prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SNc1ccc(C(=O)N2CCCC2)cc1)NCc1csc(C2CC2)n1 | O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 | O=C(/C=C/SNc1ccc(C(=O)N2CCCC2)cc1)NCc1csc(C2CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NCc2csc(C3CC3)n2)CCC1=Nc1ccc(C(=O)N2CCCC2)cc1 | O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 | O=C1C(=NCc2csc(C3CC3)n2)CCC1=Nc1ccc(C(=O)N2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(Nc2ccc(/C=N/ONCc3csc(C4CC4)n3)o2)cc1)N1CCCC1 | O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 | O=C(c1ccc(Nc2ccc(/C=N/ONCc3csc(C4CC4)n3)o2)cc1)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1csc(C2CC2)n1)NN=C1CCC(Nc2ccc(C(=O)N3CCCC3)cc2)CC1 | O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 | O=C(NCc1csc(C2CC2)n1)NN=C1CCC(Nc2ccc(C(=O)N3CCCC3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1csc(C2CC2)n1)C1=CC[C@H](Nc2ccc(C(=O)N3CCCC3)cc2)S1 | O=C(NCc1csc(C2CC2)n1)Nc1ccc(C(=O)N2CCCC2)cc1 | O=C(NCc1csc(C2CC2)n1)C1=CC[C@H](Nc2ccc(C(=O)N3CCCC3)cc2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C34"
} |
Can you make molecule COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3SCCS3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3SCCS3)nc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CCCCC3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CCCCC3)nc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3SCCCS3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3SCCCS3)nc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3SCSCS3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3SCSCS3)nc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C17CC1"
} |
Can you make molecule COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CCCCCC3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CC3)nc3ccccc23)cc1 | COc1ccc([C@@H]2c3nc[nH]c3CCN2C(=O)c2cc(C3CCCCCC3)nc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)c(OC)cc1I | COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC | COc1cc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)c(OC)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c15ccc7cc16"
} |
Can you make molecule COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)c(OC)cc1Cl | COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC | COc1cc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c15ccc7cc16"
} |
Can you make molecule COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc(I)c1OC | COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC | COc1cc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc(I)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c15ccc7cc16"
} |
Can you make molecule COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(OC)c(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)c1 | COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC | COc1cc(Br)c(OC)c(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c15ccc7cc16"
} |
Can you make molecule COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC | COc1ccc(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC | COc1cc(Br)c(NC(=O)C(=O)N[C@@H]2C[C@H]2C2CCCCC2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1&",
"old_substring": "c15ccc7cc16"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(CC(=O)SN[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(CC(=O)SN[C@@H]2CCCC[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(C(=O)CCCC(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)CCCC(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(C(C)(C)CC(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(C(C)(C)CC(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(C(C)(C)CCC(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(C(C)(C)CCC(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc([C@H](C)C(=O)SN[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCCC[C@@H]2C)cc1 | CC(C)NS(=O)(=O)c1ccc([C@H](C)C(=O)SN[C@@H]2CCCC[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Oc2ccc(Cl)c3ccccc23)nc(Cl)c1I | Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 | Cc1nc(Oc2ccc(Cl)c3ccccc23)nc(Cl)c1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&nc(Cl)c1I",
"old_substring": "Cc1nc4cc(Cl)n1"
} |
Can you make molecule Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccc(Cl)cn2c1Oc1ccc(Cl)c2ccccc12 | Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 | Cc1nc2ccc(Cl)cn2c1Oc1ccc(Cl)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc2ccc(Cl)cn2c1&",
"old_substring": "Cc1nc4cc(Cl)n1"
} |
Can you make molecule Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2cc(Cl)ccc2n1Oc1ccc(Cl)c2ccccc12 | Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 | Cc1nc2cc(Cl)ccc2n1Oc1ccc(Cl)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc2cc(Cl)ccc2n1&",
"old_substring": "Cc1nc4cc(Cl)n1"
} |
Can you make molecule Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(Oc2ccc(Cl)c3ccccc23)c(C)c1Cl | Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 | Cc1ncc(Oc2ccc(Cl)c3ccccc23)c(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ncc&c(C)c1Cl",
"old_substring": "Cc1nc4cc(Cl)n1"
} |
Can you make molecule Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cnc1Oc1ccc(Cl)c2ccccc12 | Cc1nc(Cl)cc(Oc2ccc(Cl)c3ccccc23)n1 | Cc1cc(Cl)cnc1Oc1ccc(Cl)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Cl)cnc1&",
"old_substring": "Cc1nc4cc(Cl)n1"
} |
Can you make molecule CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CCS(=O)(=O)SCNC[C@@H]1CCCN(c2ncccn2)C1 | CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 | CC(C)(C)CCS(=O)(=O)SCNC[C@@H]1CCCN(c2ncccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CCS(=O)(=O)SC(=N)NC[C@@H]1CCCN(c2ncccn2)C1 | CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 | CC(C)(C)CCS(=O)(=O)SC(=N)NC[C@@H]1CCCN(c2ncccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CCS(=O)(=O)c1snc(C[C@@H]2CCCN(c3ncccn3)C2)c1N | CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 | CC(C)(C)CCS(=O)(=O)c1snc(C[C@@H]2CCCN(c3ncccn3)C2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N34"
} |
Can you make molecule CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C[C@@H]1CCCN(c2ncccn2)C1)C(=S)SS(=O)(=O)CCC(C)(C)C | CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 | CN(C[C@@H]1CCCN(c2ncccn2)C1)C(=S)SS(=O)(=O)CCC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CCS(=O)(=O)c1cc(C[C@@H]2CCCN(c3ncccn3)C2)oc1N | CC(C)(C)CCS(=O)(=O)NC[C@@H]1CCCN(c2ncccn2)C1 | CC(C)(C)CCS(=O)(=O)c1cc(C[C@@H]2CCCN(c3ncccn3)C2)oc1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N34"
} |
Can you make molecule Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CNC(=O)c1cn(C)nc1-c1ccccc1)=N/ON1CCCC1 | Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 | C/C(CNC(=O)c1cn(C)nc1-c1ccccc1)=N/ON1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NC(=O)c1cn(C)nc1-c1ccccc1)C(=O)CN1CCCC1 | Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 | CCC(CC)(NC(=O)c1cn(C)nc1-c1ccccc1)C(=O)CN1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)NSSC(=O)N2CCCC2)c(-c2ccccc2)n1 | Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 | Cn1cc(C(=O)NSSC(=O)N2CCCC2)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NC(=O)c1cn(C)nc1-c1ccccc1)C(=O)CCN1CCCC1 | Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 | CCC(CC)(NC(=O)c1cn(C)nc1-c1ccccc1)C(=O)CCN1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NC(=O)c1cn(C)nc1-c1ccccc1)C(=O)N1CCCC1 | Cn1cc(C(=O)NCC(=O)N2CCCC2)c(-c2ccccc2)n1 | CC[C@H](C(=O)NC(=O)c1cn(C)nc1-c1ccccc1)C(=O)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule COc1cccc(NC(=O)CSCCc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)CSCCc2ccccc2Cl)c1 | COc1cccc(NC(=O)CSCCc2ccccc2)c1 | COc1cccc(NC(=O)CSCCc2ccccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1cccc(NC(=O)CSCCc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)CSCCc2ccc(I)cc2)c1 | COc1cccc(NC(=O)CSCCc2ccccc2)c1 | COc1cccc(NC(=O)CSCCc2ccc(I)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1cccc(NC(=O)CSCCc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)CSCCc2ccc(C)c(I)c2)c1 | COc1cccc(NC(=O)CSCCc2ccccc2)c1 | COc1cccc(NC(=O)CSCCc2ccc(C)c(I)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1cccc(NC(=O)CSCCc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)CSCCc2cccc(Br)c2)c1 | COc1cccc(NC(=O)CSCCc2ccccc2)c1 | COc1cccc(NC(=O)CSCCc2cccc(Br)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1cccc(NC(=O)CSCCc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)CSCCc2cccc(C)c2C)c1 | COc1cccc(NC(=O)CSCCc2ccccc2)c1 | COc1cccc(NC(=O)CSCCc2cccc(C)c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1NC(=O)CCCC(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)CCCC(=O)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1NC(=O)CCC(=O)CN1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)CCC(=O)CN1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1NC[S@+]([O-])CCC(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC[S@+]([O-])CCC(=O)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1NC(=O)CCCS(=O)(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)CCCS(=O)(=O)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Br)ccc1NC(=O)C(C)(F)C(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)C(=O)N1C[C@H](C)C[C@@H](C)C1 | Cc1nc(Br)ccc1NC(=O)C(C)(F)C(=O)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC(=O)SN(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(CC(=O)SN(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)CCCC(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(C(=O)CCCC(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(C)(C)CC(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(C(C)(C)CC(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(C)(C)CCC(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(C(C)(C)CCC(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@H](C)C(=O)SN(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc(C(=O)N(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | Cc1cc([C@H](C)C(=O)SN(C2CC2)[C@H]2CCc3ccccc32)c2ccc(F)cc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@](C)(O)CC1CN(C(=O)N[C@@H](C)CS(C)(=O)=O)C1 | CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O | CC(C)[C@](C)(O)CC1CN(C(=O)N[C@@H](C)CS(C)(=O)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N13"
} |
Can you make molecule CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@](C)(O)CSC1=NCCN1C(=O)N[C@@H](C)CS(C)(=O)=O | CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O | CC(C)[C@](C)(O)CSC1=NCCN1C(=O)N[C@@H](C)CS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N13"
} |
Can you make molecule CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@](C)(O)CC1CCN(CC(=O)N[C@@H](C)CS(C)(=O)=O)CC1 | CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O | CC(C)[C@](C)(O)CC1CCN(CC(=O)N[C@@H](C)CS(C)(=O)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N13"
} |
Can you make molecule CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@](C)(O)CN1CCN(SC(=O)N[C@@H](C)CS(C)(=O)=O)CC1 | CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O | CC(C)[C@](C)(O)CN1CCN(SC(=O)N[C@@H](C)CS(C)(=O)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N13"
} |
Can you make molecule CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@](C)(O)CCC1=NCCN1C(=O)N[C@@H](C)CS(C)(=O)=O | CC(C)[C@](C)(O)CNC(=O)N[C@@H](C)CS(C)(=O)=O | CC(C)[C@](C)(O)CCC1=NCCN1C(=O)N[C@@H](C)CS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N13"
} |
Can you make molecule C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1cncc(Nc2ccc(N3CCOC[C@@H]3C)cc2)n1 | C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 | CC(=O)c1cncc(Nc2ccc(N3CCOC[C@@H]3C)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C6(N)=O"
} |
Can you make molecule C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COCCN1c1ccc(Nc2cncc(CCCCC(N)=O)n2)cc1 | C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 | C[C@H]1COCCN1c1ccc(Nc2cncc(CCCCC(N)=O)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C6(N)=O"
} |
Can you make molecule C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COCCN1c1ccc(Nc2cncc(CC/C(N)=N/O)n2)cc1 | C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 | C[C@H]1COCCN1c1ccc(Nc2cncc(CC/C(N)=N/O)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C6(N)=O"
} |
Can you make molecule C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COCCN1c1ccc(Nc2cncc(CC/C(N)=N\O)n2)cc1 | C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 | C[C@H]1COCCN1c1ccc(Nc2cncc(CC/C(N)=N\O)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C6(N)=O"
} |
Can you make molecule C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COCCN1c1ccc(Nc2cncc(CC(N)=S)n2)cc1 | C[C@H]1COCCN1c1ccc(Nc2cncc(C(N)=O)n2)cc1 | C[C@H]1COCCN1c1ccc(Nc2cncc(CC(N)=S)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C6(N)=O"
} |
Can you make molecule CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | C=CSOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | C=CCCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Oc1ccccc1OCCCCl)c1ccc(S(=O)(=O)C(F)F)cc1 | CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | O=C(Oc1ccccc1OCCCCl)c1ccc(S(=O)(=O)C(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Oc1ccccc1OCCCCS)c1ccc(S(=O)(=O)C(F)F)cc1 | CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | O=C(Oc1ccccc1OCCCCS)c1ccc(S(=O)(=O)C(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Oc1ccccc1OCCCBr)c1ccc(S(=O)(=O)C(F)F)cc1 | CCOc1ccccc1OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 | O=C(Oc1ccccc1OCCCBr)c1ccc(S(=O)(=O)C(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)C[C@@H]1CCCN(C(=O)Cc2cc3ccccc3[nH]c2=O)CC1 | CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 | CC[NH+](CC)C[C@@H]1CCCN(C(=O)Cc2cc3ccccc3[nH]c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@@H]18CCN4C1"
} |
Can you make molecule CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)C[C@@H]1CC12CCN(C(=O)Cc1cc3ccccc3[nH]c1=O)CC2 | CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 | CC[NH+](CC)C[C@@H]1CC12CCN(C(=O)Cc1cc3ccccc3[nH]c1=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC12CCN&CC2",
"old_substring": "[C@@H]18CCN4C1"
} |
Can you make molecule CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)C[C@@H]1C=C(CC(=O)Cc2cc3ccccc3[nH]c2=O)N=N1 | CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 | CC[NH+](CC)C[C@@H]1C=C(CC(=O)Cc2cc3ccccc3[nH]c2=O)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]18CCN4C1"
} |
Can you make molecule CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)C[C@@H]1CC[C@@H](C(=O)Cc2cc3ccccc3[nH]c2=O)C1 | CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 | CC[NH+](CC)C[C@@H]1CC[C@@H](C(=O)Cc2cc3ccccc3[nH]c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]18CCN4C1"
} |
Can you make molecule CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)C[C@@H]1N=NC=C1CCC(=O)Cc1cc2ccccc2[nH]c1=O | CC[NH+](CC)C[C@@H]1CCN(C(=O)Cc2cc3ccccc3[nH]c2=O)C1 | CC[NH+](CC)C[C@@H]1N=NC=C1CCC(=O)Cc1cc2ccccc2[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]18CCN4C1"
} |
Can you make molecule CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC/[NH+]=C(/NCC1CCCCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NCC1CCCCC1)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14CCC1"
} |
Can you make molecule CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC/[NH+]=C(/NC=C1CCCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NC=C1CCCC1)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C14CCC1"
} |
Can you make molecule CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC/[NH+]=C(/NC=C1CCCCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NC=C1CCCCC1)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C14CCC1"
} |
Can you make molecule CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC/[NH+]=C(/NC=C1CCSCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NC=C1CCSCC1)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCSCC1",
"old_substring": "C14CCC1"
} |
Can you make molecule CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC/[NH+]=C(/NCC1CCCCCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NCC1CCC1)N[C@H]1CCS(=O)(=O)C1 | CC/[NH+]=C(/NCC1CCCCCC1)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CCC1"
} |
Can you make molecule COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1C=C[C@@H](C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C1 | COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 | COc1ccccc1[C@H]1C=C[C@@H](C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]17C[C@@H]15"
} |
Can you make molecule COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CN(C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C[C@@H]1C | COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 | COc1ccccc1[C@H]1CN(C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[C@H]17C[C@@H]15"
} |
Can you make molecule COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1C=C[C@H](C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C1 | COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 | COc1ccccc1[C@H]1C=C[C@H](C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]17C[C@@H]15"
} |
Can you make molecule COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CCC[C@H](C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C1 | COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 | COc1ccccc1[C@H]1CCC[C@H](C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]17C[C@@H]15"
} |
Can you make molecule COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H]1CCCC[C@H](C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C1 | COc1ccccc1[C@H]1C[C@@H]1C(=O)N1CCC[C@@H](n2cc(C)cn2)C1 | COc1ccccc1[C@H]1CCCC[C@H](C(=O)N2CCC[C@@H](n3cc(C)cn3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@H]17C[C@@H]15"
} |
Can you make molecule C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CSC(SCc2nc(-c3ccc(Cl)s3)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3ccc(Cl)s3)n[nH]2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c16cccs1"
} |
Can you make molecule C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CSC(SCc2nc(-c3ccc(Br)s3)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3ccc(Br)s3)n[nH]2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c16cccs1"
} |
Can you make molecule C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CSC(SCc2nc(-c3sccc3Br)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3sccc3Br)n[nH]2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c16cccs1"
} |
Can you make molecule C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CSC(SCc2nc(-c3csc(I)c3)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3csc(I)c3)n[nH]2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c16cccs1"
} |
Can you make molecule C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CSC(SCc2nc(-c3cc4c(s3)CSC4)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3cccs3)n[nH]2)=N1 | C[C@@H]1CSC(SCc2nc(-c3cc4c(s3)CSC4)n[nH]2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c16cccs1"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@]2(C3CC3)CCC[C@@H](NC(=O)N[C@H](CCO)c3ccccc3)C2)s1 | Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 | Cc1cnc([C@]2(C3CC3)CCC[C@@H](NC(=O)N[C@H](CCO)c3ccccc3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@@H]578"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@]2(C3CC3)CC[C@H](NC(=O)N[C@H](CCO)c3ccccc3)C2)s1 | Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 | Cc1cnc([C@]2(C3CC3)CC[C@H](NC(=O)N[C@H](CCO)c3ccccc3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@@H]578"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@@]2(C3CC3)CC[C@H](NC(=O)N[C@H](CCO)c3ccccc3)C2)s1 | Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 | Cc1cnc([C@@]2(C3CC3)CC[C@H](NC(=O)N[C@H](CCO)c3ccccc3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@@H]578"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(CCC[C@H](NC(=O)N[C@H](CCO)c2ccccc2)C(C)(C)C2CC2)s1 | Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 | Cc1cnc(CCC[C@H](NC(=O)N[C@H](CCO)c2ccccc2)C(C)(C)C2CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@@H]578"
} |
Can you make molecule Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@H]2CC(NC(=O)N[C@H](CCO)c3ccccc3)C[C@@H](C3CC3)C2)s1 | Cc1cnc([C@@H](NC(=O)N[C@H](CCO)c2ccccc2)C2CC2)s1 | Cc1cnc([C@H]2CC(NC(=O)N[C@H](CCO)c3ccccc3)C[C@@H](C3CC3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "[C@@H]578"
} |
Can you make molecule O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(CF)N1Cc2nc([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)sc2C1 | O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl | O=C(CF)N1Cc2nc([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(CF)N1Cc2cnn([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)c2C1 | O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl | O=C(CF)N1Cc2cnn([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(CF)N1CCc2noc([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)c2C1 | O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl | O=C(CF)N1CCc2noc([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(CF)N1CCCn2nc([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)cc21 | O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl | O=C(CF)N1CCCn2nc([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(CF)N1CCc2cc([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)ccc21 | O=C(CF)N[C@H](Sc1ccccc1)C(Cl)(Cl)Cl | O=C(CF)N1CCc2cc([C@H](Sc3ccccc3)C(Cl)(Cl)Cl)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule OCC1(CSc2nnc(Cc3cccs3)o2)COC1 less soluble in water? The output molecule should be similar to the input molecule. | OCC1CC(CSc2nnc(Cc3cccs3)o2)C1 | OCC1(CSc2nnc(Cc3cccs3)o2)COC1 | OCC1CC(CSc2nnc(Cc3cccs3)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C178COC1"
} |
Can you make molecule OCC1(CSc2nnc(Cc3cccs3)o2)COC1 less soluble in water? The output molecule should be similar to the input molecule. | OCC1CCN(CSc2nnc(Cc3cccs3)o2)CC1 | OCC1(CSc2nnc(Cc3cccs3)o2)COC1 | OCC1CCN(CSc2nnc(Cc3cccs3)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C178COC1"
} |
Can you make molecule OCC1(CSc2nnc(Cc3cccs3)o2)COC1 less soluble in water? The output molecule should be similar to the input molecule. | OCC1CCC(CSc2nnc(Cc3cccs3)o2)CC1 | OCC1(CSc2nnc(Cc3cccs3)o2)COC1 | OCC1CCC(CSc2nnc(Cc3cccs3)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C178COC1"
} |
Can you make molecule OCC1(CSc2nnc(Cc3cccs3)o2)COC1 less soluble in water? The output molecule should be similar to the input molecule. | OCCN1CCC(CSc2nnc(Cc3cccs3)o2)CC1 | OCC1(CSc2nnc(Cc3cccs3)o2)COC1 | OCCN1CCC(CSc2nnc(Cc3cccs3)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "C178COC1"
} |
Can you make molecule OCC1(CSc2nnc(Cc3cccs3)o2)COC1 less soluble in water? The output molecule should be similar to the input molecule. | OCC1CCC(=CSc2nnc(Cc3cccs3)o2)CC1 | OCC1(CSc2nnc(Cc3cccs3)o2)COC1 | OCC1CCC(=CSc2nnc(Cc3cccs3)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "C178COC1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.