prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CCC(CO)=Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CCCC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CC(=O)SNc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CCCCC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CC(=O)Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | CCC(C=O)=Nc1ccc(C=C2Cc3c(O)cccc3C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC4=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)C[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NSC(=O)C[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCC(=C=O)C[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NCC(=C=O)C[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCCC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NC(=O)CCCC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC(C)(C)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NC(=O)CC(C)(C)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC[S@+]([O-])CCC[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NC(=O)[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | Cc1ccc(NC[S@+]([O-])CCC[C@@H]2CCCCC[C@H]2[NH3+])c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(S(=O)(=O)SCNCCOc2ccc(Br)cc2)cn1C | Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C | Cc1nc(S(=O)(=O)SCNCCOc2ccc(Br)cc2)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N56"
} |
Can you make molecule Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(S(=O)(=O)SC(=N)NCCOc2ccc(Br)cc2)cn1C | Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C | Cc1nc(S(=O)(=O)SC(=N)NCCOc2ccc(Br)cc2)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N56"
} |
Can you make molecule Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(S(=O)(=O)c2snc(CCOc3ccc(Br)cc3)c2N)cn1C | Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C | Cc1nc(S(=O)(=O)c2snc(CCOc3ccc(Br)cc3)c2N)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N56"
} |
Can you make molecule Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(S(=O)(=O)SC(=S)N(C)CCOc2ccc(Br)cc2)cn1C | Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C | Cc1nc(S(=O)(=O)SC(=S)N(C)CCOc2ccc(Br)cc2)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N56"
} |
Can you make molecule Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(S(=O)(=O)c2cc(CCOc3ccc(Br)cc3)oc2N)cn1C | Cc1nc(S(=O)(=O)NCCOc2ccc(Br)cc2)cn1C | Cc1nc(S(=O)(=O)c2cc(CCOc3ccc(Br)cc3)oc2N)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N56"
} |
Can you make molecule N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCc1ccc(NSC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | N#CCc1ccc(NSC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C8"
} |
Can you make molecule N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCc1ccc(NC(=O)CCCC(=O)NC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | N#CCc1ccc(NC(=O)CCCC(=O)NC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C8"
} |
Can you make molecule N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1ccc(CC#N)cc1)NC(=O)c1ccc(Oc2ccccc2)cc1 | N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | CC(C)(CC(=O)Nc1ccc(CC#N)cc1)NC(=O)c1ccc(Oc2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C8"
} |
Can you make molecule N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCc1ccc(NC[S@+]([O-])CCCNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | N#CCc1ccc(NC[S@+]([O-])CCCNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C8"
} |
Can you make molecule N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)Nc1ccc(CC#N)cc1)NC(=O)c1ccc(Oc2ccccc2)cc1 | N#CCc1ccc(NC(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)cc1 | CC(C)(CCC(=O)Nc1ccc(CC#N)cc1)NC(=O)c1ccc(Oc2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C8"
} |
Can you make molecule CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc2c(c1-c1ccccc1)CCN(C(=O)C[NH2+]C1CCCCC1)C2 | CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 | CCc1sc2c(c1-c1ccccc1)CCN(C(=O)C[NH2+]C1CCCCC1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c(sc&c2&)C1",
"old_substring": "N235"
} |
Can you make molecule CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(-c2ccccc2)cc2c1OCCN(C(=O)C[NH2+]C1CCCCC1)C2 | CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 | CCc1cc(-c2ccccc2)cc2c1OCCN(C(=O)C[NH2+]C1CCCCC1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N235"
} |
Can you make molecule CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(c2ccccc2)CCN(C(=O)C[NH2+]C2CCCCC2)C1 | CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 | CCC1(c2ccccc2)CCN(C(=O)C[NH2+]C2CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N235"
} |
Can you make molecule CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(c2ccccc2)CCCN(C(=O)C[NH2+]C2CCCCC2)C1 | CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 | CCC1(c2ccccc2)CCCN(C(=O)C[NH2+]C2CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N235"
} |
Can you make molecule CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(C(=O)C[NH2+]C2CCCCC2)c(C#N)c1-c1ccccc1 | CCN(C(=O)C[NH2+]C1CCCCC1)c1ccccc1 | CCc1oc(C(=O)C[NH2+]C2CCCCC2)c(C#N)c1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N235"
} |
Can you make molecule CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)Cc1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNSC(=O)Cc1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C38=O"
} |
Can you make molecule CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCCC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNC(=O)CCCC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C38=O"
} |
Can you make molecule CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CC(C)(C)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNC(=O)CC(C)(C)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCC(C)(C)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNC(=O)CCC(C)(C)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)[C@@H](C)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNC(=O)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | CNSC(=O)[C@@H](C)c1cccc(CNC(=O)Nc2c[nH]nc2-c2ccccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C38=O"
} |
Can you make molecule CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | C=CSn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)Cn2c(=O)n(C(C)C)c3ccccc32)ccc1F | CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | Cc1cc(CNC(=O)Cn2c(=O)n(C(C)C)c3ccccc32)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | C=CCCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)Cn2c(=O)n(CCCCl)c3ccccc32)ccc1F | CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | Cc1cc(CNC(=O)Cn2c(=O)n(CCCCl)c3ccccc32)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)Cn2c(=O)n(CCCCS)c3ccccc32)ccc1F | CCn1c(=O)n(CC(=O)NCc2ccc(F)c(C)c2)c2ccccc21 | Cc1cc(CNC(=O)Cn2c(=O)n(CCCCS)c3ccccc32)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)N2CCN(Cc3cc(=O)n4nc(-c5ccccc5F)sc4n3)CC2)cc1I | Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 | Cc1ccc(NC(=O)N2CCN(Cc3cc(=O)n4nc(-c5ccccc5F)sc4n3)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccccc18"
} |
Can you make molecule Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)N2CCN(Cc3cc(=O)n4nc(-c5ccccc5F)sc4n3)CC2)cc1Cl | Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 | Cc1ccc(NC(=O)N2CCN(Cc3cc(=O)n4nc(-c5ccccc5F)sc4n3)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccccc18"
} |
Can you make molecule Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 | Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 | Cc1cc(I)ccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccccc18"
} |
Can you make molecule Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(NC(=O)N2CCN(Cc3cc(=O)n4nc(-c5ccccc5F)sc4n3)CC2)c1 | Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 | Cc1ccc(I)c(NC(=O)N2CCN(Cc3cc(=O)n4nc(-c5ccccc5F)sc4n3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccccc18"
} |
Can you make molecule Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c(NC(=O)N2CCN(Cc3cc(=O)n4nc(-c5ccccc5F)sc4n3)CC2)c1 | Cc1ccccc1NC(=O)N1CCN(Cc2cc(=O)n3nc(-c4ccccc4F)sc3n2)CC1 | Cc1ccc(Br)c(NC(=O)N2CCN(Cc3cc(=O)n4nc(-c5ccccc5F)sc4n3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccccc18"
} |
Can you make molecule COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)n2cnc(C)c2C)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)n2cnc(C)c2C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc(C)c1C",
"old_substring": "c18cnn(C)c1"
} |
Can you make molecule COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2nc(C)cs2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2nc(C)cs2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)cs1",
"old_substring": "c18cnn(C)c1"
} |
Can you make molecule COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2csc(C)n2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2csc(C)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(C)n1",
"old_substring": "c18cnn(C)c1"
} |
Can you make molecule COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2coc(C)n2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2coc(C)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&coc(C)n1",
"old_substring": "c18cnn(C)c1"
} |
Can you make molecule COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)n2ccc(C)n2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2cnn(C)c2)c1C | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)n2ccc(C)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc(C)n1",
"old_substring": "c18cnn(C)c1"
} |
Can you make molecule O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(Nc1cc(F)ccc1Br)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)ccc1Br)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c14cc(F)ccc1F"
} |
Can you make molecule O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(Nc1cc(F)ccc1Cl)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)ccc1Cl)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Cl",
"old_substring": "c14cc(F)ccc1F"
} |
Can you make molecule O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(Nc1cc(F)c(Br)cc1F)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)c(Br)cc1F)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)c(Br)cc1F",
"old_substring": "c14cc(F)ccc1F"
} |
Can you make molecule O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(Nc1ccc(Cl)c(F)c1F)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1ccc(Cl)c(F)c1F)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(F)c1F",
"old_substring": "c14cc(F)ccc1F"
} |
Can you make molecule O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(Nc1cc(F)c(F)cc1Cl)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | O=S(=O)(Nc1cc(F)c(F)cc1Cl)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)c(F)cc1Cl",
"old_substring": "c14cc(F)ccc1F"
} |
Can you make molecule COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N(C)CC(=O)NCCC(CO)=Nc1ccc(F)c(F)c1 | COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 | COc1ccccc1N(C)CC(=O)NCCC(CO)=Nc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N(C)CC(=O)NC/C(C)=N\ONc1ccc(F)c(F)c1 | COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 | COc1ccccc1N(C)CC(=O)NC/C(C)=N\ONc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NC(=O)CN(C)c1ccccc1OC)C(=O)CNc1ccc(F)c(F)c1 | COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 | CCC(CC)(NC(=O)CN(C)c1ccccc1OC)C(=O)CNc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N(C)CC(=O)NSSC(=O)Nc1ccc(F)c(F)c1 | COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 | COc1ccccc1N(C)CC(=O)NSSC(=O)Nc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)n1nc(NC(=O)CN(C)c2ccccc2OC)nc1Nc1ccc(F)c(F)c1 | COc1ccccc1N(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1 | CCC(=O)n1nc(NC(=O)CN(C)c2ccccc2OC)nc1Nc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)n1nc&nc1&",
"old_substring": "C6C3=O"
} |
Can you make molecule CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)[C@]12CCC[NH+](C1)C(=O)[C@@H]2C.N#Cc1ccc(N)cc1Cl | CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 | CC(C)[C@H](C)[C@]12CCC[NH+](C1)C(=O)[C@@H]2C.N#Cc1ccc(N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)n1c[nH+]c2c1[C@@H](C)C2=O.N#Cc1ccc(N)cc1Cl | CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 | CC(C)[C@H](C)n1c[nH+]c2c1[C@@H](C)C2=O.N#Cc1ccc(N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)c1cc2n([nH+]1)C(=O)[C@@H]2C.N#Cc1ccc(N)cc1Cl | CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 | CC(C)[C@H](C)c1cc2n([nH+]1)C(=O)[C@@H]2C.N#Cc1ccc(N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)c1c2c([nH+]n1C)C(=O)[C@@H]2C.N#Cc1ccc(N)cc1Cl | CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 | CC(C)[C@H](C)c1c2c([nH+]n1C)C(=O)[C@@H]2C.N#Cc1ccc(N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)c1nc2c(Br)c([nH+]1)C(=O)[C@@H]2C.N#Cc1ccc(N)cc1Cl | CC(C)[C@H](C)[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)c(Cl)c1 | CC(C)[C@H](C)c1nc2c(Br)c([nH+]1)C(=O)[C@@H]2C.N#Cc1ccc(N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]c&nc&c1Br",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCO)C1(Cc2c(-c3ccccc3)nn(C)c2Cl)CC[NH2+]C1 | C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl | C[C@H](CCCO)C1(Cc2c(-c3ccccc3)nn(C)c2Cl)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCO)[C@]1(Cc2c(-c3ccccc3)nn(C)c2Cl)CCC[NH2+]C1 | C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl | C[C@H](CCCO)[C@]1(Cc2c(-c3ccccc3)nn(C)c2Cl)CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCO)n1c[nH+]cc1Cc1c(-c2ccccc2)nn(C)c1Cl | C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl | C[C@H](CCCO)n1c[nH+]cc1Cc1c(-c2ccccc2)nn(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCO)c1cc(Cc2c(-c3ccccc3)nn(C)c2Cl)[nH][nH+]1 | C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl | C[C@H](CCCO)c1cc(Cc2c(-c3ccccc3)nn(C)c2Cl)[nH][nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCO)c1c(Cc2c(-c3ccccc3)nn(C)c2Cl)c[nH+]n1C | C[C@H](CCCO)[NH2+]Cc1c(-c2ccccc2)nn(C)c1Cl | C[C@H](CCCO)c1c(Cc2c(-c3ccccc3)nn(C)c2Cl)c[nH+]n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CCC(CC)([C@H](O)COC(C)C)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@H](O)C[NH+]1CCCC(C)(C)OC(C)C | CCC(CC)([C@H](O)COC(C)C)[NH+](C)C | CCC1(CC)[C@H](O)C[NH+]1CCCC(C)(C)OC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule CCC(CC)([C@H](O)COC(C)C)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([C@H](O)COC(C)C)[N+](C)(C)C | CCC(CC)([C@H](O)COC(C)C)[NH+](C)C | CCC(CC)([C@H](O)COC(C)C)[N+](C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule CCC(CC)([C@H](O)COC(C)C)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@H](O)C[NH+]1CC(C)(C)COC(C)C | CCC(CC)([C@H](O)COC(C)C)[NH+](C)C | CCC1(CC)[C@H](O)C[NH+]1CC(C)(C)COC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC(C)(C)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule CCC(CC)([C@H](O)COC(C)C)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@H](O)C[NH+]1CCC(C)(C)COC(C)C | CCC(CC)([C@H](O)COC(C)C)[NH+](C)C | CCC1(CC)[C@H](O)C[NH+]1CCC(C)(C)COC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule CCC(CC)([C@H](O)COC(C)C)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@H](O)C[NH+]1CC1(C(C)C)CCCOC1 | CCC(CC)([C@H](O)COC(C)C)[NH+](C)C | CCC1(CC)[C@H](O)C[NH+]1CC1(C(C)C)CCCOC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCC2)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C(=O)CCc2nc3ccccc3c(=O)[nH]2)Cc2ccccc2C1 | O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 | CC1(C(=O)CCc2nc3ccccc3c(=O)[nH]2)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "N3[C@H]1CCc2ccccc21"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CCCc2cc(Br)ccc21 | O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CCCc2cc(Br)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc(Br)ccc21",
"old_substring": "N3[C@H]1CCc2ccccc21"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CCCc2cc(Cl)ccc21 | O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CCCc2cc(Cl)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc(Cl)ccc21",
"old_substring": "N3[C@H]1CCc2ccccc21"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CCCc2cccc(Cl)c21 | O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CCCc2cccc(Cl)c21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cccc(Cl)c21",
"old_substring": "N3[C@H]1CCc2ccccc21"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCSc2c1cccc2C(=O)CCc1nc2ccccc2c(=O)[nH]1 | O=C(CCc1nc2ccccc2c(=O)[nH]1)N[C@H]1CCc2ccccc21 | O=C1CCSc2c1cccc2C(=O)CCc1nc2ccccc2c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1CCSc2c&cccc21",
"old_substring": "N3[C@H]1CCc2ccccc21"
} |
Can you make molecule CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCC(CO)=NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | CN(CCC(CO)=NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C3C2=O"
} |
Can you make molecule CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CN(C)S(=O)(=O)c1ccc(Cl)cc1)=N/ONCC(C)(C)c1ccncc1 | CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | C/C(CN(C)S(=O)(=O)c1ccc(Cl)cc1)=N/ONCC(C)(C)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C3C2=O"
} |
Can you make molecule CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNCC(C)(C)c1ccncc1)N(C)S(=O)(=O)c1ccc(Cl)cc1 | CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | CCC(CC)(C(=O)CNCC(C)(C)c1ccncc1)N(C)S(=O)(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C3C2=O"
} |
Can you make molecule CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(SSC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | CN(SSC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C3C2=O"
} |
Can you make molecule CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNCC(C)(C)c1ccncc1)N(C)S(=O)(=O)c1ccc(Cl)cc1 | CN(CC(=O)NCC(C)(C)c1ccncc1)S(=O)(=O)c1ccc(Cl)cc1 | CCC(CC)(C(=O)CCNCC(C)(C)c1ccncc1)N(C)S(=O)(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C3C2=O"
} |
Can you make molecule COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)CC(C)(C)NCc4ccccc4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)CC(C)(C)NCc4ccccc4)c3)cn2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)CCC(C)(C)NCc4ccccc4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)CCC(C)(C)NCc4ccccc4)c3)cn2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)C[C@@H](Br)NCc4ccccc4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)C[C@@H](Br)NCc4ccccc4)c3)cn2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C56=O"
} |
Can you make molecule COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2nc(-c3ccc(Cl)c(Nc4cc(C)n(NCc5ccccc5)c(=O)c4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(Nc4cc(C)n(NCc5ccccc5)c(=O)c4)c3)cn2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C56=O"
} |
Can you make molecule COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2nc(-c3ccc(Cl)c(Nc4c(C)n(NCc5ccccc5)ccc4=O)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(NC(=O)NCc4ccccc4)c3)cn2n1 | COc1ccc2nc(-c3ccc(Cl)c(Nc4c(C)n(NCc5ccccc5)ccc4=O)c3)cn2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C56=O"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN(C(=O)[C@@H](C)CCOc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)[C@@H](C)CCOc2ccc(C)cc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](C)CC&",
"old_substring": "C3(=O)[C@@H]4C"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN(SC(=O)[C@@H](C)Oc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(SC(=O)[C@@H](C)Oc2ccc(C)cc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C3(=O)[C@@H]4C"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN(C(=O)[C@H](C)CCOc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)[C@H](C)CCOc2ccc(C)cc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C3(=O)[C@@H]4C"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN(C(=O)C[C@@H](C)COc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)C[C@@H](C)COc2ccc(C)cc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H](C)C&",
"old_substring": "C3(=O)[C@@H]4C"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN(C(=O)C[C@@H](Br)Oc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)[C@H](C)Oc2ccc(C)cc2C)CC1 | COc1ccccc1N1CCN(C(=O)C[C@@H](Br)Oc2ccc(C)cc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C3(=O)[C@@H]4C"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc(CC(=O)SN3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(CC(=O)SN3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc(C(=O)CCCC(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(C(=O)CCCC(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc(C(C)(C)CC(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(C(C)(C)CC(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc(C(C)(C)CCC(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(C(C)(C)CCC(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc([C@H](C)C(=O)SN3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc(C(=O)N3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | COc1ccc(-n2nc([C@H](C)C(=O)SN3CCC[C@@H]4CCC[C@H]43)cc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C57=O"
} |
Can you make molecule CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCN(C(=O)CC(C)(C)NCCC[NH+]2CCCCC2)C1 | CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 | CO[C@H]1CCCN(C(=O)CC(C)(C)NCCC[NH+]2CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCN(C(=O)CCC(C)(C)NCCC[NH+]2CCCCC2)C1 | CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 | CO[C@H]1CCCN(C(=O)CCC(C)(C)NCCC[NH+]2CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCN(C(=O)C[C@@H](Br)NCCC[NH+]2CCCCC2)C1 | CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 | CO[C@H]1CCCN(C(=O)C[C@@H](Br)NCCC[NH+]2CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCN(c2cc(C)n(NCCC[NH+]3CCCCC3)c(=O)c2)C1 | CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 | CO[C@H]1CCCN(c2cc(C)n(NCCC[NH+]3CCCCC3)c(=O)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCN(c2c(C)n(NCCC[NH+]3CCCCC3)ccc2=O)C1 | CO[C@H]1CCCN(C(=O)NCCC[NH+]2CCCCC2)C1 | CO[C@H]1CCCN(c2c(C)n(NCCC[NH+]3CCCCC3)ccc2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.