prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 | CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 | C=CCC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)N1CC[C@H]([NH2+]Cc2cccc(C#N)c2)[C@H](CCCCl)C1 | CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 | CC(C)S(=O)(=O)N1CC[C@H]([NH2+]Cc2cccc(C#N)c2)[C@H](CCCCl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)N1CC[C@H]([NH2+]Cc2cccc(C#N)c2)[C@H](CCCCS)C1 | CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 | CC(C)S(=O)(=O)N1CC[C@H]([NH2+]Cc2cccc(C#N)c2)[C@H](CCCCS)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)N1CC[C@H]([NH2+]Cc2cccc(C#N)c2)[C@H](CCCBr)C1 | CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 | CC(C)S(=O)(=O)N1CC[C@H]([NH2+]Cc2cccc(C#N)c2)[C@H](CCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC5"
} |
Can you make molecule CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)N1CC[C@H]([NH2+]Cc2cccc(C#N)c2)[C@H](CCCCF)C1 | CC[C@@H]1CN(S(=O)(=O)C(C)C)CC[C@@H]1[NH2+]Cc1cccc(C#N)c1 | CC(C)S(=O)(=O)N1CC[C@H]([NH2+]Cc2cccc(C#N)c2)[C@H](CCCCF)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC5"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)c1ccc2c(c1)COCO2)C1=CCCCC1 | C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 | C[C@H](C(=O)c1ccc2c(c1)COCO2)C1=CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C1=CCCCC1",
"old_substring": "C[C@H]1CCC[C@H](C)N13"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCS)CCC(=O)c1ccc2c(c1)COCO2 | C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 | C[C@@H](CCS)CCC(=O)c1ccc2c(c1)COCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CCS",
"old_substring": "C[C@H]1CCC[C@H](C)N13"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCS)CCC(=O)c1ccc2c(c1)COCO2 | C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 | C[C@H](CCS)CCC(=O)c1ccc2c(c1)COCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CCS",
"old_substring": "C[C@H]1CCC[C@H](C)N13"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCBr)CCC(=O)c1ccc2c(c1)COCO2 | C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 | C[C@@H](CCBr)CCC(=O)c1ccc2c(c1)COCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CCBr",
"old_substring": "C[C@H]1CCC[C@H](C)N13"
} |
Can you make molecule C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCBr)CCC(=O)c1ccc2c(c1)COCO2 | C[C@H]1CCC[C@H](C)N1C(=O)c1ccc2c(c1)COCO2 | C[C@H](CCBr)CCC(=O)c1ccc2c(c1)COCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CCBr",
"old_substring": "C[C@H]1CCC[C@H](C)N13"
} |
Can you make molecule O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1cccc(O)c1)N1CCC[C@H](CN2CCOCC2)CC1 | O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 | O=C(NCCc1cccc(O)c1)N1CCC[C@H](CN2CCOCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H]&CC1",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1cccc(O)c1)N1CCCC[C@@H](CN2CCOCC2)C1 | O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 | O=C(NCCc1cccc(O)c1)N1CCCC[C@@H](CN2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC[C@@H]&C1",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@H](CN2CCOCC2)CN1C(=O)NCCc1cccc(O)c1 | O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 | C[C@@H]1CC[C@@H](CN2CCOCC2)CN1C(=O)NCCc1cccc(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H]&CC[C@H]1C",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@H](CN2CCOCC2)CCN1C(=O)NCCc1cccc(O)c1 | O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 | C[C@@H]1C[C@@H](CN2CCOCC2)CCN1C(=O)NCCc1cccc(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&C[C@H]1C",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCCN1CCOCC1)C(=O)NCCc1cccc(O)c1 | O=C(NCCc1cccc(O)c1)N1CCC[C@H]1CN1CCOCC1 | CCC[C@@H](CCCN1CCOCC1)C(=O)NCCc1cccc(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC([O-])=C2C[NH+](Cc3ccc(I)o3)CN=C2N1c1ccccc1F | O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F | O=C1NC([O-])=C2C[NH+](Cc3ccc(I)o3)CN=C2N1c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c15ccco1"
} |
Can you make molecule O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC([O-])=C2C[NH+](Cc3ccc(Br)o3)CN=C2N1c1ccccc1F | O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F | O=C1NC([O-])=C2C[NH+](Cc3ccc(Br)o3)CN=C2N1c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c15ccco1"
} |
Can you make molecule O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC([O-])=C2C[NH+](Cc3ccc(Cl)o3)CN=C2N1c1ccccc1F | O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F | O=C1NC([O-])=C2C[NH+](Cc3ccc(Cl)o3)CN=C2N1c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c15ccco1"
} |
Can you make molecule O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC([O-])=C2C[NH+](Cc3occc3Br)CN=C2N1c1ccccc1F | O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F | O=C1NC([O-])=C2C[NH+](Cc3occc3Br)CN=C2N1c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c15ccco1"
} |
Can you make molecule O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1C[NH+]1CN=C2C(=C([O-])NC(=O)N2c2ccccc2F)C1 | O=C1NC([O-])=C2C[NH+](Cc3ccco3)CN=C2N1c1ccccc1F | Cc1ccsc1C[NH+]1CN=C2C(=C([O-])NC(=O)N2c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c15ccco1"
} |
Can you make molecule Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(SC(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(SC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(CCCC(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(CCCC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(CCCCC(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(CCCCC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)C(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(CC(F)(F)C(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 | Cc1c(O)cccc1C(=O)N1C[C@@H](O)C[C@@H]1c1cccc(CC(F)(F)C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CN(Cc1ccccc1Cl)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1ccccc1Cl)Oc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CN(Cc1ccc(I)cc1)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1ccc(I)cc1)Oc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CN(Cc1ccc(C)c(I)c1)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1ccc(C)c(I)c1)Oc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CN(Cc1cccc(Br)c1)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1cccc(Br)c1)Oc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CN(Cc1cccc(C)c1C)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1ccccc1)Oc1ccc(Cl)cc1 | COC(=O)CN(Cc1cccc(C)c1C)Oc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccc(Cl)cn12 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccc(Cl)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2ccc(Cl)cn12",
"old_substring": "c14nnc2ccccn12"
} |
Can you make molecule C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1ncc2ccccn12 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1ncc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc2ccccn12",
"old_substring": "c14nnc2ccccn12"
} |
Can you make molecule C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1cnn2ccccc12 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1cnn2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnn2ccccc12",
"old_substring": "c14nnc2ccccn12"
} |
Can you make molecule C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1c2ccccc(N[C@H]3CCc4c(Cl)cc(Cl)cc43)sc3nnc1n23 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 | C[C@H]1c2ccccc(N[C@H]3CCc4c(Cl)cc(Cl)cc43)sc3nnc1n23 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2sc3ccccc3n12",
"old_substring": "c14nnc2ccccn12"
} |
Can you make molecule C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nncc2ccccc12 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nnc2ccccn12 | C[C@@H](N[C@H]1CCc2c(Cl)cc(Cl)cc21)c1nncc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nncc2ccccc12",
"old_substring": "c14nnc2ccccn12"
} |
Can you make molecule Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2ccncc2Cl)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1ccc(-c2ccncc2Cl)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c18ccncc1"
} |
Can you make molecule Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2ccccc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1ccc(-c2ccccc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c18ccncc1"
} |
Can you make molecule Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cnccc2Cl)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1ccc(-c2cnccc2Cl)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c18ccncc1"
} |
Can you make molecule Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cc(Br)ncc2F)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1ccc(-c2cc(Br)ncc2F)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c18ccncc1"
} |
Can you make molecule Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2ccc(C)c(NC(=O)C(=O)N[C@H]3CC[C@@H]([NH+](C)C)C3)c2)ncc1Br | Cc1ccc(-c2ccncc2)cc1NC(=O)C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1cc(-c2ccc(C)c(NC(=O)C(=O)N[C@H]3CC[C@@H]([NH+](C)C)C3)c2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "c18ccncc1"
} |
Can you make molecule COC[C@](C)(O)C1(C#N)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@](C)(O)CCC1(C#N)CCCC1 | COC[C@](C)(O)C1(C#N)CCCC1 | COC[C@](C)(O)CCC1(C#N)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@](C)(O)CC&",
"old_substring": "C2[C@]3(C)O"
} |
Can you make molecule COC[C@](C)(O)C1(C#N)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@@H](C)CC(=O)C1(C#N)CCCC1 | COC[C@](C)(O)C1(C#N)CCCC1 | COCC[C@@H](C)CC(=O)C1(C#N)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C2[C@]3(C)O"
} |
Can you make molecule COC[C@](C)(O)C1(C#N)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@](C)(CO)CCCC1(C#N)CCCC1 | COC[C@](C)(O)C1(C#N)CCCC1 | CO[C@@](C)(CO)CCCC1(C#N)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@]&(CO)CCC&",
"old_substring": "C2[C@]3(C)O"
} |
Can you make molecule COC[C@](C)(O)C1(C#N)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@H](C)CC(=O)C1(C#N)CCCC1 | COC[C@](C)(O)C1(C#N)CCCC1 | COCC[C@H](C)CC(=O)C1(C#N)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C2[C@]3(C)O"
} |
Can you make molecule COC[C@](C)(O)C1(C#N)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@@H](Cl)CCC1(C#N)CCCC1 | COC[C@](C)(O)C1(C#N)CCCC1 | COC[C@@H](Cl)CCC1(C#N)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cl[C@H](C&)CC&",
"old_substring": "C2[C@]3(C)O"
} |
Can you make molecule Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1SN1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 | Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 | Cc1ccccc1SN1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCN=C1CC(=O)[C@@]12CC[C@@H](C[C@@H]1Br)C2 | Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 | Cc1ccccc1N1CCN=C1CC(=O)[C@@]12CC[C@@H](C[C@@H]1Br)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)C1=O | Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 | Cc1ccccc1N1CCCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCN=C1SC(=O)[C@@]12CC[C@@H](C[C@@H]1Br)C2 | Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 | Cc1ccccc1N1CCN=C1SC(=O)[C@@]12CC[C@@H](C[C@@H]1Br)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)C(C)(C)C1 | Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)CC1 | Cc1ccccc1N1CCN(C(=O)[C@@]23CC[C@@H](C[C@@H]2Br)C3)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)Cc1nc2c(s1)CN(C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1)C2 | CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | CCC(CC)Cc1nc2c(s1)CN(C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N24"
} |
Can you make molecule CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)Cn1ncc2c1CN(C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1)C2 | CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | CCC(CC)Cn1ncc2c1CN(C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N24"
} |
Can you make molecule CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)Cc1onc2c1CN(C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1)CC2 | CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | CCC(CC)Cc1onc2c1CN(C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N24"
} |
Can you make molecule CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)Cc1cc2n(n1)CCCN2C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | CCC(CC)Cc1cc2n(n1)CCCN2C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N24"
} |
Can you make molecule CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)Cc1ccc2c(c1)CCN2C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | CCC(CC)CNC(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | CCC(CC)Cc1ccc2c(c1)CCN2C(=O)N[C@H]1CCC[C@H](S(C)(=O)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N24"
} |
Can you make molecule C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1ccccc1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c15ccccn1"
} |
Can you make molecule C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(I)cn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1ccc(I)cn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cn1",
"old_substring": "c15ccccn1"
} |
Can you make molecule C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(Cl)n1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1cccc(Cl)n1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Cl)n1",
"old_substring": "c15ccccn1"
} |
Can you make molecule C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cc(Br)ccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1cc(Br)ccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccn1",
"old_substring": "c15ccccn1"
} |
Can you make molecule C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cc2sccn2c1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1ccccn1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | C[C@@H](c1cc2sccn2c1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccn2c1",
"old_substring": "c15ccccn1"
} |
Can you make molecule CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+]1CCC(NCCC(CO)=C2CC=CC2)CC1 | CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 | CCCC[NH+]1CCC(NCCC(CO)=C2CC=CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C36=O"
} |
Can you make molecule CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+]1CCC(NSC(=O)CC2CC=CC2)CC1 | CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 | CCCC[NH+]1CCC(NSC(=O)CC2CC=CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+]1CCC(N=CC(=O)C=C2CC=CC2)CC1 | CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 | CCCC[NH+]1CCC(N=CC(=O)C=C2CC=CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C(=O)C=&",
"old_substring": "C36=O"
} |
Can you make molecule CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+]1CCC(NCC(=C=O)CC2CC=CC2)CC1 | CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 | CCCC[NH+]1CCC(NCC(=C=O)CC2CC=CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+]1CCC(NC(=O)CCCC(=O)C2CC=CC2)CC1 | CCCC[NH+]1CCC(NC(=O)C2CC=CC2)CC1 | CCCC[NH+]1CCC(NC(=O)CCCC(=O)C2CC=CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | OC1(SC(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(SC(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | OC1(CCCC(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(CCCC(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | OC1(CCCCC(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(CCCCC(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | OC1(CC(F)(F)C(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(CC(F)(F)C(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | OC1(C(F)(F)C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | OC1(C(F)(F)C(F)(F)F)[C@@H]2CC[C@H]1C[NH+](Cc1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | C=CSOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | C=CCCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CO[C@](NC(=O)Nc1cccc(C)n1)(C(=O)OCCCCl)C(F)(F)F | CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | CO[C@](NC(=O)Nc1cccc(C)n1)(C(=O)OCCCCl)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CO[C@](NC(=O)Nc1cccc(C)n1)(C(=O)OCCCCS)C(F)(F)F | CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | CO[C@](NC(=O)Nc1cccc(C)n1)(C(=O)OCCCCS)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | CO[C@](NC(=O)Nc1cccc(C)n1)(C(=O)OCCCBr)C(F)(F)F | CCOC(=O)[C@@](NC(=O)Nc1cccc(C)n1)(OC)C(F)(F)F | CO[C@](NC(=O)Nc1cccc(C)n1)(C(=O)OCCCBr)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC5"
} |
Can you make molecule COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | COCc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO6"
} |
Can you make molecule COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | COCSc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO6"
} |
Can you make molecule COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | CC(=O)Sc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO6"
} |
Can you make molecule COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1cccnc1C(=O)CS)N[C@@H]1C[C@H]2CCCc3cccc1c32 | COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | O=C(NCc1cccnc1C(=O)CS)N[C@@H]1C[C@H]2CCCc3cccc1c32 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO6"
} |
Can you make molecule COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1cccnc1C(=O)CI)N[C@@H]1C[C@H]2CCCc3cccc1c32 | COc1ncccc1CNC(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 | O=C(NCc1cccnc1C(=O)CI)N[C@@H]1C[C@H]2CCCc3cccc1c32 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO6"
} |
Can you make molecule CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(F)(F)F.CC[C@@H]1CC(=O)N2CCCN1CC2 | CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 | CC(F)(F)F.CC[C@@H]1CC(=O)N2CCCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&CC&=O",
"old_substring": "CC[C@@H]2CC[NH3+]"
} |
Can you make molecule CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(F)(F)F.CC[C@H]1CC(=O)N2CCCN1CC2 | CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 | CC(F)(F)F.CC[C@H]1CC(=O)N2CCCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&CC&=O",
"old_substring": "CC[C@@H]2CC[NH3+]"
} |
Can you make molecule CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(F)(F)F.CC[C@H]1N2CCCN(CC2)C[S@@+]1[O-] | CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 | CC(F)(F)F.CC[C@H]1N2CCCN(CC2)C[S@@+]1[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&[S@](=O)C&",
"old_substring": "CC[C@@H]2CC[NH3+]"
} |
Can you make molecule CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(F)(F)F.C[C@@H]1[C@H](O)CCN2CCCN1CC2 | CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 | CC(F)(F)F.C[C@@H]1[C@H](O)CCN2CCCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H](O)[C@H]&C",
"old_substring": "CC[C@@H]2CC[NH3+]"
} |
Can you make molecule CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(F)(F)F.Cl[C@H]1CCN2CCCN1CC2 | CC[C@H](CC[NH3+])N1CCCN(CC(F)(F)F)CC1 | CC(F)(F)F.Cl[C@H]1CCN2CCCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "CC[C@@H]2CC[NH3+]"
} |
Can you make molecule CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc(CCCC[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(CCCC[NH2+]C3CC3)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C47"
} |
Can you make molecule CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc(CCCCC[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(CCCCC[NH2+]C3CC3)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C47"
} |
Can you make molecule CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc(C3CC([NH2+]C4CC4)C3)cc2F)CC1 | CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(C3CC([NH2+]C4CC4)C3)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C47"
} |
Can you make molecule CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc(SC(=S)O[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(SC(=S)O[NH2+]C3CC3)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C47"
} |
Can you make molecule CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2ccc(NC(=S)S[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(C[NH2+]C3CC3)cc2F)CC1 | CC1CCN(c2ccc(NC(=S)S[NH2+]C3CC3)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C47"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NSC(=O)Cc2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NSC(=O)Cc2cccs2)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)CCCC(=O)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)CCCC(=O)c2cccs2)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)CC(C)(C)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)CC(C)(C)c2cccs2)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)CCC(C)(C)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)CCC(C)(C)c2cccs2)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NSC(=O)[C@@H](C)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NC(=O)c2cccs2)C(C)C)cc1 | CCS(=O)(=O)c1ccc(NC(=O)[C@@H](NSC(=O)[C@@H](C)c2cccs2)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc(S(=O)(=O)N2CCS[C@@H](CC(=O)[O-])C2)c1 | Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 | Cn1ccc(S(=O)(=O)N2CCS[C@@H](CC(=O)[O-])C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCS[C@@H]&C1",
"old_substring": "N13CCO[C@H]4C1"
} |
Can you make molecule Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@@H](CC(=O)[O-])CCN1S(=O)(=O)c1ccn(C)c1 | Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 | C[C@@H]1[C@@H](CC(=O)[O-])CCN1S(=O)(=O)c1ccn(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&[C@H]1C",
"old_substring": "N13CCO[C@H]4C1"
} |
Can you make molecule Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](CC(=O)[O-])CCN1S(=O)(=O)c1ccn(C)c1 | Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 | C[C@H]1[C@@H](CC(=O)[O-])CCN1S(=O)(=O)c1ccn(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&[C@@H]1C",
"old_substring": "N13CCO[C@H]4C1"
} |
Can you make molecule Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@H](CC(=O)[O-])CCN1S(=O)(=O)c1ccn(C)c1 | Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 | C[C@@H]1C[C@@H](CC(=O)[O-])CCN1S(=O)(=O)c1ccn(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H]&C[C@H]1C",
"old_substring": "N13CCO[C@H]4C1"
} |
Can you make molecule Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc(S(=O)(=O)N2CCC[C@@](O)(CC(=O)[O-])CC2)c1 | Cn1ccc(S(=O)(=O)N2CCO[C@H](CC(=O)[O-])C2)c1 | Cn1ccc(S(=O)(=O)N2CCC[C@@](O)(CC(=O)[O-])CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@]&(O)CC1",
"old_substring": "N13CCO[C@H]4C1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.