[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNCC(=C=O)C[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNCC(=C=O)C[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CCCC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNC(=O)CCCC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CC(C)(C)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNC(=O)CC(C)(C)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC[S@+]([O-])CCC[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNC(=O)[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | CCCNC[S@+]([O-])CCC[C@@H]1CCCN(C(=O)c2c[nH]c3cccc(F)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C47=O"
} |
Can you make molecule COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)c2C)c([N+](=O)[O-])c1 | COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 | COc1ccc(-c2csc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)c2C)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1C",
"old_substring": "c19ccc8o1"
} |
Can you make molecule COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cc3cc(C[NH2+][C@@H]4CC[C@H]([NH+](C)C)C4)ccc3o2)c([N+](=O)[O-])c1 | COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 | COc1ccc(-c2cc3cc(C[NH2+][C@@H]4CC[C@H]([NH+](C)C)C4)ccc3o2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&ccc2o1",
"old_substring": "c19ccc8o1"
} |
Can you make molecule COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cccc3cc(C[NH2+][C@@H]4CC[C@H]([NH+](C)C)C4)oc23)c([N+](=O)[O-])c1 | COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 | COc1ccc(-c2cccc3cc(C[NH2+][C@@H]4CC[C@H]([NH+](C)C)C4)oc23)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc2cc&oc12",
"old_substring": "c19ccc8o1"
} |
Can you make molecule COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2ccc3c(C[NH2+][C@@H]4CC[C@H]([NH+](C)C)C4)coc3c2)c([N+](=O)[O-])c1 | COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 | COc1ccc(-c2ccc3c(C[NH2+][C@@H]4CC[C@H]([NH+](C)C)C4)coc3c2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c&coc2c1",
"old_substring": "c19ccc8o1"
} |
Can you make molecule COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)cc3occc23)c([N+](=O)[O-])c1 | COc1ccc(-c2ccc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)o2)c([N+](=O)[O-])c1 | COc1ccc(-c2cc(C[NH2+][C@@H]3CC[C@H]([NH+](C)C)C3)cc3occc23)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2occc12",
"old_substring": "c19ccc8o1"
} |
Can you make molecule COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1CCN(C(C)(C)CC(=O)OC(C)(C)C)C[C@H]1O | COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O | COc1ccccc1[C@@H]1CCN(C(C)(C)CC(=O)OC(C)(C)C)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1CCN(C(C)(C)CCC(=O)OC(C)(C)C)C[C@H]1O | COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O | COc1ccccc1[C@@H]1CCN(C(C)(C)CCC(=O)OC(C)(C)C)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1CCN([C@H](Br)CC(=O)OC(C)(C)C)C[C@H]1O | COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O | COc1ccccc1[C@@H]1CCN([C@H](Br)CC(=O)OC(C)(C)C)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C=C(OOC(C)(C)C)c1ccc(N2CC[C@@H](c3ccccc3OC)[C@H](O)C2)cc1 | COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O | C=C(OOC(C)(C)C)c1ccc(N2CC[C@@H](c3ccccc3OC)[C@H](O)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(O&)c1ccc&cc1",
"old_substring": "C23=O"
} |
Can you make molecule COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(OC(C)(C)C)C(=O)CCN1CC[C@@H](c2ccccc2OC)[C@H](O)C1 | COc1ccccc1[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1O | CCC(CC)(OC(C)(C)C)C(=O)CCN1CC[C@@H](c2ccccc2OC)[C@H](O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C23=O"
} |
Can you make molecule O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C[N-]c1scnc1-c1ccc(F)cc1)c1nc(-c2ccccc2)cs1 | O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 | O=S(=O)(C[N-]c1scnc1-c1ccc(F)cc1)c1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=S(=O)(C&)c1nc&cs1",
"old_substring": "O=S2(=O)C4"
} |
Can you make molecule O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccccc1)S[N-]c1scnc1-c1ccc(F)cc1 | O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 | O=C(Cc1ccccc1)S[N-]c1scnc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "O=S2(=O)C4"
} |
Can you make molecule O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(O[N-]c1scnc1-c1ccc(F)cc1)c1ccc(-c2ccccc2)o1 | O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 | O=S(=O)(O[N-]c1scnc1-c1ccc(F)cc1)c1ccc(-c2ccccc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=S(=O)(O&)c1ccc&o1",
"old_substring": "O=S2(=O)C4"
} |
Can you make molecule O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1cc([N-]c2scnc2-c2ccc(F)cc2)[nH]c(=O)n1-c1ccccc1 | O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 | O=c1cc([N-]c2scnc2-c2ccc(F)cc2)[nH]c(=O)n1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=c1cc&[nH]c(=O)n1&",
"old_substring": "O=S2(=O)C4"
} |
Can you make molecule O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [O-][S@+](CCCc1ccccc1)C[N-]c1scnc1-c1ccc(F)cc1 | O=S(=O)(Cc1ccccc1)[N-]c1scnc1-c1ccc(F)cc1 | [O-][S@+](CCCc1ccccc1)C[N-]c1scnc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "O=S2(=O)C4"
} |
Can you make molecule CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](N(C)C(=O)CC(C)(C)Nc2cnccc2C)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)C(=O)CC(C)(C)Nc2cnccc2C)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](N(C)C(=O)CCC(C)(C)Nc2cnccc2C)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)C(=O)CCC(C)(C)Nc2cnccc2C)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](N(C)C(=O)C[C@@H](Br)Nc2cnccc2C)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)C(=O)C[C@@H](Br)Nc2cnccc2C)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](N(C)c2cc(C)n(Nc3cnccc3C)c(=O)c2)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)c2cc(C)n(Nc3cnccc3C)c(=O)c2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](N(C)c2c(C)n(Nc3cnccc3C)ccc2=O)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)C(=O)Nc2cnccc2C)[C@H](C)C1 | CC[NH+]1CC[C@@H](N(C)c2c(C)n(Nc3cnccc3C)ccc2=O)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.