prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | O=C(/C=C/Sc1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc([C@H]2CCC[NH+](Cc3c[nH]cn3)C2)nc1-c1ccc(F)cc1 | O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | O=Cc1sc([C@H]2CCC[NH+](Cc3c[nH]cn3)C2)nc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc([C@H]2CCC[NH+](Cc3c[nH]cn3)C2)sc1-c1ccc(F)cc1 | O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | O=Cc1nc([C@H]2CCC[NH+](Cc3c[nH]cn3)C2)sc1-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(-c2ccc(/C=N/O[C@H]3CCC[NH+](Cc4c[nH]cn4)C3)o2)cc1 | O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | Fc1ccc(-c2ccc(/C=N/O[C@H]3CCC[NH+](Cc4c[nH]cn4)C3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C45"
} |
Can you make molecule O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(c2ccc(F)cc2)CC1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | O=C(c1ccc(F)cc1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | O=C(NN=C1CCC(c2ccc(F)cc2)CC1)[C@H]1CCC[NH+](Cc2c[nH]cn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C45"
} |
Can you make molecule Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1cccc(-c2ccc(CCCC[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | Clc1cccc(-c2ccc(CCCC[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C57"
} |
Can you make molecule Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1cccc(-c2ccc(CCCCC[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | Clc1cccc(-c2ccc(CCCCC[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C57"
} |
Can you make molecule Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1cccc(-c2ccc(C3CC([NH2+]Cc4ccc5c(c4)OCO5)C3)o2)c1 | Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | Clc1cccc(-c2ccc(C3CC([NH2+]Cc4ccc5c(c4)OCO5)C3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C57"
} |
Can you make molecule Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(O[NH2+]Cc1ccc2c(c1)OCO2)Sc1ccc(-c2cccc(Cl)c2)o1 | Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | S=C(O[NH2+]Cc1ccc2c(c1)OCO2)Sc1ccc(-c2cccc(Cl)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C57"
} |
Can you make molecule Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(Nc1ccc(-c2cccc(Cl)c2)o1)S[NH2+]Cc1ccc2c(c1)OCO2 | Clc1cccc(-c2ccc(C[NH2+]Cc3ccc4c(c3)OCO4)o2)c1 | S=C(Nc1ccc(-c2cccc(Cl)c2)o1)S[NH2+]Cc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C57"
} |
Can you make molecule O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncc(-c2ccccc2)s1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&s1",
"old_substring": "c16nc8ns1"
} |
Can you make molecule O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncc(-c2ccccc2)s1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1nc&sc1&",
"old_substring": "c16nc8ns1"
} |
Can you make molecule O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncnc2sc(-c3ccccc3)cc12 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncnc2sc(-c3ccccc3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc2sc&cc12",
"old_substring": "c16nc8ns1"
} |
Can you make molecule O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncnc2cc(-c3ccccc3)sc12 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1ncnc2cc(-c3ccccc3)sc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc2cc&sc12",
"old_substring": "c16nc8ns1"
} |
Can you make molecule O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc2c(-c3ccccc3)nccc2s1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc(-c2ccccc2)ns1 | O=C(NC[C@H]1CCC[C@@H]1O)Nc1nc2c(-c3ccccc3)nccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c&nccc2s1",
"old_substring": "c16nc8ns1"
} |
Can you make molecule C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CS(C)(=O)=O)NC(=O)c1cc(C#N)c(Cc2ccc(Cl)c(F)c2)s1 | C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 | C[C@@H](CS(C)(=O)=O)NC(=O)c1cc(C#N)c(Cc2ccc(Cl)c(F)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N35C"
} |
Can you make molecule C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CS(C)(=O)=O)NC(=O)c1ccc(Cc2ccc(Cl)c(F)c2)c(C#N)c1 | C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 | C[C@@H](CS(C)(=O)=O)NC(=O)c1ccc(Cc2ccc(Cl)c(F)c2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N35C"
} |
Can you make molecule C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CS(C)(=O)=O)NC(=O)ON=C1CCN(Cc2ccc(Cl)c(F)c2)CC1 | C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 | C[C@@H](CS(C)(=O)=O)NC(=O)ON=C1CCN(Cc2ccc(Cl)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N35C"
} |
Can you make molecule C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CS(C)(=O)=O)NC(=O)N1CCC=C(CCc2ccc(Cl)c(F)c2)C1 | C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 | C[C@@H](CS(C)(=O)=O)NC(=O)N1CCC=C(CCc2ccc(Cl)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N35C"
} |
Can you make molecule C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CS(C)(=O)=O)NC(=O)N1CCC(C#N)(Cc2ccc(Cl)c(F)c2)CC1 | C[C@@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 | C[C@@H](CS(C)(=O)=O)NC(=O)N1CCC(C#N)(Cc2ccc(Cl)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&(C#N)CC1",
"old_substring": "N35C"
} |
Can you make molecule CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | C=CSc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CC[C@@H](N)c1ccc(C(C)C)cc1 | CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | CC[NH+](CC)CC[C@@H](N)c1ccc(C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | C=CCCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CC[C@@H](N)c1ccc(CCCCl)cc1 | CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | CC[NH+](CC)CC[C@@H](N)c1ccc(CCCCl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CC[C@@H](N)c1ccc(CCCCS)cc1 | CCc1ccc([C@H](N)CC[NH+](CC)CC)cc1 | CC[NH+](CC)CC[C@@H](N)c1ccc(CCCCS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1ncc(C2CC2)cc1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1ncc(C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&cc1Cl",
"old_substring": "c16n[nH]c8c1Cl"
} |
Can you make molecule O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1nc(C2CC2)ccc1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1nc(C2CC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ccc1Cl",
"old_substring": "c16n[nH]c8c1Cl"
} |
Can you make molecule O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1sc(C2CC2)nc1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1sc(C2CC2)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c16n[nH]c8c1Cl"
} |
Can you make molecule O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1cc(C2CC2)cnc1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1cc(C2CC2)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c16n[nH]c8c1Cl"
} |
Can you make molecule O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1cc(C2CC2)ncc1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1n[nH]c(C2CC2)c1Cl | O=C(NCC1([NH+]2CCCCC2)CCOCC1)c1cc(C2CC2)ncc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ncc1Cl",
"old_substring": "c16n[nH]c8c1Cl"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CCCC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC2"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CCCCC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC2"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CCCCC(=O)[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C=CC2"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(CC=C)[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CCC(CC=C)[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&CC=C",
"old_substring": "C=CC2"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CC1CCN([NH+](CC(=O)[O-])[C@@H]2CCC[C@H](C(C)(C)C)CC2)CC1 | C=CC[NH+](CC(=O)[O-])[C@@H]1CCC[C@H](C(C)(C)C)CC1 | C=CC1CCN([NH+](CC(=O)[O-])[C@@H]2CCC[C@H](C(C)(C)C)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC1CCN&CC1",
"old_substring": "C=CC2"
} |
Can you make molecule C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOc1ccccc1)C(=O)N[C@@H]1C=C(Cc2ccccc2F)N=N1 | C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@@H]1C=C(Cc2ccccc2F)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]56C#N"
} |
Can you make molecule C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOc1ccccc1)C(=O)N[C@H](CCl)CCCc1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@H](CCl)CCCc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]56C#N"
} |
Can you make molecule C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOc1ccccc1)C(=O)N[C@](C)(C#N)CCc1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@](C)(C#N)CCc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@]&(C)(C#N)CC&",
"old_substring": "[C@@H]56C#N"
} |
Can you make molecule C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOc1ccccc1)C(=O)N[C@](C)(C#N)CCCc1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@](C)(C#N)CCCc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@]&(C)(C#N)CCC&",
"old_substring": "[C@@H]56C#N"
} |
Can you make molecule C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOc1ccccc1)C(=O)N[C@@H]1N=NC=C1CCc1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@@H](C#N)c1ccccc1F | C[C@H](CCOc1ccccc1)C(=O)N[C@@H]1N=NC=C1CCc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]56C#N"
} |
Can you make molecule Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(-c2ccc(CNC(=O)CC(C)(C)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNC(=O)CC(C)(C)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(-c2ccc(CNC(=O)CCC(C)(C)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNC(=O)CCC(C)(C)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(-c2ccc(CNc3c(C)n(C)n(N[C@H]4CCC[C@@H]4C(N)=O)c3=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNc3c(C)n(C)n(N[C@H]4CCC[C@@H]4C(N)=O)c3=O)cn2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(-c2ccc(CNc3nn(N[C@H]4CCC[C@@H]4C(N)=O)c(C)cc3=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNc3nn(N[C@H]4CCC[C@@H]4C(N)=O)c(C)cc3=O)cn2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(-c2ccc(CNC(=O)C[C@@H](Br)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNC(=O)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | Cc1cc(C)n(-c2ccc(CNC(=O)C[C@@H](Br)N[C@H]3CCC[C@@H]3C(N)=O)cn2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@@H]1CCC[C@H](SCNC(=O)NCc2ccccc2C)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](SCNC(=O)NCc2ccccc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N36"
} |
Can you make molecule CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@@H]1CCC[C@H](C2CN(C(=O)NCc3ccccc3C)C2)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](C2CN(C(=O)NCc3ccccc3C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N36"
} |
Can you make molecule CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@@H]1CCC[C@H](SC(=N)NC(=O)NCc2ccccc2C)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](SC(=N)NC(=O)NCc2ccccc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N36"
} |
Can you make molecule CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@@H]1CCC[C@H](SC(=S)N(C)C(=O)NCc2ccccc2C)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](SC(=S)N(C)C(=O)NCc2ccccc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N36"
} |
Can you make molecule CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@@H]1CCC[C@H](c2cc(C(=O)NCc3ccccc3C)oc2N)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](NC(=O)NCc2ccccc2C)C1 | CC[S@@+]([O-])[C@@H]1CCC[C@H](c2cc(C(=O)NCc3ccccc3C)oc2N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N36"
} |
Can you make molecule O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1ccccc1=O)NCc1cccc(SC(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(SC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1ccccc1=O)NCc1cccc(CCCC(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(CCCC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1ccccc1=O)NCc1cccc(CCCCC(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(CCCCC(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)C(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1ccccc1=O)NCc1cccc(CC(F)(F)C(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(C(F)(F)F)c1 | O=C(Cn1ccccc1=O)NCc1cccc(CC(F)(F)C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@]2(CC[NH2+]C[C@@H]2CCCBr)CCO1 | CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | C[C@@H]1C[C@@]2(CC[NH2+]C[C@@H]2CCCBr)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | CC(C)CC[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@]2(CC[NH2+]C[C@@H]2CCCCBr)CCO1 | CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | C[C@@H]1C[C@@]2(CC[NH2+]C[C@@H]2CCCCBr)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | C=CCCC[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@]2(CC[NH2+]C[C@@H]2CCCCCl)CCO1 | CC(C)[C@H]1C[NH2+]CC[C@]12CCO[C@H](C)C2 | C[C@@H]1C[C@@]2(CC[NH2+]C[C@@H]2CCCCCl)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC3C"
} |
Can you make molecule C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1cccc2cn[nH]c12)C1CCC(C(=O)OC(C)(C)C)CC1 | C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 | C[NH+](Cc1cccc2cn[nH]c12)C1CCC(C(=O)OC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1cccc2cn[nH]c12)C1CCC(C)(C(=O)OC(C)(C)C)CC1 | C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 | C[NH+](Cc1cccc2cn[nH]c12)C1CCC(C)(C(=O)OC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](CCCCCC(=O)OC(C)(C)C)Cc1cccc2cn[nH]c12 | C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 | C[NH+](CCCCCC(=O)OC(C)(C)C)Cc1cccc2cn[nH]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1cccc2cn[nH]c12)[C@H]1CCC[C@H](C(=O)OC(C)(C)C)C1 | C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 | C[NH+](Cc1cccc2cn[nH]c12)[C@H]1CCC[C@H](C(=O)OC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](CCC1=CCC[C@@H]1C(=O)OC(C)(C)C)Cc1cccc2cn[nH]c12 | C[NH+](Cc1cccc2cn[nH]c12)C1CCN(C(=O)OC(C)(C)C)CC1 | C[NH+](CCC1=CCC[C@@H]1C(=O)OC(C)(C)C)Cc1cccc2cn[nH]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)CNSC(=O)Cc1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNSC(=O)Cc1ccc(C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)CNC(=O)CCCC(=O)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNC(=O)CCCC(=O)c1ccc(C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)CNC(=O)CC(C)(C)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNC(=O)CC(C)(C)c1ccc(C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)CNC(=O)CCC(C)(C)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNC(=O)CCC(C)(C)c1ccc(C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)CNSC(=O)[C@@H](C)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNC(=O)c1ccc(C)c(C)c1 | CC[C@H](C)NC(=O)CNSC(=O)[C@@H](C)c1ccc(C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | C=CS[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | C=CCC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCCCCC2)n2nc(CN3CC[NH+](CCCCl)CC3)nc2n1 | CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | Cc1cc(N2CCCCCC2)n2nc(CN3CC[NH+](CCCCl)CC3)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCCCCC2)n2nc(CN3CC[NH+](CCCCS)CC3)nc2n1 | CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | Cc1cc(N2CCCCCC2)n2nc(CN3CC[NH+](CCCCS)CC3)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCCCCC2)n2nc(CN3CC[NH+](CCCBr)CC3)nc2n1 | CC[NH+]1CCN(Cc2nc3nc(C)cc(N4CCCCCC4)n3n2)CC1 | Cc1cc(N2CCCCCC2)n2nc(CN3CC[NH+](CCCBr)CC3)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC5"
} |
Can you make molecule CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1Cl | CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 | CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c12ccccc1"
} |
Can you make molecule CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=S)N(C(=S)N(C)C)c1cc2sccc2s1 | CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 | CN(C)C(=S)N(C(=S)N(C)C)c1cc2sccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c12ccccc1"
} |
Can you make molecule CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=S)N(C(=S)N(C)C)c1ccc(I)cc1 | CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 | CN(C)C(=S)N(C(=S)N(C)C)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c12ccccc1"
} |
Can you make molecule CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(=S)N(C(=S)N(C)C)c1csc2ccccc12 | CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 | CN(C)C(=S)N(C(=S)N(C)C)c1csc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2ccccc12",
"old_substring": "c12ccccc1"
} |
Can you make molecule CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N(C(=S)N(C)C)C(=S)N(C)C)cc1I | CN(C)C(=S)N(C(=S)N(C)C)c1ccccc1 | Cc1ccc(N(C(=S)N(C)C)C(=S)N(C)C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c12ccccc1"
} |
Can you make molecule C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1ccccc1CN1C[C@H](C)O[C@@H](C)C1 | C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 | CC(C)Cc1ccccc1CN1C[C@H](C)O[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)C",
"old_substring": "N4C=C(C#N)C#N"
} |
Can you make molecule C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(Cl)Cc1ccccc1CN1C[C@H](C)O[C@@H](C)C1 | C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 | C=C(Cl)Cc1ccccc1CN1C[C@H](C)O[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(Cl)C&",
"old_substring": "N4C=C(C#N)C#N"
} |
Can you make molecule C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(CC)Cc1ccccc1CN1C[C@H](C)O[C@@H](C)C1 | C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 | C=C(CC)Cc1ccccc1CN1C[C@H](C)O[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)CC",
"old_substring": "N4C=C(C#N)C#N"
} |
Can you make molecule C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(Cc2ccccc2NC2=C(C#N)CCC2)C[C@H](C)O1 | C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 | C[C@H]1CN(Cc2ccccc2NC2=C(C#N)CCC2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1=C(N&)CCC1",
"old_substring": "N4C=C(C#N)C#N"
} |
Can you make molecule C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | CSC(Nc1ccccc1CN1C[C@H](C)O[C@@H](C)C1)=C(C#N)C#N | C[C@H]1CN(Cc2ccccc2NC=C(C#N)C#N)C[C@H](C)O1 | CSC(Nc1ccccc1CN1C[C@H](C)O[C@@H](C)C1)=C(C#N)C#N | 102 | {
"fragment_index": 0,
"new_substring": "CSC(N&)=C(C#N)C#N",
"old_substring": "N4C=C(C#N)C#N"
} |
Can you make molecule Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(CC(=O)SOCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(CC(=O)SOCC(=O)N[C@H]2CCCc3ccccc32)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(=O)CCCC(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(C(=O)CCCC(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(C)(C)CC(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(C(C)(C)CC(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(C)(C)CCC(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(C(C)(C)CCC(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c([C@H](C)C(=O)SOCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c(C(=O)OCC(=O)N[C@H]2CCCc3ccccc32)s1 | Cc1nc(C)c([C@H](C)C(=O)SOCC(=O)N[C@H]2CCCc3ccccc32)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN(CCS(=O)(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(CCS(=O)(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C5C(=O)[O-]"
} |
Can you make molecule C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN(ONC(C)=O)C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(ONC(C)=O)C(=O)N(C)[C@H](C)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)NO&",
"old_substring": "C5C(=O)[O-]"
} |
Can you make molecule C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN(CCC(=O)O)C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(CCC(=O)O)C(=O)N(C)[C@H](C)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC(=O)O",
"old_substring": "C5C(=O)[O-]"
} |
Can you make molecule C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN(C(=O)N(C)[C@H](C)c1cccs1)C(CC)(CC)C(=O)[O-] | C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(C(=O)N(C)[C@H](C)c1cccs1)C(CC)(CC)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C5C(=O)[O-]"
} |
Can you make molecule C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN(CCCS(=O)(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(CC(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | C#CCN(CCCS(=O)(=O)[O-])C(=O)N(C)[C@H](C)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C5C(=O)[O-]"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCCC(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)CCCC(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCC(=O)CN2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)CCC(=O)CN2CCCC2)c(OC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC[S@+]([O-])CCC(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC[S@+]([O-])CCC(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCCS(=O)(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)CCCS(=O)(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(C)(F)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | Cc1ccc(NC(=O)C(C)(F)C(=O)N2CCCC2)c(OC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C3(=O)C4=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.