prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1cccc(C(=O)C2CCN([C@]3(c4ccccc4Cl)CCCCC3=O)CC2)c1 | CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O | CN(C)S(=O)(=O)c1cccc(C(=O)C2CCN([C@]3(c4ccccc4Cl)CCCCC3=O)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)C(=S)S[C@]1(c2ccccc2Cl)CCCCC1=O | CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O | CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)C(=S)S[C@]1(c2ccccc2Cl)CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1cccc(C(=O)CN2CCC([C@]3(c4ccccc4Cl)CCCCC3=O)CC2)c1 | CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O | CN(C)S(=O)(=O)c1cccc(C(=O)CN2CCC([C@]3(c4ccccc4Cl)CCCCC3=O)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1cccc(C(=O)N2CSC(=S)N([C@]3(c4ccccc4Cl)CCCCC3=O)C2)c1 | CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O | CN(C)S(=O)(=O)c1cccc(C(=O)N2CSC(=S)N([C@]3(c4ccccc4Cl)CCCCC3=O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1cccc(C(=O)C2(C#N)CCC([C@]3(c4ccccc4Cl)CCCCC3=O)CC2)c1 | CN(C(=O)c1cccc(S(=O)(=O)N(C)C)c1)[C@]1(c2ccccc2Cl)CCCCC1=O | CN(C)S(=O)(=O)c1cccc(C(=O)C2(C#N)CCC([C@]3(c4ccccc4Cl)CCCCC3=O)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCn2c(C)cc3c(c2=O)[C@@H](c2ccccc2Cl)C(C#N)=C(N)O3)ccc1O | Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | Cc1cc(CCn2c(C)cc3c(c2=O)[C@@H](c2ccccc2Cl)C(C#N)=C(N)O3)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)c(C)c1",
"old_substring": "c14ccc(O)c(O)c1"
} |
Can you make molecule Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(c(=O)n1CCc1ccc(O)c(Cl)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | Cc1cc2c(c(=O)n1CCc1ccc(O)c(Cl)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)c(Cl)c1",
"old_substring": "c14ccc(O)c(O)c1"
} |
Can you make molecule Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCn2c(C)cc3c(c2=O)[C@@H](c2ccccc2Cl)C(C#N)=C(N)O3)ccc1C=O | Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | Cc1cc(CCn2c(C)cc3c(c2=O)[C@@H](c2ccccc2Cl)C(C#N)=C(N)O3)ccc1C=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C=O)c(C)c1",
"old_substring": "c14ccc(O)c(O)c1"
} |
Can you make molecule Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCn2c(C)cc3c(c2=O)[C@@H](c2ccccc2Cl)C(C#N)=C(N)O3)ccc1F | Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | Cc1cc(CCn2c(C)cc3c(c2=O)[C@@H](c2ccccc2Cl)C(C#N)=C(N)O3)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(C)c1",
"old_substring": "c14ccc(O)c(O)c1"
} |
Can you make molecule Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(c(=O)n1CCc1ccc(I)c(F)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | Cc1cc2c(c(=O)n1CCc1ccc(O)c(O)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | Cc1cc2c(c(=O)n1CCc1ccc(I)c(F)c1)[C@@H](c1ccccc1Cl)C(C#N)=C(N)O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)c(F)c1",
"old_substring": "c14ccc(O)c(O)c1"
} |
Can you make molecule CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCCCCCC(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCC(CC)C3=O"
} |
Can you make molecule CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCCC(C)(C)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCC(CC)C3=O"
} |
Can you make molecule CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCC(C)(CC)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "CCC(CC)C3=O"
} |
Can you make molecule CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCCC(CCC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC(CCC)C&=O",
"old_substring": "CCC(CC)C3=O"
} |
Can you make molecule CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(CCl)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCC(CC)C(=O)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | CCC(CC)(CCl)N1CCC(NC(=O)Nc2ccc(OC)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)CCl",
"old_substring": "CCC(CC)C3=O"
} |
Can you make molecule C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCCl)Nc1[nH+]c2ccccc2n1C | C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C | C[C@H](CCCCl)Nc1[nH+]c2ccccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CCCCl",
"old_substring": "C[C@@H]3CCCO"
} |
Can you make molecule C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC(=Nc2[nH+]c3ccccc3n2C)C1=O | C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C | C[C@@H]1CCCC(=Nc2[nH+]c3ccccc3n2C)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCC=&C1=O",
"old_substring": "C[C@@H]3CCCO"
} |
Can you make molecule C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCS)CCNc1[nH+]c2ccccc2n1C | C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C | C[C@H](CCS)CCNc1[nH+]c2ccccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CCS",
"old_substring": "C[C@@H]3CCCO"
} |
Can you make molecule C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCl)CCNc1[nH+]c2ccccc2n1C | C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C | C[C@@H](CCl)CCNc1[nH+]c2ccccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CCl)CC&",
"old_substring": "C[C@@H]3CCCO"
} |
Can you make molecule C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@@]1(O)Nc1[nH+]c2ccccc2n1C | C[C@H](CCCO)Nc1[nH+]c2ccccc2n1C | C[C@@H]1CCCC[C@@]1(O)Nc1[nH+]c2ccccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCC[C@]1&O",
"old_substring": "C[C@@H]3CCCO"
} |
Can you make molecule Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(C)cc2)c1 | Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 | CC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(C)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)Nc2cc(CCCCC(N)=O)ccc2C)cc1 | Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 | Cc1ccc(S(=O)(=O)Nc2cc(CCCCC(N)=O)ccc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)Nc2cc(CC/C(N)=N/O)ccc2C)cc1 | Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 | Cc1ccc(S(=O)(=O)Nc2cc(CC/C(N)=N/O)ccc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)Nc2cc(CC/C(N)=N\O)ccc2C)cc1 | Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 | Cc1ccc(S(=O)(=O)Nc2cc(CC/C(N)=N\O)ccc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)Nc2cc(CC(N)=S)ccc2C)cc1 | Cc1ccc(S(=O)(=O)Nc2cc(C(N)=O)ccc2C)cc1 | Cc1ccc(S(=O)(=O)Nc2cc(CC(N)=S)ccc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C5(N)=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCC(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)CCC(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC&=O",
"old_substring": "CC(C)C3=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC=Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)CC=Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC=&",
"old_substring": "CC(C)C3=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)CCCC(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC(C)C3=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CC(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)(C)CC(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC&=O",
"old_substring": "CC(C)C3=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCC(=O)CNc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)C(=O)Nc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | CC(C)CCC(=O)CNc1cccc(OCC(=O)Nc2ccccc2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC(=O)C&",
"old_substring": "CC(C)C3=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Cl)sc1C(=O)N1CCc2c(sc(N)c2C#N)C1 | Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 | Cc1nc(Cl)sc1C(=O)N1CCc2c(sc(N)c2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc(Cl)sc1&",
"old_substring": "Cc1nc(C)c5o1"
} |
Can you make molecule Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C(=O)N2CCc3c(sc(N)c3C#N)C2)c(C)c1I | Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 | Cc1nn(C(=O)N2CCc3c(sc(N)c3C#N)C2)c(C)c1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn&c(C)c1I",
"old_substring": "Cc1nc(C)c5o1"
} |
Can you make molecule Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C(=O)N2CCc3c(sc(N)c3C#N)C2)c(C)c1Cl | Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 | Cc1nn(C(=O)N2CCc3c(sc(N)c3C#N)C2)c(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn&c(C)c1Cl",
"old_substring": "Cc1nc(C)c5o1"
} |
Can you make molecule Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)c1C | Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 | Cc1oc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1oc(C)c&c1C",
"old_substring": "Cc1nc(C)c5o1"
} |
Can you make molecule Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(C(=O)N2CCc3c(sc(N)c3C#N)C2)c(C)c1Cl | Cc1nc(C)c(C(=O)N2CCc3c(sc(N)c3C#N)C2)o1 | Cc1ncc(C(=O)N2CCc3c(sc(N)c3C#N)C2)c(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ncc&c(C)c1Cl",
"old_substring": "Cc1nc(C)c5o1"
} |
Can you make molecule Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc2nc(CCCCOC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(CCCCOC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C68"
} |
Can you make molecule Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc2nc(CCCCCOC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(CCCCCOC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C68"
} |
Can you make molecule Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc2nc(C3CC(OC(=O)C[C@@H]4Oc5ccccc5NC4=O)C3)cc(=O)n12 | Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(C3CC(OC(=O)C[C@@H]4Oc5ccccc5NC4=O)C3)cc(=O)n12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C68"
} |
Can you make molecule Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc2nc(SC(=S)OOC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(SC(=S)OOC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C68"
} |
Can you make molecule Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc2nc(NC(=S)SOC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(COC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | Cc1csc2nc(NC(=S)SOC(=O)C[C@@H]3Oc4ccccc4NC3=O)cc(=O)n12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C68"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1cccc(CC(=O)SNc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(CC(=O)SNc2ccc(Cl)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1cccc(C(=O)CCCC(=O)Nc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(C(=O)CCCC(=O)Nc2ccc(Cl)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1cccc(C(C)(C)CC(=O)Nc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(C(C)(C)CC(=O)Nc2ccc(Cl)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1cccc(C(C)(C)CCC(=O)Nc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(C(C)(C)CCC(=O)Nc2ccc(Cl)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1cccc([C@H](C)C(=O)SNc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 | CC(C)C(=O)Nc1cccc([C@H](C)C(=O)SNc2ccc(Cl)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=NO[C@@H]2CC[C@H](NC(=O)C3CCN(CC(F)(F)F)CC3)C2)CC1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 | C[NH+]1CCC(=NO[C@@H]2CC[C@H](NC(=O)C3CCN(CC(F)(F)F)CC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC(=NO&)CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCc2onc([C@@H]3CC[C@H](NC(=O)C4CCN(CC(F)(F)F)CC4)C3)c2C1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 | C[NH+]1CCc2onc([C@@H]3CC[C@H](NC(=O)C4CCN(CC(F)(F)F)CC4)C3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCc2onc&c2C1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+](C)(C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 | C[N+](C)(C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CC[C@@H](C[NH+]2CCCSCC2)C1)C1CCN(CC(F)(F)F)CC1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 | O=C(N[C@H]1CC[C@@H](C[NH+]2CCCSCC2)C1)C1CCN(CC(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCSCC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+]1(C)CCC([C@@H]2CC[C@H](NC(=O)C3CCN(CC(F)(F)F)CC3)C2)CC1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)C2CCN(CC(F)(F)F)CC2)C1 | C[N+]1(C)CCC([C@@H]2CC[C@H](NC(=O)C3CCN(CC(F)(F)F)CC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CCCC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SN1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CC(=O)SN1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CCCCC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCN1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CC(=O)CCCN1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCN1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | CCC(=O)CCCN1CCc2cc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CC3=O"
} |
Can you make molecule C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCCCN1c1ccc2nnc(-c3ccccc3)n2n1 | C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 | C[C@@H]1CCCCCN1c1ccc2nnc(-c3ccccc3)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCCCN1&",
"old_substring": "C[C@@H]1CCOCCN14"
} |
Can you make molecule C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCN1c1ccc2nnc(-c3ccccc3)n2n1 | C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 | C[C@H]1CCCCN1c1ccc2nnc(-c3ccccc3)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCCN1&",
"old_substring": "C[C@@H]1CCOCCN14"
} |
Can you make molecule C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(c2ccc3nnc(-c4ccccc4)n3n2)C1 | C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 | C[C@@H]1CCCN(c2ccc3nnc(-c4ccccc4)n3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCN&C1",
"old_substring": "C[C@@H]1CCOCCN14"
} |
Can you make molecule C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCCN1c1ccc2nnc(-c3ccccc3)n2n1 | C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 | C[C@H]1CCCCCN1c1ccc2nnc(-c3ccccc3)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCCCN1&",
"old_substring": "C[C@@H]1CCOCCN14"
} |
Can you make molecule C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(c2ccc3nnc(-c4ccccc4)n3n2)C1 | C[C@@H]1CCOCCN1c1ccc2nnc(-c3ccccc3)n2n1 | C[C@H]1CCCN(c2ccc3nnc(-c4ccccc4)n3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCN&C1",
"old_substring": "C[C@@H]1CCOCCN14"
} |
Can you make molecule CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2Cl)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2Cl)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)O/N=C1\C(=O)N(Cc2ccc(Cl)cc2I)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(Cl)cc2I)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)O/N=C1\C(=O)N(Cc2ccc(Cl)cc2Br)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(Cl)cc2Br)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)O/N=C1\C(=O)N(Cc2cc(C)c(I)cc2C)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2cc(C)c(I)cc2C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)O/N=C1\C(=O)N(Cc2ccc(Cl)c(I)c2)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(C)cc2)c2ccccc21 | CC(=O)O/N=C1\C(=O)N(Cc2ccc(Cl)c(I)c2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(CC(=O)SN2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(CC(=O)SN2C[C@H](C)S[C@@H](C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(C(=O)CCCC(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(C(=O)CCCC(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(C(C)(C)CC(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(C(C)(C)CC(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(C(C)(C)CCC(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(C(C)(C)CCC(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc([C@H](C)C(=O)SN2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc(C(=O)N2C[C@H](C)S[C@@H](C)C2)n1 | COC(=O)c1cccc([C@H](C)C(=O)SN2C[C@H](C)S[C@@H](C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCCCC3)nn2)cc1)c1ccc(F)cc1F | O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F | O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCCCC3)nn2)cc1)c1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N15CCCCCC1"
} |
Can you make molecule O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(c2ccc(-c3ccc(NS(=O)(=O)c4ccc(F)cc4F)cc3)nn2)CCCCC1 | O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F | N#CC1(c2ccc(-c3ccc(NS(=O)(=O)c4ccc(F)cc4F)cc3)nn2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&CCCCC1",
"old_substring": "N15CCCCCC1"
} |
Can you make molecule O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCN(c2ccc(-c3ccc(NS(=O)(=O)c4ccc(F)cc4F)cc3)nn2)CC1 | O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F | CC1(C)CCCN(c2ccc(-c3ccc(NS(=O)(=O)c4ccc(F)cc4F)cc3)nn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N15CCCCCC1"
} |
Can you make molecule O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(Nc1ccc(-c2ccc(C3CCCCC3)nn2)cc1)c1ccc(F)cc1F | O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F | O=S(=O)(Nc1ccc(-c2ccc(C3CCCCC3)nn2)cc1)c1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "N15CCCCCC1"
} |
Can you make molecule O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(Nc1ccc(-c2ccc(N3CCC4(CCCCC4)C3)nn2)cc1)c1ccc(F)cc1F | O=S(=O)(Nc1ccc(-c2ccc(N3CCCCCC3)nn2)cc1)c1ccc(F)cc1F | O=S(=O)(Nc1ccc(-c2ccc(N3CCC4(CCCCC4)C3)nn2)cc1)c1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCCCC2)C1",
"old_substring": "N15CCCCCC1"
} |
Can you make molecule C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCCl)C(=O)Cc1c(F)cccc1F | C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F | C[C@H](CCCCl)C(=O)Cc1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CCCCl",
"old_substring": "C[C@@H]1CCCCN12"
} |
Can you make molecule C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)Cc1c(F)cccc1F)C1=CCCCC1 | C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F | C[C@H](C(=O)Cc1c(F)cccc1F)C1=CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C1=CCCCC1",
"old_substring": "C[C@@H]1CCCCN12"
} |
Can you make molecule C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCS)CCC(=O)Cc1c(F)cccc1F | C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F | C[C@H](CCS)CCC(=O)Cc1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CCS",
"old_substring": "C[C@@H]1CCCCN12"
} |
Can you make molecule C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCl)CCC(=O)Cc1c(F)cccc1F | C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F | C[C@@H](CCl)CCC(=O)Cc1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CCl)CC&",
"old_substring": "C[C@@H]1CCCCN12"
} |
Can you make molecule C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC=CC[C@H]1C(=O)Cc1c(F)cccc1F | C[C@@H]1CCCCN1C(=O)Cc1c(F)cccc1F | C[C@H]1CC=CC[C@H]1C(=O)Cc1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CC=CC[C@H]1&",
"old_substring": "C[C@@H]1CCCCN12"
} |
Can you make molecule Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(SCSCc3nnc(-c4cccs4)o3)[nH]c2c1 | Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 | Cc1ccc2nc(SCSCc3nnc(-c4cccs4)o3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S57"
} |
Can you make molecule Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(-c3ccc4c(c3)N(Cc3nnc(-c5cccs5)o3)CCS4)[nH]c2c1 | Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 | Cc1ccc2nc(-c3ccc4c(c3)N(Cc3nnc(-c5cccs5)o3)CCS4)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S57"
} |
Can you make molecule Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(N/C(C#N)=C(\Cl)SCc3nnc(-c4cccs4)o3)[nH]c2c1 | Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 | Cc1ccc2nc(N/C(C#N)=C(\Cl)SCc3nnc(-c4cccs4)o3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S57"
} |
Can you make molecule Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(-n3c(=S)n(Cc4nnc(-c5cccs5)o4)c4ccccc43)[nH]c2c1 | Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 | Cc1ccc2nc(-n3c(=S)n(Cc4nnc(-c5cccs5)o4)c4ccccc43)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S57"
} |
Can you make molecule Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc([C@H](C)[S@@+]([O-])CCCCc3nnc(-c4cccs4)o3)[nH]c2c1 | Cc1ccc2nc(SCc3nnc(-c4cccs4)o3)[nH]c2c1 | Cc1ccc2nc([C@H](C)[S@@+]([O-])CCCCc3nnc(-c4cccs4)o3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "S57"
} |
Can you make molecule COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC/C(C)=N\ON2CC(OCc3ccc(Cl)cc3)C2)cc1 | COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 | COc1ccc(OC/C(C)=N\ON2CC(OCc3ccc(Cl)cc3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(OC)cc1)C(=O)CN1CC(OCc2ccc(Cl)cc2)C1 | COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 | CCC(CC)(Oc1ccc(OC)cc1)C(=O)CN1CC(OCc2ccc(Cl)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C4=O"
} |
Can you make molecule COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OSSC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 | COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 | COc1ccc(OSSC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(OC)cc1)C(=O)CCN1CC(OCc2ccc(Cl)cc2)C1 | COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 | CCC(CC)(Oc1ccc(OC)cc1)C(=O)CCN1CC(OCc2ccc(Cl)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C4=O"
} |
Can you make molecule COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Oc1ccc(OC)cc1)C(=O)N1CC(OCc2ccc(Cl)cc2)C1 | COc1ccc(OCC(=O)N2CC(OCc3ccc(Cl)cc3)C2)cc1 | CC[C@H](C(=O)Oc1ccc(OC)cc1)C(=O)N1CC(OCc2ccc(Cl)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(NSC(=O)C[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NSC(=O)C[C@H]2CC(c3cccc(F)c3)=NO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(NCC(=C=O)C[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NCC(=C=O)C[C@H]2CC(c3cccc(F)c3)=NO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(NC(=O)CCCC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NC(=O)CCCC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(NC(=O)CC(C)(C)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NC(=O)CC(C)(C)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(NC[S@+]([O-])CCC[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)s1 | Cc1cnc(NC[S@+]([O-])CCC[C@H]2CC(c3cccc(F)c3)=NO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C46=O"
} |
Can you make molecule C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)CC(C)(C)C)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)CC(C)(C)C)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](CCCC(C)(C)C)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](CCCC(C)(C)C)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](CCCC(F)(F)F)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](CCCC(F)(F)F)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](CCCCC(F)(F)F)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](CCCCC(F)(F)F)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 less soluble in water? The output molecule should be similar to the input molecule. | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C1(C#N)CCC(C)CC1)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C(C)(C)C)CC2 | C#CCN1C(=O)N=C(N)[C@]12CCC[C@@H](C1(C#N)CCC(C)CC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC(C)CC1",
"old_substring": "C4(C)(C)C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.