prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)C[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COSC(=O)C[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C38=O"
} |
Can you make molecule COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCC(=C=O)C[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COCC(=C=O)C[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C38=O"
} |
Can you make molecule COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COC(=O)CCCC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C38=O"
} |
Can you make molecule COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COC(=O)CC(C)(C)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC[S@+]([O-])CCC[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COC(=O)[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | COC[S@+]([O-])CCC[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc(-c2csc(C)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C38=O"
} |
Can you make molecule CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(N2CCC(C(=O)c3ccn(-c4ccccc4F)n3)CC2)CCC1 | CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 | N#CC1(N2CCC(C(=O)c3ccn(-c4ccccc4F)n3)CC2)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)c1ccn(-c2ccccc2F)n1)C(=S)SC1(C#N)CCC1 | CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 | CN(C(=O)c1ccn(-c2ccccc2F)n1)C(=S)SC1(C#N)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C2CCN(CC(=O)c3ccn(-c4ccccc4F)n3)CC2)CCC1 | CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 | N#CC1(C2CCN(CC(=O)c3ccn(-c4ccccc4F)n3)CC2)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(N2CN(C(=O)c3ccn(-c4ccccc4F)n3)CSC2=S)CCC1 | CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 | N#CC1(N2CN(C(=O)c3ccn(-c4ccccc4F)n3)CSC2=S)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)c2ccn(-c3ccccc3F)n2)CCC(C2(C#N)CCC2)CC1 | CN(C(=O)c1ccn(-c2ccccc2F)n1)C1(C#N)CCC1 | N#CC1(C(=O)c2ccn(-c3ccccc3F)n2)CCC(C2(C#N)CCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ocnc1CNC(=O)CC(C)(C)N[C@H]1CCN(C(=O)c2ccccc2)C1 | Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 | Cc1ocnc1CNC(=O)CC(C)(C)N[C@H]1CCN(C(=O)c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ocnc1CNC(=O)CCC(C)(C)N[C@H]1CCN(C(=O)c2ccccc2)C1 | Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 | Cc1ocnc1CNC(=O)CCC(C)(C)N[C@H]1CCN(C(=O)c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ocnc1CNc1c(C)n(C)n(N[C@H]2CCN(C(=O)c3ccccc3)C2)c1=O | Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 | Cc1ocnc1CNc1c(C)n(C)n(N[C@H]2CCN(C(=O)c3ccccc3)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ocnc1CNc1nn(N[C@H]2CCN(C(=O)c3ccccc3)C2)c(C)cc1=O | Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 | Cc1ocnc1CNc1nn(N[C@H]2CCN(C(=O)c3ccccc3)C2)c(C)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ocnc1CNC(=O)C[C@@H](Br)N[C@H]1CCN(C(=O)c2ccccc2)C1 | Cc1ocnc1CNC(=O)N[C@H]1CCN(C(=O)c2ccccc2)C1 | Cc1ocnc1CNC(=O)C[C@@H](Br)N[C@H]1CCN(C(=O)c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)c1 | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c14csc5n1"
} |
Can you make molecule CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)c1C | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1C",
"old_substring": "c14csc5n1"
} |
Can you make molecule CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)s1 | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 | CCc1ccc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c14csc5n1"
} |
Can you make molecule CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)cnc1Cl | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 | CCc1cc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c14csc5n1"
} |
Can you make molecule CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)ncc1Cl | CCc1csc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)n1 | CCc1cc([C@H]2CCC[NH+](CC(=O)N(C)OC)C2)ncc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ncc1Cl",
"old_substring": "c14csc5n1"
} |
Can you make molecule O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)c1)N(CCO)Cc1ccccc1 | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)c1)N(CCO)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c16ccn8n1"
} |
Can you make molecule O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1csc2nc(-c3cccc([N+](=O)[O-])c3)cn12)N(CCO)Cc1ccccc1 | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 | O=C(c1csc2nc(-c3cccc([N+](=O)[O-])c3)cn12)N(CCO)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2nc&cn12",
"old_substring": "c16ccn8n1"
} |
Can you make molecule O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc(-c2cccc([N+](=O)[O-])c2)nc(Cl)n1)N(CCO)Cc1ccccc1 | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 | O=C(c1cc(-c2cccc([N+](=O)[O-])c2)nc(Cl)n1)N(CCO)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc(Cl)n1",
"old_substring": "c16ccn8n1"
} |
Can you make molecule O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc(Cl)nc(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 | O=C(c1cc(Cl)nc(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)nc&n1",
"old_substring": "c16ccn8n1"
} |
Can you make molecule O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(-c2cccc([N+](=O)[O-])c2)c(Br)c1C(=O)N(CCO)Cc1ccccc1 | O=C(c1ccn(-c2cccc([N+](=O)[O-])c2)n1)N(CCO)Cc1ccccc1 | Cn1nc(-c2cccc([N+](=O)[O-])c2)c(Br)c1C(=O)N(CCO)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Br)c&nn1C",
"old_substring": "c16ccn8n1"
} |
Can you make molecule CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | C=CSn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC7"
} |
Can you make molecule CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CCC(Nc3nccn(C(C)C)c3=O)CC2)[nH+]c1 | CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | Cc1ccc(N2CCC(Nc3nccn(C(C)C)c3=O)CC2)[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC7"
} |
Can you make molecule CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | C=CCCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC7"
} |
Can you make molecule CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CCC(Nc3nccn(CCCCl)c3=O)CC2)[nH+]c1 | CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | Cc1ccc(N2CCC(Nc3nccn(CCCCl)c3=O)CC2)[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC7"
} |
Can you make molecule CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CCC(Nc3nccn(CCCCS)c3=O)CC2)[nH+]c1 | CCn1ccnc(NC2CCN(c3ccc(C)c[nH+]3)CC2)c1=O | Cc1ccc(N2CCC(Nc3nccn(CCCCS)c3=O)CC2)[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC7"
} |
Can you make molecule COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCN(C(=O)c3ncc(C)[nH]3)CC2)cc1OC.Cc1ccccc1C | COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC | COc1ccc(C(=O)N2CCN(C(=O)c3ncc(C)[nH]3)CC2)cc1OC.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&c(C)[nH]1",
"old_substring": "c19cc%11n[nH]1"
} |
Can you make molecule COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCN(C(=O)c3nc(C)c[nH]3)CC2)cc1OC.Cc1ccccc1C | COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC | COc1ccc(C(=O)N2CCN(C(=O)c3nc(C)c[nH]3)CC2)cc1OC.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c&[nH]1",
"old_substring": "c19cc%11n[nH]1"
} |
Can you make molecule COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCN(C(=O)c3ccc4nc[nH]c4c3)CC2)cc1OC.Cc1ccccc1C | COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC | COc1ccc(C(=O)N2CCN(C(=O)c3ccc4nc[nH]c4c3)CC2)cc1OC.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nc&[nH]c2c1",
"old_substring": "c19cc%11n[nH]1"
} |
Can you make molecule COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCN(C(=O)c3ccc4cn[nH]c4n3)CC2)cc1OC.Cc1ccccc1C | COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC | COc1ccc(C(=O)N2CCN(C(=O)c3ccc4cn[nH]c4n3)CC2)cc1OC.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c&n[nH]c2n1",
"old_substring": "c19cc%11n[nH]1"
} |
Can you make molecule COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCN(C(=O)c3cc4cccnc4[nH]3)CC2)cc1OC.Cc1ccccc1C | COc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccc(C)c(C)c4)n[nH]3)CC2)cc1OC | COc1ccc(C(=O)N2CCN(C(=O)c3cc4cccnc4[nH]3)CC2)cc1OC.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&cnc2[nH]1",
"old_substring": "c19cc%11n[nH]1"
} |
Can you make molecule COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC | COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC | COCc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C(=O)[O-])cc(S(=O)(=O)CCC(C)C)cc1C1OCc2ccccc2CO1 | COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC | COc1c(C(=O)[O-])cc(S(=O)(=O)CCC(C)C)cc1C1OCc2ccccc2CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C(=O)[O-])cc(S(=O)(=O)CCC(C)C)cc1C1(O)Cc2ccccc2C1 | COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC | COc1c(C(=O)[O-])cc(S(=O)(=O)CCC(C)C)cc1C1(O)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C(=O)[O-])cc(S(=O)(=O)CCC(C)C)cc1C1=CC2=NN2C[C@@H](C)CO1 | COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC | COc1c(C(=O)[O-])cc(S(=O)(=O)CCC(C)C)cc1C1=CC2=NN2C[C@@H](C)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C(=O)[O-])cc(S(=O)(=O)CCC(C)C)cc1N1CCOc2ccccc21 | COc1cc(S(=O)(=O)CCC(C)C)cc(C(=O)[O-])c1OC | COc1c(C(=O)[O-])cc(S(=O)(=O)CCC(C)C)cc1N1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccccc21",
"old_substring": "CO2"
} |
Can you make molecule CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccccc1)Nc1cnc2c(cnn2CCCCBr)c1 | CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 | O=C(CCc1ccccc1)Nc1cnc2c(cnn2CCCCBr)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCn1ncc2cc(NC(=O)CCc3ccccc3)cnc21 | CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 | C=CCCCCn1ncc2cc(NC(=O)CCc3ccccc3)cnc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccccc1)Nc1cnc2c(cnn2CCCCCBr)c1 | CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 | O=C(CCc1ccccc1)Nc1cnc2c(cnn2CCCCCBr)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccccc1)Nc1cnc2c(cnn2CCCCCS)c1 | CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 | O=C(CCc1ccccc1)Nc1cnc2c(cnn2CCCCCS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccccc1)Nc1cnc2c(cnn2CCCCCCS)c1 | CC(C)n1ncc2cc(NC(=O)CCc3ccccc3)cnc21 | O=C(CCc1ccccc1)Nc1cnc2c(cnn2CCCCCCS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC6C"
} |
Can you make molecule CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc(Cl)c(NC(=O)Cn2c(=O)oc3ccccc32)cc1Cl | CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 | CCOC(=O)c1cc(Cl)c(NC(=O)Cn2c(=O)oc3ccccc32)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c&cc1Cl",
"old_substring": "c17cc(C)sc16"
} |
Can you make molecule CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc(NC(=O)Cn2c(=O)oc3ccccc32)sc1Br | CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 | CCOC(=O)c1cc(NC(=O)Cn2c(=O)oc3ccccc32)sc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&sc1Br",
"old_substring": "c17cc(C)sc16"
} |
Can you make molecule CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc(Br)c(NC(=O)Cn2c(=O)oc3ccccc32)cc1C | CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 | CCOC(=O)c1cc(Br)c(NC(=O)Cn2c(=O)oc3ccccc32)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1C",
"old_substring": "c17cc(C)sc16"
} |
Can you make molecule CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc2sc(NC(=O)Cn3c(=O)oc4ccccc43)c(C)c2c1 | CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 | CCOC(=O)c1ccc2sc(NC(=O)Cn3c(=O)oc4ccccc43)c(C)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc&c(C)c2c1",
"old_substring": "c17cc(C)sc16"
} |
Can you make molecule CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc(NC(=O)Cn2c(=O)oc3ccccc32)cc(C)c1I | CCOC(=O)c1cc(C)sc1NC(=O)Cn1c(=O)oc2ccccc21 | CCOC(=O)c1cc(NC(=O)Cn2c(=O)oc3ccccc32)cc(C)c1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(C)c1I",
"old_substring": "c17cc(C)sc16"
} |
Can you make molecule C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C(C[C@@H](Sc1ccccn1)c1ccccc1)=C1CC[NH2+]C1 | C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 | C(C[C@@H](Sc1ccccn1)c1ccccc1)=C1CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=2CC[NH2+]C1",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](c1ccccc1)C([NH3+])(CC)CC.Sc1ccccn1 | C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 | CC[C@H](c1ccccc1)C([NH3+])(CC)CC.Sc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC3([NH3+])CC",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C(C[C@@H](Sc1ccccn1)c1ccccc1)=C1CC[NH2+]CC1 | C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 | C(C[C@@H](Sc1ccccn1)c1ccccc1)=C1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=2CC[NH2+]CC1",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(C)(C)[NH3+])c1ccccc1.Sc1ccccn1 | C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 | CC[C@@H](CC(C)(C)[NH3+])c1ccccc1.Sc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)([NH3+])C3",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C[NH3+])(CCC)[C@H](CC)c1ccccc1.Sc1ccccn1 | C[NH2+]CC[C@@H](Sc1ccccn1)c1ccccc1 | CCCC(C[NH3+])(CCC)[C@H](CC)c1ccccc1.Sc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC3(C[NH3+])CCC",
"old_substring": "C[NH2+]2"
} |
Can you make molecule NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)N1CCCN(C(N)=O)CC1)Nc1cc(Cl)ccc1Cl | NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 | CC(C)(CC(=O)N1CCCN(C(N)=O)CC1)Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)N1CCCN(C(N)=O)CC1)Nc1cc(Cl)ccc1Cl | NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 | CC(C)(CCC(=O)N1CCCN(C(N)=O)CC1)Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)N1CCCN(C(=O)C[C@@H](Br)Nc2cc(Cl)ccc2Cl)CC1 | NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 | NC(=O)N1CCCN(C(=O)C[C@@H](Br)Nc2cc(Cl)ccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCCN(C(N)=O)CC2)cc(=O)n1Nc1cc(Cl)ccc1Cl | NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 | Cc1cc(N2CCCN(C(N)=O)CC2)cc(=O)n1Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N2CCCN(C(N)=O)CC2)c(=O)ccn1Nc1cc(Cl)ccc1Cl | NC(=O)N1CCCN(C(=O)Nc2cc(Cl)ccc2Cl)CC1 | Cc1c(N2CCCN(C(N)=O)CC2)c(=O)ccn1Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1Cl)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1Cl)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(NC(=O)[C@](C)(N)c1ccc(I)cc1)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1ccc(I)cc1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(NC(=O)[C@](C)(N)c1ccc(C)c(I)c1)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1ccc(C)c(I)c1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(NC(=O)[C@](C)(N)c1cccc(Br)c1)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1cccc(Br)c1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(NC(=O)[C@](C)(N)c1cccc(C)c1C)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1ccccc1)C(=O)[O-] | CC[C@](C)(NC(=O)[C@](C)(N)c1cccc(C)c1C)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1I | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)sc[n+]2Cc1cc(CBr)ccc1Br | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 | Cc1ccc2c(c1)sc[n+]2Cc1cc(CBr)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1Cl | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)sc[n+]2Cc1cccc(CBr)c1Br | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 | Cc1ccc2c(c1)sc[n+]2Cc1cccc(CBr)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)sc[n+]2Cc1cccc(CBr)c1Cl | Cc1ccc2c(c1)sc[n+]2Cc1ccc(CBr)cc1 | Cc1ccc2c(c1)sc[n+]2Cc1cccc(CBr)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c13ccc4cc1"
} |
Can you make molecule Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1ccc(N3C(=O)CCC3=O)cc1I)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1ccc(N3C(=O)CCC3=O)cc1I)n2C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cc(N3C(=O)CCC3=O)ccc1Br)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cc(N3C(=O)CCC3=O)ccc1Br)n2C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1ccc(N3C(=O)CCC3=O)cc1Cl)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1ccc(N3C(=O)CCC3=O)cc1Cl)n2C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1Br)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1Br)n2C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14cccc5c1"
} |
Can you make molecule Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1Cl)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1)n2C | Cc1cc(C)c2c(c1)s/c(=N/C(=O)c1cccc(N3C(=O)CCC3=O)c1Cl)n2C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14cccc5c1"
} |
Can you make molecule CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNS(=O)(=O)c1ccc(NSC(=O)C[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NSC(=O)C[C@@H]2C[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNS(=O)(=O)c1ccc(NCC(=C=O)C[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NCC(=C=O)C[C@@H]2C[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNS(=O)(=O)c1ccc(NC(=O)CCCC(=O)[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NC(=O)CCCC(=O)[C@@H]2C[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNS(=O)(=O)c1ccc(NC(=O)CC(C)(C)[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NC(=O)CC(C)(C)[C@@H]2C[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNS(=O)(=O)c1ccc(NC[S@+]([O-])CCC[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NC(=O)[C@@H]2C[C@@H]2C)cc1 | CCCNS(=O)(=O)c1ccc(NC[S@+]([O-])CCC[C@@H]2C[C@@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C37=O"
} |
Can you make molecule N#Cc1cnn(-c2ccc(N)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cnn(-c2ccc(N)cc2Cl)c1Cl | N#Cc1cnn(-c2ccc(N)cc2)c1Cl | N#Cc1cnn(-c2ccc(N)cc2Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(N)cc1Cl",
"old_substring": "c13ccc(N)cc1"
} |
Can you make molecule N#Cc1cnn(-c2ccc(N)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cnn(-c2ccc(I)cc2)c1Cl | N#Cc1cnn(-c2ccc(N)cc2)c1Cl | N#Cc1cnn(-c2ccc(I)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c13ccc(N)cc1"
} |
Can you make molecule N#Cc1cnn(-c2ccc(N)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C#N)ccc1-n1ncc(C#N)c1Cl | N#Cc1cnn(-c2ccc(N)cc2)c1Cl | Cc1cc(C#N)ccc1-n1ncc(C#N)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1C",
"old_substring": "c13ccc(N)cc1"
} |
Can you make molecule N#Cc1cnn(-c2ccc(N)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(-n2ncc(C#N)c2Cl)c(Cl)c1 | N#Cc1cnn(-c2ccc(N)cc2)c1Cl | N#Cc1ccc(-n2ncc(C#N)c2Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1Cl",
"old_substring": "c13ccc(N)cc1"
} |
Can you make molecule N#Cc1cnn(-c2ccc(N)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cnn(-c2ccc(N)c(Br)c2)c1Cl | N#Cc1cnn(-c2ccc(N)cc2)c1Cl | N#Cc1cnn(-c2ccc(N)c(Br)c2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(N)c(Br)c1",
"old_substring": "c13ccc(N)cc1"
} |
Can you make molecule CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CC(C)(C)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)CC(C)(C)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)CC4"
} |
Can you make molecule CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCC(C)(C)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)CCC(C)(C)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)CC4"
} |
Can you make molecule CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)C[C@@H](Br)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)C[C@@H](Br)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C3(=O)CC4"
} |
Can you make molecule CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)[C@@H](C)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNSC(=O)[C@@H](C)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C3(=O)CC4"
} |
Can you make molecule CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H](C)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | CNC(=O)[C@H](C)CCN1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C3(=O)CC4"
} |
Can you make molecule O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(/C=C/SSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1cccs1)N1CCN(ON=C2CCN(Sc3cccc(C(F)(F)F)c3)CC2)CC1 | O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 | O=S(=O)(c1cccs1)N1CCN(ON=C2CCN(Sc3cccc(C(F)(F)F)c3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCN(Sc2cccc(C(F)(F)F)c2)CC1)N1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(NN=C1CCN(Sc2cccc(C(F)(F)F)c2)CC1)N1CCN(S(=O)(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(Sc2cccc(C(F)(F)F)c2)CC1)N1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(NN=C1CCC(Sc2cccc(C(F)(F)F)c2)CC1)N1CCN(S(=O)(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON1CCN(S(=O)(=O)c2cccs2)CC1)C(=O)SSc1cccc(C(F)(F)F)c1 | O=C(CSc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 | C/C(=N\ON1CCN(S(=O)(=O)c2cccs2)CC1)C(=O)SSc1cccc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C4"
} |
Can you make molecule CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCN1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | CC(C)CCN1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@H]1CCN(CCCCBr)C1=O | CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@H]1CCN(CCCCBr)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | C=CCCCN1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@H]1CCN(CCCCCl)C1=O | CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@H]1CCN(CCCCCl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | CC(C)N1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | C=CCCCCN1CC[C@H]([NH2+][C@H](C)CCc2ccc3c(c2)OCO3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC6C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.