prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(Cl)c2)sc1CC(=O)SN[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1CC(=O)SN[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(Cl)c2)sc1C(=O)CCCC(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1C(=O)CCCC(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(Cl)c2)sc1C(C)(C)CC(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1C(C)(C)CC(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(Cl)c2)sc1C(C)(C)CCC(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1C(C)(C)CCC(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(Cl)c2)sc1[C@H](C)C(=O)SN[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1 | Cc1nc(-c2cccc(Cl)c2)sc1[C@H](C)C(=O)SN[C@H]1CC[C@@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cccc(-c2noc([C@H]3C(CC(=O)c4ccc(F)cc4)=CN=C3C)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3C(CC(=O)c4ccc(F)cc4)=CN=C3C)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C(C&)=CN=C1C",
"old_substring": "[C@H]19CCCN6C1"
} |
Can you make molecule CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cccc(-c2noc([C@H]3C=C[C@H](C(=O)c4ccc(F)cc4)C3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3C=C[C@H](C(=O)c4ccc(F)cc4)C3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]19CCCN6C1"
} |
Can you make molecule CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cccc(-c2noc([C@H]3CCC[C@H](C(=O)c4ccc(F)cc4)C3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3CCC[C@H](C(=O)c4ccc(F)cc4)C3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]19CCCN6C1"
} |
Can you make molecule CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cccc(-c2noc([C@H]3C=C(CC(=O)c4ccc(F)cc4)N=N3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3C=C(CC(=O)c4ccc(F)cc4)N=N3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C(C&)N=N1",
"old_substring": "[C@H]19CCCN6C1"
} |
Can you make molecule CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Nc1cccc(-c2noc([C@H]3C=C[C@@H](C(=O)c4ccc(F)cc4)C3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3CCCN(C(=O)c4ccc(F)cc4)C3)n2)c1 | CCC(=O)Nc1cccc(-c2noc([C@H]3C=C[C@@H](C(=O)c4ccc(F)cc4)C3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]19CCCN6C1"
} |
Can you make molecule CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 | CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 | C=CCC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H](O)[C@]2(C[NH3+])CCC[C@H](CCCCl)C2)c1C | CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 | Cc1cccc([C@@H](O)[C@]2(C[NH3+])CCC[C@H](CCCCl)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H](O)[C@]2(C[NH3+])CCC[C@H](CCCCS)C2)c1C | CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 | Cc1cccc([C@@H](O)[C@]2(C[NH3+])CCC[C@H](CCCCS)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H](O)[C@]2(C[NH3+])CCC[C@H](CCCBr)C2)c1C | CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 | Cc1cccc([C@@H](O)[C@]2(C[NH3+])CCC[C@H](CCCBr)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H](O)[C@]2(C[NH3+])CCC[C@H](CCCCF)C2)c1C | CC[C@H]1CCC[C@@](C[NH3+])([C@H](O)c2cccc(C)c2C)C1 | Cc1cccc([C@@H](O)[C@]2(C[NH3+])CCC[C@H](CCCCF)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC3"
} |
Can you make molecule CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C[NH+]1CCCC1(C)C)C(=O)[O-] | CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] | CC(C)[C@@H](C[NH+]1CCCC1(C)C)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]1(C)C"
} |
Can you make molecule CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C[NH+]1CC(C)(C)C1)C(=O)[O-] | CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] | CC(C)[C@@H](C[NH+]1CC(C)(C)C1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC(C)(C)C1",
"old_substring": "[NH+]1(C)C"
} |
Can you make molecule CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C[NH+]1CC2(CC2)C1)C(=O)[O-] | CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] | CC(C)[C@@H](C[NH+]1CC2(CC2)C1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CC2)C1",
"old_substring": "[NH+]1(C)C"
} |
Can you make molecule CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C[NH+]1CCCC1)C(=O)[O-] | CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] | CC(C)[C@@H](C[NH+]1CCCC1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1",
"old_substring": "[NH+]1(C)C"
} |
Can you make molecule CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C[NH+]1CCC(C)(C)C1)C(=O)[O-] | CC(C)[C@@H](C[NH+](C)C)C(=O)[O-] | CC(C)[C@@H](C[NH+]1CCC(C)(C)C1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]1(C)C"
} |
Can you make molecule CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | C=CSN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | C=CCCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCCl)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | CCN(CCCCl)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCCS)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | CCN(CCCCS)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCBr)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | CCN(CC)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | CCN(CCCBr)S(=O)(=O)N1CCC[C@H](C(=O)NC2CCCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCCN1CCOCC1)c1nc(-c2cnccn2)no1 | O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 | O=C(NCCCCCN1CCOCC1)c1nc(-c2cnccn2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4CC5"
} |
Can you make molecule O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCN1CCOCC1)=NC(=O)c1nc(-c2cnccn2)no1 | O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 | CC(CCN1CCOCC1)=NC(=O)c1nc(-c2cnccn2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4CC5"
} |
Can you make molecule O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCC(N2CCOCC2)CC1)c1nc(-c2cnccn2)no1 | O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 | O=C(NC1CCC(N2CCOCC2)CC1)c1nc(-c2cnccn2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4CC5"
} |
Can you make molecule O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)c1nc(-c2cnccn2)no1)CN1CCOCC1 | O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 | CC(C)(CNC(=O)c1nc(-c2cnccn2)no1)CN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C4CC5"
} |
Can you make molecule O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCN1CCOCC1)NC(=O)c1nc(-c2cnccn2)no1 | O=C(NCCCN1CCOCC1)c1nc(-c2cnccn2)no1 | CCC[C@@H](CCN1CCOCC1)NC(=O)c1nc(-c2cnccn2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C4CC5"
} |
Can you make molecule C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1c(Br)cc(CN(C)[C@H]2CCOC(C)(C)C2)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CCOC(C)(C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCOC(C)(C)C1",
"old_substring": "[C@H]17CC[NH+](C)[C@H](C)C1"
} |
Can you make molecule C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1c(Br)cc(CN(C)[C@H]2CCCC2(C)C)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CCCC2(C)C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]17CC[NH+](C)[C@H](C)C1"
} |
Can you make molecule C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1c(Br)cc(CN(C)[C@H]2CCCCN(C)C2=O)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CCCCN(C)C2=O)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN(C)C1=O",
"old_substring": "[C@H]17CC[NH+](C)[C@H](C)C1"
} |
Can you make molecule C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1c(Br)cc(CN(C)[C@H]2CCC=CCCC2)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CCC=CCCC2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC=CCCC1",
"old_substring": "[C@H]17CC[NH+](C)[C@H](C)C1"
} |
Can you make molecule C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1c(Br)cc(CN(C)[C@@H](C)CCC(C)(C)C)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@H]2CC[NH+](C)[C@H](C)C2)cc1OC | C=CCOc1c(Br)cc(CN(C)[C@@H](C)CCC(C)(C)C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "[C@H]17CC[NH+](C)[C@H](C)C1"
} |
Can you make molecule CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C)SC(=O)Cc1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)SC(=O)Cc1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C)C(=O)CCCC(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)C(=O)CCCC(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C)C(=O)CC(C)(C)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)C(=O)CC(C)(C)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C)C(=O)CCC(C)(C)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)C(=O)CCC(C)(C)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C)SC(=O)[C@@H](C)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)C(=O)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | CCN(C)SC(=O)[C@@H](C)c1cccc(C(=O)N2CC3(CCCC3)c3cc4c(cc3[C@H]2C)OCCO4)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccnc2c1nc(CCl)n2-c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2c(CCl)nc3c(C)ccnc32)sc1C | Cc1ccnc2c1nc(CCl)n2-c1ccsc1 | Cc1cc(-n2c(CCl)nc3c(C)ccnc32)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "c14ccsc1"
} |
Can you make molecule Cc1ccnc2c1nc(CCl)n2-c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2c(CCl)nc3c(C)ccnc32)c(C)s1 | Cc1ccnc2c1nc(CCl)n2-c1ccsc1 | Cc1cc(-n2c(CCl)nc3c(C)ccnc32)c(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)sc1C",
"old_substring": "c14ccsc1"
} |
Can you make molecule Cc1ccnc2c1nc(CCl)n2-c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccnc2c1nc(CCl)n2-c1sccc1Br | Cc1ccnc2c1nc(CCl)n2-c1ccsc1 | Cc1ccnc2c1nc(CCl)n2-c1sccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c14ccsc1"
} |
Can you make molecule Cc1ccnc2c1nc(CCl)n2-c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccnc2c1nc(CCl)n2-c1cc2sccc2s1 | Cc1ccnc2c1nc(CCl)n2-c1ccsc1 | Cc1ccnc2c1nc(CCl)n2-c1cc2sccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c14ccsc1"
} |
Can you make molecule Cc1ccnc2c1nc(CCl)n2-c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccnc2c1nc(CCl)n2-c1cc(Cl)sc1Cl | Cc1ccnc2c1nc(CCl)n2-c1ccsc1 | Cc1ccnc2c1nc(CCl)n2-c1cc(Cl)sc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c14ccsc1"
} |
Can you make molecule C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CCCC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCCC&",
"old_substring": "C#CC4"
} |
Can you make molecule C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CCCCC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCCCC&",
"old_substring": "C#CC4"
} |
Can you make molecule C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CC(C)(C)[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CC&(C)C",
"old_substring": "C#CC4"
} |
Can you make molecule C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC(C)(C)[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CCC(C)(C)[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCC&(C)C",
"old_substring": "C#CC4"
} |
Can you make molecule C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(CC)(CC)[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CC[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | C#CC(CC)(CC)[NH2+]CC(=O)Nc1cccc(-c2nncn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CC&(CC)CC",
"old_substring": "C#CC4"
} |
Can you make molecule COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1I | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)ccc1Br | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 | COc1cc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1Cl | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)c1Br | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 | COc1cccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)c1Cl | COc1ccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)cc1 | COc1cccc([C@H](NC(=O)c2ccc3nc(C)sc3c2)c2ccncc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2Cl)n1 | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccc(I)cc2)n1 | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccc(I)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Nc2nc(N)nc([C@@H](C#N)C(=O)c3ccc(Cl)cc3)n2)cc1I | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 | Cc1ccc(Nc2nc(N)nc([C@@H](C#N)C(=O)c3ccc(Cl)cc3)n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2cccc(Br)c2)n1 | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2cccc(Br)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(Nc2nc(N)nc([C@@H](C#N)C(=O)c3ccc(Cl)cc3)n2)c1C | N#C[C@@H](C(=O)c1ccc(Cl)cc1)c1nc(N)nc(Nc2ccccc2)n1 | Cc1cccc(Nc2nc(N)nc([C@@H](C#N)C(=O)c3ccc(Cl)cc3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2SCCS2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2SCCS2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CCCCC2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CCCCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2SCCCS2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2SCCCS2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2SCSCS2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2SCSCS2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C15CC1"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CCCCCC2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CC2)C1=O | CCc1nc2n(n1)CCC[C@@H]2N[C@H]1CCN(C2CCCCCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1cc(Br)c(F)cc1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1cc(Br)c(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c17c(F)cccc1Cl"
} |
Can you make molecule C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1cc(Br)ccc1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1cc(Br)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c17c(F)cccc1Cl"
} |
Can you make molecule C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1sc2cc(F)ccc2c1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1sc2cc(F)ccc2c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cc(F)ccc2c1Cl",
"old_substring": "c17c(F)cccc1Cl"
} |
Can you make molecule C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1cc(Br)cc(Br)c1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1cc(Br)cc(Br)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc(Br)c1Cl",
"old_substring": "c17c(F)cccc1Cl"
} |
Can you make molecule C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1sc2cccc(F)c2c1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl | C[NH+](C)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1sc2cccc(F)c2c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cccc(F)c2c1Cl",
"old_substring": "c17c(F)cccc1Cl"
} |
Can you make molecule O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1I | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccccc1F)c1cc(CN2C(=O)CCC2=O)ccc1Br | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 | O=C(NCc1ccccc1F)c1cc(CN2C(=O)CCC2=O)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1Cl | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccccc1F)c1cccc(CN2C(=O)CCC2=O)c1Br | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 | O=C(NCc1ccccc1F)c1cccc(CN2C(=O)CCC2=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccccc1F)c1cccc(CN2C(=O)CCC2=O)c1Cl | O=C(NCc1ccccc1F)c1ccc(CN2C(=O)CCC2=O)cc1 | O=C(NCc1ccccc1F)c1cccc(CN2C(=O)CCC2=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(NSC(=O)CC2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NSC(=O)CC2(c3ccccc3)CC2)cc1C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(NCC(=C=O)CC2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NCC(=C=O)CC2(c3ccccc3)CC2)cc1C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(NC(=O)CCCC(=O)C2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NC(=O)CCCC(=O)C2(c3ccccc3)CC2)cc1C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(NC(=O)CC(C)(C)C2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NC(=O)CC(C)(C)C2(c3ccccc3)CC2)cc1C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(NC[S@+]([O-])CCCC2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NC(=O)C2(c3ccccc3)CC2)cc1C(N)=O | Cn1cc(NC[S@+]([O-])CCCC2(c3ccccc3)CC2)cc1C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C47=O"
} |
Can you make molecule [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 less soluble in water? The output molecule should be similar to the input molecule. | c1nc2ncn3c(C4CCCCCC4)nnc3c2[nH]1 | [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 | c1nc2ncn3c(C4CCCCCC4)nnc3c2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[NH3+][C@@H]1CCCCC[C@@H]14"
} |
Can you make molecule [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 less soluble in water? The output molecule should be similar to the input molecule. | c1nc2ncn3c(C4CCCCCC4)nnc3c2[nH]1 | [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 | c1nc2ncn3c(C4CCCCCC4)nnc3c2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[NH3+][C@@H]1CCCCC[C@@H]14"
} |
Can you make molecule [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 less soluble in water? The output molecule should be similar to the input molecule. | c1nc2ncn3c(C4CCCC4)nnc3c2[nH]1 | [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 | c1nc2ncn3c(C4CCCC4)nnc3c2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[NH3+][C@@H]1CCCCC[C@@H]14"
} |
Can you make molecule [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 less soluble in water? The output molecule should be similar to the input molecule. | c1nc2ncn3c(C4CCCCC4)nnc3c2[nH]1 | [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 | c1nc2ncn3c(C4CCCCC4)nnc3c2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[NH3+][C@@H]1CCCCC[C@@H]14"
} |
Can you make molecule [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 less soluble in water? The output molecule should be similar to the input molecule. | CC1(c2nnc3c4[nH]cnc4ncn23)CCCCC1 | [NH3+][C@@H]1CCCCC[C@@H]1c1nnc2c3[nH]cnc3ncn12 | CC1(c2nnc3c4[nH]cnc4ncn23)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "[NH3+][C@@H]1CCCCC[C@@H]14"
} |
Can you make molecule O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 | O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 | O=C(/C=C/Sc1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CC[NH+](Cc3ccccc3)CC2)nc1-c1ccc(Br)o1 | O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 | O=Cc1sc(N2CC[NH+](Cc3ccccc3)CC2)nc1-c1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CC[NH+](Cc3ccccc3)CC2)sc1-c1ccc(Br)o1 | O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 | O=Cc1nc(N2CC[NH+](Cc3ccccc3)CC2)sc1-c1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N1CC[NH+](Cc2ccccc2)CC1)n1nc(-c2ccc(Br)o2)oc1=S | O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 | O=C(N1CC[NH+](Cc2ccccc2)CC1)n1nc(-c2ccc(Br)o2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1ccc(-c2ccc(/C=N/ON3CC[NH+](Cc4ccccc4)CC3)o2)o1 | O=C(c1ccc(Br)o1)N1CC[NH+](Cc2ccccc2)CC1 | Brc1ccc(-c2ccc(/C=N/ON3CC[NH+](Cc4ccccc4)CC3)o2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCC(C3CC[NH+](C)CC3)CC2)cc1F | C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 | COc1ccc(N2CCC(C3CC[NH+](C)CC3)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCC([NH+]3CCC=C(C)C3)CC2)cc1F | C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 | COc1ccc(N2CCC([NH+]3CCC=C(C)C3)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCC[NH+]&C1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCC([NH+]3CCC(C)CC3)CC2)cc1F | C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 | COc1ccc(N2CCC([NH+]3CCC(C)CC3)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CC[NH+]&CC1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCC(C3(C)CC[NH+](C)CC3)CC2)cc1F | C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 | COc1ccc(N2CCC(C3(C)CC[NH+](C)CC3)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&(C)CC1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCC([C@@H]3CC[NH+](C)C3)CC2)cc1F | C[NH2+]C1CCN(c2ccc(OC)c(F)c2)CC1 | COc1ccc(N2CCC([C@@H]3CC[NH+](C)C3)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CC[C@@H]&C1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule Cc1cccc(F)c1[C@H](N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(F)c1[C@@H](Br)C(F)(F)F | Cc1cccc(F)c1[C@H](N)C(F)(F)F | Cc1cccc(F)c1[C@@H](Br)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(Br)C(F)(F)F",
"old_substring": "[C@@H]2(N)C(F)(F)F"
} |
Can you make molecule Cc1cccc(F)c1[C@H](N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(F)c1[C@@H](C)C(F)(F)F | Cc1cccc(F)c1[C@H](N)C(F)(F)F | Cc1cccc(F)c1[C@@H](C)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)C(F)(F)F",
"old_substring": "[C@@H]2(N)C(F)(F)F"
} |
Can you make molecule Cc1cccc(F)c1[C@H](N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(F)c1[C@@H](Cl)C(F)(F)F | Cc1cccc(F)c1[C@H](N)C(F)(F)F | Cc1cccc(F)c1[C@@H](Cl)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(Cl)C(F)(F)F",
"old_substring": "[C@@H]2(N)C(F)(F)F"
} |
Can you make molecule Cc1cccc(F)c1[C@H](N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(F)c1[C@H](C)C(C)(C)C | Cc1cccc(F)c1[C@H](N)C(F)(F)F | Cc1cccc(F)c1[C@H](C)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C",
"old_substring": "[C@@H]2(N)C(F)(F)F"
} |
Can you make molecule Cc1cccc(F)c1[C@H](N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(F)c1[C@@](C)(C#N)C(C)C | Cc1cccc(F)c1[C@H](N)C(F)(F)F | Cc1cccc(F)c1[C@@](C)(C#N)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@]&(C)(C#N)C(C)C",
"old_substring": "[C@@H]2(N)C(F)(F)F"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.