prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc([C@@H](C)NSC(=O)CC23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NSC(=O)CC23CC4CC(CC(C4)C2)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc([C@@H](C)NCC(=C=O)CC23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NCC(=C=O)CC23CC4CC(CC(C4)C2)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)CCCC(=O)C23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)CCCC(=O)C23CC4CC(CC(C4)C2)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)CC(C)(C)C23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)CC(C)(C)C23CC4CC(CC(C4)C2)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc([C@@H](C)NC[S@+]([O-])CCCC23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 | CNS(=O)(=O)c1cccc([C@@H](C)NC[S@+]([O-])CCCC23CC4CC(CC(C4)C2)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C58=O"
} |
Can you make molecule CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | C=CSOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | C=CCCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCN(S(=O)(=O)CCCC(=O)OCCCCl)c2cc(F)ccc21 | CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | CN1CCCN(S(=O)(=O)CCCC(=O)OCCCCl)c2cc(F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCN(S(=O)(=O)CCCC(=O)OCCCCS)c2cc(F)ccc21 | CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | CN1CCCN(S(=O)(=O)CCCC(=O)OCCCCS)c2cc(F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCN(S(=O)(=O)CCCC(=O)OCCCBr)c2cc(F)ccc21 | CCOC(=O)CCCS(=O)(=O)N1CCCN(C)c2ccc(F)cc21 | CN1CCCN(S(=O)(=O)CCCC(=O)OCCCBr)c2cc(F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCC(C)(C)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC4"
} |
Can you make molecule CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCCCCC(=O)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC4"
} |
Can you make molecule CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCC[C@@H](C)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&C",
"old_substring": "CCCC4"
} |
Can you make molecule CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCCC[C@@H](C)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "CCCC4"
} |
Can you make molecule CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | CCC(C)(CC)OC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "CCCC4"
} |
Can you make molecule O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1sccc1S(=O)(=O)NC1CC1)NCc1ccc(C(=O)N2CCCCC2)cc1 | O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 | O=C(/C=C/Sc1sccc1S(=O)(=O)NC1CC1)NCc1ccc(C(=O)N2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C38"
} |
Can you make molecule O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCc2ccc(C(=O)N3CCCCC3)cc2)nc1-c1sccc1S(=O)(=O)NC1CC1 | O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 | O=Cc1sc(NCc2ccc(C(=O)N3CCCCC3)cc2)nc1-c1sccc1S(=O)(=O)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C38"
} |
Can you make molecule O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCc2ccc(C(=O)N3CCCCC3)cc2)sc1-c1sccc1S(=O)(=O)NC1CC1 | O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 | O=Cc1nc(NCc2ccc(C(=O)N3CCCCC3)cc2)sc1-c1sccc1S(=O)(=O)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C38"
} |
Can you make molecule O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(CNC(=O)n2nc(-c3sccc3S(=O)(=O)NC3CC3)oc2=S)cc1)N1CCCCC1 | O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 | O=C(c1ccc(CNC(=O)n2nc(-c3sccc3S(=O)(=O)NC3CC3)oc2=S)cc1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C38"
} |
Can you make molecule O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(CNO/N=C/c2ccc(-c3sccc3S(=O)(=O)NC3CC3)o2)cc1)N1CCCCC1 | O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1sccc1S(=O)(=O)NC1CC1 | O=C(c1ccc(CNO/N=C/c2ccc(-c3sccc3S(=O)(=O)NC3CC3)o2)cc1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C38"
} |
Can you make molecule Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(I)cc2F)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2ccc(I)cc2F)sc1CNC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cc(I)ccc2F)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2cc(I)ccc2F)sc1CNC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccccc2Cl)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2ccccc2Cl)sc1CNC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1F"
} |
Can you make molecule Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cc(F)ccc2Br)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2cc(F)ccc2Br)sc1CNC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c18ccccc1F"
} |
Can you make molecule Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(F)cc2Cl)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2ccccc2F)sc1CNC(=O)NC(C)(C)C | Cc1nc(-c2ccc(F)cc2Cl)sc1CNC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18ccccc1F"
} |
Can you make molecule Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c2c(c1)CCCN2CCCNS(=O)(=O)C(C)C | Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O | Cc1cc(F)c2c(c1)CCCN2CCCNS(=O)(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c2c(c1)CCCN2CCCNS(=O)(=O)CC(C)C | Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O | Cc1cc(F)c2c(c1)CCCN2CCCNS(=O)(=O)CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c2c(c1)CCCN2CCCNCCCCS(C)(=O)=O | Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O | Cc1cc(F)c2c(c1)CCCN2CCCNCCCCS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c2c(c1)CCCN2CCCNC(=O)N=S(C)(C)=O | Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O | Cc1cc(F)c2c(c1)CCCN2CCCNC(=O)N=S(C)(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CS(C)(=O)=NC&=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c2c(c1)CCCN2CCCNCS(=O)(=O)C(C)C | Cc1cc(F)c2c(c1)CCCN2CCCNS(C)(=O)=O | Cc1cc(F)c2c(c1)CCCN2CCCNCS(=O)(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S(=O)(=O)C&",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3SCCS3)nn21 | CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3SCCS3)nn21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "CS3"
} |
Can you make molecule CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3SCCCS3)nn21 | CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3SCCCS3)nn21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "CS3"
} |
Can you make molecule CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3(C)SCCS3)nn21 | CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3(C)SCCS3)nn21 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&SCCS1",
"old_substring": "CS3"
} |
Can you make molecule CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3SCSCS3)nn21 | CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3SCSCS3)nn21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "CS3"
} |
Can you make molecule CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3CSCCSC3)nn21 | CSc1nc2n(n1)[C@@H](c1sccc1C)[C@H]1C(=O)CCCC1=N2 | Cc1ccsc1[C@H]1[C@H]2C(=O)CCCC2=Nc2nc(C3CSCCSC3)nn21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "CS3"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1C1=CC2=C(C[NH2+]C1)S2 | [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1C1=CC2=C(C[NH2+]C1)S2 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH3+]C2"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1C1=NC2=C(C[NH2+]CC1)S2 | [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1C1=NC2=C(C[NH2+]CC1)S2 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCc2nc&sc2C1",
"old_substring": "[NH3+]C2"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1C1CC[NH2+]CC1 | [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1C1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH3+]C2"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1CC1=CC[NH2+]CC1 | [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1CC1=CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH3+]C2"
} |
Can you make molecule [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1[C@H]1CCC[NH2+]CC1 | [NH3+]C[C@H]1CCC[C@H]1S(=O)(=O)c1cccc(F)c1 | O=S(=O)(c1cccc(F)c1)[C@@H]1CCC[C@@H]1[C@H]1CCC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@H]&CC1",
"old_substring": "[NH3+]C2"
} |
Can you make molecule Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3ccc(C)c(I)c3)S2(=O)=O)c1 | Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3ccc(C)c(I)c3)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1cccc6c1"
} |
Can you make molecule Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3ccc(C)c(Cl)c3)S2(=O)=O)c1 | Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3ccc(C)c(Cl)c3)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1cccc6c1"
} |
Can you make molecule Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3ccc(I)cc3C)S2(=O)=O)c1 | Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3ccc(I)cc3C)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1cccc6c1"
} |
Can you make molecule Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3cc(C)ccc3I)S2(=O)=O)c1 | Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3cc(C)ccc3I)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1cccc6c1"
} |
Can you make molecule Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3cc(C)ccc3Br)S2(=O)=O)c1 | Cc1cccc(CN2c3ccccc3C(=O)/C(=C\Nc3cc(C)cc(C)c3)S2(=O)=O)c1 | Cc1cc(C)cc(N/C=C2\C(=O)c3ccccc3N(Cc3cc(C)ccc3Br)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1cccc6c1"
} |
Can you make molecule O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@@H](c2nc(C3SCCS3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3SCCS3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@@H](c2nc(C3CCCCC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3CCCCC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@@H](c2nc(C3SCCCS3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3SCCCS3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@@H](c2nc(C3SCSCS3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3SCSCS3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C17CC1"
} |
Can you make molecule O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@@H](c2nc(C3CCCCCC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3CC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | O[C@@H]1C[C@@H](c2nc(C3CCCCCC3)no2)[NH+](Cc2c[nH]c3ccccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1ccc(CC(=O)SNCC2(O)CCSCC2)n1 | CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 | CC(C)n1ccc(CC(=O)SNCC2(O)CCSCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1ccc(C(=O)CCCC(=O)NCC2(O)CCSCC2)n1 | CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 | CC(C)n1ccc(C(=O)CCCC(=O)NCC2(O)CCSCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1ccc(C(C)(C)CC(=O)NCC2(O)CCSCC2)n1 | CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 | CC(C)n1ccc(C(C)(C)CC(=O)NCC2(O)CCSCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1ccc(C(C)(C)CCC(=O)NCC2(O)CCSCC2)n1 | CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 | CC(C)n1ccc(C(C)(C)CCC(=O)NCC2(O)CCSCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1ccc([C@H](C)C(=O)SNCC2(O)CCSCC2)n1 | CC(C)n1ccc(C(=O)NCC2(O)CCSCC2)n1 | CC(C)n1ccc([C@H](C)C(=O)SNCC2(O)CCSCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)N2CCC(N3CCCCCCC3=O)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCCCCC3=O)CC2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)N2CCC(N3CCCCC3)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCCC3)CC2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)N2CCC(N3CC=CCC3)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CC=CCC3)CC2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CCC1",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)N2CCC(N3CCCc4sccc4C3=O)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCc4sccc4C3=O)CC2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2sccc2C1=O",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)N2CCC(N3CCCCCC3)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCC3=O)CC2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)N2CCC(N3CCCCCC3)CC2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(c1ncnc(N2CCN(c3ccc(Br)c[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | CN(c1ncnc(N2CCN(c3ccc(Br)c[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c[nH+]1",
"old_substring": "c16cccc[nH+]1"
} |
Can you make molecule CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCN(c3ncnc(N(C)C4CC[NH+](C)CC4)c3[N+](=O)[O-])CC2)cc(C)[nH+]1 | CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | Cc1cc(N2CCN(c3ncnc(N(C)C4CC[NH+](C)CC4)c3[N+](=O)[O-])CC2)cc(C)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)[nH+]1",
"old_substring": "c16cccc[nH+]1"
} |
Can you make molecule CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(c1ncnc(N2CCN(c3cc(=O)cc[nH]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | CN(c1ncnc(N2CCN(c3cc(=O)cc[nH]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(=O)cc[nH]1",
"old_substring": "c16cccc[nH+]1"
} |
Can you make molecule CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(c1ncnc(N2CCN(c3cc4occc4[nH]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | CN(c1ncnc(N2CCN(c3cc4occc4[nH]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2occc2[nH]1",
"old_substring": "c16cccc[nH+]1"
} |
Can you make molecule CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(c1ncnc(N2CCN(c3cc4sccc4[nH]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | CN(c1ncnc(N2CCN(c3cccc[nH+]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | CN(c1ncnc(N2CCN(c3cc4sccc4[nH]3)CC2)c1[N+](=O)[O-])C1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2[nH]1",
"old_substring": "c16cccc[nH+]1"
} |
Can you make molecule CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(N2CCC(C(=O)CSc3nc4cc(Cl)ccc4o3)CC2)CCCCC1 | CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 | N#CC1(N2CCC(C(=O)CSc3nc4cc(Cl)ccc4o3)CC2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C(=S)SC1(C#N)CCCCC1 | CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 | CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C(=S)SC1(C#N)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C2CCN(CC(=O)CSc3nc4cc(Cl)ccc4o3)CC2)CCCCC1 | CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 | N#CC1(C2CCN(CC(=O)CSc3nc4cc(Cl)ccc4o3)CC2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(N2CN(C(=O)CSc3nc4cc(Cl)ccc4o3)CSC2=S)CCCCC1 | CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 | N#CC1(N2CN(C(=O)CSc3nc4cc(Cl)ccc4o3)CSC2=S)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)CSc2nc3cc(Cl)ccc3o2)CCC(C2(C#N)CCCCC2)CC1 | CN(C(=O)CSc1nc2cc(Cl)ccc2o1)C1(C#N)CCCCC1 | N#CC1(C(=O)CSc2nc3cc(Cl)ccc3o2)CCC(C2(C#N)CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CCC[C@H]1CCC[NH+](CCCS)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CCC[NH+](CC2=CCCSC2)CC1 | CCC[C@H]1CCC[NH+](CCCS)CC1 | CCC[C@H]1CCC[NH+](CC2=CCCSC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)CSCC1",
"old_substring": "C2CCS"
} |
Can you make molecule CCC[C@H]1CCC[NH+](CCCS)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CCC[NH+](N2CCCSc3ccccc32)CC1 | CCC[C@H]1CCC[NH+](CCCS)CC1 | CCC[C@H]1CCC[NH+](N2CCCSc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCSc2ccccc21",
"old_substring": "C2CCS"
} |
Can you make molecule CCC[C@H]1CCC[NH+](CCCS)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CCC[NH+](C2=C3C=CC=C3C(=O)CCS2)CC1 | CCC[C@H]1CCC[NH+](CCCS)CC1 | CCC[C@H]1CCC[NH+](C2=C3C=CC=C3C(=O)CCS2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1CCSc2c&cccc21",
"old_substring": "C2CCS"
} |
Can you make molecule CCC[C@H]1CCC[NH+](CCCS)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CCC[NH+](N2CCSC3(CCCCC3)C2)CC1 | CCC[C@H]1CCC[NH+](CCCS)CC1 | CCC[C@H]1CCC[NH+](N2CCSC3(CCCCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC2(CCCCC2)C1",
"old_substring": "C2CCS"
} |
Can you make molecule CCC[C@H]1CCC[NH+](CCCS)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CCC[NH+](SC2=N[C@@H](C)CS2)CC1 | CCC[C@H]1CCC[NH+](CCCS)CC1 | CCC[C@H]1CCC[NH+](SC2=N[C@@H](C)CS2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CSC(S&)=N1",
"old_substring": "C2CCS"
} |
Can you make molecule C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(Cl)c1)N1Cc2nc(Cc3[nH+]ccn3C)sc2C1 | C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 | C[C@@H](c1cccc(Cl)c1)N1Cc2nc(Cc3[nH+]ccn3C)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(Cl)c1)N1CCc2noc(Cc3[nH+]ccn3C)c2C1 | C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 | C[C@@H](c1cccc(Cl)c1)N1CCc2noc(Cc3[nH+]ccn3C)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(Cl)c1)N1CCc2cc(Cc3[nH+]ccn3C)ccc21 | C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 | C[C@@H](c1cccc(Cl)c1)N1CCc2cc(Cc3[nH+]ccn3C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(Cl)c1)c1sc2nsc(Cc3[nH+]ccn3C)c2c1N | C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 | C[C@@H](c1cccc(Cl)c1)c1sc2nsc(Cc3[nH+]ccn3C)c2c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N23"
} |
Can you make molecule C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1cccc(Cl)c1)N1CCc2nc(Cc3[nH+]ccn3C)oc2C1 | C[C@H](NCc1[nH+]ccn1C)c1cccc(Cl)c1 | C[C@@H](c1cccc(Cl)c1)N1CCc2nc(Cc3[nH+]ccn3C)oc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2nc&oc2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCCCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | O=C(C1CCCCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCCCCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | O=C(C1CCCCCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C(=O)N2CCC[C@@H](c3ccnc4nccn34)C2)CCCC1 | O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | CC1(C(=O)N2CCC[C@@H](c3ccnc4nccn34)C2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCCCCCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | O=C(C1CCCCCCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1C2CCC1CC2)N1CCC[C@@H](c2ccnc3nccn23)C1 | O=C(C1CCC1)N1CCC[C@@H](c2ccnc3nccn23)C1 | O=C(C1C2CCC1CC2)N1CCC[C@@H](c2ccnc3nccn23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2CCC1CC2",
"old_substring": "C15CCC1"
} |
Can you make molecule Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CC[C@@H](C)CC(=O)c1ccccc1 | Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 | Cc1ccccc1CC[C@@H](C)CC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C2[S@](=O)CCC3"
} |
Can you make molecule Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(CCc1ccccc1)c1ccccc1C | Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 | CC[C@](C)(CCc1ccccc1)c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CC&",
"old_substring": "C2[S@](=O)CCC3"
} |
Can you make molecule Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(CC(=O)c1ccccc1)c1ccccc1C | Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 | CC[C@@](C)(CC(=O)c1ccccc1)c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@]&(C)CC&=O",
"old_substring": "C2[S@](=O)CCC3"
} |
Can you make molecule Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(=O)CC(C)(C)c1ccccc1 | Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 | Cc1ccccc1C(=O)CC(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2[S@](=O)CCC3"
} |
Can you make molecule Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C[C@@H](Cl)CCc1ccccc1 | Cc1ccccc1C[S@+]([O-])CCCc1ccccc1 | Cc1ccccc1C[C@@H](Cl)CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cl[C@H](C&)CC&",
"old_substring": "C2[S@](=O)CCC3"
} |
Can you make molecule N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cn(C[C@H]2CCCC[C@@H]2I)c(=O)nc1[O-] | N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] | N#Cc1cn(C[C@H]2CCCC[C@@H]2I)c(=O)nc1[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@@H]1I",
"old_substring": "[C@H]14CCCC[C@H]1O"
} |
Can you make molecule N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1SCCC[C@H]1Cn1cc(C#N)c([O-])nc1=O | N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] | C[C@@H]1SCCC[C@H]1Cn1cc(C#N)c([O-])nc1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCS[C@H]1C",
"old_substring": "[C@H]14CCCC[C@H]1O"
} |
Can you make molecule N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cn(C[C@H]2CCC=CCCC2)c(=O)nc1[O-] | N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] | N#Cc1cn(C[C@H]2CCC=CCCC2)c(=O)nc1[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC=CCCC1",
"old_substring": "[C@H]14CCCC[C@H]1O"
} |
Can you make molecule N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cn(C[C@H]2CC=CC=C2Cl)c(=O)nc1[O-] | N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] | N#Cc1cn(C[C@H]2CC=CC=C2Cl)c(=O)nc1[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CC=C1Cl",
"old_substring": "[C@H]14CCCC[C@H]1O"
} |
Can you make molecule N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1Cn1cc(C#N)c([O-])nc1=O | N#Cc1cn(C[C@H]2CCCC[C@H]2O)c(=O)nc1[O-] | CC1(C)CCC[C@@H]1Cn1cc(C#N)c([O-])nc1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]14CCCC[C@H]1O"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(O)ccc(C(=O)C2=C(C)N=C(C)[C@H]2S(=O)(=O)[N-]c2ccc(Cl)cc2F)c2noc1-2 | CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F | CCc1c(O)ccc(C(=O)C2=C(C)N=C(C)[C@H]2S(=O)(=O)[N-]c2ccc(Cl)cc2F)c2noc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2c(c1)CN(C(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F)CCO2 | CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F | CCc1ccc2c(c1)CN(C(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnc2ccc-2cc(C(=O)C2=C(C)N=C(C)[C@H]2S(=O)(=O)[N-]c2ccc(Cl)cc2F)c1=O | CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F | CCn1cnc2ccc-2cc(C(=O)C2=C(C)N=C(C)[C@H]2S(=O)(=O)[N-]c2ccc(Cl)cc2F)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc2nc-2ccc(C(=O)C2=C(C)N=C(C)[C@H]2S(=O)(=O)[N-]c2ccc(Cl)cc2F)c1=O | CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F | CCn1ccc2nc-2ccc(C(=O)C2=C(C)N=C(C)[C@H]2S(=O)(=O)[N-]c2ccc(Cl)cc2F)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc2nc-2ncc(C(=O)C2=C(C)N=C(C)[C@H]2S(=O)(=O)[N-]c2ccc(Cl)cc2F)c1=O | CCOC(=O)C1=C(C)N=C(C)[C@H]1S(=O)(=O)[N-]c1ccc(Cl)cc1F | CCn1ccc2nc-2ncc(C(=O)C2=C(C)N=C(C)[C@H]2S(=O)(=O)[N-]c2ccc(Cl)cc2F)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.