prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1CCC(CO)=C1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1CCC(CO)=C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1SC(=O)CC1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1SC(=O)CC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1CC(=C=O)CC1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1CC(=C=O)CC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)CCCC(=O)C1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)CCCC(=O)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)CC(C)(C)C1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)C1CC1 | C[C@H]1C(=O)N(c2ccccc2Cl)CCN1C(=O)CC(C)(C)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)CCN1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)C(=O)CCN1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C(=O)CC&",
"old_substring": "CC(C)(C)CS3(=O)=O"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CC(=O)CCN1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)CC(=O)CCN1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC(=O)CC&",
"old_substring": "CC(C)(C)CS3(=O)=O"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CC(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)CC(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC&=O",
"old_substring": "CC(C)(C)CS3(=O)=O"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)CCCCN1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)C(=O)CCCCN1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C(=O)CCCC&",
"old_substring": "CC(C)(C)CS3(=O)=O"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCC(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)(C)CS(=O)(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | CC(C)CCC(=O)N1Cc2nc[nH]c2C[C@H]1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC&=O",
"old_substring": "CC(C)(C)CS3(=O)=O"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | C=CS[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | C=CCC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 less soluble in water? The output molecule should be similar to the input molecule. | ClCCC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | ClCCC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 less soluble in water? The output molecule should be similar to the input molecule. | SCCCC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | SCCCC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 less soluble in water? The output molecule should be similar to the input molecule. | BrCCC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | CC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | BrCCC[NH2+][C@@H](Cc1ccc2c(c1)CCC2)[C@H]1CSCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2Cl)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2Br)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)c(Cl)c2)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)c(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(I)cc2F)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(I)cc2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2cc3c(F)cccc3s2)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2ccc(F)cc2)cc1 | CCc1ccc([C@H](CO)NC(=O)[C@H]2C[C@@H]2c2cc3c(F)cccc3s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c18ccc(F)cc1"
} |
Can you make molecule O=C(NCCC1CC1)c1c(O)cc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCC1CCCCC1)c1c(O)cc(F)cc1F | O=C(NCCC1CC1)c1c(O)cc(F)cc1F | O=C(NCCC1CCCCC1)c1c(O)cc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(NCCC1CC1)c1c(O)cc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC=C1CCCC1)c1c(O)cc(F)cc1F | O=C(NCCC1CC1)c1c(O)cc(F)cc1F | O=C(NCC=C1CCCC1)c1c(O)cc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(NCCC1CC1)c1c(O)cc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCC1SCCCS1)c1c(O)cc(F)cc1F | O=C(NCCC1CC1)c1c(O)cc(F)cc1F | O=C(NCCC1SCCCS1)c1c(O)cc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(NCCC1CC1)c1c(O)cc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCC1SCSCS1)c1c(O)cc(F)cc1F | O=C(NCCC1CC1)c1c(O)cc(F)cc1F | O=C(NCCC1SCSCS1)c1c(O)cc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(NCCC1CC1)c1c(O)cc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC=C1CCCCC1)c1c(O)cc(F)cc1F | O=C(NCCC1CC1)c1c(O)cc(F)cc1F | O=C(NCC=C1CCCCC1)c1c(O)cc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]ccn1CCCCNc1ccc(SC(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(SC(F)(F)F)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]ccn1CCCCNc1ccc(CCCC(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(CCCC(F)(F)F)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]ccn1CCCCNc1ccc(CCCCC(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(CCCCC(F)(F)F)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)C(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)C(F)(F)F)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]ccn1CCCCNc1ccc(CC(F)(F)C(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(C(F)(F)F)cn1 | Cc1[nH+]ccn1CCCCNc1ccc(CC(F)(F)C(F)(F)F)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCNC(=O)c1ccc2c(c1)NC(=O)CN2CC)SCC | CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC | CCC[C@@H](CCNC(=O)c1ccc2c(c1)NC(=O)CN2CC)SCC | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C7C[C@@H]4C"
} |
Can you make molecule CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CCS[C@](C)(CC)CCNC(=O)c1ccc2c(c1)NC(=O)CN2CC | CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC | CCS[C@](C)(CC)CCNC(=O)c1ccc2c(c1)NC(=O)CN2CC | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CC&",
"old_substring": "C7C[C@@H]4C"
} |
Can you make molecule CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CCSCCC1=CCC[C@@H]1NC(=O)c1ccc2c(c1)NC(=O)CN2CC | CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC | CCSCCC1=CCC[C@@H]1NC(=O)c1ccc2c(c1)NC(=O)CN2CC | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "C7C[C@@H]4C"
} |
Can you make molecule CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CCS[C@H](C)CC(C)(C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC | CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC | CCS[C@H](C)CC(C)(C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C7C[C@@H]4C"
} |
Can you make molecule CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC less soluble in water? The output molecule should be similar to the input molecule. | CCS[C@@H](CCNC(=O)c1ccc2c(c1)NC(=O)CN2CC)C(C)C | CCSCC[C@H](C)NC(=O)c1ccc2c(c1)NC(=O)CN2CC | CCS[C@@H](CCNC(=O)c1ccc2c(c1)NC(=O)CN2CC)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C7C[C@@H]4C"
} |
Can you make molecule CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)N1CCN(C(=O)CCCCC(=O)[O-])CC1 | CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 | CC[C@H](C)N1CCN(C(=O)CCCCC(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCCC(=O)[O-]",
"old_substring": "C2(=O)CC(=O)[O-]"
} |
Can you make molecule CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)N1CCN(CCCS(=O)(=O)[O-])CC1 | CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 | CC[C@H](C)N1CCN(CCCS(=O)(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C2(=O)CC(=O)[O-]"
} |
Can you make molecule CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)N1CCN(CCS(=O)(=O)[O-])CC1 | CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 | CC[C@H](C)N1CCN(CCS(=O)(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C2(=O)CC(=O)[O-]"
} |
Can you make molecule CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)N1CCN(OS(C)(=O)=O)CC1 | CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 | CC[C@H](C)N1CCN(OS(C)(=O)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CS(=O)(=O)O&",
"old_substring": "C2(=O)CC(=O)[O-]"
} |
Can you make molecule CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)N1CCN(C[C@@H](C)C(=O)[O-])CC1 | CC[C@H](C)N1CCN(C(=O)CC(=O)[O-])CC1 | CC[C@H](C)N1CCN(C[C@@H](C)C(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&)C(=O)[O-]",
"old_substring": "C2(=O)CC(=O)[O-]"
} |
Can you make molecule Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nc2sc(C)c(C)c2c(=O)n1C)C(=O)Cc1c[nH]c2ccccc12 | Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | CCC(CC)(Sc1nc2sc(C)c(C)c2c(=O)n1C)C(=O)Cc1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C6=O"
} |
Can you make molecule Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc2nc(SSSC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | Cc1sc2nc(SSSC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C6=O"
} |
Can you make molecule Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nc2sc(C)c(C)c2c(=O)n1C)C(=O)CCc1c[nH]c2ccccc12 | Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | CCC(CC)(Sc1nc2sc(C)c(C)c2c(=O)n1C)C(=O)CCc1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C6=O"
} |
Can you make molecule Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Sc1nc2sc(C)c(C)c2c(=O)n1C)C(=O)c1c[nH]c2ccccc12 | Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | CC[C@H](C(=O)Sc1nc2sc(C)c(C)c2c(=O)n1C)C(=O)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C5C6=O"
} |
Can you make molecule Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc2nc(SC(=O)C[C@H](C)C(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | Cc1sc2nc(SCC(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | Cc1sc2nc(SC(=O)C[C@H](C)C(=O)c3c[nH]c4ccccc34)n(C)c(=O)c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C5C6=O"
} |
Can you make molecule Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C[C@]2(Cc3cnn(C)c3C)CCC[NH2+]C2)sc1C | Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C | Cc1cc(C[C@]2(Cc3cnn(C)c3C)CCC[NH2+]C2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cn2c[nH+]cc2Cc2cnn(C)c2C)sc1C | Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C | Cc1cc(Cn2c[nH+]cc2Cc2cnn(C)c2C)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cc2cc(Cc3cnn(C)c3C)[nH][nH+]2)sc1C | Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C | Cc1cc(Cc2cc(Cc3cnn(C)c3C)[nH][nH+]2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cc2c(Cc3cnn(C)c3C)c[nH+]n2C)sc1C | Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C | Cc1cc(Cc2c(Cc3cnn(C)c3C)c[nH+]n2C)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cc2nc(Cc3cnn(C)c3C)c(Br)c[nH+]2)sc1C | Cc1cc(C[NH2+]Cc2cnn(C)c2C)sc1C | Cc1cc(Cc2nc(Cc3cnn(C)c3C)c(Br)c[nH+]2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]c&nc&c1Br",
"old_substring": "[NH2+]34"
} |
Can you make molecule CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCN(C)SC(=O)Cn1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)SC(=O)Cn1c(-c2ccccc2F)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCN(C)C(=O)CCCC(=O)n1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C(=O)CCCC(=O)n1c(-c2ccccc2F)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCN(C)C(=O)CC(C)(C)n1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C(=O)CC(C)(C)n1c(-c2ccccc2F)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCN(C)C[S@+]([O-])CCCn1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C[S@+]([O-])CCCn1c(-c2ccccc2F)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCN(C)C(=O)CCC(C)(C)n1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C(=O)Cn1c(-c2ccccc2F)nc2ccccc21 | CCCCN(C)C(=O)CCC(C)(C)n1c(-c2ccccc2F)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@@H]1NC(=O)NSC(=O)CSc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NSC(=O)CSc1nnc(-c2cccnc2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C6"
} |
Can you make molecule C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CCCC(=O)Sc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CCCC(=O)Sc1nnc(-c2cccnc2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C6"
} |
Can you make molecule C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CC(C)(C)Sc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CC(C)(C)Sc1nnc(-c2cccnc2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C6"
} |
Can you make molecule C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@@H]1NC(=O)NC[S@+]([O-])CCCSc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC[S@+]([O-])CCCSc1nnc(-c2cccnc2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C6"
} |
Can you make molecule C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CCC(C)(C)Sc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nnc(-c2cccnc2)n1C | C[C@@H]1CCCC[C@@H]1NC(=O)NC(=O)CCC(C)(C)Sc1nnc(-c2cccnc2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C6"
} |
Can you make molecule Cc1cccc(C=C(F)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | CC([O-])=Cc1cccc(C)c1C | Cc1cccc(C=C(F)C(=O)[O-])c1C | CC([O-])=Cc1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)[O-]",
"old_substring": "C=2(F)C(=O)[O-]"
} |
Can you make molecule Cc1cccc(C=C(F)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C=CCCS(=O)(=O)[O-])c1C | Cc1cccc(C=C(F)C(=O)[O-])c1C | Cc1cccc(C=CCCS(=O)(=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C=2(F)C(=O)[O-]"
} |
Can you make molecule Cc1cccc(C=C(F)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=Cc1cccc(C)c1C)[N+](=O)[O-] | Cc1cccc(C=C(F)C(=O)[O-])c1C | CC(=Cc1cccc(C)c1C)[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)[N+](=O)[O-]",
"old_substring": "C=2(F)C(=O)[O-]"
} |
Can you make molecule Cc1cccc(C=C(F)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | COS(=O)(=O)C=Cc1cccc(C)c1C | Cc1cccc(C=C(F)C(=O)[O-])c1C | COS(=O)(=O)C=Cc1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "COS(=O)(=O)C&",
"old_substring": "C=2(F)C(=O)[O-]"
} |
Can you make molecule Cc1cccc(C=C(F)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC(=O)C=Cc1cccc(C)c1C | Cc1cccc(C=C(F)C(=O)[O-])c1C | C=C(C)CC(=O)C=Cc1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC(=O)C&",
"old_substring": "C=2(F)C(=O)[O-]"
} |
Can you make molecule Nc1ccc(N2CCOCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(N2CCCC2)nc1 | Nc1ccc(N2CCOCC2)nc1 | Nc1ccc(N2CCCC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule Nc1ccc(N2CCOCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(N2CCCCC2)nc1 | Nc1ccc(N2CCOCC2)nc1 | Nc1ccc(N2CCCCC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule Nc1ccc(N2CCOCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(N2CCSCC2)nc1 | Nc1ccc(N2CCOCC2)nc1 | Nc1ccc(N2CCSCC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule Nc1ccc(N2CCOCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(N2CC=CC2)nc1 | Nc1ccc(N2CCOCC2)nc1 | Nc1ccc(N2CC=CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule Nc1ccc(N2CCOCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(SSN2CCOCC2)nc1 | Nc1ccc(N2CCOCC2)nc1 | Nc1ccc(SSN2CCOCC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | BrCCC[C@]1(CC2CCOCC2)CCC[NH2+]1 | CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 | BrCCC[C@]1(CC2CCOCC2)CCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@]1(CC2CCOCC2)CCC[NH2+]1 | CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 | CC(C)CC[C@]1(CC2CCOCC2)CCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | BrCCCC[C@]1(CC2CCOCC2)CCC[NH2+]1 | CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 | BrCCCC[C@]1(CC2CCOCC2)CCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@]1(CC2CCOCC2)CCC[NH2+]1 | CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 | C=CCCC[C@]1(CC2CCOCC2)CCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | ClCCCC[C@]1(CC2CCOCC2)CCC[NH2+]1 | CC(C)[C@]1(CC2CCOCC2)CCC[NH2+]1 | ClCCCC[C@]1(CC2CCOCC2)CCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC3C"
} |
Can you make molecule COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1I | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c13ccc7cc1"
} |
Can you make molecule COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)ccc1Br | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 | COc1cc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c13ccc7cc1"
} |
Can you make molecule COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1Cl | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c13ccc7cc1"
} |
Can you make molecule COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)c1Br | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 | COc1cccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c13ccc7cc1"
} |
Can you make molecule COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)c1Cl | COc1ccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)cc1 | COc1cccc([C@H](NS(=O)(=O)c2cccc(C(C)=O)c2)c2ccccc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c13ccc7cc1"
} |
Can you make molecule COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(CC(=O)SNCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(CC(=O)SNCCc2cc(C)ccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(C(=O)CCCC(=O)NCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(C(=O)CCCC(=O)NCCc2cc(C)ccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(C(C)(C)CC(=O)NCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(C(C)(C)CC(=O)NCCc2cc(C)ccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(C(C)(C)CCC(=O)NCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(C(C)(C)CCC(=O)NCCc2cc(C)ccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc([C@H](C)C(=O)SNCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc(C(=O)NCCc2cc(C)ccc2OC)cn1 | COC(=O)c1ccc([C@H](C)C(=O)SNCCc2cc(C)ccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)cc1I | COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 | COc1cc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c14ccc9c5c1"
} |
Can you make molecule COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)cc1Cl | COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 | COc1cc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c14ccc9c5c1"
} |
Can you make molecule COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)cc(I)c1OC | COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 | COc1cc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)cc(I)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c14ccc9c5c1"
} |
Can you make molecule COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(OC)c(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c1 | COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 | COc1cc(Br)c(OC)c(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c14ccc9c5c1"
} |
Can you make molecule COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)cc1OC | COc1ccc(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)c(OC)c1 | COc1cc(Br)c(-c2n[nH]cc2C[NH+]2CCC[C@H]2c2nc3ccc(F)cc3[nH]2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1&",
"old_substring": "c14ccc9c5c1"
} |
Can you make molecule COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | COCc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | COCSc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | CC(=O)Sc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(COc2ccc(C(=O)CS)cc2C=CC(=O)[O-])n1 | COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | Cc1noc(COc2ccc(C(=O)CS)cc2C=CC(=O)[O-])n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(COc2ccc(C(=O)CI)cc2C=CC(=O)[O-])n1 | COc1ccc(OCc2nc(C)no2)c(C=CC(=O)[O-])c1 | Cc1noc(COc2ccc(C(=O)CI)cc2C=CC(=O)[O-])n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CCn1nccc1[C@H](F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCn1nccc1[C@H](C)C(=O)Cl | CCn1nccc1[C@H](F)C(=O)[O-] | CCn1nccc1[C@H](C)C(=O)Cl | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(=O)Cl",
"old_substring": "[C@@H]3(F)C(=O)[O-]"
} |
Can you make molecule CCn1nccc1[C@H](F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCn1nccc1[C@H](C)N=O | CCn1nccc1[C@H](F)C(=O)[O-] | CCn1nccc1[C@H](C)N=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)N=O",
"old_substring": "[C@@H]3(F)C(=O)[O-]"
} |
Can you make molecule CCn1nccc1[C@H](F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCn1nccc1[C@H](C)CC(=O)NN | CCn1nccc1[C@H](F)C(=O)[O-] | CCn1nccc1[C@H](C)CC(=O)NN | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)CC(=O)NN",
"old_substring": "[C@@H]3(F)C(=O)[O-]"
} |
Can you make molecule CCn1nccc1[C@H](F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCn1nccc1[C@@H](CS)C(=O)CO | CCn1nccc1[C@H](F)C(=O)[O-] | CCn1nccc1[C@@H](CS)C(=O)CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CS)C(=O)CO",
"old_substring": "[C@@H]3(F)C(=O)[O-]"
} |
Can you make molecule CCn1nccc1[C@H](F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCn1nccc1[C@H]1CN(C)C(=O)O1 | CCn1nccc1[C@H](F)C(=O)[O-] | CCn1nccc1[C@H]1CN(C)C(=O)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN(C)C(=O)O1",
"old_substring": "[C@@H]3(F)C(=O)[O-]"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.